DE1618073A1 - Verfahren zur Herstellung von omega-Cyanopolymethylenzinnkomplexen - Google Patents
Verfahren zur Herstellung von omega-CyanopolymethylenzinnkomplexenInfo
- Publication number
- DE1618073A1 DE1618073A1 DE19671618073 DE1618073A DE1618073A1 DE 1618073 A1 DE1618073 A1 DE 1618073A1 DE 19671618073 DE19671618073 DE 19671618073 DE 1618073 A DE1618073 A DE 1618073A DE 1618073 A1 DE1618073 A1 DE 1618073A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- complex
- temperature
- range
- complexes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 20
- 238000002360 preparation method Methods 0.000 title claims description 5
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 title description 2
- 239000000203 mixture Substances 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 9
- 239000002841 Lewis acid Substances 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 150000007517 lewis acids Chemical class 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 6
- 238000007323 disproportionation reaction Methods 0.000 claims description 6
- -1 alkyl radical Chemical class 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 238000011065 in-situ storage Methods 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 239000012298 atmosphere Substances 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 3
- 229910015900 BF3 Inorganic materials 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 241000723347 Cinnamomum Species 0.000 claims 1
- 235000017803 cinnamon Nutrition 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- 239000000243 solution Substances 0.000 description 9
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- 238000003756 stirring Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- CQLFBEKRDQMJLZ-UHFFFAOYSA-M silver acetate Chemical compound [Ag+].CC([O-])=O CQLFBEKRDQMJLZ-UHFFFAOYSA-M 0.000 description 4
- 229940071536 silver acetate Drugs 0.000 description 4
- LTSUHJWLSNQKIP-UHFFFAOYSA-J tin(iv) bromide Chemical compound Br[Sn](Br)(Br)Br LTSUHJWLSNQKIP-UHFFFAOYSA-J 0.000 description 4
- 229910021623 Tin(IV) bromide Inorganic materials 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N γ Benzene hexachloride Chemical compound ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 2
- NDVLTZFQVDXFAN-UHFFFAOYSA-N 3-(2-cyanoethylsulfanyl)propanenitrile Chemical compound N#CCCSCCC#N NDVLTZFQVDXFAN-UHFFFAOYSA-N 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- 206010003402 Arthropod sting Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000191405 Lewia Species 0.000 description 1
- 101100545275 Mus musculus Znf106 gene Proteins 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- LBRBRXLQZLNWNM-UHFFFAOYSA-N bis(2-cyanoethyl)-sulfanylidenetin Chemical compound C(#N)CC[Sn](CCC#N)=S LBRBRXLQZLNWNM-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 235000015243 ice cream Nutrition 0.000 description 1
- 238000012844 infrared spectroscopy analysis Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- YJGJRYWNNHUESM-UHFFFAOYSA-J triacetyloxystannyl acetate Chemical compound [Sn+4].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O YJGJRYWNNHUESM-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/22—Tin compounds
- C07F7/2204—Not belonging to the groups C07F7/2208 - C07F7/2296
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US517938A US3417116A (en) | 1966-01-03 | 1966-01-03 | Omega-cyano-polymethylenetin lewis acid complexes and the preparation thereof |
Publications (1)
Publication Number | Publication Date |
---|---|
DE1618073A1 true DE1618073A1 (de) | 1970-10-29 |
Family
ID=24061868
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19671618073 Pending DE1618073A1 (de) | 1966-01-03 | 1967-01-03 | Verfahren zur Herstellung von omega-Cyanopolymethylenzinnkomplexen |
Country Status (8)
Families Citing this family (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3509404A (en) * | 1968-07-01 | 1970-04-28 | Gen Electric | Vacuum arc devices with doubly reentrant coaxial arc-electrode structure |
US3862090A (en) * | 1971-06-28 | 1975-01-21 | Celanese Corp | Process for producing oxymethylene copolymers |
US4327016A (en) * | 1979-05-07 | 1982-04-27 | Ciba-Geigy Corporation | Organotin compounds, and their use |
EP4074717A1 (en) * | 2021-04-13 | 2022-10-19 | BNT Chemicals GmbH | Method for cleaving alkyl tin halides |
