DE1543953A1 - Verfahren zur Hydroxylierung von aromatischen Verbindungen - Google Patents
Verfahren zur Hydroxylierung von aromatischen VerbindungenInfo
- Publication number
- DE1543953A1 DE1543953A1 DE19661543953 DE1543953A DE1543953A1 DE 1543953 A1 DE1543953 A1 DE 1543953A1 DE 19661543953 DE19661543953 DE 19661543953 DE 1543953 A DE1543953 A DE 1543953A DE 1543953 A1 DE1543953 A1 DE 1543953A1
- Authority
- DE
- Germany
- Prior art keywords
- product
- hydroxylated
- aromatic
- hydroquinone
- hydrogen fluoride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 26
- 150000001491 aromatic compounds Chemical class 0.000 title claims description 23
- 238000005805 hydroxylation reaction Methods 0.000 title description 4
- 230000033444 hydroxylation Effects 0.000 title description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 57
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 37
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 37
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 32
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 claims description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 18
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 10
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 9
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 claims description 8
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical class C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 238000011084 recovery Methods 0.000 claims description 5
- WJQOZHYUIDYNHM-UHFFFAOYSA-N 2-tert-Butylphenol Chemical compound CC(C)(C)C1=CC=CC=C1O WJQOZHYUIDYNHM-UHFFFAOYSA-N 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 claims description 4
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 claims description 4
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical class C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- SPLGZANLVHBDCC-UHFFFAOYSA-N 1-tert-butylnaphthalene Chemical compound C1=CC=C2C(C(C)(C)C)=CC=CC2=C1 SPLGZANLVHBDCC-UHFFFAOYSA-N 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- WFEHCZZKICVZRS-BGTYHANMSA-N (2R,3R,4R,5S)-6,6-diphenylhexane-1,2,3,4,5-pentol Chemical compound C1(=CC=CC=C1)C([C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C1=CC=CC=C1 WFEHCZZKICVZRS-BGTYHANMSA-N 0.000 claims description 2
- QHTJSSMHBLGUHV-UHFFFAOYSA-N 2-methylbutan-2-ylbenzene Chemical compound CCC(C)(C)C1=CC=CC=C1 QHTJSSMHBLGUHV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000001896 cresols Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 claims description 2
- QPVRKFOKCKORDP-UHFFFAOYSA-N 1,3-dimethylcyclohexa-2,4-dien-1-ol Chemical compound CC1=CC(C)(O)CC=C1 QPVRKFOKCKORDP-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 229920005547 polycyclic aromatic hydrocarbon Polymers 0.000 claims 1
- 229960002920 sorbitol Drugs 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 72
- 229960002163 hydrogen peroxide Drugs 0.000 description 23
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 22
- 239000007795 chemical reaction product Substances 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- -1 hydroxyl aromatic compounds Chemical class 0.000 description 10
