DE1545887A1 - Verfahren zur Herstellung von neuen,kondensierten heterocyclischen Verbindungen - Google Patents
Verfahren zur Herstellung von neuen,kondensierten heterocyclischen VerbindungenInfo
- Publication number
- DE1545887A1 DE1545887A1 DE19651545887 DE1545887A DE1545887A1 DE 1545887 A1 DE1545887 A1 DE 1545887A1 DE 19651545887 DE19651545887 DE 19651545887 DE 1545887 A DE1545887 A DE 1545887A DE 1545887 A1 DE1545887 A1 DE 1545887A1
- Authority
- DE
- Germany
- Prior art keywords
- phenyl
- general formula
- acid
- parts
- benzoyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- 150000002391 heterocyclic compounds Chemical class 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 4
- -1 Nitro, amino, sulfo, sulfamoyl Chemical group 0.000 claims description 79
- 150000001875 compounds Chemical class 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000005153 alkyl sulfamoyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 125000005505 thiomorpholino group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 76
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 48
- 239000005711 Benzoic acid Substances 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- SOWOYMBNJVLWGP-UHFFFAOYSA-N isoindol-5-one Chemical compound O=C1C=CC2=CN=CC2=C1 SOWOYMBNJVLWGP-UHFFFAOYSA-N 0.000 description 25
- 238000006243 chemical reaction Methods 0.000 description 19
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 18
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 16
- DRZDPLDMEHBZDN-UHFFFAOYSA-N 2,3-dihydroisoindol-5-one Chemical compound O=C1C=CC2=CNCC2=C1 DRZDPLDMEHBZDN-UHFFFAOYSA-N 0.000 description 14
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 14
- 239000007858 starting material Substances 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 11
- 238000001953 recrystallisation Methods 0.000 description 11
- JTBBWRKSUYCPFY-UHFFFAOYSA-N 2,3-dihydro-1h-pyrimidin-4-one Chemical compound O=C1NCNC=C1 JTBBWRKSUYCPFY-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- FGTYTUFKXYPTML-UHFFFAOYSA-N 2-benzoylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 FGTYTUFKXYPTML-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 235000010233 benzoic acid Nutrition 0.000 description 9
- 239000000155 melt Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 8
- JLXZMLLNPNOODV-UHFFFAOYSA-N imidazol-4-one Chemical compound O=C1C=NC=N1 JLXZMLLNPNOODV-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 8
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 7
- 238000001816 cooling Methods 0.000 description 7
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- KMQLIDDEQAJAGJ-UHFFFAOYSA-N 4-oxo-4-phenylbutyric acid Chemical compound OC(=O)CCC(=O)C1=CC=CC=C1 KMQLIDDEQAJAGJ-UHFFFAOYSA-N 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- UVNXNSUKKOLFBM-UHFFFAOYSA-N imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=CSC2=NC=CN21 UVNXNSUKKOLFBM-UHFFFAOYSA-N 0.000 description 4
