DE1298716B - Polyoxymethylen-Pressmassen - Google Patents
Polyoxymethylen-PressmassenInfo
- Publication number
- DE1298716B DE1298716B DE1963C0031034 DEC0031034A DE1298716B DE 1298716 B DE1298716 B DE 1298716B DE 1963C0031034 DE1963C0031034 DE 1963C0031034 DE C0031034 A DEC0031034 A DE C0031034A DE 1298716 B DE1298716 B DE 1298716B
- Authority
- DE
- Germany
- Prior art keywords
- weight
- percent
- compounds
- carbon black
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 16
- 238000000465 moulding Methods 0.000 title claims description 3
- -1 Polyoxymethylene Polymers 0.000 title description 5
- 229920006324 polyoxymethylene Polymers 0.000 title description 2
- 229930040373 Paraformaldehyde Natural products 0.000 title 1
- 229920000642 polymer Polymers 0.000 claims description 23
- 239000006229 carbon black Substances 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- 239000000370 acceptor Substances 0.000 claims description 18
- 125000005704 oxymethylene group Chemical group [H]C([H])([*:2])O[*:1] 0.000 claims description 10
- 239000000945 filler Substances 0.000 claims description 5
- 239000002245 particle Substances 0.000 claims description 5
- 241000872198 Serjania polyphylla Species 0.000 claims description 2
- 235000019241 carbon black Nutrition 0.000 description 18
- 239000000203 mixture Substances 0.000 description 11
- 238000003776 cleavage reaction Methods 0.000 description 9
- 230000007017 scission Effects 0.000 description 9
- 239000003381 stabilizer Substances 0.000 description 8
- 239000003112 inhibitor Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 230000015556 catabolic process Effects 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 238000006731 degradation reaction Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 150000002611 lead compounds Chemical class 0.000 description 3
- YJOMWQQKPKLUBO-UHFFFAOYSA-L lead(2+);phthalate Chemical compound [Pb+2].[O-]C(=O)C1=CC=CC=C1C([O-])=O YJOMWQQKPKLUBO-UHFFFAOYSA-L 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000004071 soot Substances 0.000 description 3
- OECTYKWYRCHAKR-UHFFFAOYSA-N 4-vinylcyclohexene dioxide Chemical compound C1OC1C1CC2OC2CC1 OECTYKWYRCHAKR-UHFFFAOYSA-N 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 229920000877 Melamine resin Polymers 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 125000000320 amidine group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 2
- 125000003700 epoxy group Chemical group 0.000 description 2
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 125000005702 oxyalkylene group Chemical group 0.000 description 2
- 125000006353 oxyethylene group Chemical group 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000012798 spherical particle Substances 0.000 description 2
- 238000009757 thermoplastic moulding Methods 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- JJWLMSCSLRJSAN-TYYBGVCCSA-L (e)-but-2-enedioate;lead(2+) Chemical compound [Pb+2].[O-]C(=O)\C=C\C([O-])=O JJWLMSCSLRJSAN-TYYBGVCCSA-L 0.000 description 1
- MFEVGQHCNVXMER-UHFFFAOYSA-L 1,3,2$l^{2}-dioxaplumbetan-4-one Chemical compound [Pb+2].[O-]C([O-])=O MFEVGQHCNVXMER-UHFFFAOYSA-L 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- OWRCNXZUPFZXOS-UHFFFAOYSA-N 1,3-diphenylguanidine Chemical compound C=1C=CC=CC=1NC(=N)NC1=CC=CC=C1 OWRCNXZUPFZXOS-UHFFFAOYSA-N 0.000 description 1
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- HLLSOEKIMZEGFV-UHFFFAOYSA-N 4-(dibutylsulfamoyl)benzoic acid Chemical compound CCCCN(CCCC)S(=O)(=O)C1=CC=C(C(O)=O)C=C1 HLLSOEKIMZEGFV-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 229910000003 Lead carbonate Inorganic materials 0.000 description 1
- 150000007945 N-acyl ureas Chemical class 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910000004 White lead Inorganic materials 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- JPNZKPRONVOMLL-UHFFFAOYSA-N azane;octadecanoic acid Chemical class [NH4+].CCCCCCCCCCCCCCCCCC([O-])=O JPNZKPRONVOMLL-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000006231 channel black Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 238000005034 decoration Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- BQQUFAMSJAKLNB-UHFFFAOYSA-N dicyclopentadiene diepoxide Chemical compound C12C(C3OC33)CC3C2CC2C1O2 BQQUFAMSJAKLNB-UHFFFAOYSA-N 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- OCWMFVJKFWXKNZ-UHFFFAOYSA-L lead(2+);oxygen(2-);sulfate Chemical compound [O-2].[O-2].[O-2].[Pb+2].[Pb+2].[Pb+2].[Pb+2].[O-]S([O-])(=O)=O OCWMFVJKFWXKNZ-UHFFFAOYSA-L 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N lead(II) oxide Inorganic materials [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- UMKARVFXJJITLN-UHFFFAOYSA-N lead;phosphorous acid Chemical compound [Pb].OP(O)O UMKARVFXJJITLN-UHFFFAOYSA-N 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 150000002942 palmitic acid derivatives Chemical class 0.000 description 1
