DE1158745B - Nematodicide Mittel - Google Patents
Nematodicide MittelInfo
- Publication number
- DE1158745B DE1158745B DED32500A DED0032500A DE1158745B DE 1158745 B DE1158745 B DE 1158745B DE D32500 A DED32500 A DE D32500A DE D0032500 A DED0032500 A DE D0032500A DE 1158745 B DE1158745 B DE 1158745B
- Authority
- DE
- Germany
- Prior art keywords
- phosphoric acid
- soil
- compounds
- methyl
- acid amide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 carbon phosphoric acid diamide Chemical compound 0.000 claims description 30
- 150000001875 compounds Chemical class 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 18
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical compound NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 5
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- ANCLJVISBRWUTR-UHFFFAOYSA-N diaminophosphinic acid Chemical class NP(N)(O)=O ANCLJVISBRWUTR-UHFFFAOYSA-N 0.000 claims description 4
- 230000001069 nematicidal effect Effects 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- OOSBSVDOHPTTCT-UHFFFAOYSA-N (2,4-dichlorophenoxy)-methoxy-methyl-sulfanylidene-$l^{5}-phosphane Chemical group COP(C)(=S)OC1=CC=C(Cl)C=C1Cl OOSBSVDOHPTTCT-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 150000003012 phosphoric acid amides Chemical class 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000000460 chlorine Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- HZWWPPSYNCZWIU-UHFFFAOYSA-N methoxy-n-methylphosphonamidic acid Chemical compound CNP(O)(=O)OC HZWWPPSYNCZWIU-UHFFFAOYSA-N 0.000 claims 1
- 239000002689 soil Substances 0.000 description 39
- 150000003016 phosphoric acids Chemical class 0.000 description 26
- 241000244206 Nematoda Species 0.000 description 25
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 241000196324 Embryophyta Species 0.000 description 9
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 206010061217 Infestation Diseases 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 239000013543 active substance Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000012141 concentrate Substances 0.000 description 5
- 239000002270 dispersing agent Substances 0.000 description 5
- 239000001963 growth medium Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 240000008067 Cucumis sativus Species 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 238000003973 irrigation Methods 0.000 description 3
- 230000002262 irrigation Effects 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 230000024121 nodulation Effects 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 241000227653 Lycopersicon Species 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical compound OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 2
- 150000003973 alkyl amines Chemical class 0.000 description 2
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 239000003864 humus Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BMPHSOWXJKLWSU-UHFFFAOYSA-N n-dihydroxyphosphinothioylmethanamine Chemical compound CNP(O)(O)=S BMPHSOWXJKLWSU-UHFFFAOYSA-N 0.000 description 2
- 235000021049 nutrient content Nutrition 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000009331 sowing Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical class OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 235000009849 Cucumis sativus Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 241000243785 Meloidogyne javanica Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Chemical class 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 150000001470 diamides Chemical class 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 150000003578 thiophosphoric acid amides Chemical class 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/06—Phosphorus compounds without P—C bonds