CN119816507A (zh) | 2022-08-12 | 2025-04-11 | 盖列斯特有限公司 | 含有不饱和取代基的高纯度锡化合物及其制备方法 |
WO2024076481A1 (en) | 2022-10-04 | 2024-04-11 | Gelest, Inc. | Cyclic azastannane and cyclic oxostannane compounds and methods for preparation thereof |
Family Cites Families (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
BE545989A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1955-03-11 | |||
US3015644A (en) * | 1958-01-31 | 1962-01-02 | Argus Chem | Stabilizing polypropylene with organictin-mercapto compounds |
US3069446A (en) * | 1958-12-03 | 1962-12-18 | Exxon Research Engineering Co | Titanium halide derivatives |
US3272852A (en) * | 1963-09-10 | 1966-09-13 | Texaco Inc | Schiff base-inorganic halide adduct |
GB1050538A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1963-10-08 | |||
US3332970A (en) * | 1964-10-28 | 1967-07-25 | Shell Oil Co | Per (beta and gamma substituted alkylene)mono-and di-tin compounds and the preparation thereof |
US3347833A (en) * | 1964-12-08 | 1967-10-17 | Shell Oil Co | Epoxy organo-tin compounds |
-
1966
- 1966-01-03 US US517938A patent/US3417116A/en not_active Expired - Lifetime
- 1966-12-29 AT AT1196166A patent/AT261633B/de active
- 1966-12-29 FR FR89299A patent/FR1510254A/fr not_active Expired
- 1966-12-29 AT AT457967A patent/AT264543B/de active
-
1967
- 1967-01-02 NL NL6700012A patent/NL6700012A/xx unknown
- 1967-01-02 ES ES0335163A patent/ES335163A1/es not_active Expired
- 1967-01-03 BE BE692122D patent/BE692122A/xx unknown
- 1967-01-03 DE DE19671618073 patent/DE1618073A1/de active Pending
- 1967-01-03 GB GB339/67A patent/GB1146102A/en not_active Expired
Also Published As
Publication number | Publication date |
---|---|
FR1510254A (fr) | 1968-01-19 |
BE692122A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-06-16 |
US3417116A (en) | 1968-12-17 |
AT264543B (de) | 1968-09-10 |
NL6700012A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1967-07-04 |
AT261633B (de) | 1968-05-10 |
ES335163A1 (es) | 1967-12-01 |
GB1146102A (en) | 1969-03-19 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE1520523A1 (de) | Polymere mit koordinativen Bindungen | |
DE2607178B2 (de) | Verfahren zur Herstellung von Organozinndihalogeniden oder Gemischen aus Organozinndihalogeniden und Organozinntrihalogeniden | |
DE1618073A1 (de) | Verfahren zur Herstellung von omega-Cyanopolymethylenzinnkomplexen | |
DE954016C (de) | Unkrautvertilgungsmittel | |
DE2651448A1 (de) | Neue organozinn-stabilisatorkompositionen und hiermit stabilisierte polyvinylharze | |
DE1669841A1 (de) | Stabilisatormischungen fuer Polymerisatkunststoffmassen | |
DE2253594C2 (de) | Verfahren zur Trennung eines Gemischs aus tertiären N-peralkylierten Polyalkylenpolyaminen | |
DE1159949B (de) | Verfahren zur Herstellung Cyclopentadienyl-Metallverbindungen | |
DE1669899B2 (de) | Stabilisatormischungen fuer halogenhaltige polymerisate | |
DE2017044C3 (de) | Nickel-Amid-Komplexe von 2,2'Thiobis-(p-t-octylphenol) und ein Verfahren zu ihrer Herstellung | |
DE1233396B (de) | Verfahren zur Herstellung von chlor- und schwefelhaltigen Organozinnverbindungen | |
DE2431796C2 (de) | Verfahren zur Herstellung von N,N, N',N'-Tetraarylchinondiimonium-Salzen | |
DE878826C (de) | Verfahren zur Verbesserung von Bindemitteln fuer Lacke, Anstrichmittel, Kitte, Klebstoffe und plastische Massen auf der Grundlage von OElen, Naturharzen oder Kunstharzen | |
DE946447C (de) | Verfahren zur Herstellung von Organozinnverbindungen | |
DE1668707A1 (de) | Verfahren zur Herstellung von Phosphonoalkylenammoniumverbindungen | |
DE2802292A1 (de) | Bis-tetrahalophthalat und verfahren zu seiner herstellung | |
DE2124079A1 (de) | Optische Aufheller | |
DE1237114B (de) | Verfahren zur Herstellung von Cyclopolysiloxanen | |
DE941193C (de) | Verfahren zur Herstellung von neuen, bisquaternaeren Phosphoniumverbindungen | |
DE1544629A1 (de) | Verfahren zur Herstellung von Hitzestabilisatoren und stabilisierte Polyvinylchloridmassen | |
DE1570014C (de) | Tetramcotinsaureester des 2,2,6,6 Tetrahydroxymethylcyclohexanols und Ver fahren zu seiner Herstellung | |
DE947410C (de) | Verfahren zur Beschleunigung der Molekuelvergroesserung ungesaettigter organischer Verbindungen | |
DE1768531C3 (de) | Verfahren zur Herstellung fluorierter organischer Verbindungen | |
DE1236205B (de) | Verfahren zur Herstellung von Dodekaphenylsilsesquioxan | |
DE867994C (de) | Verfahren zur Herstellung organischer Thiophosphorsaeureester |