DE1593871B2 - Verfahren zur herstellung von nitroaminodiarylaethern - Google Patents
Verfahren zur herstellung von nitroaminodiarylaethernInfo
- Publication number
- DE1593871B2 DE1593871B2 DE1967F0052257 DEF0052257A DE1593871B2 DE 1593871 B2 DE1593871 B2 DE 1593871B2 DE 1967F0052257 DE1967F0052257 DE 1967F0052257 DE F0052257 A DEF0052257 A DE F0052257A DE 1593871 B2 DE1593871 B2 DE 1593871B2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- volume
- dimethyl sulfoxide
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 claims description 8
- 150000002170 ethers Chemical class 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 4
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 32
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000203 mixture Substances 0.000 description 11
- BFCFYVKQTRLZHA-UHFFFAOYSA-N 1-chloro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1Cl BFCFYVKQTRLZHA-UHFFFAOYSA-N 0.000 description 8
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000002798 polar solvent Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- PNLPXABQLXSICH-UHFFFAOYSA-N 4-amino-3-chlorophenol Chemical compound NC1=CC=C(O)C=C1Cl PNLPXABQLXSICH-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- NTBYINQTYWZXLH-UHFFFAOYSA-N 1,2-dichloro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(Cl)=C1 NTBYINQTYWZXLH-UHFFFAOYSA-N 0.000 description 1
- BQCCJWMQESHLIT-UHFFFAOYSA-N 1-propylsulfinylpropane Chemical compound CCCS(=O)CCC BQCCJWMQESHLIT-UHFFFAOYSA-N 0.000 description 1
- SWFNPENEBHAHEB-UHFFFAOYSA-N 2-amino-4-chlorophenol Chemical compound NC1=CC(Cl)=CC=C1O SWFNPENEBHAHEB-UHFFFAOYSA-N 0.000 description 1
- VGBFBFRAJWOOKH-UHFFFAOYSA-N 2-aminonaphthalene-1-carbaldehyde Chemical class C1=CC=CC2=C(C=O)C(N)=CC=C21 VGBFBFRAJWOOKH-UHFFFAOYSA-N 0.000 description 1
- 229940018563 3-aminophenol Drugs 0.000 description 1
- ZBIBQNVRTVLOHQ-UHFFFAOYSA-N 5-aminonaphthalen-1-ol Chemical compound C1=CC=C2C(N)=CC=CC2=C1O ZBIBQNVRTVLOHQ-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- -1 alkali metal salt Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- CCAFPWNGIUBUSD-UHFFFAOYSA-N diethyl sulfoxide Chemical compound CCS(=O)CC CCAFPWNGIUBUSD-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-M naphthalen-1-olate Chemical compound C1=CC=C2C([O-])=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-M 0.000 description 1
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical class N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1967F0052257 DE1593871B2 (de) | 1967-04-27 | 1967-04-27 | Verfahren zur herstellung von nitroaminodiarylaethern |
| DE1967F0052958 DE1643329B2 (de) | 1967-04-27 | 1967-07-14 | Verfahren zur herstellung von nitroaminodiarylaethern |
| CH412968A CH515886A (de) | 1967-04-27 | 1968-03-20 | Verfahren zur Herstellung von Nitroaminodiaryläthern |
| GB1361568A GB1216109A (en) | 1967-04-27 | 1968-03-21 | Process for the production of nitroaminodiaryl ethers |
| NL6805895A NL6805895A (enExample) | 1967-04-27 | 1968-04-25 | |
| FR1560940D FR1560940A (enExample) | 1967-04-27 | 1968-04-26 | |
| BE714303D BE714303A (enExample) | 1967-04-27 | 1968-04-26 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1967F0052257 DE1593871B2 (de) | 1967-04-27 | 1967-04-27 | Verfahren zur herstellung von nitroaminodiarylaethern |
| DE1967F0052958 DE1643329B2 (de) | 1967-04-27 | 1967-07-14 | Verfahren zur herstellung von nitroaminodiarylaethern |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1593871A1 DE1593871A1 (de) | 1970-08-27 |
| DE1593871B2 true DE1593871B2 (de) | 1976-08-12 |
Family
ID=25977613
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1967F0052257 Granted DE1593871B2 (de) | 1967-04-27 | 1967-04-27 | Verfahren zur herstellung von nitroaminodiarylaethern |
| DE1967F0052958 Granted DE1643329B2 (de) | 1967-04-27 | 1967-07-14 | Verfahren zur herstellung von nitroaminodiarylaethern |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1967F0052958 Granted DE1643329B2 (de) | 1967-04-27 | 1967-07-14 | Verfahren zur herstellung von nitroaminodiarylaethern |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE714303A (enExample) |