- 239000013067 intermediate product Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 3
- QDAWXRKTSATEOP-UHFFFAOYSA-N 2-acetylbenzoic acid Chemical compound CC(=O)C1=CC=CC=C1C(O)=O QDAWXRKTSATEOP-UHFFFAOYSA-N 0.000 description 3
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 3
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- YFOOEYJGMMJJLS-UHFFFAOYSA-N 1,8-diaminonaphthalene Chemical compound C1=CC(N)=C2C(N)=CC=CC2=C1 YFOOEYJGMMJJLS-UHFFFAOYSA-N 0.000 description 2
- ULSHPDVBNUSTIU-UHFFFAOYSA-N 2,6-dihydro-1h-pyridin-3-one Chemical compound O=C1CNCC=C1 ULSHPDVBNUSTIU-UHFFFAOYSA-N 0.000 description 2
- GVOYKJPMUUJXBS-UHFFFAOYSA-N 2-(aminomethyl)aniline Chemical compound NCC1=CC=CC=C1N GVOYKJPMUUJXBS-UHFFFAOYSA-N 0.000 description 2
- MLCPCDOOBNXTFB-UHFFFAOYSA-N 2-phenacylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1CC(=O)C1=CC=CC=C1 MLCPCDOOBNXTFB-UHFFFAOYSA-N 0.000 description 2
- XJHBTHNAMOUNRQ-UHFFFAOYSA-N 4-(4-tert-butylphenyl)-4-oxobutanoic acid Chemical compound CC(C)(C)C1=CC=C(C(=O)CCC(O)=O)C=C1 XJHBTHNAMOUNRQ-UHFFFAOYSA-N 0.000 description 2
- BTJVYXJKBFVHPY-UHFFFAOYSA-N 4-oxo-2,4-diphenylbutanoic acid Chemical compound C=1C=CC=CC=1C(C(=O)O)CC(=O)C1=CC=CC=C1 BTJVYXJKBFVHPY-UHFFFAOYSA-N 0.000 description 2
- SHKWSBAVRQZYLE-UHFFFAOYSA-N 5-oxo-5-phenylpentanoic acid Chemical compound OC(=O)CCCC(=O)C1=CC=CC=C1 SHKWSBAVRQZYLE-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- OWKYZAGJTTTXOK-UHFFFAOYSA-N n'-propylpropane-1,3-diamine Chemical compound CCCNCCCN OWKYZAGJTTTXOK-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- HOLGXWDGCVTMTB-UHFFFAOYSA-N 2-(2-aminophenyl)aniline Chemical compound NC1=CC=CC=C1C1=CC=CC=C1N HOLGXWDGCVTMTB-UHFFFAOYSA-N 0.000 description 1
- RWOPZYIDUDXHIB-UHFFFAOYSA-N 2-(2-benzoylphenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1C(=O)C1=CC=CC=C1 RWOPZYIDUDXHIB-UHFFFAOYSA-N 0.000 description 1
- AYBONBAUMJIFLG-UHFFFAOYSA-N 2-(2-hydroxy-5-methoxybenzoyl)benzoic acid Chemical compound COC1=CC=C(O)C(C(=O)C=2C(=CC=CC=2)C(O)=O)=C1 AYBONBAUMJIFLG-UHFFFAOYSA-N 0.000 description 1
- JQXCKOOKGDIOJS-UHFFFAOYSA-N 2-(2-hydroxy-5-methylbenzoyl)benzoic acid Chemical compound CC1=CC=C(O)C(C(=O)C=2C(=CC=CC=2)C(O)=O)=C1 JQXCKOOKGDIOJS-UHFFFAOYSA-N 0.000 description 1
- HNRPIUDTZLIYEC-UHFFFAOYSA-N 2-(2-hydroxybenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1O HNRPIUDTZLIYEC-UHFFFAOYSA-N 0.000 description 1
- NJXDTGLUPRKMFN-UHFFFAOYSA-N 2-(2-phenylacetyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)CC1=CC=CC=C1 NJXDTGLUPRKMFN-UHFFFAOYSA-N 0.000 description 1
- PJENQABXFDAWMJ-UHFFFAOYSA-N 2-(3-acetamido-4-chlorobenzoyl)benzoic acid Chemical compound C1=C(Cl)C(NC(=O)C)=CC(C(=O)C=2C(=CC=CC=2)C(O)=O)=C1 PJENQABXFDAWMJ-UHFFFAOYSA-N 0.000 description 1
