DD207903A5 - Verfahren zur herstellung von substituierten benzylhalogeniden - Google Patents
Verfahren zur herstellung von substituierten benzylhalogeniden Download PDFInfo
- Publication number
- DD207903A5 DD207903A5 DD83248846A DD24884683A DD207903A5 DD 207903 A5 DD207903 A5 DD 207903A5 DD 83248846 A DD83248846 A DD 83248846A DD 24884683 A DD24884683 A DD 24884683A DD 207903 A5 DD207903 A5 DD 207903A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- item
- chloromethyl
- substituent
- benzyl
- halide
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 49
- 238000004519 manufacturing process Methods 0.000 title description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical class [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 title 1
- -1 benzylic halides Chemical class 0.000 claims abstract description 41
- 150000004820 halides Chemical class 0.000 claims abstract description 25
- HTMQZWFSTJVJEQ-UHFFFAOYSA-N benzylsulfinylmethylbenzene Chemical class C=1C=CC=CC=1CS(=O)CC1=CC=CC=C1 HTMQZWFSTJVJEQ-UHFFFAOYSA-N 0.000 claims abstract description 23
- 238000006243 chemical reaction Methods 0.000 claims abstract description 23
- 230000008569 process Effects 0.000 claims abstract description 20
- 239000002253 acid Substances 0.000 claims abstract description 19
- 238000002360 preparation method Methods 0.000 claims abstract description 14
- 125000001424 substituent group Chemical group 0.000 claims description 34
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 26
- 239000002904 solvent Substances 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 150000003462 sulfoxides Chemical class 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 230000001590 oxidative effect Effects 0.000 claims description 8
- CTLRITSBJZQTNM-UHFFFAOYSA-N 2-(chloromethyl)-6-(trifluoromethyl)aniline Chemical group NC1=C(CCl)C=CC=C1C(F)(F)F CTLRITSBJZQTNM-UHFFFAOYSA-N 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- 150000002500 ions Chemical class 0.000 claims description 5
- AKZWHYLRQANKGA-UHFFFAOYSA-N 2-amino-3-(chloromethyl)benzonitrile Chemical compound NC1=C(CCl)C=CC=C1C#N AKZWHYLRQANKGA-UHFFFAOYSA-N 0.000 claims description 4
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 claims description 4
- 230000003213 activating effect Effects 0.000 claims description 4
- 125000004122 cyclic group Chemical group 0.000 claims description 4
- 238000011065 in-situ storage Methods 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 3
- 239000012346 acetyl chloride Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical class [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- FVRDHOGHLUCNMV-UHFFFAOYSA-N n-[2-(chloromethyl)-6-(trifluoromethyl)phenyl]acetamide Chemical group CC(=O)NC1=C(CCl)C=CC=C1C(F)(F)F FVRDHOGHLUCNMV-UHFFFAOYSA-N 0.000 claims description 3
- IJADETSFESVHEI-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxyaniline Chemical group COC1=CC=CC(CCl)=C1N IJADETSFESVHEI-UHFFFAOYSA-N 0.000 claims description 2
- MRTPFROFKVXZRU-UHFFFAOYSA-N 2-(chloromethyl)-6-methylaniline Chemical compound CC1=CC=CC(CCl)=C1N MRTPFROFKVXZRU-UHFFFAOYSA-N 0.000 claims description 2
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 claims description 2
