DE1233881B - Verfahren zur Herstellung von 2-Acylimino-1, 3-oxathiolanen - Google Patents
Verfahren zur Herstellung von 2-Acylimino-1, 3-oxathiolanenInfo
- Publication number
- DE1233881B DE1233881B DEC35561A DEC0035561A DE1233881B DE 1233881 B DE1233881 B DE 1233881B DE C35561 A DEC35561 A DE C35561A DE C0035561 A DEC0035561 A DE C0035561A DE 1233881 B DE1233881 B DE 1233881B
- Authority
- DE
- Germany
- Prior art keywords
- found
- acylimino
- mol
- oxathiolanes
- oxathiolane
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 3
- 239000008164 mustard oil Substances 0.000 claims description 12
- 150000002118 epoxides Chemical class 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 20
- -1 acyl mustard oil Chemical compound 0.000 description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000012043 crude product Substances 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 description 3
- SFLGIMGLWCVAHP-UHFFFAOYSA-N 5h-oxathiole Chemical compound C1OSC=C1 SFLGIMGLWCVAHP-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- BDTDECDAHYOJRO-UHFFFAOYSA-N ethyl n-(sulfanylidenemethylidene)carbamate Chemical compound CCOC(=O)N=C=S BDTDECDAHYOJRO-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical class F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001913 cyanates Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 description 1
- JAVBBFXUGDCHLZ-UHFFFAOYSA-N 1-$l^{1}-oxidanylpropane Chemical compound CCC[O] JAVBBFXUGDCHLZ-UHFFFAOYSA-N 0.000 description 1
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- WZHRVCOCPMCGEA-UHFFFAOYSA-N 2-(2,2-dimethylpropyl)-2-methyloxirane Chemical compound CC(C)(C)CC1(C)CO1 WZHRVCOCPMCGEA-UHFFFAOYSA-N 0.000 description 1
- VMSIYTPWZLSMOH-UHFFFAOYSA-N 2-(dodecoxymethyl)oxirane Chemical compound CCCCCCCCCCCCOCC1CO1 VMSIYTPWZLSMOH-UHFFFAOYSA-N 0.000 description 1
- NJWSNNWLBMSXQR-UHFFFAOYSA-N 2-hexyloxirane Chemical compound CCCCCCC1CO1 NJWSNNWLBMSXQR-UHFFFAOYSA-N 0.000 description 1
- NAGJMKOANVHPEJ-UHFFFAOYSA-N 2-methoxy-3-methyloxirane Chemical compound COC1OC1C NAGJMKOANVHPEJ-UHFFFAOYSA-N 0.000 description 1
- CASCSTLKRAIFKN-UHFFFAOYSA-N 2-methyl-3-phenoxyoxirane Chemical compound CC1OC1OC1=CC=CC=C1 CASCSTLKRAIFKN-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- OQKITJICGXCHGS-UHFFFAOYSA-N 4-(3-formyl-4-nitrophenoxy)butanoic acid Chemical compound OC(=O)CCCOC1=CC=C([N+]([O-])=O)C(C=O)=C1 OQKITJICGXCHGS-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- LAYOWLWMBOECIQ-UHFFFAOYSA-N N-(5-methyl-1,3-oxathiolan-2-ylidene)benzamide Chemical compound C(C1=CC=CC=C1)(=O)N=C1OC(CS1)C LAYOWLWMBOECIQ-UHFFFAOYSA-N 0.000 description 1
- RVXIDVVUILMGLA-UHFFFAOYSA-N N-[5-(phenoxymethyl)-1,3-oxathiolan-2-ylidene]acetamide Chemical compound C(C)(=O)N=C1OC(CS1)COC1=CC=CC=C1 RVXIDVVUILMGLA-UHFFFAOYSA-N 0.000 description 1
- JNMFHGXNYKUOAR-UHFFFAOYSA-N [4-imino-5-(phenoxymethyl)-1,3-oxathiolan-2-yl]-(4-nitrophenyl)methanone Chemical compound [N+](=O)([O-])C1=CC=C(C(=O)C2OC(C(S2)=N)COC2=CC=CC=C2)C=C1 JNMFHGXNYKUOAR-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- ZWAJLVLEBYIOTI-UHFFFAOYSA-N cyclohexene oxide Chemical compound C1CCCC2OC21 ZWAJLVLEBYIOTI-UHFFFAOYSA-N 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohexene oxide Natural products O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- FSGJZHYPLBLJJG-UHFFFAOYSA-N n-[5-(phenoxymethyl)-1,3-oxathiolan-2-ylidene]benzamide Chemical compound C=1C=CC=CC=1C(=O)N=C(SC1)OC1COC1=CC=CC=C1 FSGJZHYPLBLJJG-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- OOFGXDQWDNJDIS-UHFFFAOYSA-N oxathiolane Chemical compound C1COSC1 OOFGXDQWDNJDIS-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
