DD157071A5 - Aphicide zusammensetzung - Google Patents
Aphicide zusammensetzung Download PDFInfo
- Publication number
- DD157071A5 DD157071A5 DD81227106A DD22710681A DD157071A5 DD 157071 A5 DD157071 A5 DD 157071A5 DD 81227106 A DD81227106 A DD 81227106A DD 22710681 A DD22710681 A DD 22710681A DD 157071 A5 DD157071 A5 DD 157071A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- group
- carbon atoms
- item
- compound
- composition according
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 75
- 150000001875 compounds Chemical class 0.000 claims abstract description 70
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 46
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 38
- 230000002824 aphicidal effect Effects 0.000 claims abstract description 24
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 22
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 14
- 239000004480 active ingredient Substances 0.000 claims abstract description 13
- 125000005843 halogen group Chemical group 0.000 claims abstract description 12
- 238000000034 method Methods 0.000 claims abstract description 9
- 238000002360 preparation method Methods 0.000 claims abstract description 9
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 8
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 7
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 7
- 125000003277 amino group Chemical class 0.000 claims abstract description 5
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 4
- -1 phenylcarbamoyl group Chemical group 0.000 claims description 54
- 239000013543 active substance Substances 0.000 claims description 39
- 239000000126 substance Substances 0.000 claims description 19
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 13
- 239000000654 additive Substances 0.000 claims description 13
- 239000007788 liquid Substances 0.000 claims description 13
- 241001124076 Aphididae Species 0.000 claims description 11
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 229910052717 sulfur Chemical group 0.000 claims description 8
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 7
- 239000000194 fatty acid Substances 0.000 claims description 7
- 229930195729 fatty acid Natural products 0.000 claims description 7
- 150000004665 fatty acids Chemical class 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 5
- 239000002270 dispersing agent Substances 0.000 claims description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 239000002480 mineral oil Substances 0.000 claims description 5
- 229920000136 polysorbate Polymers 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 239000012876 carrier material Substances 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 235000010446 mineral oil Nutrition 0.000 claims description 4
- 239000002952 polymeric resin Substances 0.000 claims description 4
- 239000011593 sulfur Chemical group 0.000 claims description 4
- 239000004094 surface-active agent Substances 0.000 claims description 4
- 229920003002 synthetic resin Polymers 0.000 claims description 4
- 231100000419 toxicity Toxicity 0.000 claims description 4
- 230000001988 toxicity Effects 0.000 claims description 4
- 235000015112 vegetable and seed oil Nutrition 0.000 claims description 4
- 239000008158 vegetable oil Substances 0.000 claims description 4
- 239000000080 wetting agent Substances 0.000 claims description 4
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 claims description 3
- MJGJMQGRZOEPJD-UHFFFAOYSA-N 2-propan-2-ylbenzenesulfonamide Chemical compound CC(C)C1=CC=CC=C1S(N)(=O)=O MJGJMQGRZOEPJD-UHFFFAOYSA-N 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 150000005215 alkyl ethers Chemical class 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 239000004202 carbamide Substances 0.000 claims description 3
- 239000003995 emulsifying agent Substances 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 238000003898 horticulture Methods 0.000 claims description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Chemical group 0.000 claims description 3
- 239000000575 pesticide Substances 0.000 claims description 3
- 229920001522 polyglycol ester Polymers 0.000 claims description 3
- 150000001555 benzenes Chemical class 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000003381 stabilizer Substances 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims 2
- JCCBZCMSYUSCFM-UHFFFAOYSA-N 2-chlorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1Cl JCCBZCMSYUSCFM-UHFFFAOYSA-N 0.000 claims 1
