DE1508821A1 - Giessereiverfahren - Google Patents
GiessereiverfahrenInfo
- Publication number
- DE1508821A1 DE1508821A1 DE19661508821 DE1508821A DE1508821A1 DE 1508821 A1 DE1508821 A1 DE 1508821A1 DE 19661508821 DE19661508821 DE 19661508821 DE 1508821 A DE1508821 A DE 1508821A DE 1508821 A1 DE1508821 A1 DE 1508821A1
- Authority
- DE
- Germany
- Prior art keywords
- mold
- metal
- magnesium
- cavity
- molten metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 27
- 229910052751 metal Inorganic materials 0.000 claims description 60
- 239000002184 metal Substances 0.000 claims description 60
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 34
- 229910052749 magnesium Inorganic materials 0.000 claims description 33
- 239000011777 magnesium Substances 0.000 claims description 33
- 239000000155 melt Substances 0.000 claims description 19
- 229910045601 alloy Inorganic materials 0.000 claims description 11
- 239000000956 alloy Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 238000001816 cooling Methods 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 238000005266 casting Methods 0.000 description 24
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 22
- 229910052742 iron Inorganic materials 0.000 description 11
- 229910010271 silicon carbide Inorganic materials 0.000 description 11
- 229910000831 Steel Inorganic materials 0.000 description 10
- 239000002131 composite material Substances 0.000 description 10
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 10
- 239000010959 steel Substances 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- 239000007789 gas Substances 0.000 description 8
- 229910052782 aluminium Inorganic materials 0.000 description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 7
- 238000007711 solidification Methods 0.000 description 6
- 230000008023 solidification Effects 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 229910000861 Mg alloy Inorganic materials 0.000 description 5
- 150000002739 metals Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000011148 porous material Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 210000002268 wool Anatomy 0.000 description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- 239000006061 abrasive grain Substances 0.000 description 4
- 239000010439 graphite Substances 0.000 description 4
- 229910002804 graphite Inorganic materials 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000009423 ventilation Methods 0.000 description 4
- 229910052725 zinc Inorganic materials 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 238000005058 metal casting Methods 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- 229910001018 Cast iron Inorganic materials 0.000 description 2
- 239000000571 coke Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000003870 refractory metal Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- YPFNIPKMNMDDDB-UHFFFAOYSA-K 2-[2-[bis(carboxylatomethyl)amino]ethyl-(2-hydroxyethyl)amino]acetate;iron(3+) Chemical compound [Fe+3].OCCN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O YPFNIPKMNMDDDB-UHFFFAOYSA-K 0.000 description 1
- 229920000049 Carbon (fiber) Polymers 0.000 description 1
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000004917 carbon fiber Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000004512 die casting Methods 0.000 description 1
- 238000005553 drilling Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- -1 etc. Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910021385 hard carbon Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- MHKWSJBPFXBFMX-UHFFFAOYSA-N iron magnesium Chemical compound [Mg].[Fe] MHKWSJBPFXBFMX-UHFFFAOYSA-N 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910001338 liquidmetal Inorganic materials 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000007666 vacuum forming Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D21/00—Casting non-ferrous metals or metallic compounds so far as their metallurgical properties are of importance for the casting procedure; Selection of compositions therefor
- B22D21/002—Castings of light metals
- B22D21/007—Castings of light metals with low melting point, e.g. Al 659 degrees C, Mg 650 degrees C
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D17/00—Pressure die casting or injection die casting, i.e. casting in which the metal is forced into a mould under high pressure
- B22D17/14—Machines with evacuated die cavity
