DD201777A5 - Verfahren zum herstellen von neuen peptiden - Google Patents
Verfahren zum herstellen von neuen peptiden Download PDFInfo
- Publication number
- DD201777A5 DD201777A5 DD81233368A DD23336881A DD201777A5 DD 201777 A5 DD201777 A5 DD 201777A5 DD 81233368 A DD81233368 A DD 81233368A DD 23336881 A DD23336881 A DD 23336881A DD 201777 A5 DD201777 A5 DD 201777A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- group
- acid
- atoms
- compound
- pro
- Prior art date
Links
- 108090000765 processed proteins & peptides Proteins 0.000 title abstract description 11
- 102000004196 processed proteins & peptides Human genes 0.000 title abstract description 8
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 363
- 238000000034 method Methods 0.000 claims abstract description 75
- 125000001424 substituent group Chemical group 0.000 claims abstract description 16
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 6
- 230000008569 process Effects 0.000 claims abstract description 5
- -1 benzylthiomethyl Chemical group 0.000 claims description 284
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 209
- 125000004432 carbon atom Chemical group C* 0.000 claims description 109
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 53
- 125000000217 alkyl group Chemical group 0.000 claims description 42
- 150000003254 radicals Chemical class 0.000 claims description 41
- 150000003839 salts Chemical class 0.000 claims description 24
- 239000007858 starting material Substances 0.000 claims description 24
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 22
- 125000006239 protecting group Chemical group 0.000 claims description 18
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 17
- 230000002829 reductive effect Effects 0.000 claims description 17
- 150000002148 esters Chemical group 0.000 claims description 15
- 125000002947 alkylene group Chemical group 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 229910052794 bromium Inorganic materials 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 8
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 150000003568 thioethers Chemical class 0.000 claims description 7
- 229910014033 C-OH Inorganic materials 0.000 claims description 6
- 229910014570 C—OH Inorganic materials 0.000 claims description 6
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 6
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 6
- 125000005130 alkyl carbonyl thio group Chemical group 0.000 claims description 6
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 6
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 238000000338 in vitro Methods 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 5
- 231100000252 nontoxic Toxicity 0.000 claims description 5
- 230000003000 nontoxic effect Effects 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 4
- 125000006294 amino alkylene group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 4
- 150000001450 anions Chemical class 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 125000004982 dihaloalkyl group Chemical group 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 125000004970 halomethyl group Chemical group 0.000 claims description 4
- 125000002349 hydroxyamino group Chemical group [H]ON([H])[*] 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 125000005358 mercaptoalkyl group Chemical group 0.000 claims description 4
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000006307 alkoxy benzyl group Chemical group 0.000 claims description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 2
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000005334 azaindolyl group Chemical group N1N=C(C2=CC=CC=C12)* 0.000 claims description 2
- 238000005100 correlation spectroscopy Methods 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000004802 cyanophenyl group Chemical group 0.000 claims description 2
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 2
- 125000006371 dihalo methyl group Chemical group 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000001041 indolyl group Chemical group 0.000 claims description 2
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 2
- 125000002757 morpholinyl group Chemical group 0.000 claims description 2
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 229960005235 piperonyl butoxide Drugs 0.000 claims description 2
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims description 2
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- 101000588924 Anthopleura elegantissima Delta-actitoxin-Ael1a Proteins 0.000 claims 3
- 239000002262 Schiff base Substances 0.000 claims 1
- 150000004753 Schiff bases Chemical class 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 125000000686 lactone group Chemical group 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 107
- 102000004190 Enzymes Human genes 0.000 abstract description 15
- 108090000790 Enzymes Proteins 0.000 abstract description 15
- 102000015427 Angiotensins Human genes 0.000 abstract description 5
- 108010064733 Angiotensins Proteins 0.000 abstract description 5
- 239000003814 drug Substances 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 121
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 111
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 107
- 239000000203 mixture Substances 0.000 description 97
- 238000002474 experimental method Methods 0.000 description 78
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 74
- 239000002904 solvent Substances 0.000 description 59
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 48
- 239000011541 reaction mixture Substances 0.000 description 48
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 46
- 239000002253 acid Substances 0.000 description 37
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- 229960003767 alanine Drugs 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 35
- 235000019441 ethanol Nutrition 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 32
- 235000004279 alanine Nutrition 0.000 description 32
- 229960002429 proline Drugs 0.000 description 31
- 125000004494 ethyl ester group Chemical group 0.000 description 30
- 239000003112 inhibitor Substances 0.000 description 28
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 28
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 26
- 229940024606 amino acid Drugs 0.000 description 25
- UUUHXMGGBIUAPW-UHFFFAOYSA-N 1-[1-[2-[[5-amino-2-[[1-[5-(diaminomethylideneamino)-2-[[1-[3-(1h-indol-3-yl)-2-[(5-oxopyrrolidine-2-carbonyl)amino]propanoyl]pyrrolidine-2-carbonyl]amino]pentanoyl]pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-methylpentanoyl]pyrrolidine-2-carbon Chemical compound C1CCC(C(=O)N2C(CCC2)C(O)=O)N1C(=O)C(C(C)CC)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C(CC=1C2=CC=CC=C2NC=1)NC(=O)C1CCC(=O)N1 UUUHXMGGBIUAPW-UHFFFAOYSA-N 0.000 description 24
- 102000004270 Peptidyl-Dipeptidase A Human genes 0.000 description 24
- 108090000882 Peptidyl-Dipeptidase A Proteins 0.000 description 24
- 239000000706 filtrate Substances 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 23
- 239000000543 intermediate Substances 0.000 description 22
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 21
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 21
- 239000002808 molecular sieve Substances 0.000 description 20
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 20
- 238000003756 stirring Methods 0.000 description 19
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 description 18
- 229960000830 captopril Drugs 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- 150000001413 amino acids Chemical group 0.000 description 17
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 235000001014 amino acid Nutrition 0.000 description 15
- 239000012074 organic phase Substances 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 239000000758 substrate Substances 0.000 description 14
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- 230000000694 effects Effects 0.000 description 12
- 102400000344 Angiotensin-1 Human genes 0.000 description 11
- 101800000734 Angiotensin-1 Proteins 0.000 description 11
- ORWYRWWVDCYOMK-HBZPZAIKSA-N angiotensin I Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CC(C)C)C(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C1=CC=C(O)C=C1 ORWYRWWVDCYOMK-HBZPZAIKSA-N 0.000 description 11
- 238000004587 chromatography analysis Methods 0.000 description 11
- 235000011121 sodium hydroxide Nutrition 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- 239000007795 chemical reaction product Substances 0.000 description 10
- 125000004185 ester group Chemical group 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- 102400000345 Angiotensin-2 Human genes 0.000 description 9
- 101800000733 Angiotensin-2 Proteins 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 229950006323 angiotensin ii Drugs 0.000 description 9
- 229940107700 pyruvic acid Drugs 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 8
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 8
- CZGUSIXMZVURDU-JZXHSEFVSA-N Ile(5)-angiotensin II Chemical compound C([C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C([O-])=O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@@H]([NH3+])CC([O-])=O)C(C)C)C1=CC=C(O)C=C1 CZGUSIXMZVURDU-JZXHSEFVSA-N 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 229920005654 Sephadex Polymers 0.000 description 8
- 239000012507 Sephadex™ Substances 0.000 description 8
- 230000036772 blood pressure Effects 0.000 description 8
- 238000010168 coupling process Methods 0.000 description 8
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 238000007127 saponification reaction Methods 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 7
- 206010020772 Hypertension Diseases 0.000 description 7
- 239000008346 aqueous phase Substances 0.000 description 7
- 239000012267 brine Substances 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 150000004702 methyl esters Chemical class 0.000 description 7
- 229960005190 phenylalanine Drugs 0.000 description 7