- UKRADWWBRBBJLZ-UHFFFAOYSA-N 2-(4-chloro-3-sulfamoylbenzoyl)benzoic acid Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(=O)C=2C(=CC=CC=2)C(O)=O)=C1 UKRADWWBRBBJLZ-UHFFFAOYSA-N 0.000 description 1
- YWECCEXWKFHHQJ-UHFFFAOYSA-N 2-(4-chlorobenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(Cl)C=C1 YWECCEXWKFHHQJ-UHFFFAOYSA-N 0.000 description 1
- NBYNVBRXIUUSIG-UHFFFAOYSA-N 2-(4-phenylbenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(C=2C=CC=CC=2)C=C1 NBYNVBRXIUUSIG-UHFFFAOYSA-N 0.000 description 1
- BGLNPRRTOGJLIE-UHFFFAOYSA-N 2-(naphthalene-2-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1 BGLNPRRTOGJLIE-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- JEZQCHJJLYRNOZ-UHFFFAOYSA-N 2-benzoyl-3-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1C(=O)C1=CC=CC=C1 JEZQCHJJLYRNOZ-UHFFFAOYSA-N 0.000 description 1
- VQCAQTNPROLAJK-UHFFFAOYSA-N 2-benzoyl-3-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 VQCAQTNPROLAJK-UHFFFAOYSA-N 0.000 description 1
- FLPQLUGZLPSVOG-UHFFFAOYSA-N 2-benzoylcyclohexane-1-carboxylic acid Chemical compound OC(=O)C1CCCCC1C(=O)C1=CC=CC=C1 FLPQLUGZLPSVOG-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- HSUHAUVCDQLYEW-UHFFFAOYSA-N 2-butanoylbenzoic acid Chemical compound CCCC(=O)C1=CC=CC=C1C(O)=O HSUHAUVCDQLYEW-UHFFFAOYSA-N 0.000 description 1
- HVWHEGNJBXFNJR-UHFFFAOYSA-N 2-butylsulfanyl-4-oxo-4-phenylbutanoic acid Chemical compound CCCCSC(C(O)=O)CC(=O)C1=CC=CC=C1 HVWHEGNJBXFNJR-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- KDRUIMNNZBMLJR-UHFFFAOYSA-N 2-isopropylaminoethylamine Chemical compound CC(C)NCCN KDRUIMNNZBMLJR-UHFFFAOYSA-N 0.000 description 1
- YMYPZBOBAISUFL-UHFFFAOYSA-N 2-n-[2-(dimethylamino)ethyl]benzene-1,2-diamine Chemical compound CN(C)CCNC1=CC=CC=C1N YMYPZBOBAISUFL-UHFFFAOYSA-N 0.000 description 1
- RPKCLSMBVQLWIN-UHFFFAOYSA-N 2-n-methylbenzene-1,2-diamine Chemical compound CNC1=CC=CC=C1N RPKCLSMBVQLWIN-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- JYBOOAWVGOYQFU-UHFFFAOYSA-N 2-propanoylbenzoic acid Chemical compound CCC(=O)C1=CC=CC=C1C(O)=O JYBOOAWVGOYQFU-UHFFFAOYSA-N 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- GIRCIBDWDIADAZ-UHFFFAOYSA-N 3-(4-chlorophenyl)-3-methoxy-2-benzofuran-1-one Chemical compound O1C(=O)C2=CC=CC=C2C1(OC)C1=CC=C(Cl)C=C1 GIRCIBDWDIADAZ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- VXJLBRVMTGCMER-UHFFFAOYSA-N 3-chloro-2-(4-chlorobenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1C(=O)C1=CC=C(Cl)C=C1 VXJLBRVMTGCMER-UHFFFAOYSA-N 0.000 description 1
