DE1915061C - - Google Patents
Info
- Publication number
- DE1915061C DE1915061C DE19691915061 DE1915061A DE1915061C DE 1915061 C DE1915061 C DE 1915061C DE 19691915061 DE19691915061 DE 19691915061 DE 1915061 A DE1915061 A DE 1915061A DE 1915061 C DE1915061 C DE 1915061C
- Authority
- DE
- Germany
- Prior art keywords
- weight
- component
- use according
- percent
- polybutene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 16
- 239000006229 carbon black Substances 0.000 claims description 15
- 239000000463 material Substances 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 8
- 229920000181 Ethylene propylene rubber Polymers 0.000 claims description 7
- 239000004033 plastic Substances 0.000 claims description 6
- 229920003023 plastic Polymers 0.000 claims description 6
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 3
- 201000008739 coronary artery disease Diseases 0.000 claims 1
- 229920001748 Polybutylene Polymers 0.000 description 20
- 235000019241 carbon black Nutrition 0.000 description 14
- 229920002367 Polyisobutene Polymers 0.000 description 9
- 238000005452 bending Methods 0.000 description 9
- 238000003466 welding Methods 0.000 description 7
- 239000006230 acetylene black Substances 0.000 description 6
- 239000004020 conductor Substances 0.000 description 6
- 238000009499 grossing Methods 0.000 description 6
- 239000002245 particle Substances 0.000 description 5
- -1 polypropylene Polymers 0.000 description 5
- 239000004743 Polypropylene Substances 0.000 description 4
- 238000007906 compression Methods 0.000 description 4
- 229920001155 polypropylene Polymers 0.000 description 4
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 3
- 229920001083 Polybutene Polymers 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 230000000875 corresponding Effects 0.000 description 3
- 238000001493 electron microscopy Methods 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 239000000314 lubricant Substances 0.000 description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CJZGTCYPCWQAJB-UHFFFAOYSA-L Calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- GHKOFFNLGXMVNJ-UHFFFAOYSA-N Dilauryl thiodipropionate Chemical compound CCCCCCCCCCCCOC(=O)CCSCCC(=O)OCCCCCCCCCCCC GHKOFFNLGXMVNJ-UHFFFAOYSA-N 0.000 description 2
- 239000003508 Dilauryl thiodipropionate Substances 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 241000872198 Serjania polyphylla Species 0.000 description 2
- 230000000111 anti-oxidant Effects 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 235000019304 dilauryl thiodipropionate Nutrition 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000006011 modification reaction Methods 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 239000004071 soot Substances 0.000 description 2
- 238000011105 stabilization Methods 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- BJQHLKABXJIVAM-UHFFFAOYSA-N Bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 241000283153 Cetacea Species 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M Sodium stearate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 210000004243 Sweat Anatomy 0.000 description 1
- PDHXHYRJLUNSDZ-UHFFFAOYSA-N [C].C#C Chemical compound [C].C#C PDHXHYRJLUNSDZ-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N acetylene Chemical group C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminum Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000010538 cationic polymerization reaction Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000001055 chewing Effects 0.000 description 1