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 229960001867 guaiacol Drugs 0.000 description 4
- 229910001220 stainless steel Inorganic materials 0.000 description 4
- 239000010935 stainless steel Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- SZURZHQMGVKJLV-UHFFFAOYSA-N 1,2-ditert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1C(C)(C)C SZURZHQMGVKJLV-UHFFFAOYSA-N 0.000 description 3
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229950011260 betanaphthol Drugs 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- OOWNNCMFKFBNOF-UHFFFAOYSA-N 1,4-ditert-butylbenzene Chemical compound CC(C)(C)C1=CC=C(C(C)(C)C)C=C1 OOWNNCMFKFBNOF-UHFFFAOYSA-N 0.000 description 2
- QGOXFEKKDFMNLK-UHFFFAOYSA-N 1-(2-methylbutan-2-yl)naphthalene Chemical compound C1=CC=C2C(C(C)(C)CC)=CC=CC2=C1 QGOXFEKKDFMNLK-UHFFFAOYSA-N 0.000 description 2
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- PGSWEKYNAOWQDF-UHFFFAOYSA-N 3-methylcatechol Chemical compound CC1=CC=CC(O)=C1O PGSWEKYNAOWQDF-UHFFFAOYSA-N 0.000 description 2
- GPJJASIJVRXZFI-UHFFFAOYSA-N 4-methoxybenzene-1,3-diol Chemical compound COC1=CC=C(O)C=C1O GPJJASIJVRXZFI-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000003205 fragrance Substances 0.000 description 2
- 238000001030 gas--liquid chromatography Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 239000010687 lubricating oil Substances 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- ODLMAHJVESYWTB-UHFFFAOYSA-N propylbenzene Chemical compound CCCC1=CC=CC=C1 ODLMAHJVESYWTB-UHFFFAOYSA-N 0.000 description 2
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- IJAPRTGBEXDTEZ-UHFFFAOYSA-N 1,2-bis(2-methylbutan-2-yl)naphthalene Chemical compound C1=CC=CC2=C(C(C)(C)CC)C(C(C)(C)CC)=CC=C21 IJAPRTGBEXDTEZ-UHFFFAOYSA-N 0.000 description 1
- GOQBFDVVKDFHPN-UHFFFAOYSA-N 1,2-ditert-butylnaphthalene Chemical compound C1=CC=CC2=C(C(C)(C)C)C(C(C)(C)C)=CC=C21 GOQBFDVVKDFHPN-UHFFFAOYSA-N 0.000 description 1
- QPVFDSSHKSRTLM-UHFFFAOYSA-N 1-(2,4,4-trimethylpentan-2-yl)anthracene Chemical compound C(C)(C)(CC(C)(C)C)C1=CC=CC2=CC3=CC=CC=C3C=C12 QPVFDSSHKSRTLM-UHFFFAOYSA-N 0.000 description 1
- PHQSULCDCYRUPD-UHFFFAOYSA-N 1-(2,4,4-trimethylpentan-2-yl)phenanthrene Chemical compound C(C)(C)(CC(C)(C)C)C1=CC=CC=2C3=CC=CC=C3C=CC12 PHQSULCDCYRUPD-UHFFFAOYSA-N 0.000 description 1
- IEPQMRPKQUBXNQ-UHFFFAOYSA-N 1-(2-methylhexan-2-yl)anthracene Chemical compound CCCCC(C)(C)C1=CC=CC2=CC3=CC=CC=C3C=C12 IEPQMRPKQUBXNQ-UHFFFAOYSA-N 0.000 description 1
- MICQNGGYVXZJIG-UHFFFAOYSA-N 1-(2-methylhexan-2-yl)phenanthrene Chemical compound C(C)(C)(CCCC)C1=CC=CC=2C3=CC=CC=C3C=CC12 MICQNGGYVXZJIG-UHFFFAOYSA-N 0.000 description 1
- VYEUEBBQWWFYQS-UHFFFAOYSA-N 1-(2-methylpentan-2-yl)anthracene Chemical compound C(C)(C)(CCC)C1=CC=CC2=CC3=CC=CC=C3C=C12 VYEUEBBQWWFYQS-UHFFFAOYSA-N 0.000 description 1
- OSIGJGFTADMDOB-UHFFFAOYSA-N 1-Methoxy-3-methylbenzene Chemical compound COC1=CC=CC(C)=C1 OSIGJGFTADMDOB-UHFFFAOYSA-N 0.000 description 1
- ZBTMRBYMKUEVEU-UHFFFAOYSA-N 1-bromo-4-methylbenzene Chemical compound CC1=CC=C(Br)C=C1 ZBTMRBYMKUEVEU-UHFFFAOYSA-N 0.000 description 1
