DE1907116A1 - 5-Chlor-3-oxo-1,2,4-thiadiazoline - Google Patents
5-Chlor-3-oxo-1,2,4-thiadiazolineInfo
- Publication number
- DE1907116A1 DE1907116A1 DE19691907116 DE1907116A DE1907116A1 DE 1907116 A1 DE1907116 A1 DE 1907116A1 DE 19691907116 DE19691907116 DE 19691907116 DE 1907116 A DE1907116 A DE 1907116A DE 1907116 A1 DE1907116 A1 DE 1907116A1
- Authority
- DE
- Germany
- Prior art keywords
- isocyanate
- optionally
- alkyl
- chlorine
- mustard oil
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- RCKZOFNKTUBRLB-UHFFFAOYSA-N 5-chloro-1,2,4-thiadiazol-3-one Chemical class ClC1=NC(=O)NS1 RCKZOFNKTUBRLB-UHFFFAOYSA-N 0.000 title 1
- -1 phenyl radicals Chemical class 0.000 claims description 34
- 239000008164 mustard oil Substances 0.000 claims description 28
- 239000000460 chlorine Substances 0.000 claims description 15
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 14
- 229910052801 chlorine Inorganic materials 0.000 claims description 14
- 239000012948 isocyanate Substances 0.000 claims description 13
- 150000002513 isocyanates Chemical class 0.000 claims description 11
- ZOJBYZNEUISWFT-UHFFFAOYSA-N allyl isothiocyanate Chemical compound C=CCN=C=S ZOJBYZNEUISWFT-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 1
- CZQIJQFTRGDODI-UHFFFAOYSA-N 1-bromo-4-isocyanatobenzene Chemical compound BrC1=CC=C(N=C=O)C=C1 CZQIJQFTRGDODI-UHFFFAOYSA-N 0.000 description 1
- BCMYXYHEMGPZJN-UHFFFAOYSA-N 1-chloro-2-isocyanatoethane Chemical compound ClCCN=C=O BCMYXYHEMGPZJN-UHFFFAOYSA-N 0.000 description 1
- QZTWVDCKDWZCLV-UHFFFAOYSA-N 1-isocyanato-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(N=C=O)C=C1 QZTWVDCKDWZCLV-UHFFFAOYSA-N 0.000 description 1
- YIDSTEJLDQMWBR-UHFFFAOYSA-N 1-isocyanatododecane Chemical compound CCCCCCCCCCCCN=C=O YIDSTEJLDQMWBR-UHFFFAOYSA-N 0.000 description 1
- BDQNKCYCTYYMAA-UHFFFAOYSA-N 1-isocyanatonaphthalene Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1 BDQNKCYCTYYMAA-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 1
- JPSJBEALHNYNBL-UHFFFAOYSA-N 2-pyrimidin-5-ylbenzaldehyde Chemical compound O=CC1=CC=CC=C1C1=CN=CN=C1 JPSJBEALHNYNBL-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- PFEVLHPHNQFASW-UHFFFAOYSA-N cyclohexyl cyanate Chemical compound N#COC1CCCCC1 PFEVLHPHNQFASW-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 238000004049 embossing Methods 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691907116 DE1907116A1 (de) | 1969-02-13 | 1969-02-13 | 5-Chlor-3-oxo-1,2,4-thiadiazoline |
| CH1770A CH525905A (de) | 1969-02-13 | 1970-01-05 | Verfahren zur Herstellung von 5-Chlor-3-oxo-1,2,4-thiadiazolinen |
| US00004759A US3711491A (en) | 1969-02-13 | 1970-01-21 | 5-chloro-3-oxo-1,2,4-thiadiazolines |
| GB1256682D GB1256682A (https=) | 1969-02-13 | 1970-02-10 | |
| BE745959D BE745959A (fr) | 1969-02-13 | 1970-02-13 | 5-chloro-3-oxo-1,2,4-thiadiazolines |
| FR7005197A FR2035411A5 (https=) | 1969-02-13 | 1970-02-13 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691907116 DE1907116A1 (de) | 1969-02-13 | 1969-02-13 | 5-Chlor-3-oxo-1,2,4-thiadiazoline |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1907116A1 true DE1907116A1 (de) | 1970-09-03 |
Family
ID=5725078
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691907116 Pending DE1907116A1 (de) | 1969-02-13 | 1969-02-13 | 5-Chlor-3-oxo-1,2,4-thiadiazoline |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3711491A (https=) |