- 239000002530 phenolic antioxidant Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003512 tertiary amines Chemical group 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/02—Elements
- C08K3/04—Carbon
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US22823462A | 1962-10-04 | 1962-10-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1298716B true DE1298716B (de) | 1969-07-03 |
Family
ID=22856344
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1963C0031034 Pending DE1298716B (de) | 1962-10-04 | 1963-10-03 | Polyoxymethylen-Pressmassen |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS4817865B1 (enExample) |
| BE (1) | BE638113A (enExample) |
| CH (1) | CH447600A (enExample) |
| DE (1) | DE1298716B (enExample) |
| DK (1) | DK107778C (enExample) |
| FI (1) | FI41072C (enExample) |
| FR (1) | FR1377596A (enExample) |
| GB (1) | GB1027032A (enExample) |
| NL (1) | NL298857A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1247645B (de) * | 1964-12-23 | 1967-08-17 | Bayer Ag | Spritzgussmassen, die hochmolekulare Polyacetale enthalten |
| JPS5284903U (enExample) * | 1975-12-23 | 1977-06-24 | ||
| JPS59107885A (ja) * | 1982-12-08 | 1984-06-22 | ファナック株式会社 | 工業用ロボツトのハンド |
| JPH072891B2 (ja) * | 1986-05-16 | 1995-01-18 | ポリプラスチックス株式会社 | ポリアセタ−ル樹脂組成物及びその製造方法 |
| JPS63185796A (ja) * | 1987-01-26 | 1988-08-01 | 高砂工業株式会社 | 匣鉢移送装置 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE567381A (enExample) * | 1957-05-06 |
-
0
- NL NL298857D patent/NL298857A/xx unknown
- BE BE638113D patent/BE638113A/xx unknown
-
1963
- 1963-01-23 GB GB282963A patent/GB1027032A/en not_active Expired
- 1963-10-03 CH CH1217063A patent/CH447600A/fr unknown
- 1963-10-03 JP JP38052199A patent/JPS4817865B1/ja active Pending
- 1963-10-03 DE DE1963C0031034 patent/DE1298716B/de active Pending
- 1963-10-03 FR FR949496A patent/FR1377596A/fr not_active Expired
- 1963-10-04 DK DK467263A patent/DK107778C/da active
- 1963-10-04 FI FI192763A patent/FI41072C/fi active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE567381A (enExample) * | 1957-05-06 |
Also Published As
| Publication number | Publication date |
|---|---|
| DK107778C (da) | 1967-07-03 |
| BE638113A (enExample) | |
| NL298857A (enExample) | |
| JPS4817865B1 (enExample) | 1973-06-01 |
| FI41072B (enExample) | 1969-04-30 |
| GB1027032A (en) | 1966-04-20 |
| CH447600A (fr) | 1967-11-30 |
| FR1377596A (fr) | 1964-11-06 |
| FI41072C (fi) | 1969-08-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0612794B1 (de) | Thermostabile kupferhaltige Polyamidformmassen | |
| DE2818240A1 (de) | Thermoplastische formmassen auf basis von polyoxymethylenen | |
| DE2808675B2 (de) | Polyoxymethylen-Formmassen | |
| EP0083084B1 (de) | Füllstoff enthaltende Kunststoff-Formmasse, Verfahren zu ihrer Herstellung sowie deren Verwendung | |
| DE3148768A1 (de) | Acetalharzmassen | |
| DE2745076B2 (de) | Massen auf Polyamidbasis | |
| AT226438B (de) | Polyoxymethylen mit verbesserter Hitzebeständigkeit | |
| DE19705559B4 (de) | Polyacetalharz-Zusammensetzung mit hervorragender Langzeitbeständigkeit | |
| DE1495365B2 (de) | Verfahren zum thermischen stabilisieren von osymethylencopolymerisaten | |
| DE3421864A1 (de) | Thermoplastische formmassen auf der basis von polyoxymethylen und polymeren adipatcarbonatmischestern | |
| DE2456374B2 (de) | Flammenhemmende polymere Formmassen | |
| DE1298716B (de) | Polyoxymethylen-Pressmassen | |
| DE1195490B (de) | Stabilisatoren fuer Polyoxymethylene | |
| EP0838495B1 (de) | Stabilisatorkombination für thermoplastische Harzzusammensetzungen | |
| DE1669840B2 (de) | Gegen thermischen abbau stabilisierte oxymethylenhomo- und copolymere | |
| DE2346930C2 (de) | Photochemisch abbaubare Polyolefine | |
| DE2739773A1 (de) | Polymermischungen mit verringerter rauchbildung | |
| DE1544677B2 (de) | Herstellung von stabilen thermoplastischen Massen | |
| CH505174A (de) | Polymermasse | |
| AT524902B1 (de) | Verfahren zur Herstellung einer Stabilisatorzusammensetzung für ein Polymer und damit hergestellte Stabilisatorzusammensetzung | |
| DE1570410B2 (de) | Verfahren z-um thermischen Stabilisieren von unter normalbedingungsfesten Oxymethylencopolymerisaten | |
| DE1469809C3 (de) | Thermoplastische Massen | |
| DE2150484C3 (de) | Selbstverlöschende Formmassen | |
| DE2154096A1 (de) | Tert phosphinoxid Ammoniumpolyphos phat Kombinationen als feuerhemmende Zu satze für Propylenpolymere | |
| DE3545476A1 (de) | Lichtstabilisator fuer polymere, insbesondere fuer polypropylen, polyethylen, polystyrol und fuer chlorhaltige polymere |