- CVGAWKYSRYXQOI-UHFFFAOYSA-N 1-chloro-2-ethylbenzene Chemical compound CCC1=CC=CC=C1Cl CVGAWKYSRYXQOI-UHFFFAOYSA-N 0.000 description 1
- ALLIZEAXNXSFGD-UHFFFAOYSA-N 1-methyl-2-phenylbenzene Chemical group CC1=CC=CC=C1C1=CC=CC=C1 ALLIZEAXNXSFGD-UHFFFAOYSA-N 0.000 description 1
- HTICYVWLHLMMPF-UHFFFAOYSA-N 1-methyl-4-(2-methylbutan-2-yl)benzene Chemical compound CCC(C)(C)C1=CC=C(C)C=C1 HTICYVWLHLMMPF-UHFFFAOYSA-N 0.000 description 1
- BBOCZFGVXFNCTC-UHFFFAOYSA-N 1-methylnaphthalen-2-ol Chemical compound C1=CC=C2C(C)=C(O)C=CC2=C1 BBOCZFGVXFNCTC-UHFFFAOYSA-N 0.000 description 1
- HMRNLPCZVBVKLZ-UHFFFAOYSA-N 1-tert-butyl-2-chlorobenzene Chemical compound CC(C)(C)C1=CC=CC=C1Cl HMRNLPCZVBVKLZ-UHFFFAOYSA-N 0.000 description 1
- QCWXDVFBZVHKLV-UHFFFAOYSA-N 1-tert-butyl-4-methylbenzene Chemical compound CC1=CC=C(C(C)(C)C)C=C1 QCWXDVFBZVHKLV-UHFFFAOYSA-N 0.000 description 1
- NSTXJOFRULEXOV-UHFFFAOYSA-N 1-tert-butylanthracene Chemical compound C1=CC=C2C=C3C(C(C)(C)C)=CC=CC3=CC2=C1 NSTXJOFRULEXOV-UHFFFAOYSA-N 0.000 description 1
- XEEFZWPIHKBYSX-UHFFFAOYSA-N 1-tert-butylphenanthrene Chemical compound C1=CC2=CC=CC=C2C2=C1C(C(C)(C)C)=CC=C2 XEEFZWPIHKBYSX-UHFFFAOYSA-N 0.000 description 1
- NKTOLZVEWDHZMU-UHFFFAOYSA-N 2,5-xylenol Chemical group CC1=CC=C(C)C(O)=C1 NKTOLZVEWDHZMU-UHFFFAOYSA-N 0.000 description 1
- BGRKGHSKCFAPCL-UHFFFAOYSA-N 2-(2-methylbutan-2-yl)phenol Chemical compound CCC(C)(C)C1=CC=CC=C1O BGRKGHSKCFAPCL-UHFFFAOYSA-N 0.000 description 1
- MPCHQYWZAVTABQ-UHFFFAOYSA-N 2-(chloromethyl)naphthalene Chemical compound C1=CC=CC2=CC(CCl)=CC=C21 MPCHQYWZAVTABQ-UHFFFAOYSA-N 0.000 description 1
- AFXFNLYMSGDWJO-UHFFFAOYSA-N 2-ethylphenol 2-phenylethanol Chemical compound C(C)C1=C(C=CC=C1)O.OCCC1=CC=CC=C1 AFXFNLYMSGDWJO-UHFFFAOYSA-N 0.000 description 1
- GPLIMIJPIZGPIF-UHFFFAOYSA-N 2-hydroxy-1,4-benzoquinone Chemical compound OC1=CC(=O)C=CC1=O GPLIMIJPIZGPIF-UHFFFAOYSA-N 0.000 description 1
- IULJSGIJJZZUMF-UHFFFAOYSA-N 2-hydroxybenzenesulfonic acid Chemical compound OC1=CC=CC=C1S(O)(=O)=O IULJSGIJJZZUMF-UHFFFAOYSA-N 0.000 description 1
- DTFKRVXLBCAIOZ-UHFFFAOYSA-N 2-methylanisole Chemical compound COC1=CC=CC=C1C DTFKRVXLBCAIOZ-UHFFFAOYSA-N 0.000 description 1
- PIUUDKDOAUICQP-UHFFFAOYSA-N 2-methylpentan-2-ylbenzene Chemical compound CCCC(C)(C)C1=CC=CC=C1 PIUUDKDOAUICQP-UHFFFAOYSA-N 0.000 description 1
- VGMJYYDKPUPTID-UHFFFAOYSA-N 4-ethylbenzene-1,3-diol Chemical compound CCC1=CC=C(O)C=C1O VGMJYYDKPUPTID-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910015475 FeF 2 Inorganic materials 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- PGAZAORSURCSOS-UHFFFAOYSA-N benzene-1,2-diol;phenol Chemical compound OC1=CC=CC=C1.OC1=CC=CC=C1O PGAZAORSURCSOS-UHFFFAOYSA-N 0.000 description 1