| BE (1) | BE745959A (https=) |
| CH (1) | CH525905A (https=) |
| DE (1) | DE1907116A1 (https=) |
| FR (1) | FR2035411A5 (https=) |
| GB (1) | GB1256682A (https=) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58225077A (ja) * | 1982-06-24 | 1983-12-27 | Nippon Soda Co Ltd | 1,2,4−チアジアゾ−ル誘導体及び農園芸用殺菌剤 |
-
1969
- 1969-02-13 DE DE19691907116 patent/DE1907116A1/de active Pending
-
1970
- 1970-01-05 CH CH1770A patent/CH525905A/de not_active IP Right Cessation
- 1970-01-21 US US00004759A patent/US3711491A/en not_active Expired - Lifetime
- 1970-02-10 GB GB1256682D patent/GB1256682A/en not_active Expired
- 1970-02-13 FR FR7005197A patent/FR2035411A5/fr not_active Expired
- 1970-02-13 BE BE745959D patent/BE745959A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1256682A (https=) | 1971-12-15 |
| FR2035411A5 (https=) | 1970-12-18 |
| CH525905A (de) | 1972-07-31 |
| BE745959A (fr) | 1970-08-13 |
| US3711491A (en) | 1973-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1927921A1 (de) | s-Triazinderivate | |
| DE1907116A1 (de) | 5-Chlor-3-oxo-1,2,4-thiadiazoline | |
| DE1943635A1 (de) | s-Triazinyl-isocyanate | |
| DE2126148A1 (en) | Prepn of uracil derivs - useful as plant - protection agents and their inters | |
| DE69411783T2 (de) | Verfahren zur Herstellung von Sulfonylharnstoffderivaten | |
| DE1670960A1 (de) | Verfahren zur Herstellung von salzartigen heterocyclischen Verbindungen | |
| DE1670833A1 (de) | Verfahren zur Herstellung salzartiger heterocyclischer Verbindungen | |
| DE2054342A1 (de) | Neue 1,2,4-Oxdiazole | |
| DE3237479A1 (de) | Verfahren zur herstellung von substituierten tetrahydropyrimidinonderivaten | |
| DD250708A5 (de) | Verfahren zur herstellung von n-(3-chlor-1,2,4-oxidiazol-5-yl)-harnstoffen der allgemeinen formel (i) | |
| DE2625722A1 (de) | Parabansaeureaminale | |
| EP0023033A1 (de) | 2.4.6-Trihalogen-pyrimidin-5-carbonsäurehalogenide und Verfahren zu ihrer Herstellung | |
| DE2210884C3 (de) | Verfahren zur Herstellung von gegebenenfalls kondensierten 4,5-Bistrifluormethylimino-oxazolidinen und -imidazolidinen | |
| DE2804824A1 (de) | Spiro-derivate von 3-(3,5-dihalogenphenyl)-oxazolidin-2,4-dionen, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DE2210882A1 (de) | Spezielles verfahren zur herstellung von 4,5-bis-trifluormethylimino-derivaten von thiazolidinen | |
| DE2852924A1 (de) | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DE1693139C (de) | Verfahren zur Herstellung von Azido gruppen enthaltender Phenyl und Naphthyl sulfenhalogenide | |
| DE3409887A1 (de) | Verfahren zur herstellung von isocyanaten | |
| DE1928130C3 (de) | Verfahren zur Herstellung neuer Iminokohlensäureesterhalogenidderivate | |
| DE1167848B (de) | Verfahren zur Herstellung von kondensierten, einen Triazinring enthaltenden heterocyclischen Verbindungen | |
| DE2065977A1 (de) | Verfahren zur herstellung von 4,5-bis-trifluormethylimino-derivate von schwefelfreien heterocyclischen fuenfringen mit zwei ring-heteroatomen | |
| DE2743516A1 (de) | 1-oxa(thia)-4,7,9-triaza-spiro eckige klammer auf 4.4 eckige klammer zu nonan-6,8-dione | |
| DE1668011A1 (de) | Verfahren zur Herstellung von N-Chlorcarbonyl-isocyanid-dichlorid neben Carbonyl-bis-(N-isocyaniddichlorid) bzw. den entsprechenden Thioverbindungen | |
| DE1793127B2 (https=) | ||
| DE2105489A1 (de) | Mono- und diisocyanato-p-chinone |