DE1958924U - Bausatz fuer eine kuppelfoermige oberlicht raumform. - Google Patents
Bausatz fuer eine kuppelfoermige oberlicht raumform.Info
- Publication number
- DE1958924U DE1958924U DEC15510U DEC0015510U DE1958924U DE 1958924 U DE1958924 U DE 1958924U DE C15510 U DEC15510 U DE C15510U DE C0015510 U DEC0015510 U DE C0015510U DE 1958924 U DE1958924 U DE 1958924U
- Authority
- DE
- Germany
- Prior art keywords
- kit
- dome
- roof
- nach
- room shape
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002184 metal Substances 0.000 claims description 4
- 101100240595 Mus musculus Nipal4 gene Proteins 0.000 claims 1
- 238000010276 construction Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 2
- 238000009423 ventilation Methods 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- 229920002972 Acrylic fiber Polymers 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 101150095130 URAD gene Proteins 0.000 description 1
- 238000003287 bathing Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04D—ROOF COVERINGS; SKY-LIGHTS; GUTTERS; ROOF-WORKING TOOLS
- E04D13/00—Special arrangements or devices in connection with roof coverings; Protection against birds; Roof drainage ; Sky-lights
- E04D13/03—Sky-lights; Domes; Ventilating sky-lights
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04D—ROOF COVERINGS; SKY-LIGHTS; GUTTERS; ROOF-WORKING TOOLS
- E04D13/00—Special arrangements or devices in connection with roof coverings; Protection against birds; Roof drainage ; Sky-lights
- E04D13/03—Sky-lights; Domes; Ventilating sky-lights
- E04D13/0305—Supports or connecting means for sky-lights of flat or domed shape
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Toys (AREA)
- Roof Covering Using Slabs Or Stiff Sheets (AREA)
- Respiratory Apparatuses And Protective Means (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB32649/66A GB1105712A (en) | 1966-07-20 | 1966-07-20 | Improvements in domed rooflights |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1958924U true DE1958924U (de) | 1967-04-20 |
Family
ID=10341920
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC15510U Expired DE1958924U (de) | 1966-07-20 | 1967-01-14 | Bausatz fuer eine kuppelfoermige oberlicht raumform. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3473276A (cg-RX-API-DMAC10.html) |
| BE (1) | BE692829A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1958924U (cg-RX-API-DMAC10.html) |
| FR (1) | FR1507998A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1105712A (cg-RX-API-DMAC10.html) |
| MY (1) | MY6900397A (cg-RX-API-DMAC10.html) |
| NL (1) | NL6700748A (cg-RX-API-DMAC10.html) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2348867A1 (de) * | 1973-09-28 | 1975-04-10 | Eberspaecher J | Profil zur befestigung von ebenen elementen zur bildung einer sattel- bis shedfoermigen eindeckung |
| DE3104217A1 (de) * | 1981-02-06 | 1982-09-09 | Fa. Johann Lemp, 5630 Remscheid | "dachfenster" |
| DE3401738A1 (de) * | 1984-01-19 | 1985-07-25 | Heinz Essmann Gmbh & Co Kg, 4902 Bad Salzuflen | Lueftungsvorrichtung, vorzugsweise fuer ein flachdach |
| DE3442869A1 (de) * | 1984-01-19 | 1986-05-28 | Heinz Essmann GmbH, 4902 Bad Salzuflen | Lueftungsvorrichtung, vorzugsweise fuer ein flachdach |