- 238000004809 thin layer chromatography Methods 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 230000009471 action Effects 0.000 description 6
- 239000000872 buffer Substances 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 230000007935 neutral effect Effects 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- 239000011701 zinc Substances 0.000 description 6
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 229960002989 glutamic acid Drugs 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- BTNMPGBKDVTSJY-UHFFFAOYSA-N keto-phenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=CC=C1 BTNMPGBKDVTSJY-UHFFFAOYSA-N 0.000 description 5
- 150000002596 lactones Chemical group 0.000 description 5
- 230000020477 pH reduction Effects 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- XJJBXZIKXFOMLP-ZETCQYMHSA-N tert-butyl (2s)-pyrrolidine-2-carboxylate Chemical compound CC(C)(C)OC(=O)[C@@H]1CCCN1 XJJBXZIKXFOMLP-ZETCQYMHSA-N 0.000 description 5
- PMNLUUOXGOOLSP-UHFFFAOYSA-N 2-mercaptopropanoic acid Chemical compound CC(S)C(O)=O PMNLUUOXGOOLSP-UHFFFAOYSA-N 0.000 description 4
- TYEYBOSBBBHJIV-UHFFFAOYSA-N 2-oxobutanoic acid Chemical compound CCC(=O)C(O)=O TYEYBOSBBBHJIV-UHFFFAOYSA-N 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 4
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 4
- XMIIGOLPHOKFCH-UHFFFAOYSA-N 3-phenylpropionic acid Chemical compound OC(=O)CCC1=CC=CC=C1 XMIIGOLPHOKFCH-UHFFFAOYSA-N 0.000 description 4
- GZYFIMLSHBLMKF-UHFFFAOYSA-N ALBIZZIINE Chemical compound OC(=O)C(N)CNC(N)=O GZYFIMLSHBLMKF-UHFFFAOYSA-N 0.000 description 4
- 239000004475 Arginine Substances 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 4
- IDGQXGPQOGUGIX-VIFPVBQESA-N O-BENZYL-l-SERINE Chemical compound OC(=O)[C@@H](N)COCC1=CC=CC=C1 IDGQXGPQOGUGIX-VIFPVBQESA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- GVJHHUAWPYXKBD-UHFFFAOYSA-N d-alpha-tocopherol Natural products OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000004220 glutamic acid Substances 0.000 description 4
- 229960002449 glycine Drugs 0.000 description 4
- 230000003301 hydrolyzing effect Effects 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 239000000546 pharmaceutical excipient Substances 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000011877 solvent mixture Substances 0.000 description 4
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 4
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical class C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- OMGHIGVFLOPEHJ-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-1-ium-2-carboxylate Chemical compound OC(=O)C1NCC=C1 OMGHIGVFLOPEHJ-UHFFFAOYSA-N 0.000 description 3
- PPKAIMDMNWBOKN-UHFFFAOYSA-N 2-Oxo-4-phenylbutyric acid Chemical compound OC(=O)C(=O)CCC1=CC=CC=C1 PPKAIMDMNWBOKN-UHFFFAOYSA-N 0.000 description 3
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 3
- 239000001903 2-oxo-3-phenylpropanoic acid Substances 0.000 description 3
- QHKABHOOEWYVLI-UHFFFAOYSA-N 3-methyl-2-oxobutanoic acid Chemical compound CC(C)C(=O)C(O)=O QHKABHOOEWYVLI-UHFFFAOYSA-N 0.000 description 3
- AYZZGFLBVPUZQH-UHFFFAOYSA-N 4-(1h-indol-3-yl)-2-oxobutanoic acid Chemical compound C1=CC=C2C(CCC(=O)C(=O)O)=CNC2=C1 AYZZGFLBVPUZQH-UHFFFAOYSA-N 0.000 description 3
- BKAJNAXTPSGJCU-UHFFFAOYSA-N 4-methyl-2-oxopentanoic acid Chemical compound CC(C)CC(=O)C(O)=O BKAJNAXTPSGJCU-UHFFFAOYSA-N 0.000 description 3
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WPWUFUBLGADILS-WDSKDSINSA-N Ala-Pro Chemical compound C[C@H](N)C(=O)N1CCC[C@H]1C(O)=O WPWUFUBLGADILS-WDSKDSINSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- IADUEWIQBXOCDZ-VKHMYHEASA-N Azetidine-2-carboxylic acid Natural products OC(=O)[C@@H]1CCN1 IADUEWIQBXOCDZ-VKHMYHEASA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 101800004538 Bradykinin Proteins 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- CKLJMWTZIZZHCS-UWTATZPHSA-N D-aspartic acid Chemical compound OC(=O)[C@H](N)CC(O)=O CKLJMWTZIZZHCS-UWTATZPHSA-N 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical compound OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 3
- 239000004471 Glycine Substances 0.000 description 3
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 3
- XUJNEKJLAYXESH-REOHCLBHSA-N L-Cysteine Chemical compound SC[C@H](N)C(O)=O XUJNEKJLAYXESH-REOHCLBHSA-N 0.000 description 3
- 229930182821 L-proline Natural products 0.000 description 3
- 239000004472 Lysine Substances 0.000 description 3
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 239000004473 Threonine Substances 0.000 description 3
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 3
- 230000004872 arterial blood pressure Effects 0.000 description 3
- IADUEWIQBXOCDZ-UHFFFAOYSA-N azetidine-2-carboxylic acid Chemical compound OC(=O)C1CCN1 IADUEWIQBXOCDZ-UHFFFAOYSA-N 0.000 description 3
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 235000011089 carbon dioxide Nutrition 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 235000018417 cysteine Nutrition 0.000 description 3
- XUJNEKJLAYXESH-UHFFFAOYSA-N cysteine Natural products SCC(N)C(O)=O XUJNEKJLAYXESH-UHFFFAOYSA-N 0.000 description 3
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 3
- 235000013355 food flavoring agent Nutrition 0.000 description 3
- 238000004108 freeze drying Methods 0.000 description 3
- 238000006698 hydrazinolysis reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- XELZGAJCZANUQH-UHFFFAOYSA-N methyl 1-acetylthieno[3,2-c]pyrazole-5-carboxylate Chemical compound CC(=O)N1N=CC2=C1C=C(C(=O)OC)S2 XELZGAJCZANUQH-UHFFFAOYSA-N 0.000 description 3
- 229960003104 ornithine Drugs 0.000 description 3
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 3
- 230000003389 potentiating effect Effects 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 229960001153 serine Drugs 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- DZLNHFMRPBPULJ-UHFFFAOYSA-N thioproline Chemical compound OC(=O)C1CSCN1 DZLNHFMRPBPULJ-UHFFFAOYSA-N 0.000 description 3
- 229960004441 tyrosine Drugs 0.000 description 3
- UXWOYJLLMYKTQJ-VIFPVBQESA-N (2s)-2-amino-4-(cyclopentylmethylsulfanyl)butanoic acid Chemical compound OC(=O)[C@@H](N)CCSCC1CCCC1 UXWOYJLLMYKTQJ-VIFPVBQESA-N 0.000 description 2
- NDFOGZJAYLBOSU-AKGZTFGVSA-N (2s)-2-amino-5,6-dihydroxyhexanoic acid Chemical compound OC(=O)[C@@H](N)CCC(O)CO NDFOGZJAYLBOSU-AKGZTFGVSA-N 0.000 description 2
- RNXKXUOGQKYKTH-AKGZTFGVSA-N (2s)-4-methoxypyrrolidine-2-carboxylic acid Chemical compound COC1CN[C@H](C(O)=O)C1 RNXKXUOGQKYKTH-AKGZTFGVSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- AUYIERBBYROJDD-UHFFFAOYSA-N 2-(2-aminoindol-2-yl)acetic acid Chemical compound C1=CC=CC2=NC(N)(CC(O)=O)C=C21 AUYIERBBYROJDD-UHFFFAOYSA-N 0.000 description 2
- OBETXYAYXDNJHR-UHFFFAOYSA-N 2-Ethylhexanoic acid Chemical compound CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 2
- LLBKEUTWJFQRJU-UHFFFAOYSA-N 2-[4-(4-aminophenyl)sulfonylanilino]ethanol Chemical group C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(NCCO)C=C1 LLBKEUTWJFQRJU-UHFFFAOYSA-N 0.000 description 2
- LTLQSMNFQOAELQ-UHFFFAOYSA-N 2-amino-1,3-dihydroindene-2,5-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=C2CC(N)(C(O)=O)CC2=C1 LTLQSMNFQOAELQ-UHFFFAOYSA-N 0.000 description 2
- MONMFXREYOKQTI-UHFFFAOYSA-N 2-bromopropanoic acid Chemical compound CC(Br)C(O)=O MONMFXREYOKQTI-UHFFFAOYSA-N 0.000 description 2
- FGSBNBBHOZHUBO-UHFFFAOYSA-N 2-oxoadipic acid Chemical compound OC(=O)CCCC(=O)C(O)=O FGSBNBBHOZHUBO-UHFFFAOYSA-N 0.000 description 2
- JTNCEQNHURODLX-UHFFFAOYSA-N 2-phenylethanimidamide Chemical compound NC(=N)CC1=CC=CC=C1 JTNCEQNHURODLX-UHFFFAOYSA-N 0.000 description 2
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 description 2
- YMOQJIWHKXKWDN-UHFFFAOYSA-N 3-(4-cyanophenyl)-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CC1=CC=C(C#N)C=C1 YMOQJIWHKXKWDN-UHFFFAOYSA-N 0.000 description 2
- RSTKLPZEZYGQPY-UHFFFAOYSA-N 3-(indol-3-yl)pyruvic acid Chemical compound C1=CC=C2C(CC(=O)C(=O)O)=CNC2=C1 RSTKLPZEZYGQPY-UHFFFAOYSA-N 0.000 description 2
- VHVGNTVUSQUXPS-JAMMHHFISA-N 3-Phenylserine Chemical group OC(=O)[C@@H](N)C(O)C1=CC=CC=C1 VHVGNTVUSQUXPS-JAMMHHFISA-N 0.000 description 2
- ZKQKNYMCJALGFK-UHFFFAOYSA-N 3-cyclohexyl-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CC1CCCCC1 ZKQKNYMCJALGFK-UHFFFAOYSA-N 0.000 description 2
- ALRHLSYJTWAHJZ-UHFFFAOYSA-N 3-hydroxypropionic acid Chemical compound OCCC(O)=O ALRHLSYJTWAHJZ-UHFFFAOYSA-N 0.000 description 2
- BAQRRRYYSFQKIF-UHFFFAOYSA-N 3-methyl-2-oxobutanoyl chloride Chemical compound CC(C)C(=O)C(Cl)=O BAQRRRYYSFQKIF-UHFFFAOYSA-N 0.000 description 2
- HGIOOMCLOWLFTJ-UHFFFAOYSA-N 3-phenyl-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC1=CC=CC=C1 HGIOOMCLOWLFTJ-UHFFFAOYSA-N 0.000 description 2
- ZKRDTNHGGOKJNM-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-2-oxobutanoic acid Chemical compound OC(=O)C(=O)CCC1=CC=C(Cl)C(Cl)=C1 ZKRDTNHGGOKJNM-UHFFFAOYSA-N 0.000 description 2
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- KKADPXVIOXHVKN-UHFFFAOYSA-N 4-hydroxyphenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=C(O)C=C1 KKADPXVIOXHVKN-UHFFFAOYSA-N 0.000 description 2
- HFXAFXVXPMUQCQ-BYPYZUCNSA-N 4-oxo-L-proline Chemical compound OC(=O)[C@@H]1CC(=O)CN1 HFXAFXVXPMUQCQ-BYPYZUCNSA-N 0.000 description 2
- FKHRGABNNLLVAR-UHFFFAOYSA-N 5-ethoxy-2,5-dioxopentanoic acid Chemical compound CCOC(=O)CCC(=O)C(O)=O FKHRGABNNLLVAR-UHFFFAOYSA-N 0.000 description 2
- CIBNXHHWVVKRDY-UHFFFAOYSA-N 5-methyl-2-oxohexanoic acid Chemical compound CC(C)CCC(=O)C(O)=O CIBNXHHWVVKRDY-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- NGCXIFFZXAZRAF-UHFFFAOYSA-N 6-acetamido-2-oxohexanoic acid Chemical compound CC(=O)NCCCCC(=O)C(O)=O NGCXIFFZXAZRAF-UHFFFAOYSA-N 0.000 description 2
- UKFYEQPRZKSNON-UHFFFAOYSA-N 6-methyl-2-oxoheptanoic acid Chemical compound CC(C)CCCC(=O)C(O)=O UKFYEQPRZKSNON-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 241000167854 Bourreria succulenta Species 0.000 description 2