- 235000015111 chews Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000005712 crystallization Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 235000015110 jellies Nutrition 0.000 description 1
- 239000008274 jelly Substances 0.000 description 1
- 238000011068 load Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 230000018984 mastication Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- KREXGRSOTUKPLX-UHFFFAOYSA-N octadecanoic acid;zinc Chemical compound [Zn].CCCCCCCCCCCCCCCCCC(O)=O.CCCCCCCCCCCCCCCCCC(O)=O KREXGRSOTUKPLX-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- URLKBWYHVLBVBO-UHFFFAOYSA-N p-xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000002965 rope Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000000087 stabilizing Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691915061 DE1915061B2 (de) | 1969-03-25 | 1969-03-25 | Leitfaehige kunststoffmasse fuer den kabelsektor |
| FR7008439A FR2035867B1 (fr) | 1969-03-25 | 1970-03-10 | |
| JP45024354A JPS4832422B1 (fr) | 1969-03-25 | 1970-03-24 | |
| GB1296254D GB1296254A (fr) | 1969-03-25 | 1970-03-24 | |
| US22672A US3671663A (en) | 1969-03-25 | 1970-03-25 | Conductive thermoplastic composition useful for high tension cables |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691915061 DE1915061B2 (de) | 1969-03-25 | 1969-03-25 | Leitfaehige kunststoffmasse fuer den kabelsektor |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1915061A1 DE1915061A1 (de) | 1970-11-05 |
| DE1915061B2 DE1915061B2 (de) | 1972-03-23 |
| DE1915061C true DE1915061C (fr) | 1973-08-23 |
Family
ID=5729185
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691915061 Granted DE1915061B2 (de) | 1969-03-25 | 1969-03-25 | Leitfaehige kunststoffmasse fuer den kabelsektor |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3671663A (fr) |
| JP (1) | JPS4832422B1 (fr) |
| DE (1) | DE1915061B2 (fr) |
| FR (1) | FR2035867B1 (fr) |
| GB (1) | GB1296254A (fr) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3749817A (en) * | 1970-12-28 | 1973-07-31 | Sumitomo Electric Industries | Insulated cable having strand shielding semi-conductive layer |
| DE2254128C3 (de) * | 1972-11-04 | 1975-08-14 | Chemische Werke Huels Ag, 4370 Marl | Thermoplastische Formmasse aus Polybuten-I |
| US4560498A (en) * | 1975-08-04 | 1985-12-24 | Raychem Corporation | Positive temperature coefficient of resistance compositions |
| US4104480A (en) * | 1976-11-05 | 1978-08-01 | General Cable Corporation | Semiconductive filling compound for power cable with improved properties |
| US4532375A (en) * | 1981-10-22 | 1985-07-30 | Ricwil, Incorporated | Heating device for utilizing the skin effect of alternating current |
| US4617449A (en) * | 1981-10-22 | 1986-10-14 | Ricwil, Incorporated | Heating device for utilizing the skin effect of alternating current |
| FR2547945B1 (fr) * | 1983-06-21 | 1986-05-02 | Raffinage Cie Francaise | Nouvelle structure de cable electrique et ses applications |
| DE19604481A1 (de) * | 1996-02-08 | 1997-08-14 | Asea Brown Boveri | Leitungsabschnitt einer gasisolierten Leitung |
| AU776970B2 (en) | 1999-12-02 | 2004-09-30 | Cabot Corporation | Carbon blacks useful in wire and cable compounds |
| US6827772B2 (en) | 2002-05-24 | 2004-12-07 | Cabot Corporation | Carbon black and compositions containing same |
| ATE388994T1 (de) * | 2004-07-22 | 2008-03-15 | Basell Polyolefine Gmbh | 1-butenpolymerzusammensetzung |
| US7776978B2 (en) * | 2004-07-22 | 2010-08-17 | Basell Polyolefine Gmbh | Process for producing fractionable 1-butene polymers |
| KR101632090B1 (ko) * | 2008-09-24 | 2016-06-20 | 바셀 폴리올레핀 이탈리아 에스.알.엘 | 양호한 백화 저항성을 갖는 폴리올레핀 조성물 |
