DE1902610B1 - Elektromagnetisches Relais - Google Patents
Elektromagnetisches RelaisInfo
- Publication number
- DE1902610B1 DE1902610B1 DE19691902610D DE1902610DA DE1902610B1 DE 1902610 B1 DE1902610 B1 DE 1902610B1 DE 19691902610 D DE19691902610 D DE 19691902610D DE 1902610D A DE1902610D A DE 1902610DA DE 1902610 B1 DE1902610 B1 DE 1902610B1
- Authority
- DE
- Germany
- Prior art keywords
- electromagnetic relay
- contact
- armature
- relay according
- force
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000005291 magnetic effect Effects 0.000 claims description 16
- 206010000496 acne Diseases 0.000 claims description 9
- 210000002105 tongue Anatomy 0.000 claims description 9
- 238000005452 bending Methods 0.000 claims description 3
- 230000004907 flux Effects 0.000 description 11
- 230000005284 excitation Effects 0.000 description 10
- 238000006073 displacement reaction Methods 0.000 description 7
- 238000010586 diagram Methods 0.000 description 5
- 230000003993 interaction Effects 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- BGPVFRJUHWVFKM-UHFFFAOYSA-N N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] Chemical compound N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] BGPVFRJUHWVFKM-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000005292 diamagnetic effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002964 excitative effect Effects 0.000 description 1
- 230000005294 ferromagnetic effect Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H51/00—Electromagnetic relays
- H01H51/22—Polarised relays
- H01H51/2272—Polarised relays comprising rockable armature, rocking movement around central axis parallel to the main plane of the armature
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H47/00—Circuit arrangements not adapted to a particular application of the relay and designed to obtain desired operating characteristics or to provide energising current
- H01H47/02—Circuit arrangements not adapted to a particular application of the relay and designed to obtain desired operating characteristics or to provide energising current for modifying the operation of the relay
- H01H2047/025—Circuit arrangements not adapted to a particular application of the relay and designed to obtain desired operating characteristics or to provide energising current for modifying the operation of the relay with taking into account of the thermal influences, e.g. change in resistivity of the coil or being adapted to high temperatures
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Electromagnets (AREA)
- Reciprocating, Oscillating Or Vibrating Motors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1902610 | 1969-01-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1902610B1 true DE1902610B1 (de) | 1969-12-11 |
Family
ID=5722861
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691902610D Pending DE1902610B1 (de) | 1969-01-20 | 1969-01-20 | Elektromagnetisches Relais |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3634793A (enrdf_load_stackoverflow) |
| CH (1) | CH522948A (enrdf_load_stackoverflow) |
| DE (1) | DE1902610B1 (enrdf_load_stackoverflow) |
| FR (1) | FR2030169A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1255133A (enrdf_load_stackoverflow) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2030169A1 (enrdf_load_stackoverflow) * | 1969-01-20 | 1970-10-30 | Sauer Hans | |
| EP0232728A1 (de) * | 1986-01-16 | 1987-08-19 | Siemens Aktiengesellschaft | Elektromagnetisches Relais |
| DE3837666A1 (de) * | 1988-11-05 | 1990-05-10 | Gruner Kg Relais Fabrik | Relais |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2318812B1 (de) * | 1973-04-13 | 1974-01-10 | Hans Sauer | Elektromagnetisches Relais |
| JPS505133U (enrdf_load_stackoverflow) * | 1973-05-14 | 1975-01-20 | ||
| AT333369B (de) * | 1973-06-30 | 1976-11-25 | Elmeg | Elektromagnetisches relais |
| US3949332A (en) * | 1973-07-09 | 1976-04-06 | Elmeg Elektro-Mechanik Gmbh | Rapid action relay |
| DE2454967C3 (de) * | 1974-05-15 | 1981-12-24 | Hans 8024 Deisenhofen Sauer | Gepoltes elektromagnetisches Relais |
| US4323945A (en) * | 1979-01-25 | 1982-04-06 | Matsushita Electric Works, Ltd. | Polarized electromagnetic relay |
| DE2902885C2 (de) * | 1979-01-25 | 1983-03-24 | Sds-Elektro Gmbh, 8024 Deisenhofen | Kontaktfederanordnung für elektromagnetische Drehankerrelais |
| EP0040778B1 (en) * | 1980-05-16 | 1984-09-26 | Omron Tateisi Electronics Co. | Polarized electromagnetic device |