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B22—CASTING; POWDER METALLURGY
- B22D—CASTING OF METALS; CASTING OF OTHER SUBSTANCES BY THE SAME PROCESSES OR DEVICES
- B22D18/00—Pressure casting; Vacuum casting
- B22D18/06—Vacuum casting, i.e. making use of vacuum to fill the mould
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Manufacture Of Alloys Or Alloy Compounds (AREA)
- Mold Materials And Core Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US437581A US3364976A (en) | 1965-03-05 | 1965-03-05 | Method of casting employing self-generated vacuum |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1508821A1 true DE1508821A1 (de) | 1969-11-06 |
Family
ID=23737027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661508821 Pending DE1508821A1 (de) | 1965-03-05 | 1966-02-04 | Giessereiverfahren |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3364976A (enrdf_load_stackoverflow) |
| BE (1) | BE677385A (enrdf_load_stackoverflow) |
| DE (1) | DE1508821A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1144873A (enrdf_load_stackoverflow) |
| NL (1) | NL6602441A (enrdf_load_stackoverflow) |
| NO (1) | NO115451B (enrdf_load_stackoverflow) |
| SE (1) | SE340508B (enrdf_load_stackoverflow) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3396777A (en) * | 1966-06-01 | 1968-08-13 | Dow Chemical Co | Process for impregnating porous solids |
| US3529655A (en) * | 1966-10-03 | 1970-09-22 | Dow Chemical Co | Method of making composites of magnesium and silicon carbide whiskers |
| US3867177A (en) * | 1972-01-05 | 1975-02-18 | Dow Chemical Co | Impregnation of porous body with metal |
| US3849879A (en) * | 1973-10-01 | 1974-11-26 | Dow Chemical Co | Method of making a composite magnesium-titanium conductor |
| US3992200A (en) * | 1975-04-07 | 1976-11-16 | Crucible Inc. | Method of hot pressing using a getter |
| JPS602149B2 (ja) * | 1980-07-30 | 1985-01-19 | トヨタ自動車株式会社 | 複合材料の製造方法 |
| US4492265A (en) * | 1980-08-04 | 1985-01-08 | Toyota Jidosha Kabushiki Kaisha | Method for production of composite material using preheating of reinforcing material |
| DE3109602C2 (de) * | 1981-01-31 | 1983-01-13 | Klöckner-Werke AG, 4100 Duisburg | Verfahren und Vorrichtung zum Herstellen plattierter Blöcke |
| US4828008A (en) * | 1987-05-13 | 1989-05-09 | Lanxide Technology Company, Lp | Metal matrix composites |
| US4935055A (en) * | 1988-01-07 | 1990-06-19 | Lanxide Technology Company, Lp | Method of making metal matrix composite with the use of a barrier |
| US5141819A (en) * | 1988-01-07 | 1992-08-25 | Lanxide Technology Company, Lp | Metal matrix composite with a barrier |
| US5277989A (en) * | 1988-01-07 | 1994-01-11 | Lanxide Technology Company, Lp | Metal matrix composite which utilizes a barrier |
| US4998578A (en) * | 1988-01-11 | 1991-03-12 | Lanxide Technology Company, Lp | Method of making metal matrix composites |
| US4871008A (en) * | 1988-01-11 | 1989-10-03 | Lanxide Technology Company, Lp | Method of making metal matrix composites |
| US5518061A (en) * | 1988-11-10 | 1996-05-21 | Lanxide Technology Company, Lp | Method of modifying the properties of a metal matrix composite body |
| US5287911A (en) * | 1988-11-10 | 1994-02-22 | Lanxide Technology Company, Lp | Method for forming metal matrix composites having variable filler loadings and products produced thereby |
| US5301738A (en) * | 1988-11-10 | 1994-04-12 | Lanxide Technology Company, Lp | Method of modifying the properties of a metal matrix composite body |
| US5526867A (en) * | 1988-11-10 | 1996-06-18 | Lanxide Technology Company, Lp | Methods of forming electronic packages |
| US5303763A (en) * | 1988-11-10 | 1994-04-19 | Lanxide Technology Company, Lp | Directional solidification of metal matrix composites |
| US5240062A (en) * | 1988-11-10 | 1993-08-31 | Lanxide Technology Company, Lp | Method of providing a gating means, and products thereby |
| US5163499A (en) * | 1988-11-10 | 1992-11-17 | Lanxide Technology Company, Lp | Method of forming electronic packages |
| US5119864A (en) * | 1988-11-10 | 1992-06-09 | Lanxide Technology Company, Lp | Method of forming a metal matrix composite through the use of a gating means |
| US5004036A (en) * | 1988-11-10 | 1991-04-02 | Lanxide Technology Company, Lp | Method for making metal matrix composites by the use of a negative alloy mold and products produced thereby |
| US5016703A (en) * | 1988-11-10 | 1991-05-21 | Lanxide Technology Company, Lp | Method of forming a metal matrix composite body by a spontaneous infiltration technique |