- 102400000967 Bradykinin Human genes 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- 108010071840 Cytosol nonspecific dipeptidase Proteins 0.000 description 2
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 2
- UQBOJOOOTLPNST-UHFFFAOYSA-N Dehydroalanine Chemical compound NC(=C)C(O)=O UQBOJOOOTLPNST-UHFFFAOYSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- GZYFIMLSHBLMKF-REOHCLBHSA-N L-Albizziine Chemical compound OC(=O)[C@@H](N)CNC(N)=O GZYFIMLSHBLMKF-REOHCLBHSA-N 0.000 description 2
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 2
- HXEACLLIILLPRG-YFKPBYRVSA-N L-pipecolic acid Chemical compound [O-]C(=O)[C@@H]1CCCC[NH2+]1 HXEACLLIILLPRG-YFKPBYRVSA-N 0.000 description 2
- YDGMGEXADBMOMJ-LURJTMIESA-N N(g)-dimethylarginine Chemical compound CN(C)C(\N)=N\CCC[C@H](N)C(O)=O YDGMGEXADBMOMJ-LURJTMIESA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- ODHCTXKNWHHXJC-GSVOUGTGSA-N Pyroglutamic acid Natural products OC(=O)[C@H]1CCC(=O)N1 ODHCTXKNWHHXJC-GSVOUGTGSA-N 0.000 description 2
- 108090000783 Renin Proteins 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- KZSNJWFQEVHDMF-UHFFFAOYSA-N Valine Chemical compound CC(C)C(N)C(O)=O KZSNJWFQEVHDMF-UHFFFAOYSA-N 0.000 description 2
- 229930003427 Vitamin E Natural products 0.000 description 2
- 238000000862 absorption spectrum Methods 0.000 description 2
- ODHCTXKNWHHXJC-UHFFFAOYSA-N acide pyroglutamique Natural products OC(=O)C1CCC(=O)N1 ODHCTXKNWHHXJC-UHFFFAOYSA-N 0.000 description 2
- DEDGUGJNLNLJSR-UHFFFAOYSA-N alpha-hydroxycinnamic acid Natural products OC(=O)C(O)=CC1=CC=CC=C1 DEDGUGJNLNLJSR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000000539 amino acid group Chemical group 0.000 description 2
- 229940124277 aminobutyric acid Drugs 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 235000006708 antioxidants Nutrition 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 238000001574 biopsy Methods 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 235000019693 cherries Nutrition 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 2
- HBOGUIFRIAXYNB-UHFFFAOYSA-N ethyl 2-hydroxy-3-phenylpropanoate Chemical compound CCOC(=O)C(O)CC1=CC=CC=C1 HBOGUIFRIAXYNB-UHFFFAOYSA-N 0.000 description 2
- IIFWIQQBZUIBLR-UHFFFAOYSA-N ethyl 4-methyl-2-sulfanylhexanoate Chemical compound CCOC(=O)C(S)CC(C)CC IIFWIQQBZUIBLR-UHFFFAOYSA-N 0.000 description 2
- 239000010685 fatty oil Substances 0.000 description 2
- 210000003191 femoral vein Anatomy 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 2
- 235000013922 glutamic acid Nutrition 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- HXEACLLIILLPRG-RXMQYKEDSA-N l-pipecolic acid Natural products OC(=O)[C@H]1CCCCN1 HXEACLLIILLPRG-RXMQYKEDSA-N 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- IUXVIPGPIFGSEU-INIZCTEOSA-N methyl (2s)-2-amino-3-(4-phenylmethoxyphenyl)propanoate Chemical compound C1=CC(C[C@H](N)C(=O)OC)=CC=C1OCC1=CC=CC=C1 IUXVIPGPIFGSEU-INIZCTEOSA-N 0.000 description 2
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 2
- OCKPCBLVNKHBMX-UHFFFAOYSA-N n-butyl-benzene Natural products CCCCC1=CC=CC=C1 OCKPCBLVNKHBMX-UHFFFAOYSA-N 0.000 description 2
- NTBSWACRSMKRRB-UHFFFAOYSA-N o-Hydroxyphenylpyruvic acid Natural products OC(=O)C(=O)CC1=CC=CC=C1O NTBSWACRSMKRRB-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 238000004810 partition chromatography Methods 0.000 description 2
- 229960001639 penicillamine Drugs 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 125000001151 peptidyl group Chemical group 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000002335 preservative effect Effects 0.000 description 2
- 150000003140 primary amides Chemical class 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 125000001308 pyruvoyl group Chemical group O=C([*])C(=O)C([H])([H])[H] 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 125000003607 serino group Chemical group [H]N([H])[C@]([H])(C(=O)[*])C(O[H])([H])[H] 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 2
- 150000007970 thio esters Chemical class 0.000 description 2
- 229960004295 valine Drugs 0.000 description 2
- 239000004474 valine Substances 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 235000019165 vitamin E Nutrition 0.000 description 2
- 239000011709 vitamin E Substances 0.000 description 2
- SSMKWGMAYVLYBJ-SECBINFHSA-N (2R)-1-(2-methylpropanoyl)-2-sulfanylpyrrolidine-2-carboxylic acid Chemical compound CC(C)C(=O)N1CCC[C@@]1(S)C(O)=O SSMKWGMAYVLYBJ-SECBINFHSA-N 0.000 description 1
- BJBUEDPLEOHJGE-UHFFFAOYSA-N (2R,3S)-3-Hydroxy-2-pyrolidinecarboxylic acid Natural products OC1CCNC1C(O)=O BJBUEDPLEOHJGE-UHFFFAOYSA-N 0.000 description 1
- BSBABVNDMZCKSE-BYPYZUCNSA-N (2S)-2-(difluoroamino)-3-methylbutanoic acid Chemical compound FN([C@@H](C(C)C)C(=O)O)F BSBABVNDMZCKSE-BYPYZUCNSA-N 0.000 description 1
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 1
- JAPMNWXYNYHZGZ-QMMMGPOBSA-N (2r)-2-amino-2-methyl-3-(2-methylpropylsulfanyl)propanoic acid Chemical compound CC(C)CSC[C@](C)(N)C(O)=O JAPMNWXYNYHZGZ-QMMMGPOBSA-N 0.000 description 1
- JQZCNHYREAEVKK-VIFPVBQESA-N (2r)-2-amino-2-methyl-3-(3-methylbutylsulfanyl)propanoic acid Chemical compound CC(C)CCSC[C@](C)(N)C(O)=O JQZCNHYREAEVKK-VIFPVBQESA-N 0.000 description 1
- LWKUSWORIVQIAU-YFKPBYRVSA-N (2r)-2-amino-2-methyl-3-methylsulfanylpropanoic acid Chemical compound CSC[C@](C)(N)C(O)=O LWKUSWORIVQIAU-YFKPBYRVSA-N 0.000 description 1
- DKKTXYCCRGEHPC-VIFPVBQESA-N (2r)-2-amino-2-methyl-3-pentylsulfanylpropanoic acid Chemical compound CCCCCSC[C@](C)(N)C(O)=O DKKTXYCCRGEHPC-VIFPVBQESA-N 0.000 description 1
- ZRBBFADVPJQXFF-ZETCQYMHSA-N (2r)-2-amino-2-methyl-3-propan-2-ylsulfanylpropanoic acid Chemical compound CC(C)SC[C@](C)(N)C(O)=O ZRBBFADVPJQXFF-ZETCQYMHSA-N 0.000 description 1
- LFLCENOSUFBYGP-ZETCQYMHSA-N (2r)-2-amino-2-methyl-3-propylsulfanylpropanoic acid Chemical compound CCCSC[C@](C)(N)C(O)=O LFLCENOSUFBYGP-ZETCQYMHSA-N 0.000 description 1
- PPNFGVZDIOCWDK-QMMMGPOBSA-N (2r)-2-amino-3-butylsulfanyl-2-methylpropanoic acid Chemical compound CCCCSC[C@](C)(N)C(O)=O PPNFGVZDIOCWDK-QMMMGPOBSA-N 0.000 description 1
- NMJNPLIFGMSGNZ-QMMMGPOBSA-N (2r)-2-amino-3-tert-butylsulfanyl-2-methylpropanoic acid Chemical compound CC(C)(C)SC[C@](C)(N)C(O)=O NMJNPLIFGMSGNZ-QMMMGPOBSA-N 0.000 description 1
- KIPDMPPOTUGMPW-SNVBAGLBSA-N (2r)-2-amino-4-benzylsulfanylbutanoic acid Chemical compound OC(=O)[C@H](N)CCSCC1=CC=CC=C1 KIPDMPPOTUGMPW-SNVBAGLBSA-N 0.000 description 1
- DLGMKSOKCBHKMG-QMMMGPOBSA-N (2r)-2-anilino-3-fluoropropanoic acid Chemical compound OC(=O)[C@H](CF)NC1=CC=CC=C1 DLGMKSOKCBHKMG-QMMMGPOBSA-N 0.000 description 1
- HLBPRUWPRRRMCK-PPSBICQBSA-N (2s)-1-[(2s)-2-(1-carboxyethylamino)propanoyl]pyrrolidine-2-carboxylic acid Chemical compound OC(=O)C(C)N[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O HLBPRUWPRRRMCK-PPSBICQBSA-N 0.000 description 1
- GKCBQPXKGNTQKX-VDGAXYAQSA-N (2s)-1-[(2s)-2-[[(2s)-2-benzamido-3-phenylpropanoyl]amino]propanoyl]pyrrolidine-2-carboxylic acid Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)NC(=O)C=1C=CC=CC=1)C1=CC=CC=C1 GKCBQPXKGNTQKX-VDGAXYAQSA-N 0.000 description 1
- OMGHIGVFLOPEHJ-BYPYZUCNSA-N (2s)-2,5-dihydro-1h-pyrrole-2-carboxylic acid Chemical compound OC(=O)[C@H]1NCC=C1 OMGHIGVFLOPEHJ-BYPYZUCNSA-N 0.000 description 1
- QTOUZGRCRVLFHQ-BYPYZUCNSA-N (2s)-2-(2,4,5-trihydroxyanilino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1=CC(O)=C(O)C=C1O QTOUZGRCRVLFHQ-BYPYZUCNSA-N 0.000 description 1
- GADBGEBOMCMDIU-ZETCQYMHSA-N (2s)-2-(2-ethoxy-5-nitroanilino)propanoic acid Chemical compound CCOC1=CC=C([N+]([O-])=O)C=C1N[C@@H](C)C(O)=O GADBGEBOMCMDIU-ZETCQYMHSA-N 0.000 description 1
- FOYXZVHDLXZETB-LBPRGKRZSA-N (2s)-2-(benzylazaniumyl)-3-(1h-imidazol-5-yl)propanoate Chemical compound C([C@@H](C(=O)O)NCC=1C=CC=CC=1)C1=CNC=N1 FOYXZVHDLXZETB-LBPRGKRZSA-N 0.000 description 1
- MVTHUEOHHHQQKY-QMMMGPOBSA-N (2s)-2-(diaminomethylideneamino)-3-phenylpropanoic acid Chemical compound NC(N)=N[C@H](C(O)=O)CC1=CC=CC=C1 MVTHUEOHHHQQKY-QMMMGPOBSA-N 0.000 description 1
- XGERCEBWYUDFOM-VKHMYHEASA-N (2s)-2-(methylideneamino)butanedioic acid Chemical compound OC(=O)C[C@H](N=C)C(O)=O XGERCEBWYUDFOM-VKHMYHEASA-N 0.000 description 1
- RRAJBPRNPLBANW-YFKPBYRVSA-N (2s)-2-(trimethylsilylamino)propanoic acid Chemical compound OC(=O)[C@H](C)N[Si](C)(C)C RRAJBPRNPLBANW-YFKPBYRVSA-N 0.000 description 1
- HBFHGJUIEHIHFT-MACXSXHHSA-N (2s)-2-[[(2r,3s,4r,5r)-5-(2-amino-6-oxo-3h-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]-4-sulfanylbutanoic acid Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1[C@@H]1O[C@H](CN[C@@H](CCS)C(O)=O)[C@@H](O)[C@H]1O HBFHGJUIEHIHFT-MACXSXHHSA-N 0.000 description 1
- REBWUCRWJNKVLL-LURJTMIESA-N (2s)-2-amino-3-(1h-pyrrol-2-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CN1 REBWUCRWJNKVLL-LURJTMIESA-N 0.000 description 1
- FICCYWIDRZLXIS-ZETCQYMHSA-N (2s)-2-amino-3-(1h-pyrrolo[3,2-b]pyridin-3-yl)propanoic acid Chemical compound C1=CN=C2C(C[C@H](N)C(O)=O)=CNC2=C1 FICCYWIDRZLXIS-ZETCQYMHSA-N 0.000 description 1
- JFDDIQNKNLUINS-LURJTMIESA-N (2s)-2-amino-3-(2,3,5,6-tetrafluorophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=C(F)C(F)=CC(F)=C1F JFDDIQNKNLUINS-LURJTMIESA-N 0.000 description 1
- MWCDQZBPLTYYSP-VIFPVBQESA-N (2s)-2-amino-3-(2,5-dimethoxy-4-methylphenyl)propanoic acid Chemical compound COC1=CC(C[C@H](N)C(O)=O)=C(OC)C=C1C MWCDQZBPLTYYSP-VIFPVBQESA-N 0.000 description 1
- BYXRWAYRLQEIRT-VKHMYHEASA-N (2s)-2-amino-3-(2-amino-6-oxo-3h-purin-9-yl)propanoic acid Chemical compound N1=C(N)N=C2N(C[C@H](N)C(O)=O)C=NC2=C1O BYXRWAYRLQEIRT-VKHMYHEASA-N 0.000 description 1
- SUZCEFCFAIWLGL-VKHMYHEASA-N (2s)-2-amino-3-(2-amino-6-sulfanylidene-3h-purin-9-yl)propanoic acid Chemical compound N1=C(N)N=C2N(C[C@H](N)C(O)=O)C=NC2=C1S SUZCEFCFAIWLGL-VKHMYHEASA-N 0.000 description 1
- WVXAXDTZEMZHQB-BYPYZUCNSA-N (2s)-2-amino-3-(2-aminoethylamino)propanoic acid Chemical compound NCCNC[C@H](N)C(O)=O WVXAXDTZEMZHQB-BYPYZUCNSA-N 0.000 description 1
- BRONSICUNQRLFP-QMMMGPOBSA-N (2s)-2-amino-3-(2-ethyl-4,5-dihydroxyphenyl)propanoic acid Chemical compound CCC1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O BRONSICUNQRLFP-QMMMGPOBSA-N 0.000 description 1