| DE102010061129A1 (de) * | 2010-12-09 | 2012-06-14 | Essmann Gmbh | Aufsetzkranz |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE341674B (cg-RX-API-DMAC10.html) * | 1971-06-11 | 1972-01-10 | Hoeganaes Ab | |
| US3762120A (en) * | 1971-12-01 | 1973-10-02 | L Janssen | Continuous type skylight device |
| US3983669A (en) * | 1972-03-20 | 1976-10-05 | Bogaert P E E J | Skylight and frame therefore |
| US3788013A (en) * | 1972-06-07 | 1974-01-29 | Hillsdale Ind Inc | Drop away fire vent |
| US4073097A (en) * | 1976-06-29 | 1978-02-14 | Wasco Products, Inc. | Energy efficient skylight construction |
| US4106399A (en) * | 1977-03-08 | 1978-08-15 | Lawrence Jr George C | Vehicle roof ventilator insulation covering |
| US4466221A (en) * | 1981-10-09 | 1984-08-21 | Wasco Products, Inc. | Thermal barrier skylight |
| US4408422A (en) * | 1982-06-10 | 1983-10-11 | Bechtold Stephen K | Skylight dome assembly |
| US4527368A (en) * | 1982-12-27 | 1985-07-09 | Wasco Products, Inc. | Skylight sealing |
| DE3317104C2 (de) * | 1983-05-10 | 1987-04-16 | Ulrich 4970 Bad Oeynhausen Kreft | Verfahren zur Herstellung eines Lichtkuppelaufsetzkranzes aus extrudierten Kunststoffprofilen und Kunststoffprofile zur Durchführung eines solchen Verfahrens |
| DE3329901C2 (de) * | 1983-08-18 | 1987-04-16 | Ulrich 4970 Bad Oeynhausen Kreft | Verfahren zur Herstellung eines Lichtkuppelaufsetzkranzes aus stranggepreßten Aluminiumprofilen sowie Aluminiumprofile zur Durchführung eines solchen Verfahrens |
| FR2667634B1 (fr) * | 1990-10-03 | 1992-09-04 | Alcaud Sa | Dispositif de fixation d'un lanterneau. |
| US5357720A (en) * | 1993-07-19 | 1994-10-25 | O'keeffe's Inc. | Skylight sill with built-in reglet for removable flashing |
| DK173830B1 (da) * | 1996-11-19 | 2001-12-03 | Vkr Holding As | Vindue med forbedret karmkonstruktion |
| US6079167A (en) * | 1999-10-04 | 2000-06-27 | Voegele, Jr.; William P. | Continuous ridge skylight system |
| US7441379B2 (en) * | 2003-06-27 | 2008-10-28 | Konvin Associates Limited Partnership | Light transmission panels, retaining clip and a combination thereof |
| US7926236B2 (en) * | 2003-06-27 | 2011-04-19 | Konvin Associates Limited Partnership | Light transmission panels, retaining clip and a combination thereof |
| GB2439319A (en) * | 2006-06-22 | 2007-12-27 | Metal Window Co Ltd | Rooflight comprising a water deflector |
| US8020350B2 (en) * | 2008-07-21 | 2011-09-20 | Vkr Holding A/S | Seamless deck-sealing surround for skylights and roof windows |
| PL219728B1 (pl) † | 2011-09-12 | 2015-07-31 | Fakro Pp Spółka Z Ograniczoną Odpowiedzialnością | Okno dachowe, a zwłaszcza okno dachowe, dostosowane do montażu w zespole kolektorów słonecznych |
| DK179674B1 (en) * | 2015-02-26 | 2019-03-19 | Vkr Holding A/S | Window including a climate-shielding transition assembly |
| US9453343B1 (en) * | 2015-09-30 | 2016-09-27 | Vkr Holding A/S | Skylight mounting system and assembly |
| GB2570272B (en) * | 2017-09-19 | 2021-06-09 | Donnellan Thomas | Rooflight |
| US12024890B2 (en) * | 2021-09-22 | 2024-07-02 | Vkr Holding A/S | Tubular skylight assembly |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3209669A (en) * | 1963-07-19 | 1965-10-05 | Donald E Bayne | Cupola |
| US3307309A (en) * | 1964-07-01 | 1967-03-07 | Dan E Bloxsom | Snap lock construction for locking domes in skylight frames |
| US3340656A (en) * | 1965-06-09 | 1967-09-12 | Mathieu Marie Eugene | Support device for a cupola or other plastic skylight |