- ISVGVBSZLPZCJK-UHFFFAOYSA-N 3-chloro-6-(chloromethyl)-2-methoxyaniline Chemical compound COC1=C(Cl)C=CC(CCl)=C1N ISVGVBSZLPZCJK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001266 acyl halides Chemical class 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- NUXLOJGLOHSJEF-UHFFFAOYSA-N 1,1-bis(4-chlorophenyl)ethanol;(4-chlorophenyl)sulfanyl-(2,4,5-trichlorophenyl)diazene Chemical compound C=1C=C(Cl)C=CC=1C(O)(C)C1=CC=C(Cl)C=C1.C1=CC(Cl)=CC=C1SN=NC1=CC(Cl)=C(Cl)C=C1Cl NUXLOJGLOHSJEF-UHFFFAOYSA-N 0.000 claims 1
- IQDHVJHXJCNISY-UHFFFAOYSA-N 2-(chloromethyl)-6-ethylaniline Chemical group CCC1=CC=CC(CCl)=C1N IQDHVJHXJCNISY-UHFFFAOYSA-N 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims 1
- 239000004202 carbamide Substances 0.000 claims 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 21
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 21
- 239000000047 product Substances 0.000 description 20
- 239000000243 solution Substances 0.000 description 18
- 238000006956 Pummerer reaction Methods 0.000 description 12
- 230000002159 abnormal effect Effects 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-O phenylazanium Chemical class [NH3+]C1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-O 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- 125000003118 aryl group Chemical group 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- 230000004913 activation Effects 0.000 description 5
- 230000005587 bubbling Effects 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 229910000039 hydrogen halide Inorganic materials 0.000 description 5
- 239000012433 hydrogen halide Substances 0.000 description 5
- GLBQVJGBPFPMMV-UHFFFAOYSA-N sulfilimine Chemical compound S=N GLBQVJGBPFPMMV-UHFFFAOYSA-N 0.000 description 5
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 230000002363 herbicidal effect Effects 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000008707 rearrangement Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 150000003568 thioethers Chemical class 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- QTEYDTXRTCNUCO-UHFFFAOYSA-N 2-(methylsulfinylmethyl)-6-(trifluoromethyl)aniline Chemical compound CS(=O)CC1=CC=CC(C(F)(F)F)=C1N QTEYDTXRTCNUCO-UHFFFAOYSA-N 0.000 description 2
- OFQPKKGMNWASPN-UHFFFAOYSA-N Benzyl methyl sulfide Chemical compound CSCC1=CC=CC=C1 OFQPKKGMNWASPN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LISVNGUOWUKZQY-UHFFFAOYSA-N Methyl benzyl sulfoxide Chemical compound CS(=O)CC1=CC=CC=C1 LISVNGUOWUKZQY-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical class CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- LSNZDSZHZXNVCN-UHFFFAOYSA-N 1-methoxy-4-[(4-methoxyphenyl)methylsulfinylmethyl]benzene Chemical compound C1=CC(OC)=CC=C1CS(=O)CC1=CC=C(OC)C=C1 LSNZDSZHZXNVCN-UHFFFAOYSA-N 0.000 description 1
- AWUQKTSPRJBWCX-UHFFFAOYSA-N 2-(chloromethyl)-4-methoxyaniline Chemical group COC1=CC=C(N)C(CCl)=C1 AWUQKTSPRJBWCX-UHFFFAOYSA-N 0.000 description 1
- AWUFEMPPABUXSZ-UHFFFAOYSA-N 2-(methylsulfanylmethyl)-6-(trifluoromethyl)aniline Chemical compound CSCC1=CC=CC(C(F)(F)F)=C1N AWUFEMPPABUXSZ-UHFFFAOYSA-N 0.000 description 1
- ULGVCLLENSJGFX-UHFFFAOYSA-N 2-amino-3-(methylsulfinylmethyl)benzonitrile Chemical compound CS(=O)CC1=CC=CC(C#N)=C1N ULGVCLLENSJGFX-UHFFFAOYSA-N 0.000 description 1
- LXPCTHRQJVSSIQ-UHFFFAOYSA-N 2-methyl-6-(trifluoromethyl)aniline Chemical compound CC1=CC=CC(C(F)(F)F)=C1N LXPCTHRQJVSSIQ-UHFFFAOYSA-N 0.000 description 1
