DE1468630C - - Google Patents
Info
- Publication number
- DE1468630C DE1468630C DE1468630C DE 1468630 C DE1468630 C DE 1468630C DE 1468630 C DE1468630 C DE 1468630C
- Authority
- DE
- Germany
- Prior art keywords
- bromine
- methane
- yield
- chlorine
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 68
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 58
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 57
- 229910052794 bromium Inorganic materials 0.000 claims description 57
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 47
- 239000000460 chlorine Substances 0.000 claims description 44
- 238000006243 chemical reaction Methods 0.000 claims description 27
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical class BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 claims description 25
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 24
- 229910052801 chlorine Inorganic materials 0.000 claims description 24
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 10
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 7
- 230000031709 bromination Effects 0.000 claims description 3
- 238000005893 bromination reaction Methods 0.000 claims description 3
- 239000007789 gas Substances 0.000 description 23
- 239000000203 mixture Substances 0.000 description 19
- 239000000047 product Substances 0.000 description 15
- 229910020314 ClBr Inorganic materials 0.000 description 7
- 150000002894 organic compounds Chemical class 0.000 description 5
- 230000005855 radiation Effects 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- JPOXNPPZZKNXOV-UHFFFAOYSA-N bromochloromethane Chemical class ClCBr JPOXNPPZZKNXOV-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical class ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- ICBQXEWYZVQCFH-UHFFFAOYSA-N 3-(4-bromoanilino)-n,n-dimethylpropanamide Chemical compound CN(C)C(=O)CCNC1=CC=C(Br)C=C1 ICBQXEWYZVQCFH-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229950001336 bromamide Drugs 0.000 description 1
- GZUXJHMPEANEGY-BJUDXGSMSA-N bromomethane Chemical group Br[11CH3] GZUXJHMPEANEGY-BJUDXGSMSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69105924T2 (de) | Verfahren zur Herstellung von 1,1,1,2-Tetrafluorethan. | |
| DE69417388T2 (de) | Verfahren zur herstellung von vinylchlorid | |
| DE2032098C3 (de) | Verfahren zur Herstellung eines Chromoxidkatalysators zur Fluorierung von Kohlenwasserstoffen | |
| DE3874231T2 (de) | Katalysator und verfahren zur herstellung von 1,1,1,2-tetrafluoraethan in der dampfphase. | |
| DE19654719C2 (de) | Verfahren zur Herstellung von Perfluorkohlenstoffen | |
| DE1618480A1 (de) | Verfahren zur Herstellung von Vinylaethern | |
| DE69118002T2 (de) | Verfahren zur Herstellung von 1,1,1-Trifluorchlorethan und 1,1,1,2-Tetrafluorethan | |
| DE2028350C2 (de) | Verfahren zur Herstellung von Aceton und/oder Methylisobuthylketon | |
| DE3119290A1 (de) | Verfahren zur herstellung eines als kraftstoff geeigneten gemisches aus methanol und hoeheren alkoholen | |
| DE2755828A1 (de) | Verfahren zur herstellung von 1,1,1-trifluor-2,2-dichloraethan | |
| DE1468630C (enExample) | ||
| DE1468630B (de) | Verfahren zur Herstellung von Brom methanen | |
| DE1643081B2 (de) | Verfahren zur herstellung von alkylenchlor- oder -bromhydrinen und/oder alkylenglykolen mit 2 bis 4 kohlenstoffatomen | |
| DE2120005B2 (de) | Verfahren zur kontinuierlichen Herstellung von Ameisensäure-, Essigsäure-, Propionsäure-, Benzoesäure- oder p-Toluolsäurediestern eines vicinalen C2 oder C3 -Glykole | |
| DE2127485C3 (de) | Verfahren zur Herstellung von 1,1,1-Trichloräthan | |
| DE1768453A1 (de) | Verfahren zur Herstellung von 1-2-Dichloraethan | |
| DE2164567A1 (de) | Verfahren zur herstellung von perfluoralkyljodiden | |
| DE19605211A1 (de) | Verfahren zur Herstellung von Formaldehyd | |
| DE68909978T2 (de) | Oxydationsverfahren. | |
| DE2226657A1 (de) | Verfahren zur selektiven Oxychlorierung von äthylenisch ungesättigten Kohlenwasserstoffen | |
| DE68904523T2 (de) | Verfahren zur herstellung von 1,1,1,2-tetrafluorethan. | |
| DE2335084A1 (de) | Verfahren zur katalytischen oxychlorierung von kohlenwasserstoffen | |
| DE1468630A1 (de) | Verfahren zur Herstellung von Brommethanen | |
| DE2400905A1 (de) | Verfahren und katalysator fuer die oxyhalogenierung von kohlenwasserstoffen oder halogenierten kohlenwasserstoffen | |
| DE3143704A1 (de) | Verfahren zur herstellung von formaldehyd |