- WPUJEWVVTKLMQI-UHFFFAOYSA-N benzene;ethoxyethane Chemical compound CCOCC.C1=CC=CC=C1 WPUJEWVVTKLMQI-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- OCKPCBLVNKHBMX-UHFFFAOYSA-N butylbenzene Chemical compound CCCCC1=CC=CC=C1 OCKPCBLVNKHBMX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical class NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- IPJKJLXEVHOKSE-UHFFFAOYSA-L manganese dihydroxide Chemical compound [OH-].[OH-].[Mn+2] IPJKJLXEVHOKSE-UHFFFAOYSA-L 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- NRZWYNLTFLDQQX-UHFFFAOYSA-N p-tert-Amylphenol Chemical compound CCC(C)(C)C1=CC=C(O)C=C1 NRZWYNLTFLDQQX-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical compound OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- DSNYFFJTZPIKFZ-UHFFFAOYSA-N propoxybenzene Chemical compound CCCOC1=CC=CC=C1 DSNYFFJTZPIKFZ-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229940079877 pyrogallol Drugs 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/60—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by oxidation reactions introducing directly hydroxy groups on a =CH-group belonging to a six-membered aromatic ring with the aid of other oxidants than molecular oxygen or their mixtures with molecular oxygen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/50—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions decreasing the number of carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/18—Preparation of ethers by reactions not forming ether-oxygen bonds
- C07C41/26—Preparation of ethers by reactions not forming ether-oxygen bonds by introduction of hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50685065A | 1965-11-08 | 1965-11-08 | |
| US506851A US3407237A (en) | 1965-11-08 | 1965-11-08 | Preparation of hydroxylated aromatic compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1543953A1 true DE1543953A1 (de) | 1970-02-12 |
Family
ID=27055603
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661543953 Pending DE1543953A1 (de) | 1965-11-08 | 1966-11-03 | Verfahren zur Hydroxylierung von aromatischen Verbindungen |
Country Status (5)
| Country | Link |
|---|---|
| US (2) | US3461170A (OSRAM) |
| DE (1) | DE1543953A1 (OSRAM) |
| FR (1) | FR1498818A (OSRAM) |
| GB (1) | GB1158173A (OSRAM) |
| NL (1) | NL6615739A (OSRAM) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3481989A (en) * | 1967-06-01 | 1969-12-02 | Universal Oil Prod Co | Substitution of aromatic compounds |
| US3692842A (en) * | 1971-02-12 | 1972-09-19 | Stephen N Massie | Hydroxylation of aromatic compounds |
| US3953530A (en) * | 1972-01-10 | 1976-04-27 | S. A. Texaco Belgium N.V. | Process for making o- and p-chlorophenols |
| FR2182668A1 (OSRAM) * | 1972-05-03 | 1973-12-14 | Rhone Poulenc Sa | |
| JPS5217015B2 (OSRAM) * | 1973-01-31 | 1977-05-12 | ||
| FR2318851A1 (fr) * | 1975-07-25 | 1977-02-18 | Rhone Poulenc Ind | Procede d'hydroxylation de composes aromatiques |
| US4419528A (en) * | 1979-10-05 | 1983-12-06 | Pcuk - Produits Chimiques Ugine Kuhlmann | Regioselective preparation of α- or β-naphthol |
| DE2942366A1 (de) * | 1979-10-19 | 1981-04-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung mehrwertiger phenole |
| US4588845A (en) * | 1983-07-18 | 1986-05-13 | Fmc Corporation | Oxidation of unsaturated organic compounds with hydrogen peroxide |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2644014A (en) * | 1949-12-30 | 1953-06-30 | Hercules Powder Co Ltd | Phenol production |