- CAYYZOKWYGGFAV-UHFFFAOYSA-N 3-chloro-3-phenyl-2-benzofuran-1-one Chemical compound O1C(=O)C2=CC=CC=C2C1(Cl)C1=CC=CC=C1 CAYYZOKWYGGFAV-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- OAKRTWYFZWBTSF-UHFFFAOYSA-N 3-hydroxy-3-phenyl-2-[2-(propan-2-ylamino)ethyl]isoindol-1-one Chemical compound CC(C)NCCN1C(=O)C2=CC=CC=C2C1(O)C1=CC=CC=C1 OAKRTWYFZWBTSF-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- WWROZRYLEDOUCU-UHFFFAOYSA-N 3-methoxy-3-phenyl-2-benzofuran-1-one Chemical compound O1C(=O)C2=CC=CC=C2C1(OC)C1=CC=CC=C1 WWROZRYLEDOUCU-UHFFFAOYSA-N 0.000 description 1
- QBQVEOIVSWQRDU-UHFFFAOYSA-N 4-(2-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=CC=C1O QBQVEOIVSWQRDU-UHFFFAOYSA-N 0.000 description 1
- HHVYNFFVNGZSNG-UHFFFAOYSA-N 4-(3-fluorophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=CC(F)=C1 HHVYNFFVNGZSNG-UHFFFAOYSA-N 0.000 description 1
- RBRZHQLWTDIFSE-UHFFFAOYSA-N 4-(3-hydroxyphenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=CC(O)=C1 RBRZHQLWTDIFSE-UHFFFAOYSA-N 0.000 description 1
- NZHPMZMVALJALH-UHFFFAOYSA-N 4-(3-methylphenyl)-4-oxobutanoic acid Chemical compound CC1=CC=CC(C(=O)CCC(O)=O)=C1 NZHPMZMVALJALH-UHFFFAOYSA-N 0.000 description 1
- VNDVLOPITGDGOG-UHFFFAOYSA-N 4-(3-nitrophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=CC([N+]([O-])=O)=C1 VNDVLOPITGDGOG-UHFFFAOYSA-N 0.000 description 1
- ZODFRCZNTXLDDW-UHFFFAOYSA-N 4-(4-bromophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=C(Br)C=C1 ZODFRCZNTXLDDW-UHFFFAOYSA-N 0.000 description 1
- AHVASTJJVAYFPY-UHFFFAOYSA-N 4-(4-chlorophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=C(Cl)C=C1 AHVASTJJVAYFPY-UHFFFAOYSA-N 0.000 description 1
- ZLHLIRYSBPOFQB-UHFFFAOYSA-N 4-(4-ethylphenyl)-4-oxobutanoic acid Chemical compound CCC1=CC=C(C(=O)CCC(O)=O)C=C1 ZLHLIRYSBPOFQB-UHFFFAOYSA-N 0.000 description 1
- WUYWHIAAQYQKPP-UHFFFAOYSA-N 4-(4-fluorophenyl)-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)C1=CC=C(F)C=C1 WUYWHIAAQYQKPP-UHFFFAOYSA-N 0.000 description 1
- FOMCCBCZVZXCMY-UHFFFAOYSA-N 4-(4-methoxyphenyl)-4-oxo-2-phenylbutanoic acid Chemical compound C1=CC(OC)=CC=C1C(=O)CC(C(O)=O)C1=CC=CC=C1 FOMCCBCZVZXCMY-UHFFFAOYSA-N 0.000 description 1
- OMTDIBZSUZNVJK-UHFFFAOYSA-N 4-(4-methoxyphenyl)-4-oxobutanoic acid Chemical compound COC1=CC=C(C(=O)CCC(O)=O)C=C1 OMTDIBZSUZNVJK-UHFFFAOYSA-N 0.000 description 1
- OEEUWZITKKSXAZ-UHFFFAOYSA-N 4-(4-methylphenyl)-4-oxobutanoic acid Chemical compound CC1=CC=C(C(=O)CCC(O)=O)C=C1 OEEUWZITKKSXAZ-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- DGRGLKZMKWPMOH-UHFFFAOYSA-N 4-methylbenzene-1,2-diamine Chemical compound CC1=CC=C(N)C(N)=C1 DGRGLKZMKWPMOH-UHFFFAOYSA-N 0.000 description 1
- CRTBQADLERFRSD-UHFFFAOYSA-N 4-oxo-4-(4-propan-2-ylphenyl)butanoic acid Chemical compound CC(C)C1=CC=C(C(=O)CCC(O)=O)C=C1 CRTBQADLERFRSD-UHFFFAOYSA-N 0.000 description 1
- GFJXNVQCYADSHX-UHFFFAOYSA-N 4-oxo-4-phenyl-2-phenylsulfanylbutanoic acid Chemical compound C=1C=CC=CC=1SC(C(=O)O)CC(=O)C1=CC=CC=C1 GFJXNVQCYADSHX-UHFFFAOYSA-N 0.000 description 1