- C07F9/22—Amides of acids of phosphorus
- C07F9/24—Esteramides
- C07F9/2404—Esteramides the ester moiety containing a substituent or a structure which is considered as characteristic
- C07F9/242—Esteramides the ester moiety containing a substituent or a structure which is considered as characteristic of hydroxyaryl compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US791052A US3005749A (en) | 1959-02-04 | 1959-02-04 | Method for improving the ability of soil to support plant growth |
Publications (1)
Publication Number | Publication Date |
---|---|
DE1158745B true DE1158745B (de) | 1963-12-05 |
Family
ID=25152532
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DED32500A Pending DE1158745B (de) | 1959-02-04 | 1960-02-02 | Nematodicide Mittel |
Country Status (5)
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN110551659A (zh) * | 2019-09-16 | 2019-12-10 | 中国农业科学院蔬菜花卉研究所 | 一种具有抗线虫活性的蜡样芽孢杆菌菌株及其应用 |
Families Citing this family (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3074790A (en) * | 1960-03-30 | 1963-01-22 | Dow Chemical Co | Method for the control of undesired vegetation |
US3301749A (en) * | 1962-12-01 | 1967-01-31 | Takeda Chemical Industries Ltd | Pesticidal omicron, omicron-dimethyl-omicron-(2-[or 3-] methoxy-4-cyanophenyl) phosphorothioate |
US3325568A (en) * | 1963-06-10 | 1967-06-13 | Velsicol Chemical Corp | Diphosphates of xylylene |
US3242042A (en) * | 1963-07-03 | 1966-03-22 | Monsanto Co | Insecticidal omicron-aryl alkylphosphonothioates |
US3912813A (en) * | 1973-09-24 | 1975-10-14 | Dow Chemical Co | Nematocidal soil treating compositions comprising 1,2-dibromo-3-chloropropane and o-phenyl n,n'-dimethyl phosphorodiamidate |
US3895109A (en) * | 1974-02-11 | 1975-07-15 | Dow Chemical Co | Nematocidal compositions comprising 2-chloro-6-methoxy-4-(trichloro-methyl)pyridine and N,N{40 -dimethyl O-phenyl phosphorodiamidate |
Citations (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB705926A (en) * | 1952-03-05 | 1954-03-24 | Pest Control Ltd | Means for introducing chemicals beneath the surface of the soil |
US2761806A (en) * | 1954-10-27 | 1956-09-04 | Virginia Carolina Chem Corp | Method of controlling nematodes in the soil |
US2857308A (en) * | 1956-11-15 | 1958-10-21 | Monsanto Chemicals | Method of destroying nematodes employing phosphorodithioates |
Family Cites Families (14)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2377446A (en) * | 1941-11-17 | 1945-06-05 | Pacific Guano And Fertilizer C | Soil treatment |
US2502244A (en) * | 1943-03-26 | 1950-03-28 | Carter Walter | Soil fumigant comprising 1, 3-dichloropropene and 1, 2-dichloropropane |
US2473984A (en) * | 1946-09-27 | 1949-06-21 | Innis Speiden And Company | Fumigant composition and method |
US2552540A (en) * | 1949-04-15 | 1951-05-15 | Dow Chemical Co | O-methoxy o-alkyl amidothiophosphates |
US2743209A (en) * | 1952-12-24 | 1956-04-24 | Robert H Jones | Xanthyl and trithiocarbonyl, sulfides, sulfoxides, and sulfones as pesticides |
US2770638A (en) * | 1953-07-03 | 1956-11-13 | Stauffer Chemical Co | Xanthyl and trithiocarbonyl sulfones as novel compositions of matter |
US2730547A (en) * | 1955-02-01 | 1956-01-10 | Monsanto Chemicals | Benzyltris (dialkylamino) phosphonium halides |
US2757117A (en) * | 1955-02-08 | 1956-07-31 | Monsanto Chemicals | N, n', n''-hexaalkylphosphorohalogenidotriamidothioic acid esters |
US2802021A (en) * | 1956-01-27 | 1957-08-06 | Monsanto Chemicals | Hydrazinopropionitrile compounds |
