DE1643333A1 - Verfahren zur Herstellung von Phthalsaeurephenylaetherderivaten - Google Patents
Verfahren zur Herstellung von PhthalsaeurephenylaetherderivatenInfo
- Publication number
- DE1643333A1 DE1643333A1 DE19671643333 DE1643333A DE1643333A1 DE 1643333 A1 DE1643333 A1 DE 1643333A1 DE 19671643333 DE19671643333 DE 19671643333 DE 1643333 A DE1643333 A DE 1643333A DE 1643333 A1 DE1643333 A1 DE 1643333A1
- Authority
- DE
- Germany
- Prior art keywords
- phthalic acid
- preparation
- phenyl ether
- ether derivatives
- acid phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 phthalic acid phenyl ether derivatives Chemical class 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 3
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 title description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 claims description 4
- 150000001555 benzenes Chemical class 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 239000003495 polar organic solvent Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims 1
- 150000001447 alkali salts Chemical class 0.000 claims 1
- BQGDDMMXPRJQHZ-UHFFFAOYSA-N dimethyl 3-hydroxybenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(O)=C1C(=O)OC BQGDDMMXPRJQHZ-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- PWKNBLFSJAVFAB-UHFFFAOYSA-N 1-fluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1F PWKNBLFSJAVFAB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- JJXVDRYFBGDXOU-UHFFFAOYSA-N dimethyl 4-hydroxybenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=C(O)C=C1C(=O)OC JJXVDRYFBGDXOU-UHFFFAOYSA-N 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- MNUOZFHYBCRUOD-UHFFFAOYSA-N hydroxyphthalic acid Natural products OC(=O)C1=CC=CC(O)=C1C(O)=O MNUOZFHYBCRUOD-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- BFCFYVKQTRLZHA-UHFFFAOYSA-N 1-chloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1Cl BFCFYVKQTRLZHA-UHFFFAOYSA-N 0.000 description 1
- HRMCXDSWURAYFR-UHFFFAOYSA-N 3-phenoxyphthalic acid Chemical class OC(=O)C1=CC=CC(OC=2C=CC=CC=2)=C1C(O)=O HRMCXDSWURAYFR-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0053060 | 1967-07-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1643333A1 true DE1643333A1 (de) | 1971-03-25 |
Family
ID=7105965
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671643333 Pending DE1643333A1 (de) | 1967-07-26 | 1967-07-26 | Verfahren zur Herstellung von Phthalsaeurephenylaetherderivaten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3686266A (cs) |
| BE (1) | BE718564A (cs) |
| CH (1) | CH499483A (cs) |
| DE (1) | DE1643333A1 (cs) |
| FR (1) | FR1573736A (cs) |
| GB (1) | GB1202166A (cs) |
| NL (1) | NL6810545A (cs) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3873593A (en) * | 1971-01-20 | 1975-03-25 | Gen Electric | Process for making aryloxy compositions |
| CH564525A5 (cs) * | 1972-01-17 | 1975-07-31 | Ciba Geigy Ag | |
| US4395570A (en) * | 1981-11-16 | 1983-07-26 | Rohm And Haas Company | Preparation of 5-(2-halo-4-trifluoromethylphenoxy)-2-nitrobenzoic acid and salts and esters and amides |
-
1967
- 1967-07-26 DE DE19671643333 patent/DE1643333A1/de active Pending
-
1968
- 1968-04-18 CH CH575068A patent/CH499483A/de not_active IP Right Cessation
- 1968-06-13 GB GB28091/68A patent/GB1202166A/en not_active Expired
- 1968-07-18 US US745707A patent/US3686266A/en not_active Expired - Lifetime
- 1968-07-25 BE BE718564D patent/BE718564A/xx unknown
- 1968-07-25 NL NL6810545A patent/NL6810545A/xx unknown
- 1968-07-26 FR FR1573736D patent/FR1573736A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH499483A (de) | 1970-11-30 |
| US3686266A (en) | 1972-08-22 |
| BE718564A (cs) | 1968-12-31 |
| NL6810545A (cs) | 1969-01-28 |
| GB1202166A (en) | 1970-08-12 |
| FR1573736A (cs) | 1969-07-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2540740A1 (de) | Verfahren zur dehalogenierung von aromatischen verbindungen | |
| EP0294685B1 (de) | Verfahren zur Herstellung von Chinolinen | |
| DE2433066A1 (de) | Phenylaether und verfahren zu ihrer herstellung | |
| DE2130919B2 (de) | Substituierte diphenylaether, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE1643333A1 (de) | Verfahren zur Herstellung von Phthalsaeurephenylaetherderivaten | |
| DE2948142C2 (de) | Verfahren zur Herstellung von 21-Acylthio-Steroiden | |
| DE3339859A1 (de) | Verfahren zur herstellung von 3,4,6-trisubstituierten 3-alkyl-thio-1,2,4-triazin-5-on-derivaten | |
| EP0675095A1 (de) | Verfahren zur Herstellung von 2,2'-Bis(halogenmethyl)-1,1'-binaphthyl | |
| DE3426792A1 (de) | Verfahren zur herstellung von monoperoxydicarbonsaeuren und deren salze | |
| EP0061113A1 (de) | Verfahren zur Herstellung von gegebenenfalls substituierten Fluor-nitro-benzaldehyden | |
| EP0401626B1 (de) | Verfahren zur Herstellung chlorierter Diphenylether | |
| DE1942993A1 (de) | 0,0-Dialkyl-thiono- oder -dithio-phosphorsaeureester von Oxdiazolen | |
| DE1961623C (de) | 2 (2 Butinyloxy) phenol | |
| DE2460909A1 (de) | Verfahren zur herstellung von alphaoxothiodimethylamiden | |
| DE1643246C3 (de) | 2,5-Di-(methylmercapto)-4-chlorphenol und Verfahren zur Herstellung von 2,5-Di-(alkylmercapto)-4-chlorphenolen | |
| DE2231462C3 (de) | Alkylphenolphthalein-pH-lndikatoren und deren Herstellung | |
| DE69503346T2 (de) | Methode zur Herstellung von Triazolverbindungen | |
| DE2112778B2 (de) | Verfahren zur Herstellung von 2-CyBn-S^Ae-IeITaChIOr- bzw. brombenzoesäurealkylestern | |
| DE3111848A1 (de) | Verfahren zur herstellung von substituierten (alpha)-halogen-propionsaeuren und ihren derivaten | |
| DE3538873A1 (de) | Verfahren zur herstellung von imidazolyl-methan-derivaten | |
| DE2404999A1 (de) | Mehrkernige, halogenierte, aromatische benzylaether und verfahren zu deren herstellung | |
| DE2527575C3 (de) | Verfahren zur Herstellung von 5-Methyl-2-nitrophenol | |
| EP0006463A1 (de) | Verfahren zur Herstellung von 2-substituierten 1-Alkyl-nitroimidazolen | |
| CH633245A5 (de) | Verfahren zur herstellung von 2,3-dichlor-1-(c1-7)-alkoxybenzolen. | |
| DE1620459C3 (de) | Verfahren zur Herstellung von 2H-1,2,4-Benzothiadiazin-1,1 -dioxidderi vaten |