DE1168884B - Verfahren zur Entfernung von Verunreinigungen aus gesaettigten aliphatischen Dinitrilen - Google Patents
Verfahren zur Entfernung von Verunreinigungen aus gesaettigten aliphatischen DinitrilenInfo
- Publication number
- DE1168884B DE1168884B DEB55450A DEB0055450A DE1168884B DE 1168884 B DE1168884 B DE 1168884B DE B55450 A DEB55450 A DE B55450A DE B0055450 A DEB0055450 A DE B0055450A DE 1168884 B DE1168884 B DE 1168884B
- Authority
- DE
- Germany
- Prior art keywords
- dinitrile
- water
- parts
- dinitriles
- impurities
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 37
- 125000001931 aliphatic group Chemical group 0.000 title claims description 7
- 239000012535 impurity Substances 0.000 title description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 25
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims description 10
- 239000003513 alkali Substances 0.000 claims description 6
- BIGPRXCJEDHCLP-UHFFFAOYSA-N ammonium bisulfate Chemical compound [NH4+].OS([O-])(=O)=O BIGPRXCJEDHCLP-UHFFFAOYSA-N 0.000 claims description 3
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 description 24
- 238000004140 cleaning Methods 0.000 description 12
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 238000005984 hydrogenation reaction Methods 0.000 description 7
- 150000003839 salts Chemical class 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- BTNXBLUGMAMSSH-UHFFFAOYSA-N octanedinitrile Chemical compound N#CCCCCCCC#N BTNXBLUGMAMSSH-UHFFFAOYSA-N 0.000 description 6
- 239000001361 adipic acid Substances 0.000 description 5
- 235000011037 adipic acid Nutrition 0.000 description 5
- -1 alkali metal cyanides Chemical class 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- MVDKKZZVTWHVMC-UHFFFAOYSA-N 2-hexadecylpropanedioic acid Chemical compound CCCCCCCCCCCCCCCCC(C(O)=O)C(O)=O MVDKKZZVTWHVMC-UHFFFAOYSA-N 0.000 description 4
- 239000004952 Polyamide Substances 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000003463 adsorbent Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 229920002647 polyamide Polymers 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 3
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 3
- KLECQVSYSMVNOX-UHFFFAOYSA-N C1CC(=N)C(=C1)C#N Chemical compound C1CC(=N)C(=C1)C#N KLECQVSYSMVNOX-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 235000013877 carbamide Nutrition 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 description 3
- 125000002560 nitrile group Chemical group 0.000 description 3
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- KJDRSWPQXHESDQ-UHFFFAOYSA-N 1,4-dichlorobutane Chemical compound ClCCCCCl KJDRSWPQXHESDQ-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 238000010306 acid treatment Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- CFEYBLWMNFZOPB-UHFFFAOYSA-N pent-4-enenitrile Chemical compound C=CCCC#N CFEYBLWMNFZOPB-UHFFFAOYSA-N 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 238000001577 simple distillation Methods 0.000 description 2
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 2
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- AOSFMYBATFLTAQ-UHFFFAOYSA-N 1-amino-3-(benzimidazol-1-yl)propan-2-ol Chemical compound C1=CC=C2N(CC(O)CN)C=NC2=C1 AOSFMYBATFLTAQ-UHFFFAOYSA-N 0.000 description 1
- SRGQQZYVZFJYHJ-UHFFFAOYSA-N 2-(aminomethyl)cyclopentan-1-amine Chemical compound NCC1CCCC1N SRGQQZYVZFJYHJ-UHFFFAOYSA-N 0.000 description 1
- KFNGTNYRGWDUAG-UHFFFAOYSA-N 2-heptyldodecanedinitrile Chemical compound C(#N)CCCCCCCCCC(CCCCCCC)C#N KFNGTNYRGWDUAG-UHFFFAOYSA-N 0.000 description 1
- IPMQSLPLJDKUPI-UHFFFAOYSA-N 2-oxocyclopentane-1-carbonitrile Chemical compound O=C1CCCC1C#N IPMQSLPLJDKUPI-UHFFFAOYSA-N 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- NOIZJQMZRULFFO-UHFFFAOYSA-N adipamic acid Chemical class NC(=O)CCCCC(O)=O NOIZJQMZRULFFO-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- UBLYEVLMRSPMOG-UHFFFAOYSA-N cyclopentylmethanamine Chemical compound NCC1CCCC1 UBLYEVLMRSPMOG-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/32—Separation; Purification; Stabilisation; Use of additives
- C07C253/34—Separation; Purification
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL257583D NL257583A (OSRAM) | 1959-11-07 | ||
| DEB55450A DE1168884B (de) | 1959-11-07 | 1959-11-07 | Verfahren zur Entfernung von Verunreinigungen aus gesaettigten aliphatischen Dinitrilen |
| US66430A US3223724A (en) | 1959-11-07 | 1960-11-01 | Purification of aliphatic dinitriles |