| US5197528A (en) * | 1988-11-10 | 1993-03-30 | Lanxide Technology Company, Lp | Investment casting technique for the formation of metal matrix composite bodies and products produced thereby |
| US5005631A (en) * | 1988-11-10 | 1991-04-09 | Lanxide Technology Company, Lp | Method for forming a metal matrix composite body by an outside-in spontaneous infiltration process, and products produced thereby |
| US5010945A (en) * | 1988-11-10 | 1991-04-30 | Lanxide Technology Company, Lp | Investment casting technique for the formation of metal matrix composite bodies and products produced thereby |
| US5267601A (en) * | 1988-11-10 | 1993-12-07 | Lanxide Technology Company, Lp | Method for forming a metal matrix composite body by an outside-in spontaneous infiltration process, and products produced thereby |
| US5165463A (en) * | 1988-11-10 | 1992-11-24 | Lanxide Technology Company, Lp | Directional solidification of metal matrix composites |
| US5040588A (en) * | 1988-11-10 | 1991-08-20 | Lanxide Technology Company, Lp | Methods for forming macrocomposite bodies and macrocomposite bodies produced thereby |
| US5172747A (en) * | 1988-11-10 | 1992-12-22 | Lanxide Technology Company, Lp | Method of forming a metal matrix composite body by a spontaneous infiltration technique |
| US5224533A (en) * | 1989-07-18 | 1993-07-06 | Lanxide Technology Company, Lp | Method of forming metal matrix composite bodies by a self-generated vaccum process, and products produced therefrom |
| IL94957A (en) * | 1989-07-18 | 1994-12-29 | Lanxide Technology Co Ltd | A method of creating bodies from a compound of a metal matrix by an empty process produced by itself, and products produced by it |
| US5188164A (en) * | 1989-07-21 | 1993-02-23 | Lanxide Technology Company, Lp | Method of forming macrocomposite bodies by self-generated vacuum techniques using a glassy seal |
| US5247986A (en) * | 1989-07-21 | 1993-09-28 | Lanxide Technology Company, Lp | Method of forming macrocomposite bodies by self-generated vacuum techniques, and products produced therefrom |
| US5163498A (en) * | 1989-11-07 | 1992-11-17 | Lanxide Technology Company, Lp | Method of forming metal matrix composite bodies having complex shapes by a self-generated vacuum process, and products produced therefrom |
| US5329984A (en) * | 1990-05-09 | 1994-07-19 | Lanxide Technology Company, Lp | Method of forming a filler material for use in various metal matrix composite body formation processes |
| EP0527948B1 (en) * | 1990-05-09 | 1996-11-13 | Lanxide Technology Company, Lp | Thin metal matrix composites and production methods |
| US5851686A (en) * | 1990-05-09 | 1998-12-22 | Lanxide Technology Company, L.P. | Gating mean for metal matrix composite manufacture |
| US5505248A (en) * | 1990-05-09 | 1996-04-09 | Lanxide Technology Company, Lp | Barrier materials for making metal matrix composites |
| AU8084191A (en) * | 1990-05-09 | 1991-11-27 | Lanxide Technology Company, Lp | Barrier materials for making metal matrix composites |
| WO1991017129A1 (en) * | 1990-05-09 | 1991-11-14 | Lanxide Technology Company, Lp | Macrocomposite bodies and production methods |
| US5487420A (en) * | 1990-05-09 | 1996-01-30 | Lanxide Technology Company, Lp | Method for forming metal matrix composite bodies by using a modified spontaneous infiltration process and products produced thereby |
| WO1991017279A1 (en) * | 1990-05-09 | 1991-11-14 | Lanxide Technology Company, Lp | Rigidized filler materials for metal matrix composites |
| US5361824A (en) * | 1990-05-10 | 1994-11-08 | Lanxide Technology Company, Lp | Method for making internal shapes in a metal matrix composite body |
| US5652723A (en) * | 1991-04-18 | 1997-07-29 | Mitsubishi Denki Kabushiki Kaisha | Semiconductor memory device |
| US5620791A (en) * | 1992-04-03 | 1997-04-15 | Lanxide Technology Company, Lp | Brake rotors and methods for making the same |
| US5848349A (en) * | 1993-06-25 | 1998-12-08 | Lanxide Technology Company, Lp | Method of modifying the properties of a metal matrix composite body |
| US5526914A (en) * | 1994-04-12 | 1996-06-18 | Lanxide Technology Company, Lp | Brake rotors, clutch plates and like parts and methods for making the same |
| WO2001046486A1 (fr) * | 1999-12-21 | 2001-06-28 | Hitachi Metals, Ltd. | Procede de production d'un materiau composite a base de metal |