- IOYWTNNHQPFPDP-VIFPVBQESA-N (2s)-2-amino-3-(2-tert-butyl-4,5-dihydroxyphenyl)propanoic acid Chemical compound CC(C)(C)C1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O IOYWTNNHQPFPDP-VIFPVBQESA-N 0.000 description 1
- MXXMBZQIPZDATA-ZETCQYMHSA-N (2s)-2-amino-3-(3,4,5-triiodophenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC(I)=C(I)C(I)=C1 MXXMBZQIPZDATA-ZETCQYMHSA-N 0.000 description 1
- ZUFQWHALMXLGCS-AKGZTFGVSA-N (2s)-2-amino-3-(3-aminopropyl)butanedioic acid Chemical compound NCCCC(C(O)=O)[C@H](N)C(O)=O ZUFQWHALMXLGCS-AKGZTFGVSA-N 0.000 description 1
- NSCSKUVWGVFCLY-JTQLQIEISA-N (2s)-2-amino-3-(3-bromophenyl)-2-methylpropanoic acid Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(Br)=C1 NSCSKUVWGVFCLY-JTQLQIEISA-N 0.000 description 1
- FQZGACCJFXQSCQ-JTQLQIEISA-N (2s)-2-amino-3-(3-fluorophenyl)-2-methylpropanoic acid Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(F)=C1 FQZGACCJFXQSCQ-JTQLQIEISA-N 0.000 description 1
- IYEPWXAPHDCHBS-ZETCQYMHSA-N (2s)-2-amino-3-(3h-benzimidazol-5-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C2N=CNC2=C1 IYEPWXAPHDCHBS-ZETCQYMHSA-N 0.000 description 1
- JDWSIKUNMDDGCF-VIFPVBQESA-N (2s)-2-amino-3-(4,5-dihydroxy-2-propan-2-ylphenyl)propanoic acid Chemical compound CC(C)C1=CC(O)=C(O)C=C1C[C@H](N)C(O)=O JDWSIKUNMDDGCF-VIFPVBQESA-N 0.000 description 1
- XPRCPVGCTGELMN-QMMMGPOBSA-N (2s)-2-amino-3-(4-carbamimidoylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(N)=N)C=C1 XPRCPVGCTGELMN-QMMMGPOBSA-N 0.000 description 1
- DQLHSFUMICQIMB-VIFPVBQESA-N (2s)-2-amino-3-(4-methylphenyl)propanoic acid Chemical compound CC1=CC=C(C[C@H](N)C(O)=O)C=C1 DQLHSFUMICQIMB-VIFPVBQESA-N 0.000 description 1
- YTWNUUSHKAQWDZ-VKZKZBKNSA-N (2s)-2-amino-3-(4-nitroimidazol-4-yl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1([N+]([O-])=O)C=NC=N1 YTWNUUSHKAQWDZ-VKZKZBKNSA-N 0.000 description 1
- DKZIJCYVZNQMAU-QMMMGPOBSA-N (2s)-2-amino-3-(4-sulfanylphenyl)propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(S)C=C1 DKZIJCYVZNQMAU-QMMMGPOBSA-N 0.000 description 1
- PPHXPZMIUIDJKV-ZETCQYMHSA-N (2s)-2-amino-3-(6-chloro-4-methyl-1h-pyrrolo[2,3-b]pyridin-3-yl)propanoic acid Chemical compound CC1=CC(Cl)=NC2=C1C(C[C@H](N)C(O)=O)=CN2 PPHXPZMIUIDJKV-ZETCQYMHSA-N 0.000 description 1
- MUNRJYQFIYRMAQ-HNNXBMFYSA-N (2s)-2-amino-3-[3,5-bis(ethylsulfanyl)-4-(4-hydroxyphenoxy)phenyl]propanoic acid Chemical compound CCSC1=CC(C[C@H](N)C(O)=O)=CC(SCC)=C1OC1=CC=C(O)C=C1 MUNRJYQFIYRMAQ-HNNXBMFYSA-N 0.000 description 1
- LARNBHANOBFOGY-VIFPVBQESA-N (2s)-2-amino-3-[3-[(2-chloroacetyl)amino]phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(NC(=O)CCl)=C1 LARNBHANOBFOGY-VIFPVBQESA-N 0.000 description 1
- RECHJOLMOMKLOH-VIFPVBQESA-N (2s)-2-amino-3-[4-(2-bromoacetyl)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(=O)CBr)C=C1 RECHJOLMOMKLOH-VIFPVBQESA-N 0.000 description 1
- LYNSNQULPIJXAO-DHRDCHLVSA-N (2s)-2-amino-3-[4-(3-bromo-4-hydroxyphenoxy)-3,5-di(butan-2-yl)phenyl]propanoic acid Chemical compound CCC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)CC)=C1OC1=CC=C(O)C(Br)=C1 LYNSNQULPIJXAO-DHRDCHLVSA-N 0.000 description 1
- YZTKBJWKYGBVPL-SFHVURJKSA-N (2s)-2-amino-3-[4-(3-bromo-4-hydroxyphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CC=C(O)C(Br)=C1 YZTKBJWKYGBVPL-SFHVURJKSA-N 0.000 description 1
- UTXBHQJDWCMLPW-IEYKGCCVSA-N (2s)-2-amino-3-[4-(4-amino-4-hydroxycyclohexa-1,5-dien-1-yl)oxy-3,5-di(butan-2-yl)phenyl]propanoic acid Chemical compound CCC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)CC)=C1OC1=CCC(N)(O)C=C1 UTXBHQJDWCMLPW-IEYKGCCVSA-N 0.000 description 1
- VQDAEOPPYIXSKB-YMXDCFFPSA-N (2s)-2-amino-3-[4-(4-amino-4-hydroxycyclohexa-1,5-dien-1-yl)oxy-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CCC(N)(O)C=C1 VQDAEOPPYIXSKB-YMXDCFFPSA-N 0.000 description 1
- QHHWMOKQVCJRPS-KRWDZBQOSA-N (2s)-2-amino-3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]propanoic acid Chemical compound C1=C(O)C(C(C)C)=CC(OC=2C(=CC(C[C@H](N)C(O)=O)=CC=2C)C)=C1 QHHWMOKQVCJRPS-KRWDZBQOSA-N 0.000 description 1
- FLSWNGNXLWAVMK-IBGZPJMESA-N (2s)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound CC(C)C1=CC(C[C@H](N)C(O)=O)=CC(C(C)C)=C1OC1=CC=C(O)C=C1 FLSWNGNXLWAVMK-IBGZPJMESA-N 0.000 description 1
- FYMNTAQFDTZISY-QMMMGPOBSA-N (2s)-2-amino-3-[4-(diaminomethylideneamino)phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N=C(N)N)C=C1 FYMNTAQFDTZISY-QMMMGPOBSA-N 0.000 description 1
- YNLOZYCMUQNFNZ-VIFPVBQESA-N (2s)-2-amino-3-[4-[(2-bromoacetyl)amino]phenyl]propanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(NC(=O)CBr)C=C1 YNLOZYCMUQNFNZ-VIFPVBQESA-N 0.000 description 1
- GHBAYRBVXCRIHT-SECBINFHSA-N (2s)-2-amino-3-benzylsulfanylpropanoic acid Chemical compound OC(=O)[C@H](N)CSCC1=CC=CC=C1 GHBAYRBVXCRIHT-SECBINFHSA-N 0.000 description 1
- JNHATNWAMGXQJQ-AKGZTFGVSA-N (2s)-2-amino-3-methyl-4-methylsulfanylbutanoic acid Chemical compound CSCC(C)[C@H](N)C(O)=O JNHATNWAMGXQJQ-AKGZTFGVSA-N 0.000 description 1
- LXRUAYBIUSUULX-NFJMKROFSA-N (2s)-2-amino-3-methylbutanedioic acid Chemical compound OC(=O)C(C)[C@H](N)C(O)=O LXRUAYBIUSUULX-NFJMKROFSA-N 0.000 description 1
- UAMWJYRYDNTFAQ-VKHMYHEASA-N (2s)-2-amino-3-methylidenebutanedioic acid Chemical compound OC(=O)[C@@H](N)C(=C)C(O)=O UAMWJYRYDNTFAQ-VKHMYHEASA-N 0.000 description 1
- SBTLHKXSISNXTP-YFKPBYRVSA-N (2s)-2-amino-3-methylidenepentanoic acid Chemical compound CCC(=C)[C@H](N)C(O)=O SBTLHKXSISNXTP-YFKPBYRVSA-N 0.000 description 1
- XDGLJHLHGJQLQG-AKGZTFGVSA-N (2s)-2-amino-3-propylbutanedioic acid Chemical compound CCCC(C(O)=O)[C@H](N)C(O)=O XDGLJHLHGJQLQG-AKGZTFGVSA-N 0.000 description 1
- DFZVZEMNPGABKO-ZETCQYMHSA-N (2s)-2-amino-3-pyridin-3-ylpropanoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=CN=C1 DFZVZEMNPGABKO-ZETCQYMHSA-N 0.000 description 1
- AVUJSZHBQSYJRR-NSHDSACASA-N (2s)-2-amino-4-(3-amino-2,4,6-triiodophenyl)-2-methylbutanoic acid Chemical compound OC(=O)[C@](N)(C)CCC1=C(I)C=C(I)C(N)=C1I AVUJSZHBQSYJRR-NSHDSACASA-N 0.000 description 1
- UZBDSDZPGQJZMC-LURJTMIESA-N (2s)-2-amino-4-(3-aminopropylsulfanyl)butanoic acid Chemical compound NCCCSCC[C@H](N)C(O)=O UZBDSDZPGQJZMC-LURJTMIESA-N 0.000 description 1
- NHQFDNPXQBGRMG-NSHDSACASA-N (2s)-2-amino-4-(3-hydroxy-2,4,6-triiodophenyl)-2-methylbutanoic acid Chemical compound OC(=O)[C@](N)(C)CCC1=C(I)C=C(I)C(O)=C1I NHQFDNPXQBGRMG-NSHDSACASA-N 0.000 description 1
- YCSFMOVBARTLBW-YFKPBYRVSA-N (2s)-2-amino-4-ethoxybutanoic acid Chemical compound CCOCC[C@H](N)C(O)=O YCSFMOVBARTLBW-YFKPBYRVSA-N 0.000 description 1
- OQFSQFPPLPISGP-REOHCLBHSA-N (2s)-2-aminoethane-1,1,2-tricarboxylic acid Chemical compound OC(=O)[C@@H](N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-REOHCLBHSA-N 0.000 description 1
- RCYLCZQGMUWCBV-JTQLQIEISA-N (2s)-2-azaniumyl-3-(3-iodophenyl)-2-methylpropanoate Chemical compound OC(=O)[C@](N)(C)CC1=CC=CC(I)=C1 RCYLCZQGMUWCBV-JTQLQIEISA-N 0.000 description 1
- RMYPEYHEPIZYDJ-JTQLQIEISA-N (2s)-2-azaniumyl-3-(4-ethoxyphenyl)propanoate Chemical compound CCOC1=CC=C(C[C@H](N)C(O)=O)C=C1 RMYPEYHEPIZYDJ-JTQLQIEISA-N 0.000 description 1
- DDCPKNYKNWXULB-YFKPBYRVSA-N (2s)-2-azaniumyl-3-[(2-methylpropan-2-yl)oxy]propanoate Chemical class CC(C)(C)OC[C@H]([NH3+])C([O-])=O DDCPKNYKNWXULB-YFKPBYRVSA-N 0.000 description 1
- SNZIFNXFAFKRKT-NSHDSACASA-N (2s)-2-azaniumyl-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate Chemical compound CC(C)(C)OC1=CC=C(C[C@H]([NH3+])C([O-])=O)C=C1 SNZIFNXFAFKRKT-NSHDSACASA-N 0.000 description 1
- QNDSZPLLLMNLBY-JTQLQIEISA-N (2s)-3-(3-amino-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CC1=CC=C(O)C(N)=C1 QNDSZPLLLMNLBY-JTQLQIEISA-N 0.000 description 1
- XRUZZWBPZICCSB-BYPYZUCNSA-N (2s)-3-(4-amino-2-oxopyrimidin-1-yl)-2-azaniumylpropanoate Chemical compound NC=1C=CN(C[C@H]([NH3+])C([O-])=O)C(=O)N=1 XRUZZWBPZICCSB-BYPYZUCNSA-N 0.000 description 1
- RUQLVQSODALTBB-KRWDZBQOSA-N (2s)-3-[4-(4-hydroxyphenoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound C1=CC(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 RUQLVQSODALTBB-KRWDZBQOSA-N 0.000 description 1
- HSQIYOPBCOPMSS-ZETCQYMHSA-N (2s)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCCN=C(N)N HSQIYOPBCOPMSS-ZETCQYMHSA-N 0.000 description 1
- VVNYDCGZZSTUBC-LURJTMIESA-N (2s)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid Chemical compound CC(C)(C)OC(=O)N[C@H](C(O)=O)CCC(N)=O VVNYDCGZZSTUBC-LURJTMIESA-N 0.000 description 1
- QJHBJHUKURJDLG-YFKPBYRVSA-N (2s)-6-amino-2-(hydroxyamino)hexanoic acid Chemical compound NCCCC[C@H](NO)C(O)=O QJHBJHUKURJDLG-YFKPBYRVSA-N 0.000 description 1
- LULHTUNPBBMNSJ-UHNVWZDZSA-N (2s,3r)-2-amino-3-ethoxybutanoic acid Chemical compound CCO[C@H](C)[C@H](N)C(O)=O LULHTUNPBBMNSJ-UHNVWZDZSA-N 0.000 description 1
- XHNHHUFIUAJZNF-INEUFUBQSA-N (2s,3r)-2-amino-3-hydroxy-3-methylpentanoic acid Chemical compound CC[C@@](C)(O)[C@H](N)C(O)=O XHNHHUFIUAJZNF-INEUFUBQSA-N 0.000 description 1
- KPIXLPPFVSFATP-IYSWYEEDSA-N (2s,3r)-2-amino-3-methoxy-3-methylpentanoic acid Chemical compound CC[C@@](C)(OC)[C@H](N)C(O)=O KPIXLPPFVSFATP-IYSWYEEDSA-N 0.000 description 1
- ONOURAAVVKGJNM-SCZZXKLOSA-N (2s,3r)-2-azaniumyl-3-phenylmethoxybutanoate Chemical compound [O-]C(=O)[C@@H]([NH3+])[C@@H](C)OCC1=CC=CC=C1 ONOURAAVVKGJNM-SCZZXKLOSA-N 0.000 description 1
- QJCNLJWUIOIMMF-YUMQZZPRSA-N (2s,3s)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CC[C@H](C)[C@@H](C(O)=O)NC(=O)OC(C)(C)C QJCNLJWUIOIMMF-YUMQZZPRSA-N 0.000 description 1
- HGRWHBQLRXWSLV-DEOSSOPVSA-N (4s)-3'-(3,6-dihydro-2h-pyran-5-yl)-1'-fluoro-7'-(3-fluoropyridin-2-yl)spiro[5h-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine Chemical compound C1OC(N)=N[C@]21C1=CC(C=3COCCC=3)=NC(F)=C1OC1=CC=C(C=3C(=CC=CN=3)F)C=C12 HGRWHBQLRXWSLV-DEOSSOPVSA-N 0.000 description 1
- GRZHHTYDZVRPIC-UHFFFAOYSA-N (benzyloxy)acetic acid Chemical compound OC(=O)COCC1=CC=CC=C1 GRZHHTYDZVRPIC-UHFFFAOYSA-N 0.000 description 1
- DEOWHQAFPBKSMV-UHFFFAOYSA-N 1,5-dihydroxypentan-3-one Chemical compound OCCC(=O)CCO DEOWHQAFPBKSMV-UHFFFAOYSA-N 0.000 description 1
