DE1302590B - - Google Patents
Info
- Publication number
- DE1302590B DE1302590B DE19661302590D DE1302590DA DE1302590B DE 1302590 B DE1302590 B DE 1302590B DE 19661302590 D DE19661302590 D DE 19661302590D DE 1302590D A DE1302590D A DE 1302590DA DE 1302590 B DE1302590 B DE 1302590B
- Authority
- DE
- Germany
- Prior art keywords
- solution
- groups
- reaction
- mol
- benzene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- GOSCAGTYPPAXCJ-UHFFFAOYSA-N O=C(CC(C=CC=C1)=C1SCl)Cl Chemical class O=C(CC(C=CC=C1)=C1SCl)Cl GOSCAGTYPPAXCJ-UHFFFAOYSA-N 0.000 claims description 5
- UZVGSSNIUNSOFA-UHFFFAOYSA-N dibenzofuran-1-carboxylic acid Chemical compound O1C2=CC=CC=C2C2=C1C=CC=C2C(=O)O UZVGSSNIUNSOFA-UHFFFAOYSA-N 0.000 claims description 4
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 150000001491 aromatic compounds Chemical class 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- 229910018162 SeO2 Inorganic materials 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 239000007832 Na2SO4 Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- RVEZZJVBDQCTEF-UHFFFAOYSA-N sulfenic acid Chemical compound SO RVEZZJVBDQCTEF-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ABDKAPXRBAPSQN-UHFFFAOYSA-N veratrole Chemical compound COC1=CC=CC=C1OC ABDKAPXRBAPSQN-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000011086 high cleaning Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000007040 multi-step synthesis reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D337/00—Heterocyclic compounds containing rings of more than six members having one sulfur atom as the only ring hetero atom
- C07D337/02—Seven-membered rings
- C07D337/06—Seven-membered rings condensed with carbocyclic rings or ring systems
- C07D337/10—Seven-membered rings condensed with carbocyclic rings or ring systems condensed with two six-membered rings
- C07D337/14—[b,f]-condensed
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0049864 | 1966-08-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1302590B true DE1302590B (en:Method) | 1970-11-12 |
Family
ID=7103336
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661302590D Pending DE1302590B (en:Method) | 1966-08-03 | 1966-08-03 |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1302590B (en:Method) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0885610A4 (en) * | 1996-01-19 | 1999-04-21 | Nippon Suisan Kaisha Ltd | Tracheal smooth muscle relaxant |
| US6602898B1 (en) | 1999-06-03 | 2003-08-05 | Nippon Suisan Kaisha, Ltd. | Tricyclic fused heterocycle compounds, process for preparing the same and use thereof |
-
1966
- 1966-08-03 DE DE19661302590D patent/DE1302590B/de active Pending
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0885610A4 (en) * | 1996-01-19 | 1999-04-21 | Nippon Suisan Kaisha Ltd | Tracheal smooth muscle relaxant |
| US6495592B1 (en) | 1996-01-19 | 2002-12-17 | Nippon Suisan Kaisha, Ltd. | Tracheal smooth muscle relaxants |
| US6602898B1 (en) | 1999-06-03 | 2003-08-05 | Nippon Suisan Kaisha, Ltd. | Tricyclic fused heterocycle compounds, process for preparing the same and use thereof |
| US6700013B2 (en) | 1999-06-03 | 2004-03-02 | Nippon Suisan Kaisha, Ltd. | Tricyclic fused heterocycle compounds, process for preparing the same and use thereof |
| US7410997B2 (en) | 1999-06-03 | 2008-08-12 | Nippon Sulsan Kaisha, Ltd. | Tricyclic fused heterocycle compounds, process for preparing the same and use thereof |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2337396A1 (de) | Verfahren zur herstellung aromatischer 1,3-diketone | |
| DE2934614C2 (de) | Verfahren zur Herstellung von Terephthalaldehyd bzw. Isophthalaldehyd | |
| DE1302590B (en:Method) | ||
| DE3125329A1 (de) | Verfahren zur herstellung von derivaten der vinylphosphon- oder vinylpyrophosphonsaeure | |
| DE2216883A1 (de) | Verfahren zur Herstellung von tricyclischen Verbindungen | |
| DE2117690A1 (de) | Verfahren zur Herstellung von Phenoxyphenolen bzw. Chlorphenoxyphenolen | |
| DE2038455A1 (de) | Verfahren zur Herstellung von epsilon-Caprolacton | |
| DE1962095A1 (de) | Aromatische Keto-AEther sowie Verfahren zu deren Herstellung und deren Anwendung | |
| DE1297101B (de) | Verfahren zur Herstellung alkylierter 1,1,3-Trimethylindane | |
| EP0075698B1 (de) | Verfahren zur Herstellung von 10,11-Dihydro-5H-dibenzo (a,d) cyclohepten-5-on und dessen Substitutionsprodukten | |
| DE1001259C2 (de) | Verfahren zur Herstellung von Derivaten des Nortricyclens | |
| DE1470018C (de) | 6 Chlor 7 sulfamyl 4 methoxy spiro eckige Klammer auf 2H 3,4 dihydro 1,2,4 benzothiadiazm 3,1 cyclohexan eckige Klam mer zu 1,1 dioxyd | |
| DE2161084C3 (de) | Gemische der Acetale des a- und ß-Sinensals und analog aufgebauter isomerer Acetale sowie ein Verfahren zu deren Herstellung | |
| CH218361A (de) | Verfahren zur Herstellung einer Cyclopentano-dimethyl-polyhydro-phenanthren-carbonsäure. | |
| DE3802372A1 (de) | Neue fluorbenzophenone und fluorbenzoesaeurefluorphenylester sowie verfahren zu ihrer herstellung | |
| DE2642415A1 (de) | Syntheseverfahren fuer in 6-stellung substituierte 2,3-dimethoxy-5-methyl-1,4- benzochinone | |
| AT247847B (de) | Verfahren zur Herstellung von neuen 5-(3'-Aminopropyliden)-5H-dibenzo [a, d] cycloheptenen bzw. den 10, 11-Dihydroderivaten derselben | |
| DE2810398C2 (de) | Verfahren zur Herstellung von Tetrachlorcyclobutenon aus Hexachlorcyclobuten | |
| DE2619321C2 (de) | Oxalsäurederivate, ihre Herstellung und ihre Verwendung | |
| EP0238569B1 (de) | Verfahren zur herstellung von cycloalkancarbonsäuren | |
| DE2814129A1 (de) | Verfahren zur herstellung von alpha-tetralonen | |
| DE2600768A1 (de) | Verfahren zur herstellung von 6,11- dihydro-11-oxodibenz eckige klammer auf b,e eckige klammer zu -oxepin-alkansaeuren | |
| AT251588B (de) | Verfahren zur Herstellung von Chinazolin-Derivaten | |
| DE1643341C3 (de) | Verfahren zur Herstellung eines cyclischen Sulfinsäureesters | |
| DE945448C (de) | Verfahren zur Herstellung neuer Verbindungen mit 2 bis 5 linear verknuepften Bicyclo-[2, 2, 1]-heptanringen |