DE1547942A1 - Lichtempfindliche Praeparate - Google Patents
Lichtempfindliche PraeparateInfo
- Publication number
- DE1547942A1 DE1547942A1 DE19661547942 DE1547942A DE1547942A1 DE 1547942 A1 DE1547942 A1 DE 1547942A1 DE 19661547942 DE19661547942 DE 19661547942 DE 1547942 A DE1547942 A DE 1547942A DE 1547942 A1 DE1547942 A1 DE 1547942A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- material according
- organic
- sulfur
- photosensitive material
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000002360 preparation method Methods 0.000 title description 33
- 239000000463 material Substances 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 14
- -1 Mercapto compounds Chemical class 0.000 claims description 12
- 229910052717 sulfur Inorganic materials 0.000 claims description 11
- 150000002896 organic halogen compounds Chemical class 0.000 claims description 9
- 230000005855 radiation Effects 0.000 claims description 9
- 239000011593 sulfur Substances 0.000 claims description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 8
- 150000002894 organic compounds Chemical class 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 150000003464 sulfur compounds Chemical class 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 150000002898 organic sulfur compounds Chemical class 0.000 claims description 3
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 125000003435 aroyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 150000002019 disulfides Chemical class 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 150000003536 tetrazoles Chemical class 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 150000002367 halogens Chemical class 0.000 claims 2
- 238000000034 method Methods 0.000 claims 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 150000002430 hydrocarbons Chemical class 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 description 10
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 238000007792 addition Methods 0.000 description 7
- 238000009472 formulation Methods 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 4
- 229910001864 baryta Inorganic materials 0.000 description 4
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 4
- OKJPEAGHQZHRQV-UHFFFAOYSA-N iodoform Chemical compound IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 4
- 229920000915 polyvinyl chloride Polymers 0.000 description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 3
- HVYVMSPIJIWUNA-UHFFFAOYSA-N triphenylstibine Chemical compound C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 HVYVMSPIJIWUNA-UHFFFAOYSA-N 0.000 description 3
- 229940054266 2-mercaptobenzothiazole Drugs 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229920003345 Elvax® Polymers 0.000 description 2
- CBFCDTFDPHXCNY-UHFFFAOYSA-N icosane Chemical compound CCCCCCCCCCCCCCCCCCCC CBFCDTFDPHXCNY-UHFFFAOYSA-N 0.000 description 2
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- OGVPXEPSTZMAFF-UHFFFAOYSA-N 1,1,1,2,2-pentabromoethane Chemical compound BrC(Br)C(Br)(Br)Br OGVPXEPSTZMAFF-UHFFFAOYSA-N 0.000 description 1
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical compound O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 description 1
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical class SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 description 1
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- YLNDNABNWASMFD-UHFFFAOYSA-N 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=CN1C YLNDNABNWASMFD-UHFFFAOYSA-N 0.000 description 1
- CYCKHTAVNBPQDB-UHFFFAOYSA-N 4-phenyl-3H-thiazole-2-thione Chemical compound S1C(S)=NC(C=2C=CC=CC=2)=C1 CYCKHTAVNBPQDB-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 235000000396 iron Nutrition 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/675—Compositions containing polyhalogenated compounds as photosensitive substances
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US438760A US3359105A (en) | 1965-03-10 | 1965-03-10 | Speed-increasing agents for an nu-vinyl amine and organic halogen dye former system |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1547942A1 true DE1547942A1 (de) | 1969-12-11 |
Family
ID=23741896