- CWZUTHDJLNZLCM-DFBGVHRSSA-N 1-[2-[(1r,3s,5r)-3-[(6-bromopyridin-2-yl)carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]-2-oxoethyl]indazole-3-carboxamide Chemical compound O=C([C@@H]1C[C@H]2C[C@H]2N1C(=O)CN1N=C(C2=CC=CC=C21)C(=O)N)NC1=CC=CC(Br)=N1 CWZUTHDJLNZLCM-DFBGVHRSSA-N 0.000 description 1
- ODTNRWGIIUZDHW-UHFFFAOYSA-N 1-diazonio-4-phenylbut-1-en-2-olate Chemical compound [N-]=[N+]=CC(=O)CCC1=CC=CC=C1 ODTNRWGIIUZDHW-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-UHFFFAOYSA-N 13-cis retinol Natural products OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-UHFFFAOYSA-N 0.000 description 1
- RZYHXKLKJRGJGP-UHFFFAOYSA-N 2,2,2-trifluoro-n,n-bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)N([Si](C)(C)C)C(=O)C(F)(F)F RZYHXKLKJRGJGP-UHFFFAOYSA-N 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- BHLMPCPJODEJRG-UHFFFAOYSA-N 2,6-diaminohex-4-ynoic acid Chemical compound NCC#CCC(N)C(O)=O BHLMPCPJODEJRG-UHFFFAOYSA-N 0.000 description 1
- APAUAYLVDHNFBF-UHFFFAOYSA-N 2-(2-hydroxyphenyl)-1,3-thiazolidine-4-carboxylic acid Chemical compound N1C(C(=O)O)CSC1C1=CC=CC=C1O APAUAYLVDHNFBF-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- UZAGRLZNUCTZIT-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-oxo-4-phenylbutanoate Chemical compound CN(C)CCOC(=O)C(=O)CCC1=CC=CC=C1 UZAGRLZNUCTZIT-UHFFFAOYSA-N 0.000 description 1
- IDDYNNYMUPHFMO-UHFFFAOYSA-N 2-Keto-n-heptylic acid Chemical compound CCCCCC(=O)C(O)=O IDDYNNYMUPHFMO-UHFFFAOYSA-N 0.000 description 1
- YSZAJVHOAVCJFQ-QMMMGPOBSA-N 2-[(2s)-2-amino-2-carboxyethyl]-5-hydroxybenzoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1C(O)=O YSZAJVHOAVCJFQ-QMMMGPOBSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- LUQBDMIQOXUAEQ-UHFFFAOYSA-N 2-[2-bromo-4-[(2-methylpropan-2-yl)oxy]phenyl]acetic acid Chemical compound CC(C)(C)OC1=CC=C(CC(O)=O)C(Br)=C1 LUQBDMIQOXUAEQ-UHFFFAOYSA-N 0.000 description 1
- SQMNVQXCSHRTOP-UHFFFAOYSA-N 2-amino-2-(3,5-dibromo-4-hydroxyphenyl)acetic acid Chemical compound OC(=O)C(N)C1=CC(Br)=C(O)C(Br)=C1 SQMNVQXCSHRTOP-UHFFFAOYSA-N 0.000 description 1
- LTDTUZSHTIJYIF-UHFFFAOYSA-N 2-amino-2-methyl-4-oxo-6-phenylhexanoic acid Chemical compound OC(=O)C(N)(C)CC(=O)CCC1=CC=CC=C1 LTDTUZSHTIJYIF-UHFFFAOYSA-N 0.000 description 1
- HBDUOPBBUNDYLE-UHFFFAOYSA-N 2-amino-2-methyl-4-oxopentanoic acid Chemical compound CC(=O)CC(C)(N)C(O)=O HBDUOPBBUNDYLE-UHFFFAOYSA-N 0.000 description 1
- QHSCIWIRXWFIGH-UHFFFAOYSA-N 2-amino-2-methylpentanedioic acid Chemical compound OC(=O)C(N)(C)CCC(O)=O QHSCIWIRXWFIGH-UHFFFAOYSA-N 0.000 description 1
- ATGSPCNBGHEKRW-UHFFFAOYSA-N 2-amino-3,3-dimethylhex-5-enoic acid Chemical compound C=CCC(C)(C)C(N)C(O)=O ATGSPCNBGHEKRW-UHFFFAOYSA-N 0.000 description 1
- BEFUFPUMGNJZEV-UHFFFAOYSA-N 2-amino-3,3-dimethylhexa-4,5-dienoic acid Chemical compound C=C=CC(C)(C)C(N)C(O)=O BEFUFPUMGNJZEV-UHFFFAOYSA-N 0.000 description 1
- XNLKIKNNGCSKQU-UHFFFAOYSA-N 2-amino-3-(4-fluoroimidazol-4-yl)propanoic acid Chemical compound OC(=O)C(N)CC1(F)C=NC=N1 XNLKIKNNGCSKQU-UHFFFAOYSA-N 0.000 description 1
- VBCSMZMAPIIUJQ-UHFFFAOYSA-N 2-amino-3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-di(propan-2-yl)phenyl]propanoic acid Chemical compound C1=C(O)C(C(C)C)=CC(OC=2C(=CC(CC(N)C(O)=O)=CC=2C(C)C)C(C)C)=C1 VBCSMZMAPIIUJQ-UHFFFAOYSA-N 0.000 description 1
- QAAAJCNONHZRTG-UHFFFAOYSA-N 2-amino-3-chloropentanedioic acid Chemical compound OC(=O)C(N)C(Cl)CC(O)=O QAAAJCNONHZRTG-UHFFFAOYSA-N 0.000 description 1
- LIAMCTICNTVEHD-UHFFFAOYSA-N 2-amino-3-hydroxy-6-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCC(O)C(N)(C(O)=O)NC(=O)OC(C)(C)C LIAMCTICNTVEHD-UHFFFAOYSA-N 0.000 description 1
- DJJDVURDQUREHS-UHFFFAOYSA-N 2-amino-3-methoxy-3-oxopropanoic acid Chemical compound COC(=O)C(N)C(O)=O DJJDVURDQUREHS-UHFFFAOYSA-N 0.000 description 1
- RAQYONYLNDYWKY-UHFFFAOYSA-N 2-amino-3-methylhepta-5,6-dienoic acid Chemical compound OC(=O)C(N)C(C)CC=C=C RAQYONYLNDYWKY-UHFFFAOYSA-N 0.000 description 1
- AKOINERHKFEQLT-UHFFFAOYSA-N 2-amino-4-(1h-pyrrol-2-yl)butanoic acid Chemical compound OC(=O)C(N)CCC1=CC=CN1 AKOINERHKFEQLT-UHFFFAOYSA-N 0.000 description 1
- QBLKAYIQCFZPFA-UHFFFAOYSA-N 2-amino-4-(3-iodophenyl)-2-methylbutanoic acid Chemical compound OC(=O)C(N)(C)CCC1=CC=CC(I)=C1 QBLKAYIQCFZPFA-UHFFFAOYSA-N 0.000 description 1
- SKSSCZUCLQZXMV-UHFFFAOYSA-N 2-amino-4-hydroxy-2-methylpentanoic acid Chemical compound CC(O)CC(C)(N)C(O)=O SKSSCZUCLQZXMV-UHFFFAOYSA-N 0.000 description 1
- GLNYGUGVGMUOAR-UHFFFAOYSA-N 2-amino-4-hydroxysulfonothioylbutanoic acid Chemical compound OC(=O)C(N)CCS(O)(=O)=S GLNYGUGVGMUOAR-UHFFFAOYSA-N 0.000 description 1
- KUPUYBKLZDKJSY-UHFFFAOYSA-N 2-amino-4-oxo-6-phenylhexanoic acid Chemical compound OC(=O)C(N)CC(=O)CCC1=CC=CC=C1 KUPUYBKLZDKJSY-UHFFFAOYSA-N 0.000 description 1
- QUCHWTCTBHQQDU-UHFFFAOYSA-N 2-amino-4-oxopentanoic acid Chemical compound CC(=O)CC([NH3+])C([O-])=O QUCHWTCTBHQQDU-UHFFFAOYSA-N 0.000 description 1
- GTUZDCUWVAGCRP-UHFFFAOYSA-N 2-amino-5,6-dihydroxy-1,3-dihydroindene-2-carboxylic acid Chemical compound OC1=C(O)C=C2CC(N)(C(O)=O)CC2=C1 GTUZDCUWVAGCRP-UHFFFAOYSA-N 0.000 description 1
- HBEFHUVCZDCVQM-UHFFFAOYSA-N 2-amino-5-chloro-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(Cl)C=C2CC(N)(C(O)=O)CC2=C1 HBEFHUVCZDCVQM-UHFFFAOYSA-N 0.000 description 1
- XJTXTAXBACZMBN-UHFFFAOYSA-N 2-amino-5-hydroxy-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(O)C=C2CC(N)(C(O)=O)CC2=C1 XJTXTAXBACZMBN-UHFFFAOYSA-N 0.000 description 1
- DZDAHNSLONRHLW-UHFFFAOYSA-N 2-amino-5-iodo-1,3-dihydroindene-2-carboxylic acid Chemical compound C1=C(I)C=C2CC(N)(C(O)=O)CC2=C1 DZDAHNSLONRHLW-UHFFFAOYSA-N 0.000 description 1
- XITCRIZJHHQTCH-UHFFFAOYSA-N 2-amino-5-methoxy-1,3-dihydroindene-2-carboxylic acid Chemical compound COC1=CC=C2CC(N)(C(O)=O)CC2=C1 XITCRIZJHHQTCH-UHFFFAOYSA-N 0.000 description 1
- DYCMDRVZQOLIMD-UHFFFAOYSA-N 2-amino-5-methylhepta-3,4-dienoic acid Chemical compound CCC(C)=C=CC(N)C(O)=O DYCMDRVZQOLIMD-UHFFFAOYSA-N 0.000 description 1
- RKVIDZZUVZAELE-UHFFFAOYSA-N 2-amino-5-tert-butyl-6,6-dimethylhepta-3,4-dienoic acid Chemical compound CC(C)(C)C(C(C)(C)C)=C=CC(N)C(O)=O RKVIDZZUVZAELE-UHFFFAOYSA-N 0.000 description 1
- PHWDBZCRUNKABS-UHFFFAOYSA-N 2-aminohepta-4,5-dienoic acid Chemical compound CC=C=CCC(N)C(O)=O PHWDBZCRUNKABS-UHFFFAOYSA-N 0.000 description 1
- NMNDMLQYTWPKSA-UHFFFAOYSA-N 2-aminohepta-5,6-dienoic acid Chemical compound OC(=O)C(N)CCC=C=C NMNDMLQYTWPKSA-UHFFFAOYSA-N 0.000 description 1
- LUYLVPILJAHRJD-UHFFFAOYSA-N 2-aminohexa-4,5-dienoic acid Chemical compound OC(=O)C(N)CC=C=C LUYLVPILJAHRJD-UHFFFAOYSA-N 0.000 description 1
- BKMMTJMQCTUHRP-UHFFFAOYSA-N 2-aminopropan-1-ol Chemical compound CC(N)CO BKMMTJMQCTUHRP-UHFFFAOYSA-N 0.000 description 1
- DEBQMEYEKKWIKC-UHFFFAOYSA-N 2-azaniumyl-3-(4-fluoro-1h-indol-3-yl)propanoate Chemical compound C1=CC(F)=C2C(CC(N)C(O)=O)=CNC2=C1 DEBQMEYEKKWIKC-UHFFFAOYSA-N 0.000 description 1
- GXQWQJTWVARFQS-UHFFFAOYSA-N 2-benzamidoacetic acid Chemical compound OC(=O)CNC(=O)C1=CC=CC=C1.OC(=O)CNC(=O)C1=CC=CC=C1 GXQWQJTWVARFQS-UHFFFAOYSA-N 0.000 description 1
- XXSPGBOGLXKMDU-UHFFFAOYSA-N 2-bromo-2-methylpropanoic acid Chemical compound CC(C)(Br)C(O)=O XXSPGBOGLXKMDU-UHFFFAOYSA-N 0.000 description 1
- QMVSHFLUZXESTN-UHFFFAOYSA-N 2-bromo-3-methoxypentanoic acid Chemical compound CCC(OC)C(Br)C(O)=O QMVSHFLUZXESTN-UHFFFAOYSA-N 0.000 description 1
- VKJQJNVYWGDEQN-UHFFFAOYSA-N 2-bromo-3-phenylmethoxypropanoic acid Chemical compound OC(=O)C(Br)COCC1=CC=CC=C1 VKJQJNVYWGDEQN-UHFFFAOYSA-N 0.000 description 1
- DROZQELYZZXYSX-UHFFFAOYSA-N 2-bromobutanoyl chloride Chemical compound CCC(Br)C(Cl)=O DROZQELYZZXYSX-UHFFFAOYSA-N 0.000 description 1
- YAQLSKVCTLCIIE-UHFFFAOYSA-N 2-bromobutyric acid Chemical compound CCC(Br)C(O)=O YAQLSKVCTLCIIE-UHFFFAOYSA-N 0.000 description 1
- OZGMODDEIHYPRY-UHFFFAOYSA-N 2-bromopropanoyl chloride Chemical compound CC(Br)C(Cl)=O OZGMODDEIHYPRY-UHFFFAOYSA-N 0.000 description 1
- IASIQPSVWNZTGZ-UHFFFAOYSA-N 2-methyl-2-sulfanylpentanedioic acid Chemical compound OC(=O)C(S)(C)CCC(O)=O IASIQPSVWNZTGZ-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- RSUOYCBRWUTZAO-UHFFFAOYSA-N 2-oxo-3-phenoxypropanoic acid Chemical compound OC(=O)C(=O)COC1=CC=CC=C1 RSUOYCBRWUTZAO-UHFFFAOYSA-N 0.000 description 1
- MLHLDFLQSMZQNK-UHFFFAOYSA-N 2-oxo-3-phenylpropanethioic s-acid Chemical compound SC(=O)C(=O)CC1=CC=CC=C1 MLHLDFLQSMZQNK-UHFFFAOYSA-N 0.000 description 1
- QDJVGSZTQJRNKQ-UHFFFAOYSA-N 2-oxo-4-(4-phenoxyphenyl)butanoic acid Chemical compound C1=CC(CCC(=O)C(=O)O)=CC=C1OC1=CC=CC=C1 QDJVGSZTQJRNKQ-UHFFFAOYSA-N 0.000 description 1
- HXVYSVJVIUDSBN-UHFFFAOYSA-N 2-oxo-4-phenylbutanethioic s-acid Chemical compound SC(=O)C(=O)CCC1=CC=CC=C1 HXVYSVJVIUDSBN-UHFFFAOYSA-N 0.000 description 1
- JBFDBSZCFDASAE-UHFFFAOYSA-N 2-oxodecanoic acid Chemical compound CCCCCCCCC(=O)C(O)=O JBFDBSZCFDASAE-UHFFFAOYSA-N 0.000 description 1
- GPPUPQFYDYLTIY-UHFFFAOYSA-N 2-oxooctanoic acid Chemical compound CCCCCCC(=O)C(O)=O GPPUPQFYDYLTIY-UHFFFAOYSA-N 0.000 description 1
- AUUTXOKCFQTKPL-UHFFFAOYSA-N 2-oxopropanoyl chloride Chemical compound CC(=O)C(Cl)=O AUUTXOKCFQTKPL-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- IAWVHZJZHDSEOC-UHFFFAOYSA-N 3,3-dimethyl-2-oxobutanoic acid Chemical compound CC(C)(C)C(=O)C(O)=O IAWVHZJZHDSEOC-UHFFFAOYSA-N 0.000 description 1
- VOOLHWPXPFEYAH-UHFFFAOYSA-N 3,3-dimethyl-2-oxopentanoic acid Chemical compound CCC(C)(C)C(=O)C(O)=O VOOLHWPXPFEYAH-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- ZAQXSMCYFQJRCQ-UHFFFAOYSA-N 3-(1-adamantyl)-2-azaniumylpropanoate Chemical compound C1C(C2)CC3CC2CC1(CC(N)C(O)=O)C3 ZAQXSMCYFQJRCQ-UHFFFAOYSA-N 0.000 description 1
- BBOOMRFBUGNJOS-UHFFFAOYSA-N 3-(1h-imidazol-2-yl)-2-oxopropanoic acid Chemical compound OC(=O)C(=O)CC1=NC=CN1 BBOOMRFBUGNJOS-UHFFFAOYSA-N 0.000 description 1
- GESJDJXTHHQBMC-UHFFFAOYSA-N 3-(4-hydroxyphenoxy)-2-oxopropanoic acid Chemical compound OC(=O)C(=O)COC1=CC=C(O)C=C1 GESJDJXTHHQBMC-UHFFFAOYSA-N 0.000 description 1
- KETLEKPFYHJPIN-UHFFFAOYSA-N 3-(4-nitrophenyl)-2-sulfanylpropanoic acid Chemical compound OC(=O)C(S)CC1=CC=C([N+]([O-])=O)C=C1 KETLEKPFYHJPIN-UHFFFAOYSA-N 0.000 description 1
