DE1629892A1 - Piezoelektrische Zuendvorrichtung zur Entflammung von brennbaren Gasen - Google Patents
Piezoelektrische Zuendvorrichtung zur Entflammung von brennbaren GasenInfo
- Publication number
- DE1629892A1 DE1629892A1 DE19671629892 DE1629892A DE1629892A1 DE 1629892 A1 DE1629892 A1 DE 1629892A1 DE 19671629892 DE19671629892 DE 19671629892 DE 1629892 A DE1629892 A DE 1629892A DE 1629892 A1 DE1629892 A1 DE 1629892A1
- Authority
- DE
- Germany
- Prior art keywords
- anvil
- piezo element
- ignition device
- spring
- striking
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000007789 gas Substances 0.000 title claims description 24
- 238000010304 firing Methods 0.000 claims description 12
- 239000011810 insulating material Substances 0.000 claims description 5
- 210000000056 organ Anatomy 0.000 claims description 4
- 230000001902 propagating effect Effects 0.000 claims description 3
- 208000028659 discharge Diseases 0.000 description 6
- 210000002105 tongue Anatomy 0.000 description 4
- 238000010276 construction Methods 0.000 description 2
- 238000010891 electric arc Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- 102220540461 Mitogen-activated protein kinase kinase kinase 10_Q21S_mutation Human genes 0.000 description 1
- 240000007313 Tilia cordata Species 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004146 energy storage Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 239000003345 natural gas Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23Q—IGNITION; EXTINGUISHING-DEVICES
- F23Q3/00—Igniters using electrically-produced sparks
- F23Q3/002—Igniters using electrically-produced sparks using piezoelectric elements
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Lighters Containing Fuel (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0091319 | 1967-02-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1629892A1 true DE1629892A1 (de) | 1971-03-11 |
Family
ID=6985777
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671629892 Pending DE1629892A1 (de) | 1967-02-22 | 1967-02-22 | Piezoelektrische Zuendvorrichtung zur Entflammung von brennbaren Gasen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3457461A (enExample) |
| AT (1) | AT284324B (enExample) |
| DE (1) | DE1629892A1 (enExample) |
| FR (1) | FR1555988A (enExample) |
| GB (1) | GB1221070A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2229927A1 (enExample) * | 1973-05-14 | 1974-12-13 | Braun Ag | |
| FR2316750A1 (fr) * | 1975-06-19 | 1977-01-28 | Matsushita Electric Industrial Co Ltd | Dispositif generateur haute-tension |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3585417A (en) * | 1969-03-06 | 1971-06-15 | Mallory & Co Inc P R | Piezoelectric device having a resistor and a plastic insulating casing |
| JPS482692Y1 (enExample) * | 1970-04-13 | 1973-01-24 | ||
| DE2058968A1 (de) * | 1970-12-01 | 1972-06-15 | Dynamit Nobel Ag | Piezoelektrische Energiequelle |
| SE351286C (sv) * | 1971-12-23 | 1979-07-30 | Swelex Teknik Ab | Piezoelektrisk gastendare |
| AR206995A1 (es) * | 1972-09-06 | 1976-09-09 | Braun Ag | Piezoignitor con mecanismo gol peador |
| JPS5153906Y2 (enExample) * | 1972-09-14 | 1976-12-23 | ||
| FR2229926B1 (enExample) * | 1973-05-14 | 1978-03-24 | Braun Ag | |
| DE2335058A1 (de) * | 1973-07-10 | 1975-01-30 | Braun Ag | Piezozuender |
| US3992640A (en) * | 1974-11-29 | 1976-11-16 | Eastman Kodak Company | Piezo crystal housing and mount |
| AR208584A1 (es) * | 1976-01-29 | 1977-02-15 | Mfg De Articulos Para El Hogar | Encendedor compacto a piezoelectrico |
| US4412151A (en) * | 1980-09-02 | 1983-10-25 | Charles W. Taggart | Piezoelectric crystal spark plug |
| US4430595A (en) | 1981-07-29 | 1984-02-07 | Toko Kabushiki Kaisha | Piezo-electric push button switch |
| ES2014189A6 (es) * | 1989-08-02 | 1990-06-16 | Laforest Sa | Mecanismo piezoelectrico para encendedores de gas. |
| US5496356A (en) * | 1993-03-29 | 1996-03-05 | Hudz; Paul H. | Piezo de-toxifier |
