DE1568362B - - Google Patents
Info
- Publication number
- DE1568362B DE1568362B DE1568362B DE 1568362 B DE1568362 B DE 1568362B DE 1568362 B DE1568362 B DE 1568362B
- Authority
- DE
- Germany
- Prior art keywords
- adamantane
- catalyst
- dealkylation
- dimethyladamantane
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- ORILYTVJVMAKLC-UHFFFAOYSA-N adamantane Chemical compound C1C(C2)CC3CC1CC2C3 ORILYTVJVMAKLC-UHFFFAOYSA-N 0.000 claims description 54
- 239000003054 catalyst Substances 0.000 claims description 23
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 15
- 230000020335 dealkylation Effects 0.000 claims description 12
- 238000006900 dealkylation reaction Methods 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052759 nickel Inorganic materials 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 2
- QDOXWKRWXJOMAK-UHFFFAOYSA-N dichromium trioxide Chemical compound O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 claims 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims 2
- UZUCFTVAWGRMTQ-UHFFFAOYSA-N 1-methyladamantane Chemical compound C1C(C2)CC3CC2CC1(C)C3 UZUCFTVAWGRMTQ-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- CWNOIUTVJRWADX-UHFFFAOYSA-N 1,3-dimethyladamantane Chemical compound C1C(C2)CC3CC1(C)CC2(C)C3 CWNOIUTVJRWADX-UHFFFAOYSA-N 0.000 description 11
- 239000007795 chemical reaction product Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 125000000217 alkyl group Chemical group 0.000 description 6
- 238000006317 isomerization reaction Methods 0.000 description 5
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- FZDZWLDRELLWNN-UHFFFAOYSA-N 1,2,3,3a,4,5,5a,6,7,8,8a,8b-dodecahydroacenaphthylene Chemical compound C1CCC2CCC3C2C1CCC3 FZDZWLDRELLWNN-UHFFFAOYSA-N 0.000 description 2
- FTNPDAKMYKMVKB-UHFFFAOYSA-N 1-ethyl-3,5-dimethyladamantane Chemical compound C1C(C2)CC3(C)CC2(C)CC1(CC)C3 FTNPDAKMYKMVKB-UHFFFAOYSA-N 0.000 description 2
- LXTHCCWEYOKFSR-UHFFFAOYSA-N 1-ethyladamantane Chemical compound C1C(C2)CC3CC2CC1(CC)C3 LXTHCCWEYOKFSR-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- -1 alkyl radical Chemical class 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- LPSXSORODABQKT-YNFQOJQRSA-N (3ar,4r,7s,7as)-rel-octahydro-1h-4,7-methanoindene Chemical compound C([C@H]1C2)C[C@H]2[C@@H]2[C@H]1CCC2 LPSXSORODABQKT-YNFQOJQRSA-N 0.000 description 1
- GVJFFQYXVOJXFI-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene Chemical compound C1C2CCCCC2CC2C1CCCC2 GVJFFQYXVOJXFI-UHFFFAOYSA-N 0.000 description 1
- HBIKNLNXSSBQCT-UHFFFAOYSA-N 1,2,5,7-tetramethyladamantane Chemical compound C1C(C2)(C)CC3(C)CC1C(C)C2(C)C3 HBIKNLNXSSBQCT-UHFFFAOYSA-N 0.000 description 1
- UJSORZVCMMYGBS-UHFFFAOYSA-N 1,3,5,7-tetramethyladamantane Chemical compound C1C(C2)(C)CC3(C)CC1(C)CC2(C)C3 UJSORZVCMMYGBS-UHFFFAOYSA-N 0.000 description 1
- WCACLGXPFTYVEL-UHFFFAOYSA-N 1,3,5-trimethyladamantane Chemical compound C1C(C2)CC3(C)CC1(C)CC2(C)C3 WCACLGXPFTYVEL-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000662429 Fenerbahce Species 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000017858 demethylation Effects 0.000 description 1
- 238000010520 demethylation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000002250 progressing effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2724365C3 (de) | Verfahren zum Trennen eines C4 -Kohlenwasserstoffgemisches durch extraktive Destillation | |
| DE1229089B (de) | Verfahren zur Herstellung von Carbonsaeuren | |
| DE3338269A1 (de) | Verfahren zur gewinnung von isopren aus einem c(pfeil abwaerts)5(pfeil abwaerts)-kohlenwasserstoffgemisch | |
| DE2127625C2 (de) | Verfahren zur Herstellung von Cyclopenten durch thermische Depolymerisation von Diclopentadien | |
| DE102009027770B4 (de) | Verfahren zur Hydrierung von Butadiin | |
| DE2353327C3 (de) | Verfahren zur Isomerisierung von Xylolen | |
| DE1568362A1 (de) | Verfahren zur Herstellung von Adamantan | |
| DE1568362B (https=) | ||
| DE2425289C3 (de) | Verfahren zur Herstellung von Cyclopenten aus Dicyclopentadien durch thermische Spaltung in flüssiger Phase und Hydrierung | |
| DE1493073A1 (de) | Verfahren zum Herstellen von Nitroalkyladamantanen | |
| DE1568362C (de) | Verfahren zur Herstellung von Adaman tan | |
| DE733239C (de) | Verfahren zur Gewinnung aromatischer Kohlenwasserstoffe | |
| DE3708332A1 (de) | Verfahren zur thermischen umwandlung von ethylen | |
| DE1183072B (de) | Verfahren zur thermischen Spaltung fluessiger Kohlenwasserstoffe zu Olefinen | |
| DE746307C (de) | Verfahren zur Herstellung von alkoholischen Hydrierungsprodukten des Furfurols | |
| DE2216168B2 (https=) | ||
| DE1493025C3 (de) | Verfahren zur Herstellung von Alkyladamantanen mit 12 bis 15 Kohlenstoffatomen durch katalytische Isomerisierung von bestimmten tricyclischen perhydroaromatischen Kohlenwasserstoffen mit 12 bis 15 Kohlenstoffatomen und Unterbrechen der Reaktion vor Abschluß der Isomerisierung | |
| EP0248422B1 (de) | Verfahren zur destillativen Aufarbeitung von Cyclohexen, Cyclohexan und Benzol enthaltenden Gemischen | |
| DE1960941A1 (de) | Verfahren zur Herstellung von Methylcyclohexenen | |
| DE2226086C3 (de) | Verfahren zur Herstellung von Heizgas mit einem Heizwert von mindestens 9500 kcal/Nm hoch 3 | |
| DE874901C (de) | Verfahren zur UEberfuehrung von hochchlorierten aliphatischen Kohlenwasserstoffen in weniger Chlor enthaltende Kohlenwasserstoffe | |
| AT231414B (de) | Verfahren zur Herstellung von Isopren-haltigem Material | |
| DE1418628C (de) | Verfahren zur Herstellung von Reinst aromaten | |
| DE1300551B (de) | Verfahren zur kontinuierlichen Herstellung von aliphatischen oder cycloaliphatischenMonoolefinen | |
| DE1807502A1 (de) | Verfahren zur Herstellung von Naphthalin durch pyrolytische Ringerweiterung von Indenhomologen |