- DAKUXQRKCUCIMV-UHFFFAOYSA-N 3-methylcyclohexyne Chemical compound CC1CCCC#C1 DAKUXQRKCUCIMV-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical group [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 102100037804 Inositol oxygenase Human genes 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 101150089916 Miox gene Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- HOSGENXQRDHJNF-UHFFFAOYSA-N [amino(phenyl)methyl]sulfinyl-phenylmethanamine Chemical compound C=1C=CC=CC=1C(N)S(=O)C(N)C1=CC=CC=C1 HOSGENXQRDHJNF-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- 230000002547 anomalous effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- TXDLNDSQBXCXKE-UHFFFAOYSA-N azane;chloromethylbenzene Chemical compound N.ClCC1=CC=CC=C1 TXDLNDSQBXCXKE-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- LUFPJJNWMYZRQE-UHFFFAOYSA-N benzylsulfanylmethylbenzene Chemical compound C=1C=CC=CC=1CSCC1=CC=CC=C1 LUFPJJNWMYZRQE-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 125000006003 dichloroethyl group Chemical group 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- GKCSPGZBMIBOJH-UHFFFAOYSA-N methyl 2-amino-3-(chloromethyl)benzoate Chemical compound COC(=O)C1=CC=CC(CCl)=C1N GKCSPGZBMIBOJH-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- RFIZPYFNEYSHKG-UHFFFAOYSA-N pyrrolidine-2,5-dione;sodium Chemical compound [Na].O=C1CCC(=O)N1 RFIZPYFNEYSHKG-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C321/00—Thiols, sulfides, hydropolysulfides or polysulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/24—Preparation of compounds containing amino groups bound to a carbon skeleton by reductive alkylation of ammonia, amines or compounds having groups reducible to amino groups, with carbonyl compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US35896682A | 1982-03-17 | 1982-03-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD207903A5 true DD207903A5 (de) | 1984-03-21 |
Family
ID=23411756
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD83248846A DD207903A5 (de) | 1982-03-17 | 1983-03-16 | Verfahren zur herstellung von substituierten benzylhalogeniden |
Country Status (16)
| Country | Link |
|---|---|
| EP (1) | EP0089330B1 (cs) |
| JP (1) | JPS58167525A (cs) |
| KR (1) | KR870000246B1 (cs) |
| AT (1) | ATE26698T1 (cs) |
| AU (1) | AU562361B2 (cs) |
| CS (1) | CS240955B2 (cs) |
| DD (1) | DD207903A5 (cs) |
| DE (1) | DE3371068D1 (cs) |
| GB (1) | GB2117380B (cs) |
| HU (1) | HU189673B (cs) |
| MY (1) | MY8700115A (cs) |
| NZ (1) | NZ203592A (cs) |
| PL (1) | PL241049A1 (cs) |
| PT (1) | PT76398B (cs) |
| RO (1) | RO87596B (cs) |
| ZA (1) | ZA831840B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP4779311B2 (ja) * | 2004-06-21 | 2011-09-28 | 井関農機株式会社 | ひまわり収穫機 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3894034A (en) * | 1973-01-29 | 1975-07-08 | Ohio State Res Found | A process for producing azasulfonium salts |
-
1983
- 1983-03-15 AT AT83870021T patent/ATE26698T1/de active
- 1983-03-15 EP EP83870021A patent/EP0089330B1/en not_active Expired
- 1983-03-15 DE DE8383870021T patent/DE3371068D1/de not_active Expired
- 1983-03-16 ZA ZA831840A patent/ZA831840B/xx unknown
- 1983-03-16 CS CS831829A patent/CS240955B2/cs unknown
- 1983-03-16 DD DD83248846A patent/DD207903A5/de unknown
- 1983-03-16 AU AU12492/83A patent/AU562361B2/en not_active Ceased
- 1983-03-16 NZ NZ203592A patent/NZ203592A/en unknown
- 1983-03-16 RO RO110354A patent/RO87596B/ro unknown
- 1983-03-16 HU HU83893A patent/HU189673B/hu unknown