| US4437078A (en) | 1981-02-03 | 1984-03-13 | Omron Tateisi Electronics Co. | Polarized electromagnetic device |
| AU565375B2 (en) * | 1984-07-25 | 1987-09-10 | Matsushita Electric Works Ltd. | Polarized electromagnetic relay |
| US4864264A (en) * | 1988-01-20 | 1989-09-05 | Sigma Instruments, Inc. | Bistable toggling indicator |
| FR2773910B1 (fr) * | 1998-01-16 | 2000-05-19 | Schneider Electric Sa | Appareil interrupteur a commande electromagnetique |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH241771A (de) * | 1944-06-03 | 1946-03-31 | Siemens Ag Albis | Polarisiertes Magnetsystem. |
| FR1129189A (fr) * | 1955-07-21 | 1957-01-16 | Perfectionnements aux dispositifs électromagnétiques | |
| US2888533A (en) * | 1958-01-23 | 1959-05-26 | Clare & Co C P | Center stable polar relay |
| DE1125547B (de) * | 1959-03-13 | 1962-03-15 | Siemens Ag | Magnetische Schaltvorrichtung mit dauermagnetisiertem Anker |
| US3178532A (en) * | 1962-12-05 | 1965-04-13 | Connecticut Valley Entpr Inc | Electromagnetic relay with contact supported armature |
| DE1213917B (de) * | 1965-03-04 | 1966-04-07 | Hans Sauer | Polarisiertes elektromagnetisches Relais |
| DE1243271B (de) * | 1966-04-12 | 1967-06-29 | Hans Sauer | Elektromagnetisches Umschaltrelais mit geschuetztem Kontaktsystem |
| DE1614516B1 (de) * | 1967-04-27 | 1971-12-30 | Siemens Ag | Gepoltes relais mit bistabiler haftcharakteristik |
| DE1909940B2 (de) * | 1968-02-27 | 1971-12-23 | Sauer, Hans, 8000 München | Elektromagnetisches umschaltrelais mit geschuetztem kontakt system |
| DE1902610B1 (de) * | 1969-01-20 | 1969-12-11 | Sauer, Hans, 8000 München | Elektromagnetisches Relais |
-
1969
- 1969-01-20 DE DE19691902610D patent/DE1902610B1/de active Pending
- 1969-11-24 CH CH1746269A patent/CH522948A/de not_active IP Right Cessation
-
1970
- 1970-01-14 US US2916A patent/US3634793A/en not_active Expired - Lifetime
- 1970-01-19 GB GB2446/70A patent/GB1255133A/en not_active Expired
- 1970-01-19 FR FR7001725A patent/FR2030169A1/fr not_active Withdrawn
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2030169A1 (enrdf_load_stackoverflow) * | 1969-01-20 | 1970-10-30 | Sauer Hans | |
| EP0232728A1 (de) * | 1986-01-16 | 1987-08-19 | Siemens Aktiengesellschaft | Elektromagnetisches Relais |
| DE3837666A1 (de) * | 1988-11-05 | 1990-05-10 | Gruner Kg Relais Fabrik | Relais |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1255133A (en) | 1971-11-24 |
| SU406389A3 (enrdf_load_stackoverflow) | 1973-11-05 |
| FR2030169A1 (enrdf_load_stackoverflow) | 1970-10-30 |
| US3634793A (en) | 1972-01-11 |
| CH522948A (de) | 1972-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1902610B1 (de) | Elektromagnetisches Relais | |
| DE2728629C2 (de) | Elektromagnetvorrichtung | |
| DE102010017872B4 (de) | Bistabiles Kleinrelais großer Leistung | |
| DE10347452A1 (de) | Aktuator, Verfahren zur Herstellung des Aktuators und Leistungsschalter, der mit dem Aktuator ausgestattet ist | |
| EP0078324A1 (de) | Polarisiertes elektromagnetisches relais | |
| DE3787756T2 (de) | Polarisierte elektromagnetische Vorrichtung. | |
| DE3230564A1 (de) | Elektromagnetisches schaltgeraet, bestehend aus einem magnetantrieb und einem oberhalb dessen angeordneten kontaktapparat | |
| DE842809C (de) | Schaltpatrone | |
| DE3347602A1 (de) | Polarisiertes elektromagnetisches relais | |
| DE102006005697A1 (de) | Einrichtung zum Auslösen eines elektrischen Schaltgeräts | |
| DE2148377A1 (de) | Gepoltes miniaturrelais | |
| DE19649515B4 (de) | Verfahren und Vorrichtung zur Messung der Dicke dünner Schichten sowie Schaltung zur Ansteuerung der Vorrichtung | |
| DE4009427A1 (de) | Elektromagnetisches schaltschuetz und herstellungsverfahren dafuer | |
| DE3047608C2 (de) | Elektromagnetisches Relais | |
| DE731121C (de) | Kontaktfedergruppe | |
| EP0594870A1 (de) | Steuermotor | |
| DE102021212346A1 (de) | elektromagnetischer Aktuator | |
| DE1213917B (de) | Polarisiertes elektromagnetisches Relais | |
| EP0013991B2 (de) | Kontaktfederanordnung für gepolte elektromagnetische Relais | |
| DE2701230C3 (de) | Elektromagnetisches Relais und Verfahren zu dessen Justierung | |
| EP1393338B1 (de) | Magnetjoch eines elektromagnetischen auslösers | |
| DE602005002604T2 (de) | Elektromagnetischer Betätiger mit beweglicher Spule | |
| DE2750142A1 (de) | Monostabiles elektromagnetisches drehankerrelais | |
| DE1764921C3 (de) | Magnetsystem für einen Relaisschalter | |
| DE267556C (enrdf_load_stackoverflow) |