| GB37623/60A GB905121A (en) | 1959-11-07 | 1960-11-02 | Purification of aliphatic dinitriles |
| FR843174A FR1272896A (fr) | 1959-11-07 | 1960-11-07 | épuration de dinitriles aliphatiques |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB55450A DE1168884B (de) | 1959-11-07 | 1959-11-07 | Verfahren zur Entfernung von Verunreinigungen aus gesaettigten aliphatischen Dinitrilen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1168884B true DE1168884B (de) | 1964-04-30 |
Family
ID=6970995
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB55450A Pending DE1168884B (de) | 1959-11-07 | 1959-11-07 | Verfahren zur Entfernung von Verunreinigungen aus gesaettigten aliphatischen Dinitrilen |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3223724A (OSRAM) |
| DE (1) | DE1168884B (OSRAM) |
| FR (1) | FR1272896A (OSRAM) |
| GB (1) | GB905121A (OSRAM) |
| NL (1) | NL257583A (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN109071421B (zh) | 2016-05-02 | 2022-02-25 | 英威达纺织(英国)有限公司 | 减少二腈流中的cpi的方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2242309A (en) * | 1938-03-23 | 1941-05-20 | Du Pont | Process for purifying nitriles |
| US2305103A (en) * | 1941-05-20 | 1942-12-15 | Du Pont | Purification of nitriles |
| GB731458A (en) * | 1951-12-06 | 1955-06-08 | Basf Ag | Improvements in the production of pure adipic acid dinitrile |
| US2768132A (en) * | 1954-09-13 | 1956-10-23 | Du Pont | Process for purification of an adiponitrile |
-
0
- NL NL257583D patent/NL257583A/xx unknown
-
1959
- 1959-11-07 DE DEB55450A patent/DE1168884B/de active Pending
-
1960
- 1960-11-01 US US66430A patent/US3223724A/en not_active Expired - Lifetime
- 1960-11-02 GB GB37623/60A patent/GB905121A/en not_active Expired
- 1960-11-07 FR FR843174A patent/FR1272896A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1272896A (fr) | 1961-09-29 |
| US3223724A (en) | 1965-12-14 |
| GB905121A (en) | 1962-09-05 |
| NL257583A (OSRAM) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2441650C3 (de) | Verfahren zur Herstellung von halogenierten aromatischen primären Aminen | |
| CH494733A (de) | Verfahren zur Herstellung von p-Aminophenol | |
| DE1948566B2 (de) | Verfahren zur herstellung von di(4-aminocyclohexyl)-methan durch katalytische hydrierung von di-(4-aminophenyl)-methan | |
| DE2050406A1 (de) | Verfahren zur Entfernung der kationischen Verunreinigungen aus technischer Phosphorsäure | |
| DE19713456B4 (de) | Verfahren zur Herstellung einer für die Synthese von iodierten Kontrastmitteln nützlichen Zwischenverbindung | |
| CH407115A (de) | Verfahren zum Reinigen von reduzierbaren, cyclischen, organischen Verbindungen | |
| DE2005309A1 (de) | Verfahren zur Herstellung von 1,3-Cyclohexylendiisocyanaten | |
| DE2652394C2 (de) | Verfahren zur Reinigung von 2-Mercaptobenzothiazol | |
| DE1168884B (de) | Verfahren zur Entfernung von Verunreinigungen aus gesaettigten aliphatischen Dinitrilen | |
| DE2624472C3 (de) | Verfahren zur Reinigung von Adipinsäure | |
| DE2151553A1 (de) | Verfahren zur Herstellung von Adipinsaeurenitril | |
| DE1116646B (de) | Verfahren zur Reinigung von aliphatischen Dinitrilen | |
| DE2202204C2 (de) | Verfahren zur Herstellung von 2-Mercaptobenzimidazol | |
| DE1283823B (de) | Verfahren zur Gewinnung von Adipinsaeuredinitril | |
| DE2938424C2 (de) | Verfahren zur Abtrenunng von mit Destillatdämpfen übergehenden Säuren und Basen | |
| DE1593092C3 (de) | Verfahren zur Abtrennung von festem Ammoniumsulfat aus einem Schlamm, der aus einer wäßrigen Lösung von Acrylsäureamid und festem Ammoniumsulfat besteht | |
| DE1156777B (de) | Verfahren zur Reinigung von gesaettigten aliphatischen Dinitrilen | |
| DE2052167C3 (de) | Verfahren zur Herstellung des gereinigten Ammoniumsalzes der 11-Cyanundecansäure bzw. der reinen freien 11-Cyanundecansäure | |
| DE2018616B2 (de) | Verfahren zur gewinnung von reinem dimethylformamid | |
| DE1543815A1 (de) | Verfahren zur Herstellung von sehr reinem Trioxan | |
| CH415588A (de) | Verfahren zum Reinigen von aliphatischen Nitrilen | |
| DE1268611C2 (de) | Verfahren zur reinigung von adipinsaeuredinitril durch destillation | |
| DE1046601B (de) | Verfahren zur Reinigung von Adipinsaeuredinitril | |
| DE1925038B2 (de) | Verfahren zur Gewinnung von Terephthalsäure | |
| CH564528A5 (en) | Purification of caprolactam freed from water - by counter-current multi-stage cystallisation from the melt using a solvent |