| US3340663A (en) * | 1965-06-17 | 1967-09-12 | Earl W Collard | Interlocking window framing system |
-
1966
- 1966-07-20 GB GB32649/66A patent/GB1105712A/en not_active Expired
-
1967
- 1967-01-14 DE DEC15510U patent/DE1958924U/de not_active Expired
- 1967-01-17 NL NL6700748A patent/NL6700748A/xx unknown
- 1967-01-17 FR FR91379A patent/FR1507998A/fr not_active Expired
- 1967-01-18 BE BE692829D patent/BE692829A/xx unknown
- 1967-06-07 US US644268A patent/US3473276A/en not_active Expired - Lifetime
-
1969
- 1969-12-31 MY MY1969397A patent/MY6900397A/xx unknown
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2348867A1 (de) * | 1973-09-28 | 1975-04-10 | Eberspaecher J | Profil zur befestigung von ebenen elementen zur bildung einer sattel- bis shedfoermigen eindeckung |
| DE3104217A1 (de) * | 1981-02-06 | 1982-09-09 | Fa. Johann Lemp, 5630 Remscheid | "dachfenster" |
| DE3401738A1 (de) * | 1984-01-19 | 1985-07-25 | Heinz Essmann Gmbh & Co Kg, 4902 Bad Salzuflen | Lueftungsvorrichtung, vorzugsweise fuer ein flachdach |
| DE3442869A1 (de) * | 1984-01-19 | 1986-05-28 | Heinz Essmann GmbH, 4902 Bad Salzuflen | Lueftungsvorrichtung, vorzugsweise fuer ein flachdach |
| DE102010061129A1 (de) * | 2010-12-09 | 2012-06-14 | Essmann Gmbh | Aufsetzkranz |
Also Published As
| Publication number | Publication date |
|---|---|
| NL6700748A (cg-RX-API-DMAC10.html) | 1968-01-22 |
| GB1105712A (en) | 1968-03-13 |
| BE692829A (cg-RX-API-DMAC10.html) | 1967-07-03 |
| FR1507998A (fr) | 1967-12-29 |
| MY6900397A (en) | 1969-12-31 |
| US3473276A (en) | 1969-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1958924U (de) | Bausatz fuer eine kuppelfoermige oberlicht raumform. | |
| DE1247777B (de) | Verbindungselement fuer Dehnfalten in aneinanderstossenden Waenden eines dehnfaehigen Behaelters | |
| DE663576C (de) | Gartenueberdachung | |
| RU94045840A (ru) | Строительная кровельная структура | |
| DE841343C (de) | Geschweisster Dachbinder aus Gittertraegern | |
| Berghahn | Ehe als Übergangsarbeitsmarkt? | |
| DE2920743A1 (de) | Element eines spielzeugbaukastens | |
| Heidegger et al. | Briefe Martin Heideggers an Julius Stenzel (1928-1932) | |
| DE610976C (de) | Traeger, insbesondere fuer Luftschiffe | |
| DE7409722U (de) | Vorgefertigtes Gartenhaus | |
| EP3599310A1 (de) | Faltsignal | |
| DE2403552B2 (de) | Aus Tragwerkseinheiten bestehendes Dachtragwerk | |
| DE7122514U (de) | Plattenelement fur Rasterdecken | |
| Light | Drawing the Wagons into a Circle: Sectionalism and Energy Politics | |
| Papke | Is There a Lawyer in the House? | |
| Knoll | Vom Niedergang des akademischen Stils Professoren im Wandel der Zeit | |
| Kappraff | The Sacred Cut | |
| Cook | Company of Heroes: Unleashing the Power of Self-Leadership | |
| DE2339320A1 (de) | Dach aus segeltuch, verstaerkter kunststoffolie oder dergl., insbesondere zur ueberdachung von wegen, gaengen, plaetzen oder dergl | |
| AT215022B (de) | Verkleidung von Leuchtstofflampen | |
| DE3725864A1 (de) | Mehrzweck-profil, insbesondere fuer landwirtschaftliche zwecke | |
| DE508506C (de) | Pfettenloses Eisenbetontonnendach | |
| Clark | Outlines of Public Utility Economics | |
| DE1559274B2 (de) | Bauwerk mit einer an Stützen aufgespannten Haut | |
| Bosman et al. | Architectural Crossroads Studies in the History of Architecture |