- ADEKJVNFIQUGRR-UHFFFAOYSA-N 4h-pyridin-3-one Chemical compound O=C1CC=CN=C1 ADEKJVNFIQUGRR-UHFFFAOYSA-N 0.000 description 1
- QSTNFAHLTANHAC-UHFFFAOYSA-N 5-(4-methoxyphenyl)-5-oxo-2,3-diphenylpentanoic acid Chemical compound C1=CC(OC)=CC=C1C(=O)CC(C=1C=CC=CC=1)C(C(O)=O)C1=CC=CC=C1 QSTNFAHLTANHAC-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical class CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- AIEMSTCGCMIJTI-UHFFFAOYSA-N 6-oxo-6-phenylhexanoic acid Chemical compound OC(=O)CCCCC(=O)C1=CC=CC=C1 AIEMSTCGCMIJTI-UHFFFAOYSA-N 0.000 description 1
- KVUFIJYHYXWEGC-UHFFFAOYSA-N 7,8a-diphenyl-1,2,3,4,7,8-hexahydropyrrolo[1,2-a]pyrimidin-6-one Chemical compound N1CCCN2C(=O)C(C=3C=CC=CC=3)CC21C1=CC=CC=C1 KVUFIJYHYXWEGC-UHFFFAOYSA-N 0.000 description 1
- LQWNJFJCVAWCNN-UHFFFAOYSA-N 8a-(4-chlorophenyl)-1-ethyl-3,4,7,8-tetrahydro-2h-pyrrolo[1,2-a]pyrimidin-6-one Chemical compound CCN1CCCN2C(=O)CCC12C1=CC=C(Cl)C=C1 LQWNJFJCVAWCNN-UHFFFAOYSA-N 0.000 description 1
- UZHDFTCCJFETLP-UHFFFAOYSA-N 9a-phenyl-2,3,4,7,8,9-hexahydro-1h-pyrido[1,2-a]pyrimidin-6-one Chemical compound N1CCCN2C(=O)CCCC21C1=CC=CC=C1 UZHDFTCCJFETLP-UHFFFAOYSA-N 0.000 description 1
- WUFFYAFXNGRHNO-UHFFFAOYSA-N 9b-(4-chlorophenyl)-2,3-dihydro-1h-imidazo[2,1-a]isoindol-5-one Chemical compound C1=CC(Cl)=CC=C1C1(C2=CC=CC=C2C2=O)N2CCN1 WUFFYAFXNGRHNO-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- XQPNFUJVKKPMNB-UHFFFAOYSA-N CCCCSC(CC(C(C=C1)=CC=C1Cl)=O)C(O)=O Chemical compound CCCCSC(CC(C(C=C1)=CC=C1Cl)=O)C(O)=O XQPNFUJVKKPMNB-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- SPAGIJMPHSUYSE-UHFFFAOYSA-N Magnesium peroxide Chemical compound [Mg+2].[O-][O-] SPAGIJMPHSUYSE-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NQSMEZJWJJVYOI-UHFFFAOYSA-N Methyl 2-benzoylbenzoate Chemical compound COC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 NQSMEZJWJJVYOI-UHFFFAOYSA-N 0.000 description 1
- RMIVMBYMDISYFZ-UHFFFAOYSA-N N-methylputrescine Chemical compound CNCCCCN RMIVMBYMDISYFZ-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- LHIJANUOQQMGNT-UHFFFAOYSA-N aminoethylethanolamine Chemical compound NCCNCCO LHIJANUOQQMGNT-UHFFFAOYSA-N 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- ULEAQRIQMIQDPJ-UHFFFAOYSA-N butane-1,2-diamine Chemical compound CCC(N)CN ULEAQRIQMIQDPJ-UHFFFAOYSA-N 0.000 description 1
- RGTXVXDNHPWPHH-UHFFFAOYSA-N butane-1,3-diamine Chemical compound CC(N)CCN RGTXVXDNHPWPHH-UHFFFAOYSA-N 0.000 description 1
- GHWVXCQZPNWFRO-UHFFFAOYSA-N butane-2,3-diamine Chemical compound CC(N)C(C)N GHWVXCQZPNWFRO-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- DHZYXWMZLAKTQV-UHFFFAOYSA-N diazepin-3-one Chemical compound O=C1C=CC=CN=N1 DHZYXWMZLAKTQV-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- BRUOEHVDTAORQY-UHFFFAOYSA-N ethyl 4-oxo-4-phenylbutanoate Chemical compound CCOC(=O)CCC(=O)C1=CC=CC=C1 BRUOEHVDTAORQY-UHFFFAOYSA-N 0.000 description 1