- CAOMCZAIALVUPA-UHFFFAOYSA-N 3-(methylthio)propionic acid Chemical compound CSCCC(O)=O CAOMCZAIALVUPA-UHFFFAOYSA-N 0.000 description 1
- YASMWUYVDFUVPO-UHFFFAOYSA-N 3-amino-6-[(2-methylpropan-2-yl)oxy]-2,6-dioxohexanoic acid Chemical compound CC(C)(C)OC(=O)CCC(N)C(=O)C(O)=O YASMWUYVDFUVPO-UHFFFAOYSA-N 0.000 description 1
- UWHJEIOVUDJWAS-UHFFFAOYSA-N 3-benzyl-5-(dimethylamino)-2-oxopentanoic acid Chemical compound CN(C)CCC(C(=O)C(O)=O)CC1=CC=CC=C1 UWHJEIOVUDJWAS-UHFFFAOYSA-N 0.000 description 1
- NEGBRWMBIHKZDW-UHFFFAOYSA-N 3-benzylsulfanyl-3-methyl-2-oxobutanoic acid Chemical compound OC(=O)C(=O)C(C)(C)SCC1=CC=CC=C1 NEGBRWMBIHKZDW-UHFFFAOYSA-N 0.000 description 1
- VOIZNVUXCQLQHS-UHFFFAOYSA-N 3-bromobenzoic acid Chemical compound OC(=O)C1=CC=CC(Br)=C1 VOIZNVUXCQLQHS-UHFFFAOYSA-N 0.000 description 1
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 1
- PNYWALDMLUDDTA-UHFFFAOYSA-N 3-hydroxyphenylpyruvic acid Chemical compound OC(=O)C(=O)CC1=CC=CC(O)=C1 PNYWALDMLUDDTA-UHFFFAOYSA-N 0.000 description 1
- HHDDCCUIIUWNGJ-UHFFFAOYSA-N 3-hydroxypyruvic acid Chemical compound OCC(=O)C(O)=O HHDDCCUIIUWNGJ-UHFFFAOYSA-N 0.000 description 1
- ODOGURBVHZDJQF-UHFFFAOYSA-N 3-methoxy-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid Chemical compound CCC(OC)C(C)(C(O)=O)NC(=O)OC(C)(C)C ODOGURBVHZDJQF-UHFFFAOYSA-N 0.000 description 1
- JVQYSWDUAOAHFM-UHFFFAOYSA-N 3-methyl-2-oxovaleric acid Chemical compound CCC(C)C(=O)C(O)=O JVQYSWDUAOAHFM-UHFFFAOYSA-N 0.000 description 1
- WRKUXWSHBOIOHZ-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxy]-2,4-dioxobutanoic acid Chemical compound CC(C)(C)OC(=O)CC(=O)C(O)=O WRKUXWSHBOIOHZ-UHFFFAOYSA-N 0.000 description 1
- YXDGRBPZVQPESQ-QMMMGPOBSA-N 4-[(2s)-2-amino-2-carboxyethyl]benzoic acid Chemical compound OC(=O)[C@@H](N)CC1=CC=C(C(O)=O)C=C1 YXDGRBPZVQPESQ-QMMMGPOBSA-N 0.000 description 1
- BBYDXOIZLAWGSL-UHFFFAOYSA-N 4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1 BBYDXOIZLAWGSL-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 1
- 239000001142 4-methyl-2-oxopentanoic acid Substances 0.000 description 1
- SFJWLUAGMZINFE-UHFFFAOYSA-N 4-methyl-2-oxopentanoyl chloride Chemical compound CC(C)CC(=O)C(Cl)=O SFJWLUAGMZINFE-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- SXFSQZDSUWACKX-UHFFFAOYSA-N 4-methylthio-2-oxobutanoic acid Chemical compound CSCCC(=O)C(O)=O SXFSQZDSUWACKX-UHFFFAOYSA-N 0.000 description 1
- DKCOYWUJPJQANX-UHFFFAOYSA-N 4-phenyl-2-sulfanylbutanoic acid Chemical compound OC(=O)C(S)CCC1=CC=CC=C1 DKCOYWUJPJQANX-UHFFFAOYSA-N 0.000 description 1
- OYNANFOWNSGDJL-UHFFFAOYSA-N 4-sulfanylpyrrolidin-1-ium-2-carboxylate Chemical compound OC(=O)C1CC(S)CN1 OYNANFOWNSGDJL-UHFFFAOYSA-N 0.000 description 1
- GIAPJCXSKMCTML-UHFFFAOYSA-N 5-amino-6-ethoxy-6-oxohexanoic acid Chemical compound CCOC(=O)C(N)CCCC(O)=O GIAPJCXSKMCTML-UHFFFAOYSA-N 0.000 description 1
- INPQIVHQSQUEAJ-UHFFFAOYSA-N 5-fluorotryptophan Chemical compound C1=C(F)C=C2C(CC(N)C(O)=O)=CNC2=C1 INPQIVHQSQUEAJ-UHFFFAOYSA-N 0.000 description 1
- FUFZNHHSSMCXCZ-UHFFFAOYSA-N 5-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole Chemical compound FC(F)(F)C1=CC=CC(C=2N=C(ON=2)C2CCNCC2)=C1 FUFZNHHSSMCXCZ-UHFFFAOYSA-N 0.000 description 1
- YMEXGEAJNZRQEH-UHFFFAOYSA-N 6-Fluoro-DL-tryptophan Chemical compound FC1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 YMEXGEAJNZRQEH-UHFFFAOYSA-N 0.000 description 1
- YLLGZOVWGLYOQQ-UHFFFAOYSA-N 6-amino-7-ethoxy-7-oxoheptanoic acid Chemical compound CCOC(=O)C(N)CCCCC(O)=O YLLGZOVWGLYOQQ-UHFFFAOYSA-N 0.000 description 1
- VIJOIFCZOYEASP-UHFFFAOYSA-N 6-methoxy-2,6-dioxohexanoic acid Chemical compound COC(=O)CCCC(=O)C(O)=O VIJOIFCZOYEASP-UHFFFAOYSA-N 0.000 description 1
- UIJIQXGRFSPYQW-UHFFFAOYSA-N 6-methylthiopurine Chemical group CSC1=NC=NC2=C1N=CN2 UIJIQXGRFSPYQW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- YZEINECMQBAAPZ-UHFFFAOYSA-N 8-amino-9-ethoxy-9-oxononanoic acid Chemical compound CCOC(=O)C(N)CCCCCCC(O)=O YZEINECMQBAAPZ-UHFFFAOYSA-N 0.000 description 1
- MWWVLEJXSXRGGL-UHFFFAOYSA-N 9-amino-10-ethoxy-10-oxodecanoic acid Chemical compound CCOC(=O)C(N)CCCCCCCC(O)=O MWWVLEJXSXRGGL-UHFFFAOYSA-N 0.000 description 1
- 239000005541 ACE inhibitor Substances 0.000 description 1
- PQSUYGKTWSAVDQ-ZVIOFETBSA-N Aldosterone Chemical compound C([C@@]1([C@@H](C(=O)CO)CC[C@H]1[C@@H]1CC2)C=O)[C@H](O)[C@@H]1[C@]1(C)C2=CC(=O)CC1 PQSUYGKTWSAVDQ-ZVIOFETBSA-N 0.000 description 1
- PQSUYGKTWSAVDQ-UHFFFAOYSA-N Aldosterone Natural products C1CC2C3CCC(C(=O)CO)C3(C=O)CC(O)C2C2(C)C1=CC(=O)CC2 PQSUYGKTWSAVDQ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 102000004881 Angiotensinogen Human genes 0.000 description 1
- 108090001067 Angiotensinogen Proteins 0.000 description 1
- 244000186140 Asperula odorata Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241001598984 Bromius obscurus Species 0.000 description 1
- 125000001433 C-terminal amino-acid group Chemical group 0.000 description 1
- SHPXLTUKAJFQCM-UHFFFAOYSA-N CC(C)C(=O)C(O)=O.CC(C)CC(=O)C(O)=O Chemical compound CC(C)C(=O)C(O)=O.CC(C)CC(=O)C(O)=O SHPXLTUKAJFQCM-UHFFFAOYSA-N 0.000 description 1
- YOKDVWWESDBOGV-QMMMGPOBSA-N CC(C)CN[C@@H](CCC(=O)O)C(=O)OC Chemical compound CC(C)CN[C@@H](CCC(=O)O)C(=O)OC YOKDVWWESDBOGV-QMMMGPOBSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N Caprylic acid Natural products CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 102000000496 Carboxypeptidases A Human genes 0.000 description 1
- 108010080937 Carboxypeptidases A Proteins 0.000 description 1
- 241000288673 Chiroptera Species 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZZZCUOFIHGPKAK-UHFFFAOYSA-N D-erythro-ascorbic acid Natural products OCC1OC(=O)C(O)=C1O ZZZCUOFIHGPKAK-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 108010016626 Dipeptides Proteins 0.000 description 1
- HJEINPVZRDJRBY-UHFFFAOYSA-N Disul Chemical compound OS(=O)(=O)OCCOC1=CC=C(Cl)C=C1Cl HJEINPVZRDJRBY-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-UHFFFAOYSA-N Elaidinsaeure-aethylester Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC LVGKNOAMLMIIKO-UHFFFAOYSA-N 0.000 description 1
- 108010059378 Endopeptidases Proteins 0.000 description 1
- 102000005593 Endopeptidases Human genes 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 235000008526 Galium odoratum Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 102000006395 Globulins Human genes 0.000 description 1
- 108010044091 Globulins Proteins 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical group OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- MMFKFJORZBJVNF-UWVGGRQHSA-N His-Leu Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)[C@@H](N)CC1=CN=CN1 MMFKFJORZBJVNF-UWVGGRQHSA-N 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- AGPKZVBTJJNPAG-UHNVWZDZSA-N L-allo-Isoleucine Chemical compound CC[C@@H](C)[C@H](N)C(O)=O AGPKZVBTJJNPAG-UHNVWZDZSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- FORGMRSGVSYZQR-YFKPBYRVSA-N L-leucinamide Chemical compound CC(C)C[C@H](N)C(N)=O FORGMRSGVSYZQR-YFKPBYRVSA-N 0.000 description 1
- LRQKBLKVPFOOQJ-YFKPBYRVSA-N L-norleucine Chemical compound CCCC[C@H]([NH3+])C([O-])=O LRQKBLKVPFOOQJ-YFKPBYRVSA-N 0.000 description 1
- VLJNHYLEOZPXFW-BYPYZUCNSA-N L-prolinamide Chemical compound NC(=O)[C@@H]1CCCN1 VLJNHYLEOZPXFW-BYPYZUCNSA-N 0.000 description 1
- KKCIOUWDFWQUBT-AWEZNQCLSA-N L-thyronine Chemical group C1=CC(C[C@H](N)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 KKCIOUWDFWQUBT-AWEZNQCLSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- KZSNJWFQEVHDMF-BYPYZUCNSA-N L-valine Chemical compound CC(C)[C@H](N)C(O)=O KZSNJWFQEVHDMF-BYPYZUCNSA-N 0.000 description 1
- RQVLGLPAZTUBKX-VKHMYHEASA-N L-vinylglycine Chemical compound C=C[C@H](N)C(O)=O RQVLGLPAZTUBKX-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- 229930045534 Me ester-Cyclohexaneundecanoic acid Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AAXJCFQYLQNVQD-UHFFFAOYSA-N N(C(=O)C)CCCC(C(=O)O)=O Chemical compound N(C(=O)C)CCCC(C(=O)O)=O AAXJCFQYLQNVQD-UHFFFAOYSA-N 0.000 description 1
- MDXGYYOJGPFFJL-QMMMGPOBSA-N N(alpha)-t-butoxycarbonyl-L-leucine Chemical compound CC(C)C[C@@H](C(O)=O)NC(=O)OC(C)(C)C MDXGYYOJGPFFJL-QMMMGPOBSA-N 0.000 description 1
- JMOXSQYGVIXBBZ-UHFFFAOYSA-N N,N-dimethyl-beta-alanine Chemical compound CN(C)CCC(O)=O JMOXSQYGVIXBBZ-UHFFFAOYSA-N 0.000 description 1
- GDFAOVXKHJXLEI-VKHMYHEASA-N N-methyl-L-alanine Chemical compound C[NH2+][C@@H](C)C([O-])=O GDFAOVXKHJXLEI-VKHMYHEASA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- NPKSPKHJBVJUKB-UHFFFAOYSA-N N-phenylglycine Chemical compound OC(=O)CNC1=CC=CC=C1 NPKSPKHJBVJUKB-UHFFFAOYSA-N 0.000 description 1
- SNHWHJFEISXBOB-UHFFFAOYSA-N NBrO Chemical compound NBrO SNHWHJFEISXBOB-UHFFFAOYSA-N 0.000 description 1
- KAFHLONDOVSENM-HNNXBMFYSA-N O-Benzyl-L-tyrosine Chemical compound C1=CC(C[C@H](N)C(O)=O)=CC=C1OCC1=CC=CC=C1 KAFHLONDOVSENM-HNNXBMFYSA-N 0.000 description 1
- FYCWLJLGIAUCCL-DMTCNVIQSA-N O-methyl-L-threonine Chemical compound CO[C@H](C)[C@H](N)C(O)=O FYCWLJLGIAUCCL-DMTCNVIQSA-N 0.000 description 1
- GEYBMYRBIABFTA-VIFPVBQESA-N O-methyl-L-tyrosine Chemical compound COC1=CC=C(C[C@H](N)C(O)=O)C=C1 GEYBMYRBIABFTA-VIFPVBQESA-N 0.000 description 1
- KNTFCRCCPLEUQZ-VKHMYHEASA-N O-methylserine Chemical compound COC[C@H](N)C(O)=O KNTFCRCCPLEUQZ-VKHMYHEASA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- GHBAYRBVXCRIHT-VIFPVBQESA-N S-benzyl-L-cysteine zwitterion Chemical compound OC(=O)[C@@H](N)CSCC1=CC=CC=C1 GHBAYRBVXCRIHT-VIFPVBQESA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 102000005686 Serum Globulins Human genes 0.000 description 1
- 108010045362 Serum Globulins Proteins 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical group OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- FPIPGXGPPPQFEQ-BOOMUCAASA-N Vitamin A Natural products OC/C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-BOOMUCAASA-N 0.000 description 1
- 229930003268 Vitamin C Natural products 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229960002478 aldosterone Drugs 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 108010001822 benzoylphenylalanyl-alanyl-proline Proteins 0.000 description 1