| JP3422969B2 (ja) * | 2000-04-10 | 2003-07-07 | 日信工業株式会社 | 還元鋳造方法及びこれを用いたアルミニウム鋳造方法 |
| EP1153678B1 (en) * | 2000-05-10 | 2006-08-23 | Nissin Kogyo Co., Ltd | Method of casting and casting machine |
| KR101694260B1 (ko) | 2014-12-11 | 2017-01-09 | 이건배 | 알루미늄 기지 복합재료의 제조방법 및 이에 의하여 제조된 알루미늄 기지 복합재료 |
| CN106890983A (zh) * | 2015-12-18 | 2017-06-27 | 比亚迪股份有限公司 | 浸渗装置及具有其的浸渗系统 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1053880A (en) * | 1911-03-31 | 1913-02-18 | Campbell Scott | Process of impregnating. |
| US1555978A (en) * | 1920-08-26 | 1925-10-06 | American Magnesium Corp | Metal stock |
| US2192792A (en) * | 1938-07-28 | 1940-03-05 | Gen Motors Corp | Method of sintering and impregnating porous metal briquettes |
| US2665999A (en) * | 1950-04-18 | 1954-01-12 | Gen Motors Corp | Method of impregnation |
| US2671955A (en) * | 1950-12-14 | 1954-03-16 | Mallory & Co Inc P R | Composite metal-ceramic body and method of making the same |
| US2881068A (en) * | 1952-04-28 | 1959-04-07 | Wargons Ab | Method of treating a ferrous melt with a porous sintered metal body impregnated with a treating agent |
| US3235346A (en) * | 1960-11-22 | 1966-02-15 | Valley Co Inc | Composite bodies comprising a continuous framework and an impregnated metallic material and methods of their production |
| US3166415A (en) * | 1960-12-28 | 1965-01-19 | Union Carbide Corp | Magnesium-based alloys |
-
1965
- 1965-03-05 US US437581A patent/US3364976A/en not_active Expired - Lifetime
-
1966
- 1966-02-04 DE DE19661508821 patent/DE1508821A1/de active Pending
- 1966-02-24 NL NL6602441A patent/NL6602441A/xx unknown
- 1966-02-25 GB GB8494/66A patent/GB1144873A/en not_active Expired
- 1966-03-04 NO NO161951A patent/NO115451B/no unknown
- 1966-03-04 BE BE677385D patent/BE677385A/xx unknown
- 1966-03-04 SE SE02869/66A patent/SE340508B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO115451B (enrdf_load_stackoverflow) | 1968-10-07 |
| NL6602441A (enrdf_load_stackoverflow) | 1966-09-06 |
| US3364976A (en) | 1968-01-23 |
| GB1144873A (en) | 1969-03-12 |
| BE677385A (enrdf_load_stackoverflow) | 1966-09-05 |
| SE340508B (enrdf_load_stackoverflow) | 1971-11-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1508821A1 (de) | Giessereiverfahren | |
| DE69303417T2 (de) | Metallmatrixverbundwerkstoff auf Aluminiumbasis | |
| DE19834571C2 (de) | Verfahren zur Herstellung von Körpern aus faserverstärkten Verbundwerkstoffen und Verwendung des Verfahrens | |
| DE68910190T2 (de) | Verfahren zur Herstellung von Sputtertargets aus Wolfram-Titan. | |
| DE69814801T2 (de) | Verfahren zur Herstellung von Metallmatrix -Faserverbundkörper | |
| DE3807541C1 (enrdf_load_stackoverflow) | ||
| DE2027016A1 (de) | Verfahren zum Verdichten von Metall oder Keramikgegenstanden | |
| DE2913623B2 (de) | Pulvermetallurgisches Verfahren | |
| DE2015362B2 (de) | Verfahren zur herstellung von dispersionsverfestigten legierungen | |
| EP1227908A1 (de) | Verfahren und vorrichtung zur herstellung von gitternetzstrukturen | |
| DE3002971C2 (enrdf_load_stackoverflow) | ||
| DE1533154A1 (de) | Verfahren zur Herstellung starrer Koerper aus hitzebestaendigen Materialien | |
| DE1150264B (de) | Organisches Suspensionsmittel beim Herstellen von zu sinternden Formkoerpern nach dem Schlickerguss-verfahren | |
| DE3909136C2 (de) | Verfahren und Vorrichtung zum Gießen von Formteilen, beispielsweise Kraftfahrzeugrädern, aus Aluminium, Magnesium und dergleichen Leichtmetallen in Niederdruckgießmaschinen | |
| DE3720110C2 (de) | Verfahren zum Schmelzen und zum Vergießen von beta-Titanlegierungen | |
| DE68909522T2 (de) | Metall-Matrix-Verbundschleudergiessen. | |
| DE3200104C2 (de) | Gießvorrichtung zum Herstellen von legierten Metallgußstücken | |
| DE68911691T2 (de) | Gefäss für flüssige metalle, werkstoff für dieses gefäss und verfahren zur herstellung des materials. | |
| DE10236751A1 (de) | Verfahren zur Herstellung eines Bauteils, Bauteil und Verwendung | |
| DE19503464A1 (de) | Verfahren und Vorrichtung zur Herstellung von Metall-Matrix-Verbundwerkstoffen | |
| DE69120415T2 (de) | Gegossenes verbundmaterial | |
| EP0779259A1 (de) | Verfahren zur Herstellung eines oxidkeramischen Sinterkörpers und dessen Verwendung | |
| DE2254674B2 (de) | Katalysator fuer die aushaertung eines silicon-harzes in einer kernformmasse zum praezisionsguss mit verlorenem modell | |
| DE3627337C2 (enrdf_load_stackoverflow) | ||
| DE19629064C2 (de) | Verfahren zur Herstellung von Verbundwerkstoffen |