- MHYCRLGKOZWVEF-UHFFFAOYSA-N ethyl acetate;hydrate Chemical compound O.CCOC(C)=O MHYCRLGKOZWVEF-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- NQBUERYLUPYOEL-UHFFFAOYSA-N isoindol-4-one Chemical compound O=C1C=CC=C2C=NC=C12 NQBUERYLUPYOEL-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 229960004995 magnesium peroxide Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- HLTMVWQXGLNLCU-UHFFFAOYSA-N n'-[2-(dimethylamino)ethyl]ethane-1,2-diamine Chemical compound CN(C)CCNCCN HLTMVWQXGLNLCU-UHFFFAOYSA-N 0.000 description 1
- MIFWXJNZWLWCGL-UHFFFAOYSA-N n'-butylpropane-1,3-diamine Chemical compound CCCCNCCCN MIFWXJNZWLWCGL-UHFFFAOYSA-N 0.000 description 1
- ONCPEIKLFULSSA-UHFFFAOYSA-N n'-ethylbutane-1,4-diamine Chemical compound CCNCCCCN ONCPEIKLFULSSA-UHFFFAOYSA-N 0.000 description 1
- SCZVXVGZMZRGRU-UHFFFAOYSA-N n'-ethylethane-1,2-diamine Chemical compound CCNCCN SCZVXVGZMZRGRU-UHFFFAOYSA-N 0.000 description 1
- ODGYWRBCQWKSSH-UHFFFAOYSA-N n'-ethylpropane-1,3-diamine Chemical compound CCNCCCN ODGYWRBCQWKSSH-UHFFFAOYSA-N 0.000 description 1
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 1
- QHJABUZHRJTCAR-UHFFFAOYSA-N n'-methylpropane-1,3-diamine Chemical compound CNCCCN QHJABUZHRJTCAR-UHFFFAOYSA-N 0.000 description 1
- KFDIDIIKNMZLRZ-UHFFFAOYSA-N n'-propan-2-ylpropane-1,3-diamine Chemical compound CC(C)NCCCN KFDIDIIKNMZLRZ-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- JGQDLMSXMOGEMC-UHFFFAOYSA-N pentane-2,4-diamine Chemical compound CC(N)CC(C)N JGQDLMSXMOGEMC-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- ZZYXNRREDYWPLN-UHFFFAOYSA-N pyridine-2,3-diamine Chemical compound NC1=CC=CN=C1N ZZYXNRREDYWPLN-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/06—Peri-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Cathode-Ray Tubes And Fluorescent Screens For Display (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH163264A CH471135A (de) | 1964-02-11 | 1964-02-11 | Verfahren zur Herstellung von neuen, kondensierten heterocyclischen Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1545887A1 true DE1545887A1 (de) | 1970-01-29 |
Family
ID=4214977
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651545887 Pending DE1545887A1 (de) | 1964-02-11 | 1965-02-10 | Verfahren zur Herstellung von neuen,kondensierten heterocyclischen Verbindungen |
Country Status (14)
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1067079A (en) * | 1976-07-22 | 1979-11-27 | Yamanouchi Pharmaceutical Co. | Nitrogen-containing heterobicyclic compounds |
| DE3730718A1 (de) * | 1987-09-12 | 1989-03-23 | Basf Ag | Tetracyclische chinazolinderivate, herstellung und verwendung |
| US5856508A (en) * | 1990-05-08 | 1999-01-05 | Ciba Specialty Chemicals Corporation | Fluorescent yellow 1,2,3,4-Tetrachloro-11H-Isoindolo- 2,1-A!-Benzimidazol-11-one pigments |