- GONOPSZTUGRENK-UHFFFAOYSA-N benzyl(trichloro)silane Chemical compound Cl[Si](Cl)(Cl)CC1=CC=CC=C1 GONOPSZTUGRENK-UHFFFAOYSA-N 0.000 description 1
- RTGHRDFWYQHVFW-UHFFFAOYSA-N beta-Ketoadipic acid Natural products OC(=O)CCC(=O)CC(O)=O RTGHRDFWYQHVFW-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 230000023555 blood coagulation Effects 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 210000004899 c-terminal region Anatomy 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000007958 cherry flavor Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 235000014510 cooky Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000002150 cyclohexa-1,4-dienyl group Chemical group [H]C1=C([H])C([H])(*)C([H])=C([H])C1([H])[H] 0.000 description 1
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- PFLHGSJLYNJIOF-UHFFFAOYSA-N diethyl 2-formamidopropanedioate Chemical compound CCOC(=O)C(NC=O)C(=O)OCC PFLHGSJLYNJIOF-UHFFFAOYSA-N 0.000 description 1
- 125000004212 difluorophenyl group Chemical group 0.000 description 1
- FBWIRBFZWNIGJC-UHFFFAOYSA-N dihomomethionine Chemical compound CSCCCCC([NH3+])C([O-])=O FBWIRBFZWNIGJC-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- YSMODUONRAFBET-UHNVWZDZSA-N erythro-5-hydroxy-L-lysine Chemical compound NC[C@H](O)CC[C@H](N)C(O)=O YSMODUONRAFBET-UHNVWZDZSA-N 0.000 description 1
- VZMQTNWZEYXCEH-KRWDZBQOSA-N ethyl (2S)-2-amino-3-(2-benzylphenyl)propanoate Chemical compound CCOC(=O)[C@@H](N)Cc1ccccc1Cc1ccccc1 VZMQTNWZEYXCEH-KRWDZBQOSA-N 0.000 description 1
- CJGXMNONHNZEQQ-JTQLQIEISA-N ethyl (2s)-2-amino-3-phenylpropanoate Chemical compound CCOC(=O)[C@@H](N)CC1=CC=CC=C1 CJGXMNONHNZEQQ-JTQLQIEISA-N 0.000 description 1
- WFLQXECQLHZKMV-NSHDSACASA-N ethyl (2s)-2-amino-4-phenylbutanoate Chemical compound CCOC(=O)[C@@H](N)CCC1=CC=CC=C1 WFLQXECQLHZKMV-NSHDSACASA-N 0.000 description 1
- QPNJHVDIRZNKOX-LURJTMIESA-N ethyl (2s)-pyrrolidine-2-carboxylate Chemical compound CCOC(=O)[C@@H]1CCCN1 QPNJHVDIRZNKOX-LURJTMIESA-N 0.000 description 1
- SBBWEQLNKVHYCX-JTQLQIEISA-N ethyl L-tyrosinate Chemical compound CCOC(=O)[C@@H](N)CC1=CC=C(O)C=C1 SBBWEQLNKVHYCX-JTQLQIEISA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethyl mercaptane Natural products CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 1
- LVGKNOAMLMIIKO-QXMHVHEDSA-N ethyl oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC LVGKNOAMLMIIKO-QXMHVHEDSA-N 0.000 description 1
- 229940093471 ethyl oleate Drugs 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- LNTHITQWFMADLM-UHFFFAOYSA-M gallate Chemical compound OC1=CC(C([O-])=O)=CC(O)=C1O LNTHITQWFMADLM-UHFFFAOYSA-M 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 210000000585 glomerular basement membrane Anatomy 0.000 description 1
- 229940049906 glutamate Drugs 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 108010016268 hippuryl-histidyl-leucine Proteins 0.000 description 1
- 229960002885 histidine Drugs 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 108010025306 histidylleucine Proteins 0.000 description 1
- YPGCWEMNNLXISK-UHFFFAOYSA-N hydratropic acid Chemical compound OC(=O)C(C)C1=CC=CC=C1 YPGCWEMNNLXISK-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 229960002591 hydroxyproline Drugs 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229960000310 isoleucine Drugs 0.000 description 1
- AGPKZVBTJJNPAG-UHFFFAOYSA-N isoleucine Natural products CCC(C)C(N)C(O)=O AGPKZVBTJJNPAG-UHFFFAOYSA-N 0.000 description 1
- 125000000741 isoleucyl group Chemical group [H]N([H])C(C(C([H])([H])[H])C([H])([H])C([H])([H])[H])C(=O)O* 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 238000011862 kidney biopsy Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- XMGQYMWWDOXHJM-UHFFFAOYSA-N limonene Chemical compound CC(=C)C1CCC(C)=CC1 XMGQYMWWDOXHJM-UHFFFAOYSA-N 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- VWHRYODZTDMVSS-QMMMGPOBSA-N m-fluoro-L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC(F)=C1 VWHRYODZTDMVSS-QMMMGPOBSA-N 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000005399 mechanical ventilation Methods 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- VHRYZQNGTZXDNX-UHFFFAOYSA-N methacryloyl chloride Chemical compound CC(=C)C(Cl)=O VHRYZQNGTZXDNX-UHFFFAOYSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- 125000001360 methionine group Chemical group N[C@@H](CCSC)C(=O)* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- MBOJFMMTOKMYMT-QMMMGPOBSA-N methyl (2s)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoate Chemical compound COC(=O)[C@@H](N)CC1=CC=C(O)C(I)=C1 MBOJFMMTOKMYMT-QMMMGPOBSA-N 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N n-hexanoic acid Natural products CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000007968 orange flavor Substances 0.000 description 1
- 150000002892 organic cations Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- OTIJNTWWDCIUNM-UHFFFAOYSA-N pentanethioic s-acid Chemical compound CCCCC(S)=O OTIJNTWWDCIUNM-UHFFFAOYSA-N 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229950009215 phenylbutanoic acid Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- REQCZEXYDRLIBE-UHFFFAOYSA-N procainamide Chemical compound CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 REQCZEXYDRLIBE-UHFFFAOYSA-N 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001500 prolyl group Chemical group [H]N1C([H])(C(=O)[*])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 206010038464 renal hypertension Diseases 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- UQDJGEHQDNVPGU-UHFFFAOYSA-N serine phosphoethanolamine Chemical compound [NH3+]CCOP([O-])(=O)OCC([NH3+])C([O-])=O UQDJGEHQDNVPGU-UHFFFAOYSA-N 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 239000003998 snake venom Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000012064 sodium phosphate buffer Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 125000003375 sulfoxide group Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- CANQRTXTMVVNCH-LBPRGKRZSA-N tert-butyl (2s)-2-amino-4-phenylbutanoate Chemical compound CC(C)(C)OC(=O)[C@@H](N)CCC1=CC=CC=C1 CANQRTXTMVVNCH-LBPRGKRZSA-N 0.000 description 1
- CVAWKJKISIPBOD-UHFFFAOYSA-N tert-butyl 2-bromopropanoate Chemical compound CC(Br)C(=O)OC(C)(C)C CVAWKJKISIPBOD-UHFFFAOYSA-N 0.000 description 1
- BPVGMSZRMOLZLF-UHFFFAOYSA-N tert-butyl 2-hydroxy-4-phenylbutanoate Chemical compound CC(C)(C)OC(=O)C(O)CCC1=CC=CC=C1 BPVGMSZRMOLZLF-UHFFFAOYSA-N 0.000 description 1
- NPDBDJFLKKQMCM-UHFFFAOYSA-N tert-butylglycine Chemical compound CC(C)(C)C(N)C(O)=O NPDBDJFLKKQMCM-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- NJRXVEJTAYWCQJ-UHFFFAOYSA-N thiomalic acid Chemical compound OC(=O)CC(S)C(O)=O NJRXVEJTAYWCQJ-UHFFFAOYSA-N 0.000 description 1
- 125000000341 threoninyl group Chemical group [H]OC([H])(C([H])([H])[H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 125000003294 thymin-1-yl group Chemical group [H]N1C(=O)N(*)C([H])=C(C1=O)C([H])([H])[H] 0.000 description 1
- KKCIOUWDFWQUBT-UHFFFAOYSA-N thyronine Chemical compound C1=CC(CC(N)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 KKCIOUWDFWQUBT-UHFFFAOYSA-N 0.000 description 1
- 230000036964 tight binding Effects 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 229950009883 tocopheryl nicotinate Drugs 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- BJBUEDPLEOHJGE-IMJSIDKUSA-N trans-3-hydroxy-L-proline Chemical compound O[C@H]1CC[NH2+][C@@H]1C([O-])=O BJBUEDPLEOHJGE-IMJSIDKUSA-N 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 125000001493 tyrosinyl group Chemical group [H]OC1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000019155 vitamin A Nutrition 0.000 description 1
- 239000011719 vitamin A Substances 0.000 description 1
- 235000019154 vitamin C Nutrition 0.000 description 1
- 239000011718 vitamin C Substances 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 229940045997 vitamin a Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000009637 wintergreen oil Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/02—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link
- C07K5/022—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2
- C07K5/0222—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing at least one abnormal peptide link containing the structure -X-C(=O)-(C)n-N-C-C(=O)-Y-; X and Y being heteroatoms; n being 1 or 2 with the first amino acid being heterocyclic, e.g. Pro, Trp
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Genetics & Genomics (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Molecular Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US18799280A | 1980-09-17 | 1980-09-17 | |
| US29513581A | 1981-08-21 | 1981-08-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD201777A5 true DD201777A5 (de) | 1983-08-10 |
Family
ID=26883623
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD81233368A DD201777A5 (de) | 1980-09-17 | 1981-09-17 | Verfahren zum herstellen von neuen peptiden |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP0048159A3 (cs) |
| AU (1) | AU7529581A (cs) |
| DD (1) | DD201777A5 (cs) |
| ES (2) | ES8306097A1 (cs) |
| GR (1) | GR75019B (cs) |
| NO (1) | NO813153L (cs) |
| PL (4) | PL233060A1 (cs) |
| PT (1) | PT73685B (cs) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2480747A1 (fr) * | 1980-04-17 | 1981-10-23 | Roques Bernard | Derives d'acides amines et leur application therapeutique |
| IE54551B1 (en) * | 1982-01-22 | 1989-11-22 | Ici Plc | Amide derivatives |
| JPS6058233B2 (ja) * | 1982-05-24 | 1985-12-19 | 田辺製薬株式会社 | 2−オキソイミダゾリジン誘導体及びその製法 |
| AU1643283A (en) * | 1982-07-19 | 1984-01-26 | E.R. Squibb & Sons, Inc. | Substituted peptides |
| US4500713A (en) * | 1982-09-23 | 1985-02-19 | Usv Pharmaceutical Corporation | Therapeutic dipeptides |
| DK156484A (da) * | 1983-03-16 | 1984-09-17 | Usv Pharma Corp | Aminosyrederivater |
| EP0127124A3 (en) * | 1983-05-23 | 1987-04-08 | Usv Pharmaceutical Corporation | Compounds for treating hypertension |