- 1983-03-16 JP JP58042527A patent/JPS58167525A/ja active Pending
- 1983-03-16 KR KR1019830001060A patent/KR870000246B1/ko not_active Expired
- 1983-03-16 GB GB08307289A patent/GB2117380B/en not_active Expired
- 1983-03-16 PT PT76398A patent/PT76398B/pt unknown
- 1983-03-16 PL PL24104983A patent/PL241049A1/xx unknown
-
1987
- 1987-12-30 MY MY115/87A patent/MY8700115A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0089330B1 (en) | 1987-04-22 |
| GB2117380B (en) | 1986-04-23 |
| CS182983A2 (en) | 1985-06-13 |
| GB2117380A (en) | 1983-10-12 |
| MY8700115A (en) | 1987-12-31 |
| PT76398B (en) | 1985-12-05 |
| KR870000246B1 (ko) | 1987-02-21 |
| ZA831840B (en) | 1983-12-28 |
| AU1249283A (en) | 1983-09-22 |
| CS240955B2 (en) | 1986-03-13 |
| HU189673B (en) | 1986-07-28 |
| ATE26698T1 (de) | 1987-05-15 |
| RO87596A (ro) | 1985-08-31 |
| AU562361B2 (en) | 1987-06-11 |
| GB8307289D0 (en) | 1983-04-20 |
| PT76398A (en) | 1983-04-01 |
| PL241049A1 (en) | 1984-01-30 |
| NZ203592A (en) | 1986-02-21 |
| DE3371068D1 (en) | 1987-05-27 |
| KR840004058A (ko) | 1984-10-06 |
| RO87596B (ro) | 1985-09-01 |
| JPS58167525A (ja) | 1983-10-03 |
| EP0089330A3 (en) | 1985-03-27 |
| EP0089330A2 (en) | 1983-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69501487T2 (de) | Herstellung von Thioamiden | |
| EP0077501A1 (de) | Verfahren zur Herstellung von in o-Stellung substituierten Fluoraromaten | |
| DE3132332C2 (cs) | ||
| KR100429082B1 (ko) | 1,2-벤즈이소티아졸린-3-온의제조방법 | |
| DE1900133C3 (de) | Verfahren zur Herstellung von 2-(Morpholinothio)-benzothiazol | |
| DD207903A5 (de) | Verfahren zur herstellung von substituierten benzylhalogeniden | |
| DE2756560C2 (de) | Verfahren zur Herstellung von Piperonal | |
| EP0028392B1 (de) | Verfahren zur Herstellung von 2,3-Dioxo-1,4-benzoxazinderivaten | |
| DE3504073C2 (cs) | ||
| DE68904350T2 (de) | Herstellung von 3,5,6-trichlorpyridin-2-ol und zwischenprodukte dafuer. | |
| DE2044854C3 (de) | Verfahren zur Herstellung von CC-ungesättigten organischen Verbindungen durch Zersetzen der Xanthogenatester von entsprechenden Alkoholen | |
| EP0008055B1 (de) | Verfahren zur Herstellung von Di-(N-methyl-N-phenyl-thiuram)-disulfid | |
| US3480636A (en) | Process for preparing alpha-nitrosulfonic acids | |
| US2929846A (en) | Method of making a fungicidal substance | |
| EP0069905B1 (de) | Verfahren zur Herstellung von Hydrazidinen | |
| DD207902A5 (de) | Verfahren zur herstellung von ortho-methylanilinen | |
| DE3742984A1 (de) | Verfahren zur herstellung von 3-chlorisothiazol-verbindungen | |
| DE2321332C2 (de) | Verfahren zur Herstellung von 2-Nitro-5-chlor-benzolsulfonsäurechlorid oder von 2-Nitro-5-chlor-benzolsulfonsäure | |
| DE2616612C2 (de) | Verfahren zur Herstellung von Chlorsulfonylbenzoylchlorid | |
| DE69604878T2 (de) | Herstellung von Alkansulfonamiden mit niedrigen Ammonium-Restverunreinigungen | |
| CH420199A (de) | Verfahren zur Herstellung von Tetracyan-1,4-dithiin | |
| DE19735682A1 (de) | Verfahren zur Herstellung von 3-Isopropyl-1H-2,1,3-benzothiadiazin-4(3H)-on-2,2-dioxid | |
| DE1543941C (de) | Verfahren zur Herstellung von 1-Oxa-2-methyl-3-aminocarbonyl-4-thia-cyclohex-2-en-4-oxiden oder 4,4-dioxiden | |
| DE2505036C3 (de) | Verfahren zur Herstellung von organischen Sulfonylsemicarbaziden | |
| DD208975A5 (de) | Verfahren zur herstellung von haltbaren quarternaehren ortho-aminobenzylammoniumhalogenidsalzen |