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661547942 Pending DE1547942A1 (de) | 1965-03-10 | 1966-02-24 | Lichtempfindliche Praeparate |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3359105A (enExample) |
| BE (1) | BE677396A (enExample) |
| DE (1) | DE1547942A1 (enExample) |
| GB (1) | GB1107279A (enExample) |
| NL (1) | NL6602979A (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL6516580A (enExample) * | 1964-12-30 | 1966-07-01 | ||
| US3495987A (en) * | 1965-09-03 | 1970-02-17 | Du Pont | Photopolymerizable products |
| US3980480A (en) * | 1970-09-01 | 1976-09-14 | Urbain Leopold Laridon | Photographic recording and reproduction of information photochromic composition containing polyhalogenated hydrocarbon, spiropyran compound and heterocyclic mercapto compound and the use thereof |
| GB1432771A (en) * | 1972-06-26 | 1976-04-22 | Agfa Gevaert | Recording method |
| US4036648A (en) * | 1975-06-30 | 1977-07-19 | International Business Machines Corporation | Highly conductive printing medium containing a halogenated hydrocarbon photoactivator and a tetrathiafulvalene or a related compound thereof |
| US4371566A (en) * | 1980-09-10 | 1983-02-01 | Panelgraphic Corporation | Abrasion resistant coating composition |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL256138A (enExample) * | 1959-09-22 | |||
| US3042518A (en) * | 1960-01-08 | 1962-07-03 | Horizons Inc | Light sensitive photographic compositions |
| NL263797A (enExample) * | 1960-04-19 | |||
| US3285744A (en) * | 1963-04-04 | 1966-11-15 | Horizons Inc | Photography |
| US3275443A (en) * | 1963-08-14 | 1966-09-27 | Horizons Inc | Anti-fogging agents for an n-vinyl, organic halogen, dye former system |
-
1965
- 1965-03-10 US US438760A patent/US3359105A/en not_active Expired - Lifetime
-
1966
- 1966-02-24 DE DE19661547942 patent/DE1547942A1/de active Pending
- 1966-03-04 BE BE677396D patent/BE677396A/xx unknown
- 1966-03-07 GB GB9929/66A patent/GB1107279A/en not_active Expired
- 1966-03-08 NL NL6602979A patent/NL6602979A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3359105A (en) | 1967-12-19 |
| BE677396A (enExample) | 1966-08-01 |
| NL6602979A (enExample) | 1966-09-12 |
| GB1107279A (en) | 1968-03-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2113833C2 (de) | Verwendung von 2'-Hydroxyphenyl-1,3,5-triazinen als Stabilisator gegen Ultraviolettstrahlung in photographischem Material | |
| DE2653669B2 (de) | Auskopiermaterial | |
| DE2329170A1 (de) | Photothermographisches aufzeichnungsmaterial | |
| DE1547942A1 (de) | Lichtempfindliche Praeparate | |
| DE2822495C2 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2230936B2 (enExample) | ||
| DE1283092B (de) | Lichtempfindliche Schicht | |
| DE1282448B (de) | Lichtempfindliche Schicht | |
| EP0056787B1 (de) | Photographisches Aufzeichnungsmaterial und Verfahren zu seiner Herstellung | |
| DE1522358A1 (de) | Sensibilisierung lichtempfindlicher Polymerer | |
| DE2332040A1 (de) | Thermographische aufzeichnungsverfahren | |
| DE2164275A1 (de) | Photographisches lichtempfindliches direktes Umkehrsilberhalogenidmaterial | |
| DE2162895C3 (de) | Lichtempfindliches Gemisch und seine Verwendung zur Herstellung von Kopierschichten und Verfahren zur Herstellung von Kopiermaterialien | |
| DE2165465A1 (de) | Silberhalogenidfreies lichtempfindliches Material | |
| EP0070254A1 (de) | Entwicklungsbeschleuniger enthaltendes photographisches Material | |
| DE1813001A1 (de) | Lichtempfindliche,photographische Halogensilberemulsion fuer Mikrofilme | |
| DE1813843A1 (de) | Photoempfindliches Praeparat und photographisches Verfahren | |
| DE1695112B2 (de) | Kationische komplex-merocyaninfarbstoffderivate und deren verwendung in einer photoleiter-komposition | |
| DE2221135B2 (de) | Elektrophotographisches AufzeichnungsmateriaL | |
| DE2147888A1 (de) | Spektral sensibilisierte photographische Silberhalogenidemulsion | |
| DE1296978B (de) | Verfahren zur Herstellung von Auskopierbildern durch Belichtung einer lichtempfindlichen Schicht | |
| DE2706532C3 (de) | Silberfreies, photolytisch Radikale bildendes lichtempfindliches Aufzeichnungsmaterial | |
| DE1572159C3 (de) | Zweikomponenten· Diazotypiematerial | |
| DE2331396A1 (de) | Herstellung von positiven farbbildern | |
| DE3528194A1 (de) | Optisch sensibilisierende farbstoffe |