| DE69626638T2 (de) * | 1995-12-04 | 2003-12-18 | Laforest Bic, S.A. | Piezoelektrischer mechanismus für gasfeuerzeuge mit aussen geschlossenem teleskopkörper |
| US5854530A (en) * | 1996-12-18 | 1998-12-29 | Bic Corporation | Piezoelectric lighter which has a higher level of difficulty for operation |
| US6046528A (en) * | 1997-11-03 | 2000-04-04 | Bic Corporation | Selectively actuatable piezoelectric ignition mechanism |
| US6765338B2 (en) | 2001-05-29 | 2004-07-20 | Bic Corporation | Child-resistant piezoelectric lighter |
| US6856074B2 (en) * | 2002-03-01 | 2005-02-15 | Bic Corporation | Piezoelectric ignition mechanism |
| JP4060300B2 (ja) * | 2004-09-22 | 2008-03-12 | リンナイ株式会社 | 加熱調理器 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB712803A (en) * | 1951-09-04 | 1954-07-28 | Mcculloch Motors Corp | Electrical ignition systems |
| US3200295A (en) * | 1962-12-26 | 1965-08-10 | Honeywell Inc | Manually operable piezoelectric lighters |
| US3298421A (en) * | 1964-09-28 | 1967-01-17 | Rion Company Ltd | Ignition system for gas burners |
| US3408153A (en) * | 1966-04-25 | 1968-10-29 | Ishiguro Mitsuei | Gas lighter with a manually operable piezoelectric ignition device |
-
1967
- 1967-02-22 DE DE19671629892 patent/DE1629892A1/de active Pending
-
1968
- 1968-01-29 AT AT87668A patent/AT284324B/de not_active IP Right Cessation
- 1968-02-07 US US703587A patent/US3457461A/en not_active Expired - Lifetime
- 1968-02-19 FR FR1555988D patent/FR1555988A/fr not_active Expired
- 1968-02-21 GB GB8366/68A patent/GB1221070A/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2229927A1 (enExample) * | 1973-05-14 | 1974-12-13 | Braun Ag | |
| FR2316750A1 (fr) * | 1975-06-19 | 1977-01-28 | Matsushita Electric Industrial Co Ltd | Dispositif generateur haute-tension |
Also Published As
| Publication number | Publication date |
|---|---|
| AT284324B (de) | 1970-09-10 |
| US3457461A (en) | 1969-07-22 |
| GB1221070A (en) | 1971-02-03 |
| FR1555988A (enExample) | 1969-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1629892A1 (de) | Piezoelektrische Zuendvorrichtung zur Entflammung von brennbaren Gasen | |
| DE1629890B2 (de) | Zuendvorrichtung zur entflammung brennbarer gase | |
| DE2709303A1 (de) | Zuendkerze | |
| DE1782767A1 (de) | Gasfeuerzeug | |
| DE1905000A1 (de) | Handbetaetigter Gasanzuender | |
| DE1632657A1 (de) | Zuender fuer ein Gasfeuerzeug | |
| EP3349944A1 (de) | Brenngasbetriebenes eintreibgerät mit ventilglied | |
| DE1228883B (de) | Spann- und Ausloesevorrichtung | |
| DE102007024924B4 (de) | Sicherheitsmechanismus für einen Brenner | |
| DE1553868C3 (de) | Elektronisch gesteuerte Abzugseinrichtung für Handfeuerwaffen | |
| DE2556219A1 (de) | Piezoelektrische zuendvorrichtung | |
| DE1629891A1 (de) | Piezoelektrische Zuendvorrichtung fuer brennbare Gase,insbesondere fuer Gasfeuerzeuge | |
| DE2010154B2 (de) | Waffe mit einem Metallrohr, das an einem Ende offen ist und am anderen Ende einen Boden aufweist sowie zur Aufnahme von Geschossen dient | |
| DE1457626A1 (de) | Gasfeuerzeug mit elektrischer Funkenzuendung | |
| DE4223492C2 (de) | Zündvorrichtung für Maschinen (Roboter) und Handgasbrenner aller Art zum Hart- oder Weichlöten sowie Schweissen oder Schneidbrennen | |
| DE1529149C (de) | Piezoelektrischer Gasanzünder | |
| DE639801C (de) | Elektrisches Feuerzeug mit einer zur Entzuendung eines Dochtes dienenden Heizspirale | |
| AT264705B (de) | Handbetätigbare Vorrichtung zum Entzünden brennbarer Gase | |
| DE1139231B (de) | Brennstoffabsperrvorrichtung, insbesondere Gasabsperrvorrichtung | |
| DE1429117C2 (de) | Handbetätigtes Feuerzeug mit elektrischer Funkenzündung | |
| DE1457584C (de) | Feuerzeug | |
| DE394058C (de) | Stromueberlastungssicherung mit Hoechststromschalter | |
| DE1171067B (de) | Schnell-Kurzschliesser fuer Hoch- und Hoechstspannungsnetze | |
| DE1162118B (de) | Gasfeuerzeug mit elektrischer Funkenzuendung | |
| DE2654225A1 (de) | Hochspannungserzeugungsvorrichtung |