| GB723454A (en) * | 1952-06-19 | 1955-02-09 | Rhone Poulenc Sa | Improvements in or relating to the manufacture of hydroquinone |
| US2700689A (en) * | 1953-03-09 | 1955-01-25 | Standard Oil Co | Disproportionation of mono- and ditertiary-butylbenzenes |
| US2803681A (en) * | 1955-07-26 | 1957-08-20 | Standard Oil Co | Tetramethylbenzene production |
-
1965
- 1965-11-08 US US506850A patent/US3461170A/en not_active Expired - Lifetime
- 1965-11-08 US US506851A patent/US3407237A/en not_active Expired - Lifetime
-
1966
- 1966-11-03 DE DE19661543953 patent/DE1543953A1/de active Pending
- 1966-11-04 GB GB49521/66A patent/GB1158173A/en not_active Expired
- 1966-11-07 FR FR82704A patent/FR1498818A/fr not_active Expired
- 1966-11-08 NL NL6615739A patent/NL6615739A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3407237A (en) | 1968-10-22 |
| GB1158173A (en) | 1969-07-16 |
| NL6615739A (OSRAM) | 1967-05-09 |
| FR1498818A (fr) | 1967-10-20 |
| US3461170A (en) | 1969-08-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1543953A1 (de) | Verfahren zur Hydroxylierung von aromatischen Verbindungen | |
| CH668709A5 (de) | Verfahren zur enthalogenierung von polyhalogenierten aliphatischen und aromatischen verbindungen. | |
| DE2633302A1 (de) | Verfahren zur hydroxylierung von aromatischen verbindungen | |
| DE2167040C2 (de) | Verfahren zur Herstellung von Brenzcatechin und Hydrochinon | |
| DE3545196C2 (OSRAM) | ||
| DE674984C (de) | Verfahren zur Herstellung von Reaktionsprodukten des Styrols | |
| EP0113798A1 (de) | Verfahren zur Herstellung von Alkoholgemischen aus epoxidierten Fettalkoholen | |
| EP0022533B2 (de) | Verfahren zur Herstellung mehrwertiger Phenole | |
| EP0025519A1 (de) | Verfahren zur Herstellung von 2-Alkyl- bzw. 2-Arylthiomethylphenol | |
| DE60213998T2 (de) | Verfahren zur herstellung von 2 oxocarbonsäureestern | |
| EP0055387B1 (de) | Verfahren zur Herstellung von Epoxiden | |
| DE1262282B (de) | Verfahren zur Herstellung von Phenolen durch Oxydieren von aromatischen Kohlenwasserstoffen | |
| CH630590A5 (de) | Verfahren zur herstellung eines gemisches von brenzcatechin und hydrochinon. | |
| DE2658866A1 (de) | Verfahren zur herstellung von mehrwertigen phenolen | |
| DE1543953C (de) | Verfahren zur Kernhydroxylierung einer aromatischen Verbindung | |
| EP0013924B1 (de) | Verfahren zur Herstellung von Alkylarylethern | |
| DE3130428C2 (de) | Verfahren zur tert. Butylierung von hydroxyaromatischen Verbindungen | |
| DE1543016A1 (de) | Verfahren zur Herstellung von Alkoholen | |
| EP0027593B1 (de) | Verfahren zur Herstellung mehrwertiger Phenole | |
| DE2027599A1 (de) | Verfahren zur Herstellung von substi tuierten Acrylsaureamiden | |
| EP0009851A1 (de) | Verfahren zur Herstellung von araliphatischen Dihydroperoxiden | |
| DE1543953B (de) | Verfahren zur Kernhydroxyherung einer aromatischen Verbindung | |
| EP0005574A1 (de) | Verfahren zur Herstellung eines Alkalimetallbenzoats neben einem Benzylalkohol | |
| DE2215452A1 (OSRAM) | ||
| DE1643985C3 (de) | S-lsopropyl^nitro-phenyl-dimethyl-carbinol und 3,5-Diisopropyl-4-nitro-phenyldimethylcarbinol und Verfahren zu deren Herstellung |