DE1929731B - - Google Patents
Info
- Publication number
- DE1929731B DE1929731B DE1929731B DE 1929731 B DE1929731 B DE 1929731B DE 1929731 B DE1929731 B DE 1929731B
- Authority
- DE
- Germany
- Prior art keywords
- formula
- dichloro
- carbon atoms
- formaldehyde
- phenoxyacetic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- -1 oxo compound Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- AVOLMBLBETYQHX-UHFFFAOYSA-N etacrynic acid Chemical compound CCC(=C)C(=O)C1=CC=C(OCC(O)=O)C(Cl)=C1Cl AVOLMBLBETYQHX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 2
- 230000020477 pH reduction Effects 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000155 melt Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- XWYGGAJWANYRPA-UHFFFAOYSA-N methyl 2-(4-butanoyl-2,3-dichlorophenoxy)acetate Chemical compound CCCC(=O)C1=C(Cl)C(Cl)=C(OCC(=O)OC)C=C1 XWYGGAJWANYRPA-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- FQAYODYTZPXLRH-UHFFFAOYSA-N 2-(4-butanoyl-2,3-dichlorophenoxy)acetic acid Chemical compound CCCC(=O)C1=CC=C(OCC(O)=O)C(Cl)=C1Cl FQAYODYTZPXLRH-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 238000007281 aminoalkylation reaction Methods 0.000 description 1
- XDLDASNSMGOEMX-UHFFFAOYSA-N benzene benzene Chemical compound C1=CC=CC=C1.C1=CC=CC=C1 XDLDASNSMGOEMX-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000003216 chloruretic effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000001452 natriuretic effect Effects 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1795808C2 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethyl-4-oxopiperidin | |
| CH634817A5 (de) | Verfahren zur herstellung neuer enolatsalze. | |
| DE2316377C3 (de) | Verfahren zur Herstellung von 2-Phenyl-amino-2-imidazolin-Derivaten und von deren Salzen | |
| DE1545792B2 (de) | Verfahren zur Herstellung von 4-Hydroxyplperidinen | |
| DE3821197A1 (de) | Verfahren zur herstellung von (alpha),(beta)-ungesaettigten ketonen | |
| DE2251097B2 (de) | Verfahren zur gewinnung eines gemisches von (+)-cis- und (+)-trans-chrysanthemummonocarbonsaeure | |
| DE2508947B2 (de) | Verfahren zur Herstellung von 4-Oxo-1,2,3,6,7, 11b-hexahydro-4H-pyrazino [2,1-a] isochinolinen | |
| DE681505C (de) | Verfahren zur Herstellung von Cyanin- bzw. Styrylfarbstoffen | |
| DE1929731B (enExample) | ||
| DE1929731C (enExample) | ||
| EP0480307A2 (de) | Verfahren zur Herstellung von Acylaminomethanphosphonsäuren | |
| DE1150991B (de) | Verfahren zur Herstellung von 7-Sulfamyl-3, 4-dihydro-1, 2, 4-benzothiadiazin-1, 1-dioxyden | |
| EP0081459B1 (de) | Verfahren zur Herstellung von N-Phosphonomethylglycin | |
| DE2446256B2 (de) | Verfahren zur herstellung von hexahydrothieno eckige klammer auf 3,4- d eckige klammer zu -imidazol-2,4-dionen | |
| DE707426C (de) | Herstellung von ungesaettigten Aldehyden | |
| EP0115811B1 (de) | 2,4-Dichlor-5-thiazolcarboxaldehyd und ein Verfahren zu seiner Herstellung | |
| DE1620285A1 (de) | Verfahren zur Herstellung von Thiazolverbindungen | |
| DE1929731A1 (de) | Verfahren zur Herstellung von 2,3-Dichlor4-(2'-Methylenbutyryl)-Phenoxyessigsaeure | |
| DE1620536C (de) | Verfahren zur Herstellung von alpha Pyrrolidinoketonen und ihren Salzen | |
| DE266788C (enExample) | ||
| DE1192647B (de) | Verfahren zur Herstellung von Thiol- bzw. Thionothiolphosphonsaeureestern | |
| DE1119263B (de) | Verfahren zur Herstellung neuer Sulfonylurethane | |
| DE235358C (enExample) | ||
| DE960722C (de) | Verfahren zur Herstellung von Serinen aus Glykokoll und Aldehyden | |
| DE958844C (de) | Verfahren zur Herstellung von ª†-Acyl-buttersaeuren |