| CN110791028B (zh) * | 2019-11-11 | 2022-02-08 | 太原科技大学 | 一种用于高效诱导聚丁烯-1晶型转变的专用助剂制备方法及专用助剂的应用 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA508338A (fr) * | 1954-12-21 | L. Hewitt Norman | Conducteurs electriques isoles | |
| BE562034A (fr) * | ||||
| US2512459A (en) * | 1949-02-23 | 1950-06-20 | Du Pont | Dispersion of pigments in ethylene polymers |
| US2597741A (en) * | 1950-11-29 | 1952-05-20 | Goodrich Co B F | Electrical-conductive rubbery composition and method of making same |
| US2830919A (en) * | 1955-07-13 | 1958-04-15 | Rome Cable Corp | Insulated conductor coated with polyethylene butyl rubber resin |
| GB842479A (en) * | 1956-11-06 | 1960-07-27 | Montedison Spa | Improvements in or relating to electric cables |
| US3096210A (en) * | 1959-04-17 | 1963-07-02 | Cabot Corp | Insulated conductors and method of making same |
| FR1305140A (fr) * | 1961-11-09 | 1962-09-28 | Montedison Spa | Mélanges à base de polyoléfines cristallines et éléments électriques de conductance variable formés de tels mélanges |
| US3517086A (en) * | 1966-01-31 | 1970-06-23 | Sumitomo Chemical Co | Nucleated blend of polypropylene,polyethylene,and ethylene propylene copolymer |
-
1969
- 1969-03-25 DE DE19691915061 patent/DE1915061B2/de active Granted
-
1970
- 1970-03-10 FR FR7008439A patent/FR2035867B1/fr not_active Expired
- 1970-03-24 JP JP45024354A patent/JPS4832422B1/ja active Pending
- 1970-03-24 GB GB1296254D patent/GB1296254A/en not_active Expired
- 1970-03-25 US US22672A patent/US3671663A/en not_active Expired - Lifetime
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1915061C (fr) | ||
| DE2344067C2 (de) | Stoffzusammensetzungen mit nicht-linearer elektrischer Widerstandscharakteristik | |
| DE3855132T2 (de) | Halbleitende Kunststoff-Zusammensetzung | |
| EP0677120B1 (fr) | Piece moulee etiree monoaxialement en polytetrafluorethylene | |
| DE2413475A1 (de) | Polymerenmassen fuer elektrische verwendungszwecke | |
| DE1915061B2 (de) | Leitfaehige kunststoffmasse fuer den kabelsektor | |
| DE2439490C2 (de) | Äthylenvinylacetat-Copolymermasse | |
| DE69904353T2 (de) | Raucharmes selbstlöschendes elektrisches kabel und flammwidrige zusammensetzung | |
| DE69802479T2 (de) | Verfahren zur Wiedergewinnung eines vernetzten polymeren Materials, insbesondere von Beschichtungsmaterialien für Elektrokabel | |
| WO2018234522A1 (fr) | Garniture de câble pour câble de liaison à haute tension continue | |
| DE2451451A1 (de) | Verfahren zum ummanteln eines leitenden gegenstandes | |
| EP0244738A2 (fr) | Composition d'étanchéité | |
| DE2118135C3 (de) | Leitfähige Polymermischung | |
| DE2225774A1 (de) | Als elektrisch leitende Elemente verwendbare Materialien | |
| DE2915155A1 (de) | Polymerzusammensetzungen | |
| DE69921904T2 (de) | Halbleitermaterial, Verfahren zur Herstellung desselben und damit ummanteltes Kabel | |
| DE2022848C3 (de) | Herstellung von elektrisch leitfähigen bzw. antistatischen Kunststoffen | |
| WO2021105319A1 (fr) | Charge particulaire, production et utilisation correspondantes | |
| DE1719251B2 (de) | Wärmevernetzbare Formmasse zur Herstellung von Halbleiterformkörpern Ausscheidung aus: 1219674 | |
| DE2214599C3 (de) | Verfahren zur Herstellung von Folien | |
| DE1937587C (de) | Schwefelvernetzbare Formmasse | |
| DE69221814T2 (de) | Elektrisches Kabel | |
| DE3246484C2 (de) | Kunststoffband | |
| WO2022101374A1 (fr) | Procédé de réglage variable des propriétés d'isolation électrique de matériaux contenant des varistances | |
| DE2923245A1 (de) | Extrudierbare, elektrisch leitfaehige polymermischung |