US2809983A (en) * | 1956-03-12 | 1957-10-15 | Monsanto Chemicals | Hydroxyanilinopropionitriles |
US2855425A (en) * | 1956-04-04 | 1958-10-07 | Dow Chemical Co | O-(2, 6-dicyclohexyl-4-methylphenyl) o-methyl n-alkyl phosphoroamidothioates |
US2802818A (en) * | 1956-07-05 | 1957-08-13 | Dow Chemical Co | Phthalides |
US2862018A (en) * | 1956-07-30 | 1958-11-25 | Dow Chemical Co | O-aryl o-loweralkyl n-alkenyl phosphoroamidothioates |
US2824890A (en) * | 1957-02-21 | 1958-02-25 | Monsanto Chemicals | Adducts of halogenated benzene sulfenyl halides and vinyl esters and process |
-
0
- NL NL248018D patent/NL248018A/xx unknown
- NL NL123375D patent/NL123375C/xx active
-
1959
- 1959-02-04 US US791052A patent/US3005749A/en not_active Expired - Lifetime
-
1960
- 1960-01-19 GB GB3330/60A patent/GB943201A/en not_active Expired
- 1960-02-02 DE DED32500A patent/DE1158745B/de active Pending
- 1960-02-03 FR FR817487A patent/FR1248246A/fr not_active Expired
Patent Citations (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB705926A (en) * | 1952-03-05 | 1954-03-24 | Pest Control Ltd | Means for introducing chemicals beneath the surface of the soil |
US2761806A (en) * | 1954-10-27 | 1956-09-04 | Virginia Carolina Chem Corp | Method of controlling nematodes in the soil |
US2857308A (en) * | 1956-11-15 | 1958-10-21 | Monsanto Chemicals | Method of destroying nematodes employing phosphorodithioates |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN110551659A (zh) * | 2019-09-16 | 2019-12-10 | 中国农业科学院蔬菜花卉研究所 | 一种具有抗线虫活性的蜡样芽孢杆菌菌株及其应用 |
Also Published As
Publication number | Publication date |
---|---|
US3005749A (en) | 1961-10-24 |
NL123375C (US06291589-20010918-C00001.png) | |
FR1248246A (fr) | 1960-12-09 |
NL248018A (US06291589-20010918-C00001.png) | |
GB943201A (en) | 1963-12-04 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2463046C2 (de) | Fungizide Mittel auf Ammoniumphosphonatbasis | |
DE1013302B (de) | Mittel zum voruebergehenden Sterilisieren von landwirtschaftlichen Kulturboeden | |
EP1278415A1 (de) | Verfahren zur induktion der virenresistenz von pflanzen | |
DE1046938B (de) | Schaedlingsbekaempfungsmittel | |
DE1245206B (de) | Insektenbekaempfungsmittel | |
DE1158745B (de) | Nematodicide Mittel | |
DE2837819A1 (de) | 2-hydroxybenzamidderivate | |
DE1693192A1 (de) | Schaedlingsbekaempfungsmittel | |
DE1004858B (de) | Unkrautvernichtungsmittel | |
DE1542972C3 (de) | Herbicide Mittel | |
WO1999062337A2 (de) | Biogene kontrolle und einschränkung der vermehrung parasitärer boden-nematoden bei der pflanzenaufzucht | |
DE2512556C2 (de) | Cyclische Diphosphorverbindungen, ihre Herstellung und diese enthaltende fungizide Zusammensetzungen | |
DE2154634A1 (US06291589-20010918-C00001.png) | ||
DE2805941C2 (de) | Hydraziniumphosphite, ihre Herstellung und funigzide Zusammensetzungen | |
DE2144700A1 (de) | Benzyl-N,N-di-sek.~butylthiolcarbamat und seine Verwendung | |
DE963113C (de) | Unkrautbekaempfungsmittel und Verfahren zu seiner Verwendung | |
DE942057C (de) | Unkrautvertilgungsmittel | |
DE3524334A1 (de) | Mittel zur beeinflussung der pflanzenentwicklung | |
DE944404C (de) | Insektenbekaempfungsmittel | |
DE952666C (de) | Behandlung von Pflanzen zwecks Bekaempfung von tierischen Parasiten sowie von Krankheitserregern | |
DE1567218C3 (de) | Verwendung von 4-Chlorphenoxyessigsäureamid-Derivaten als Herbizide | |
EP0005227B1 (de) | Akarizide und insektizide Mittel sowie deren Verwendung zur Schädlingsbekämpfung | |
AT240647B (de) | Nematozide Zubereitungen | |
DE2815345A1 (de) | Regulierung der entwicklung von baumwollpflanzen | |
DE1542942C3 (de) | Herbicides Mittel |