| CH (1) | CH515886A (enExample) |
| DE (2) | DE1593871B2 (enExample) |
| FR (1) | FR1560940A (enExample) |
| GB (1) | GB1216109A (enExample) |
| NL (1) | NL6805895A (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA992991A (en) * | 1971-07-26 | 1976-07-13 | Mallinckrodt | Preparation of amino- and nitro-substituted diphenyl ethers |
| CH621768A5 (enExample) * | 1976-06-15 | 1981-02-27 | Ciba Geigy Ag | |
| US4196144A (en) * | 1976-06-15 | 1980-04-01 | Ciba-Geigy Corporation | Aromatic diamines and their use as polycondensation components for the manufacture of polyamide, polyamide-imide and polyimide polymers |
| US4222962A (en) * | 1978-12-11 | 1980-09-16 | Gulf Research & Development Company | Process for preparing a substituted diphenoxybenzene |
| IL61273A (en) * | 1979-10-24 | 1984-02-29 | Basf Ag | Preparation of anilines and certain novel anilines |
| US4551551A (en) * | 1982-09-27 | 1985-11-05 | Mallinckrodt, Inc. | Preparation of bis(aminophenyl) ethers from (N-acetyl)aminophenols or their phenolates |
-
1967
- 1967-04-27 DE DE1967F0052257 patent/DE1593871B2/de active Granted
- 1967-07-14 DE DE1967F0052958 patent/DE1643329B2/de active Granted
-
1968
- 1968-03-20 CH CH412968A patent/CH515886A/de not_active IP Right Cessation
- 1968-03-21 GB GB1361568A patent/GB1216109A/en not_active Expired
- 1968-04-25 NL NL6805895A patent/NL6805895A/xx unknown
- 1968-04-26 BE BE714303D patent/BE714303A/xx unknown
- 1968-04-26 FR FR1560940D patent/FR1560940A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL6805895A (enExample) | 1968-10-28 |
| BE714303A (enExample) | 1968-09-16 |
| FR1560940A (enExample) | 1969-03-21 |
| DE1593871A1 (de) | 1970-08-27 |
| DE1643329B2 (de) | 1976-12-02 |
| CH515886A (de) | 1971-11-30 |
| DE1643329A1 (de) | 1971-06-03 |
| GB1216109A (en) | 1970-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69813312T2 (de) | Verfahren zur herstellung von cyclopropylethyn sowie zwischenprodukte zur herstellung von cyclopropylethyn | |
| JPS5982349A (ja) | パラ−ニトロソジフエニルアミン塩酸塩の改良製造方法 | |
| DE2855764A1 (de) | Verfahren zur herstellung von nitrodiarylamin unter verwendung eines promotors | |
| DE1593871B2 (de) | Verfahren zur herstellung von nitroaminodiarylaethern | |
| DE1593871C3 (de) | Verfahren zur Herstellung von Nitroaminodiaryläthern | |
| DE3836175A1 (de) | Fluor enthaltende phenole | |
| DE2756560C2 (de) | Verfahren zur Herstellung von Piperonal | |
| DE3104388A1 (de) | Verfahren zur herstellung von 1-alkyl-2-chlor-5-nitro-4-benzol-sulfonsaeuren | |
| DE2614264A1 (de) | Verfahren zur herstelung von nitrohalogenophenolen | |
| DE1618207B2 (de) | Verfahren zur herstellung von alphachloracetessigsaeure-monoalkylamiden | |
| DE2354959B2 (de) | Neues Verfahren zur Herstellung von 4-Amino-3,5-dihalogen-phenyl-äthanolaminen | |
| DE3605197A1 (de) | Verfahren zur herstellung von 4-nitrodiphenylaminen | |
| DE1643329C3 (de) | Verfahren zur Herstellung von Nitroaminodiarylathern | |
| EP0011790B1 (de) | Verfahren zur Herstellung von Nitrodiphenylamin-Derivaten | |
| DE3445644A1 (de) | Neue diaminoalkyldiphenylether, ein verfahren zu ihrer herstellung sowie deren verwendung | |
| EP0089485B1 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
| DE3146471C2 (de) | Verfahren zur Herstellung von 1-(3,5-Dimethoxy-4-hydroxyphenyl)-2-(N-methylamino)-ethanol-hydrochlorid | |
| DE2535337C2 (de) | Verfahren zur Herstellung von 1-Amino-naphthalin-7-sulfonsäure | |
| DE1933525A1 (de) | Verfahren zur Herstellung von chlor- und/oder cyansubstituierten Hydroxybenzonitrilen oder deren Alkali- oder Erdalkalisalzen | |
| DE2331044A1 (de) | Diphenylmethan-derivate und verfahren zu deren herstellung | |
| AT203495B (de) | Verfahren zur Herstellung von neuen tertiären Aminen | |
| DE2416260A1 (de) | Verfahren zur herstellung von phenolderivaten | |
| EP1389608A1 (de) | Katalytische Reduktion von Benzonitrilderivaten zu Benzaldehydderivaten | |
| DE929192C (de) | Verfahren zur Herstellung von am Stickstoffatom acylierten oder sulfonylierten aliphatischen Aminocarbonsaeureamiden | |
| DE929191C (de) | Verfahren zur Herstellung von Aminocarbonsaeuren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |