DE1695168A1 - Verfahren zur Herstellung von Benzodiazepin-Derivaten - Google Patents
Verfahren zur Herstellung von Benzodiazepin-DerivatenInfo
- Publication number
- DE1695168A1 DE1695168A1 DE19661695168 DE1695168A DE1695168A1 DE 1695168 A1 DE1695168 A1 DE 1695168A1 DE 19661695168 DE19661695168 DE 19661695168 DE 1695168 A DE1695168 A DE 1695168A DE 1695168 A1 DE1695168 A1 DE 1695168A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- lower alkyl
- halogen
- formula
- nitro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 5
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 title claims description 3
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 title claims 2
- 150000001875 compounds Chemical class 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000243 solution Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- ZUWXHHBROGLWNH-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-phenylmethanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 ZUWXHHBROGLWNH-UHFFFAOYSA-N 0.000 description 1
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical class N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 description 1
- YIBUYDHSWMGPBG-UHFFFAOYSA-N 2-(benzenecarboximidoyl)-4-chloro-n-methylaniline Chemical compound CNC1=CC=C(Cl)C=C1C(=N)C1=CC=CC=C1 YIBUYDHSWMGPBG-UHFFFAOYSA-N 0.000 description 1
- FGQBDNROFQTSRT-UHFFFAOYSA-N 2-(benzenecarboximidoyl)-n-methyl-4-nitroaniline Chemical compound CNC1=CC=C([N+]([O-])=O)C=C1C(=N)C1=CC=CC=C1 FGQBDNROFQTSRT-UHFFFAOYSA-N 0.000 description 1
- LKRZCUQFUCYWLZ-UHFFFAOYSA-N 2-chloroacetyl bromide Chemical compound ClCC(Br)=O LKRZCUQFUCYWLZ-UHFFFAOYSA-N 0.000 description 1
- WDFDOEZDEQJRHF-UHFFFAOYSA-N 2-chloroacetyl iodide Chemical compound ClCC(I)=O WDFDOEZDEQJRHF-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001557 benzodiazepines Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- -1 sodium hydroxide Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US512773A US3376290A (en) | 1965-12-09 | 1965-12-09 | Process for preparing benzodiazepines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1695168A1 true DE1695168A1 (de) | 1970-12-10 |
Family
ID=24040498
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661695168 Pending DE1695168A1 (de) | 1965-12-09 | 1966-11-24 | Verfahren zur Herstellung von Benzodiazepin-Derivaten |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3376290A (enExample) |
| BE (1) | BE690185A (enExample) |
| BR (1) | BR6685044D0 (enExample) |
| CH (1) | CH484163A (enExample) |
| DE (1) | DE1695168A1 (enExample) |
| DK (1) | DK122079B (enExample) |
| ES (1) | ES334297A1 (enExample) |
| FR (1) | FR1503276A (enExample) |
| GB (1) | GB1164499A (enExample) |
| IL (1) | IL26893A (enExample) |
| MY (1) | MY7000087A (enExample) |
| NL (2) | NL6617011A (enExample) |
| NO (1) | NO122070B (enExample) |
| SE (1) | SE319184B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2016385C3 (de) * | 1969-04-16 | 1980-09-18 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | 1 -Alkoxyalkyl-5-(o-fluorphenyl)-7chlor-13-dihydro-2H-benzodiazepin-2-onderivate |
| US3872089A (en) * | 1971-05-14 | 1975-03-18 | Hoffmann La Roche | Substituted thienodiazepines |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3297755A (en) * | 1960-12-02 | 1967-01-10 | Hoffmann La Roche | 2-chloro-5-trifluoromethylbenzo-phenone compounds |
| NL122319C (enExample) * | 1961-06-20 |
-
0
- NL NL131731D patent/NL131731C/xx active
-
1965
- 1965-12-09 US US512773A patent/US3376290A/en not_active Expired - Lifetime
-
1966
- 1966-11-18 IL IL26893A patent/IL26893A/xx unknown
- 1966-11-21 CH CH1667166A patent/CH484163A/de not_active IP Right Cessation
- 1966-11-24 DE DE19661695168 patent/DE1695168A1/de active Pending
- 1966-11-25 BE BE690185D patent/BE690185A/xx unknown
- 1966-12-02 NL NL6617011A patent/NL6617011A/xx unknown
- 1966-12-02 BR BR185044/66A patent/BR6685044D0/pt unknown
- 1966-12-02 SE SE16540/66A patent/SE319184B/xx unknown
- 1966-12-05 DK DK629966AA patent/DK122079B/da unknown
- 1966-12-06 FR FR86239A patent/FR1503276A/fr not_active Expired
- 1966-12-07 ES ES334297A patent/ES334297A1/es not_active Expired
- 1966-12-08 NO NO165919A patent/NO122070B/no unknown
- 1966-12-08 GB GB54953/66A patent/GB1164499A/en not_active Expired
-
1970
- 1970-12-31 MY MY197087A patent/MY7000087A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR6685044D0 (pt) | 1973-12-18 |
| MY7000087A (en) | 1970-12-31 |
| IL26893A (en) | 1970-10-30 |
| NO122070B (enExample) | 1971-05-18 |
| ES334297A1 (es) | 1968-02-01 |
| DK122079B (da) | 1972-01-17 |
| GB1164499A (en) | 1969-09-17 |
| FR1503276A (fr) | 1967-11-24 |
| US3376290A (en) | 1968-04-02 |
| BE690185A (enExample) | 1967-05-25 |
| NL6617011A (enExample) | 1967-06-12 |
| SE319184B (enExample) | 1970-01-12 |
| NL131731C (enExample) | |
| CH484163A (de) | 1970-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Russell et al. | Electron-transfer reactions. IX. Formation of azo radical anions and their vinylogs | |
| DE1695168A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1593865C3 (de) | Verfahren zur Isolierung von 4,4'-Diaminodiphenylmethan aus Polyphenylmethylenpolyamingemischen | |
| AT266144B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| US3365505A (en) | Novel halogenated compounds and methods for the preparation thereof | |
| WO1999062848A1 (de) | Verfahren zur herstellung von alkyl-, alkenyl- und alkinylchloriden | |
| DE2523351C2 (de) | Verfahren zur Herstellung von 1,5- und 1,8-Diaminonaphthalin | |
| EP0675095A1 (de) | Verfahren zur Herstellung von 2,2'-Bis(halogenmethyl)-1,1'-binaphthyl | |
| DE2125229C3 (de) | Verfahren zur Herstellung von Chinazolinen | |
| DE1568799A1 (de) | Verfahren zur Herstellung von Benzophenon-Derivaten | |
| DE2147283A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT274816B (de) | Verfahren zur Herstellung von 1,2-Dihydrobenzodiazepinen und von Säureadditionssalzen dieser Verbindungen | |
| DE1695169A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| US3335151A (en) | Highly chlorinated nitrogen heterocyclic compounds and process for producing the same | |
| AT272305B (de) | Verfahren zur Herstellung von neuen 2-Aminobenzophenoniminen | |
| US2802037A (en) | Method of preparing hexahalobenzenes | |
| EP1036055A2 (de) | Verfahren zur herstellung von chlorcarbonsäurechloriden | |
| DE1493818A1 (de) | Verfahren zur Herstellung von Benzophenon-Derivaten | |
| DE2433837A1 (de) | Amidinoharnstoff-verbindungen | |
| US3087972A (en) | Nitro compounds | |
| AT210428B (de) | Verfahren zur Herstellung von neuen, mit einer einwertigen Schwefelfunktion substituierten Pyrido-benzthiazin-Derivaten | |
| DE1643634C3 (enExample) | ||
| US3428632A (en) | Production of 3,4,5,6-tetrahydro-4,5,6-substituted-2h-1,3,4-oxadiazin-2-ones | |
| DE2713431A1 (de) | Verfahren zur herstellung von diacylierten 4-imidazolinonen-2 und deren verwendung fuer cycloadditionen | |
| DE1695188A1 (de) | Verfahren zur Herstellung von 1,2-Dihydrobenzodiazepinen |