| EP0475908A1 (de) * | 1990-09-14 | 1992-03-18 | Ciba-Geigy Ag | Chromogene Lactamverbindungen und ihre Herstellung und Verwendung |
| ATE496920T1 (de) * | 2003-12-24 | 2011-02-15 | Biota Scient Management | Polycyclische mittel zur behandlung von infektionen mit dem respiratory syncytial virus |
| TWI423972B (zh) | 2006-09-28 | 2014-01-21 | Biota Scient Management | 治療呼吸系融合細胞病毒感染之多環劑 |
| TWI508968B (zh) | 2010-02-08 | 2015-11-21 | Biota Scient Management | 用於治療呼吸道融合性病毒感染的化合物 |
| US8796303B2 (en) | 2010-11-26 | 2014-08-05 | Biota Scientific Management Pty Ltd. | Imidazo[2,1-G][1,7]naphthyridines for treating respiratory syncytial virus infections |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3334113A (en) * | 1963-12-18 | 1967-08-01 | Sandoz Ag | 9b-phenyl-1, 2, 3, 9b-tetrahydro-5h-imidazo[2,1-a]isoindol-5-ones |
| US3334099A (en) * | 1965-03-31 | 1967-08-01 | Sandoz Ag | Novel pyrrolo-diazepines, pyrrolo-imidazolidines, and pyrrolo-pyrimidines |
-
0
- NL NL126596D patent/NL126596C/xx active
-
1964
- 1964-02-11 CH CH163264A patent/CH471135A/de not_active IP Right Cessation
-
1965
- 1965-02-02 US US04/429,911 patent/US4058529A/en not_active Expired - Lifetime
- 1965-02-10 BE BE659530D patent/BE659530A/xx unknown
- 1965-02-10 AT AT118665A patent/AT251597B/de active
- 1965-02-10 DE DE19651545887 patent/DE1545887A1/de active Pending
- 1965-02-10 FR FR5056A patent/FR1460524A/fr not_active Expired
- 1965-02-10 NO NO156726A patent/NO117857B/no unknown
- 1965-02-10 IL IL22957A patent/IL22957A/xx unknown
- 1965-02-10 NL NL6501647A patent/NL6501647A/xx unknown
- 1965-02-10 BR BR167070/65A patent/BR6567070D0/pt unknown
- 1965-02-10 ES ES0309174A patent/ES309174A1/es not_active Expired
- 1965-02-10 SE SE01715/65A patent/SE329400B/xx unknown
- 1965-02-10 GB GB5689/65A patent/GB1038735A/en not_active Expired
- 1965-02-10 DK DK68565AA patent/DK116797B/da unknown
- 1965-05-10 FR FR16397A patent/FR4420M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1460524A (fr) | 1966-12-02 |
| CH471135A (de) | 1969-04-15 |
| NL6501647A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1965-08-12 |
| US4058529A (en) | 1977-11-15 |
| SE329400B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1970-10-12 |
| ES309174A1 (es) | 1965-12-16 |
| NL126596C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| IL22957A (en) | 1969-01-29 |
| NO117857B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1969-10-06 |
| GB1038735A (en) | 1966-08-10 |
| AT251597B (de) | 1967-01-10 |
| BE659530A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1965-08-10 |
| BR6567070D0 (pt) | 1973-08-14 |
| DK116797B (da) | 1970-02-16 |
| FR4420M (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1966-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4058558A (en) | Aromatic keto acids and derivatives having analgetic, antiinflammatory, and hypocholesterolemizing action | |
| US4008323A (en) | Method of reducing cholesterol using certain aromatic keto acids | |
| DE69125308T2 (de) | Indolderivate | |
| DE1795613B2 (de) | Indolylessigsaeuren, verfahren zu ihrer herstellung und arzneimittel | |
| US5693795A (en) | Process for the manufacture of 4H-imidazo 1,5-A! 1,4!benzodiazepines | |
| DE69318563T2 (de) | 5H,10H-IMIDAZO[1,2-a]INDENO[1,2-e]PYRAZIN-4-ONE DERIVATE, IHRE HERSTELLUNG UND DIE SIE ENTHALTENDEN ARZNEIMITTEL | |
| DE2851028A1 (de) | Neue indolo eckige klammer auf 2.3-a eckige klammer zu chinolizidine, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische zubereitung | |
| DE1545887A1 (de) | Verfahren zur Herstellung von neuen,kondensierten heterocyclischen Verbindungen | |
| EP0386628B1 (de) | Verfahren zur Herstellung von Indolcarbonsäurederivaten | |
| DE2234651A1 (de) | Eckige klammer auf 1-(p-chlorbenzoyl)5-methoxy-2-methyl-3-indol eckige klammer zu acetoxyessigsaeure, verfahren zu ihrer herstellung sowie ihre verwendung in arzneimitteln | |
| FR2717812A1 (fr) | Indeno[1,2-e]pyrazine-4-ones, leur préparation et les médicaments les contenant. | |
| CH624670A5 (en) | Process for preparing an oxoazetidine derivative as a stereospecific intermediate for the synthesis of cephalosporins | |
| DE1815802A1 (de) | Verfahren zur Herstellung von substituierten Phenylessigsaeuren | |
| CH520680A (de) | Verfahren zur Herstellung neuer Mutterkornpeptidalkaloide | |
| DE69028355T2 (de) | 4,5-Dihydro-6H-imidazo[4,5,1-ij]chinolin-6-on-6-oxim-O-sulfonsäurederivate | |
| DE1695604A1 (de) | N'-Phenylindolinderivate und Verfahren zu deren Herstellung | |
| US3565943A (en) | 1-indancarboxylic acids and derivatives | |
| DE2004038C3 (de) | 5-Cyclohexyl-1-indancarbonsäuren,,deren Niedrigalkyl- und tert.-Aminoniedrigalkylester, nicht-toxische pharmakologisch verträgliche Salze und Verfahren zu deren Herstellung | |
| CH524612A (de) | Verfahren zur Herstellung von neuen Imidazolderivaten | |
| DE1545885A1 (de) | Verfahren zur Herstellung von neuen,kondensierten heterocyclischen Verbindungen | |
| DD234012A5 (de) | Verfahre zur herstellung neuer imidazolderivaten | |
| US4255573A (en) | Imidazoindole derivatives and pharmaceutical compositions comprising imidazoindole derivatives | |
| DE1927452C3 (de) | 2,3-Dihydrobenzofuran-2-carbonsäuren und deren Salze mit pharmakologisch verträglichen anorganischen oder organischen Basen und Verfahren zur deren Herstellung sowie Arzneimittel mit einem Gehalt an diesen Verbindungen | |
| DE1795758A1 (de) | Verfahren zur herstellung von 5hydroxy-5-phenyl-2,3-dihydro-5h-imidazo eckige klammer auf 2,1-a eckige klammer zu isoindolen | |
| DD150897A5 (de) | Verfahren zur herstellung von neuen pyrazolo(1,5-c)chinazolinderivaten |