- C07D327/04—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Lubricants (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEC35561A DE1233881B (de) | 1965-04-10 | 1965-04-10 | Verfahren zur Herstellung von 2-Acylimino-1, 3-oxathiolanen |
| FR55334A FR1472735A (fr) | 1965-04-10 | 1966-03-29 | Procédé de préparation de 2-acylimino-1, 3-oxa-thiolanes |
| US539328A US3480647A (en) | 1965-04-10 | 1966-04-01 | 2-acylimino-1,3-oxathiolanes and process for their production |
| GB15502/66A GB1135583A (en) | 1965-04-10 | 1966-04-07 | Process for the production of 2-acylamino-1,3-oxathiolanes |
| BE679242D BE679242A (enExample) | 1965-04-10 | 1966-04-07 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEC35561A DE1233881B (de) | 1965-04-10 | 1965-04-10 | Verfahren zur Herstellung von 2-Acylimino-1, 3-oxathiolanen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1233881B true DE1233881B (de) | 1967-02-09 |
Family
ID=7021876
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC35561A Pending DE1233881B (de) | 1965-04-10 | 1965-04-10 | Verfahren zur Herstellung von 2-Acylimino-1, 3-oxathiolanen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3480647A (enExample) |
| BE (1) | BE679242A (enExample) |
| DE (1) | DE1233881B (enExample) |
| GB (1) | GB1135583A (enExample) |
-
1965
- 1965-04-10 DE DEC35561A patent/DE1233881B/de active Pending
-
1966
- 1966-04-01 US US539328A patent/US3480647A/en not_active Expired - Lifetime
- 1966-04-07 GB GB15502/66A patent/GB1135583A/en not_active Expired
- 1966-04-07 BE BE679242D patent/BE679242A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1135583A (en) | 1968-12-04 |
| BE679242A (enExample) | 1966-09-16 |
| US3480647A (en) | 1969-11-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2735255C2 (de) | Verfahren zur Herstellung von Dicarboalkoxycyclohexenen | |
| DE2627986C2 (de) | Verfahren zur Herstellung von Perfluoralkoxypropionsäurefluoriden | |
| EP0280781A1 (de) | Verfahren zur Herstellung von N-Alkyl-N'-methyl-alkylenharnstoffen, insbesondere N,N'-Dimethylalkylenharnstoffen | |
| DE1131681B (de) | Verfahren zur Herstellung von stickstoffhaltigen organischen Siliciumverbindungen | |
| US3397223A (en) | Preparation of cyclopropane derivatives | |
| DE1233881B (de) | Verfahren zur Herstellung von 2-Acylimino-1, 3-oxathiolanen | |
| DE2103686C3 (de) | Verfahren zur Herstellung von a -Hydroxy- γ -lactonen | |
| US2422400A (en) | Production of n-methylamides | |
| DE1233882B (de) | Verfahren zur Herstellung von substituierten 1, 3-Oxathiol-2-onen | |
| DE1270568B (de) | Verfahren zur Herstellung von 2, 5-Bis-(halogen-methyl)-1, 4-dioxanen | |
| EP0003052B1 (de) | Verfahren zur Herstellung von 4-Methyl-5-chlormethylimidazol | |
| EP0050768B1 (de) | Verfahren zur Herstellung von Azidogruppen aufweisenden Organosiliciumverbindungen | |
| JPS5896037A (ja) | マロンジアルデヒドテトラアルキルアセタ−ルの製法 | |
| US2992270A (en) | Process for producing acrylic acid esters | |
| DE1261852B (de) | Verfahren zur Herstellung von 2-Aminothiazolen | |
| US3742063A (en) | Dihydroxybutanones | |
| JPS5824591A (ja) | 2−トリメチルシリルオキシ−エチルアミン及びその製造法 | |
| EP0385194B1 (de) | Verfahren zur Herstellung von unsymmetrischen Spiroorthocarbonaten | |
| DE1236521B (de) | Verfahren zur Herstellung von substituierten 1-Thia-2-sila-cyclopentanen | |
| DE3009604A1 (de) | Verfahren zur herstellung von butyrolactonen | |
| US3133938A (en) | Insecticidal lactones | |
| DE2013261A1 (de) | Verfahren zur Herstellung von Furanen | |
| US3317596A (en) | Bicyclic borazole compound | |
| AT262272B (de) | Verfahren zur Herstellung von neuen Benzofuranderivaten und ihren Salzen | |
| DE973558C (de) | Verfahren zur Herstellung von aliphatischen ªÏ-Chlorcarbonsaeurenitrilen |