| US4574079A (en) * | 1983-05-27 | 1986-03-04 | Gavras Haralambos P | Radiolabeled angiotensin converting enzyme inhibitors for radiolabeling mammalian organ sites |
| IT1165464B (it) * | 1983-07-29 | 1987-04-22 | Montedison Spa | Composti ad attivita' antidotica per la difesa di colture di interesse agrario dall'azione di erbicidi non selettivi |
| US4665052A (en) * | 1984-03-27 | 1987-05-12 | Merck & Co., Inc. | Renin inhibitors containing homophe8 and a C-terminal amide cycle |
| US4668663A (en) * | 1984-03-27 | 1987-05-26 | Merck & Co., Inc. | Renin inhibitors containing homophe8 |
| US5684016A (en) * | 1984-04-12 | 1997-11-04 | Hoechst Aktiengesellschaft | Method of treating cardiac insufficiency |
| DE3413710A1 (de) * | 1984-04-12 | 1985-10-24 | Hoechst Ag, 6230 Frankfurt | Verfahren zur behandlung der herzinsuffizienz |
| US4500518A (en) * | 1984-04-19 | 1985-02-19 | E. R. Squibb & Sons, Inc. | Amino thiol dipeptides |
| US4560506A (en) * | 1984-05-25 | 1985-12-24 | E. R. Squibb & Sons, Inc. | Mercaptocycloalkylcarbonyl and mercaptoarylcarbonyl dipeptides |
| GB8422165D0 (en) * | 1984-09-01 | 1984-10-03 | Wellcome Found | Compounds |
| ATE135711T1 (de) * | 1984-09-12 | 1996-04-15 | Rhone Poulenc Rorer Pharma | Antihypertensive derivate |
| DE3436386A1 (de) * | 1984-10-04 | 1986-04-10 | Merck Patent Gmbh, 6100 Darmstadt | (thio)morpholine |
| IT1176983B (it) * | 1984-10-16 | 1987-08-26 | Zambon Spa | Dipeptidi ad attivita' farmacologica |
| CH672792A5 (cs) * | 1985-02-19 | 1989-12-29 | Sandoz Ag | |
| ATE72431T1 (de) * | 1985-08-31 | 1992-02-15 | Fisons Plc | 5-gliedrige heterocyclische angiotensinumwandlungsenzym-inhibitoren. |
| US5231080A (en) * | 1985-10-15 | 1993-07-27 | Hoechst Aktiengesellschaft | Method for the treatment of atherosclerosis, thrombosis, and peripheral vessel disease |
| US5231084A (en) * | 1986-03-27 | 1993-07-27 | Hoechst Aktiengesellschaft | Compounds having a cognition adjuvant action, agents containing them, and the use thereof for the treatment and prophylaxis of cognitive dysfuncitons |
| IT1206078B (it) * | 1987-06-03 | 1989-04-14 | Polifarma Spa | Procedimento per la produzione di acido 3-indolpiruvico e suoi derivati loro uso farmaceutico |
| DE3803225A1 (de) * | 1988-02-04 | 1989-08-17 | Hoechst Ag | Aminosaeureamide mit psychotroper wirkung, verfahren zu ihrer herstellung, sie enthaltende mittel und deren verwendung |
| US5563277A (en) * | 1994-12-21 | 1996-10-08 | Eli Lilly And Company | Process for preparing benzyl-substituted rhodanine derivatives |
| US5859031A (en) | 1995-06-07 | 1999-01-12 | Gpi Nil Holdings, Inc. | Small molecule inhibitors of rotamase enzyme activity |
| GB2324527B (en) * | 1995-06-07 | 1999-12-22 | Guilford Pharm Inc | Small molecule inhibitors of rotamase enzyme activity |
| US7056935B2 (en) | 1995-06-07 | 2006-06-06 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| US5801197A (en) * | 1995-10-31 | 1998-09-01 | Gpi Nil Holdings, Inc. | Rotamase enzyme activity inhibitors |
| US6218424B1 (en) | 1996-09-25 | 2001-04-17 | Gpi Nil Holdings, Inc. | Heterocyclic ketone and thioester compounds and uses |
| US5801187A (en) * | 1996-09-25 | 1998-09-01 | Gpi-Nil Holdings, Inc. | Heterocyclic esters and amides |
| US5786378A (en) * | 1996-09-25 | 1998-07-28 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters |
| US5945441A (en) | 1997-06-04 | 1999-08-31 | Gpi Nil Holdings, Inc. | Pyrrolidine carboxylate hair revitalizing agents |
| US6274602B1 (en) | 1998-06-03 | 2001-08-14 | Gpi Nil Holdings, Inc. | Heterocyclic thioester and ketone hair growth compositions and uses |
| US20010049381A1 (en) | 1997-06-04 | 2001-12-06 | Gpl Nil Holdings, Inc., | Pyrrolidine derivative hair growth compositions and uses |
| US6187796B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Sulfone hair growth compositions and uses |
| US6187784B1 (en) | 1998-06-03 | 2001-02-13 | Gpi Nil Holdings, Inc. | Pipecolic acid derivative hair growth compositions and uses |
| US6271244B1 (en) | 1998-06-03 | 2001-08-07 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioester hair growth compositions and uses |
| CZ291417B6 (cs) * | 1997-08-06 | 2003-03-12 | Dsm Fine Chemicals Austria Nfg Gmbh & Co Kg | Způsob výroby 1-pyruvyl-L-prolinu |
| US6331537B1 (en) | 1998-06-03 | 2001-12-18 | Gpi Nil Holdings, Inc. | Carboxylic acids and carboxylic acid isosteres of N-heterocyclic compounds |
| US6172087B1 (en) | 1998-06-03 | 2001-01-09 | Gpi Nil Holding, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| WO1999062487A1 (en) | 1998-06-03 | 1999-12-09 | Gpi Nil Holdings, Inc. | Heterocyclic ester and amide hair growth compositions and uses |
| US6429215B1 (en) | 1998-06-03 | 2002-08-06 | Gpi Nil Holdings, Inc. | N-oxide of heterocyclic ester, amide, thioester, or ketone hair growth compositions and uses |
| US7338976B1 (en) | 1998-08-14 | 2008-03-04 | Gpi Nil Holdings, Inc. | Heterocyclic esters or amides for vision and memory disorders |
| US6218423B1 (en) | 1998-08-14 | 2001-04-17 | Gpi Nil Holdings, Inc. | Pyrrolidine derivatives for vision and memory disorders |
| US6399648B1 (en) | 1998-08-14 | 2002-06-04 | Gpi Nil Holdings, Inc. | N-oxides of heterocyclic ester, amide, thioester, or ketone for vision and memory disorders |
| US6339101B1 (en) | 1998-08-14 | 2002-01-15 | Gpi Nil Holdings, Inc. | N-linked sulfonamides of N-heterocyclic carboxylic acids or isosteres for vision and memory disorders |
| US6333340B1 (en) | 1998-08-14 | 2001-12-25 | Gpi Nil Holdings, Inc. | Small molecule sulfonamides for vision and memory disorders |
| US6376517B1 (en) | 1998-08-14 | 2002-04-23 | Gpi Nil Holdings, Inc. | Pipecolic acid derivatives for vision and memory disorders |
| US6506788B1 (en) | 1998-08-14 | 2003-01-14 | Gpi Nil Holdings, Inc. | N-linked urea or carbamate of heterocyclic thioesters for vision and memory disorders |
| US6337340B1 (en) | 1998-08-14 | 2002-01-08 | Gpi Nil Holdings, Inc. | Carboxylic acids and isosteres of heterocyclic ring compounds having multiple heteroatoms for vision and memory disorders |
| US6395758B1 (en) | 1998-08-14 | 2002-05-28 | Gpi Nil Holdings, Inc. | Small molecule carbamates or ureas for vision and memory disorders |
| US6384056B1 (en) | 1998-08-14 | 2002-05-07 | Gpi Nil Holdings, Inc. | Heterocyclic thioesters or ketones for vision and memory disorders |
| US6335348B1 (en) | 1998-08-14 | 2002-01-01 | Gpi Nil Holdings, Inc. | Nitrogen-containing linear and azepinyl/ compositions and uses for vision and memory disorders |
| US6462072B1 (en) | 1998-09-21 | 2002-10-08 | Gpi Nil Holdings, Inc. | Cyclic ester or amide derivatives |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL58849A (en) * | 1978-12-11 | 1983-03-31 | Merck & Co Inc | Carboxyalkyl dipeptides and derivatives thereof,their preparation and pharmaceutical compositions containing them |
| JPS5683483A (en) * | 1979-12-13 | 1981-07-08 | Santen Pharmaceut Co Ltd | Thiazolidine compound |
-
1981
- 1981-09-15 GR GR66073A patent/GR75019B/el unknown
- 1981-09-15 EP EP81304210A patent/EP0048159A3/en not_active Withdrawn
- 1981-09-16 NO NO813153A patent/NO813153L/no unknown
- 1981-09-16 PT PT73685A patent/PT73685B/pt not_active IP Right Cessation
- 1981-09-16 AU AU75295/81A patent/AU7529581A/en not_active Abandoned
- 1981-09-17 PL PL23306081A patent/PL233060A1/xx unknown
- 1981-09-17 PL PL23847281A patent/PL238472A1/xx unknown
- 1981-09-17 PL PL23847181A patent/PL238471A1/xx unknown
- 1981-09-17 PL PL23847081A patent/PL238470A1/xx unknown
- 1981-09-17 DD DD81233368A patent/DD201777A5/de unknown
-
1982
- 1982-08-02 ES ES514664A patent/ES8306097A1/es not_active Expired
- 1982-08-02 ES ES514672A patent/ES8306098A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| EP0048159A3 (en) | 1982-05-12 |
| GR75019B (cs) | 1984-07-12 |
| ES514672A0 (es) | 1983-05-01 |
| PT73685B (pt) | 2003-12-31 |
| AU7529581A (en) | 1982-03-25 |
| ES8306098A1 (es) | 1983-05-01 |
| PL238471A1 (en) | 1983-08-29 |
| EP0048159A2 (en) | 1982-03-24 |
| PL238472A1 (en) | 1983-08-29 |
| ES514664A0 (es) | 1983-05-01 |
| NO813153L (no) | 1982-03-18 |
| PL233060A1 (en) | 1983-01-31 |
| ES8306097A1 (es) | 1983-05-01 |
| PL238470A1 (en) | 1983-08-29 |
| PT73685A (en) | 1981-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD201777A5 (de) | Verfahren zum herstellen von neuen peptiden | |
| KR940001769B1 (ko) | 중성 메탈로엔도펩티다제 억제제 | |
| US5736521A (en) | Method of treatment and prophylaxis of arterial thrombosis | |
| DE69131317T2 (de) | HIV-Proteaseinhibitoren | |
| DE3689508T2 (de) | Peptide. | |
| US4692458A (en) | Anti-hypertensive agents | |
| US4692437A (en) | Anti-hypertensive agents | |
| EP0073143A2 (en) | Novel complex amido and imido derivatives of carboxyalkyl peptides and thioethers and ethers of peptides | |
| CH634830A5 (de) | Verfahren zur herstellung neuer substituierten aminosaeuren. | |
| DE3889726T2 (de) | Synthetische inhibitoren von säugetier-collagenase. | |
| EP0143746A2 (de) | Substituierte 5-Amino-4-hydroxyvalerylderivate | |
| EP0052991A1 (en) | Carboxyalkyl amino acid derivatives of various substituted prolines | |
| DD158238A5 (de) | Verfahren zur herstellung eines neuen inhibitors fuer das angiotensin umwandelnde enzym | |
| IE49653B1 (en) | Mercaptoacyldipeptides | |
| WO1996017860A1 (de) | Neue dipeptidische p-amidinobenzylamide mit n-terminalen sulfonyl- bzw. aminosulfonylresten | |
| DE3138092A1 (de) | Neues analgetisches mittel | |
| DE69319733T2 (de) | In der konformation beschränkte peptid analoge als wirkstoff gegen plättchenaggregation | |
| DE69431603T2 (de) | Oligopeptide hergeleitet von fragmenten des c-reaktiven proteins | |
| US4684660A (en) | Mercaptoacyldepeptides | |
| EP0036713B1 (en) | Angiotensin converting enzyme inhibitors | |
| US4734420A (en) | Anti-hypertensive agents | |
| CH618960A5 (cs) | ||
| DE68913936T2 (de) | Retro-Inverso-Thrymopentin-Analoge, Verfahren zu deren Herstellung und deren Verwendung für die Zubereitung von pharmazeutischen Zusammensetzungen. | |
| GB1587809A (en) | Synthesis of peptides | |
| CH637374A5 (en) | Substituted amino acids |