- HNNQYHFROJDYHQ-UHFFFAOYSA-N 3-(4-ethylcyclohexyl)propanoic acid 3-(3-ethylcyclopentyl)propanoic acid Chemical compound CCC1CCC(CCC(O)=O)C1.CCC1CCC(CCC(O)=O)CC1 HNNQYHFROJDYHQ-UHFFFAOYSA-N 0.000 claims 1
- 150000007945 N-acyl ureas Chemical class 0.000 claims 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims 1
- 235000013339 cereals Nutrition 0.000 claims 1
- 239000003337 fertilizer Substances 0.000 claims 1
- 150000002989 phenols Chemical class 0.000 claims 1
- 229920000151 polyglycol Polymers 0.000 claims 1
- 239000010695 polyglycol Substances 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 18
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 abstract description 4
- 238000007363 ring formation reaction Methods 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 40
- 238000006243 chemical reaction Methods 0.000 description 31
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 23
- 241000196324 Embryophyta Species 0.000 description 22
- 238000002844 melting Methods 0.000 description 22
- 230000008018 melting Effects 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000002904 solvent Substances 0.000 description 21
- 239000000243 solution Substances 0.000 description 20
- 241001425390 Aphis fabae Species 0.000 description 14
- 235000019441 ethanol Nutrition 0.000 description 14
- 208000015181 infectious disease Diseases 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 11
- 244000046052 Phaseolus vulgaris Species 0.000 description 10
- 238000009472 formulation Methods 0.000 description 10
- 239000005995 Aluminium silicate Substances 0.000 description 9
- 229920001732 Lignosulfonate Polymers 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 235000012211 aluminium silicate Nutrition 0.000 description 9
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 9
- 210000002268 wool Anatomy 0.000 description 9
- 238000009835 boiling Methods 0.000 description 8
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- 239000008187 granular material Substances 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 239000003495 polar organic solvent Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 229920000847 nonoxynol Polymers 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000004563 wettable powder Substances 0.000 description 5
- DLBPTOMGZXBZOX-UHFFFAOYSA-N 1,2-thiazole 1,1-dioxide Chemical compound O=S1(=O)C=CC=N1 DLBPTOMGZXBZOX-UHFFFAOYSA-N 0.000 description 4
- BCPVKLRBQLRWDQ-UHFFFAOYSA-N 3-chloro-1,2-benzothiazole Chemical compound C1=CC=C2C(Cl)=NSC2=C1 BCPVKLRBQLRWDQ-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 238000007792 addition Methods 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 4
- 239000000417 fungicide Substances 0.000 description 4
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- GUUULVAMQJLDSY-UHFFFAOYSA-N 4,5-dihydro-1,2-thiazole Chemical compound C1CC=NS1 GUUULVAMQJLDSY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000000440 bentonite Substances 0.000 description 3
- 229910000278 bentonite Inorganic materials 0.000 description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- RECCURWJDVZHIH-UHFFFAOYSA-N (4-chlorophenyl)urea Chemical compound NC(=O)NC1=CC=C(Cl)C=C1 RECCURWJDVZHIH-UHFFFAOYSA-N 0.000 description 2
- KMVZDSQHLDGKGV-UHFFFAOYSA-N 2-chlorobenzenesulfonyl chloride Chemical compound ClC1=CC=CC=C1S(Cl)(=O)=O KMVZDSQHLDGKGV-UHFFFAOYSA-N 0.000 description 2
- GCJSHQQIDPHFGX-UHFFFAOYSA-N 4-chloro-1,1-dioxo-1,2-benzothiazol-3-amine Chemical compound C1=CC(Cl)=C2C(N)=NS(=O)(=O)C2=C1 GCJSHQQIDPHFGX-UHFFFAOYSA-N 0.000 description 2
- GYIZLMDUQRZVMZ-UHFFFAOYSA-N 4-methyl-1,1-dioxo-1,2-benzothiazol-3-amine Chemical compound CC1=CC=CC2=C1C(N)=NS2(=O)=O GYIZLMDUQRZVMZ-UHFFFAOYSA-N 0.000 description 2
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- WLLGXSLBOPFWQV-UHFFFAOYSA-N MGK 264 Chemical compound C1=CC2CC1C1C2C(=O)N(CC(CC)CCCC)C1=O WLLGXSLBOPFWQV-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241000721621 Myzus persicae Species 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- 231100000674 Phytotoxicity Toxicity 0.000 description 2
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000000642 acaricide Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 125000004188 dichlorophenyl group Chemical group 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- ZJXZSIYSNXKHEA-UHFFFAOYSA-N ethyl dihydrogen phosphate Chemical compound CCOP(O)(O)=O ZJXZSIYSNXKHEA-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000008202 granule composition Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 229920000053 polysorbate 80 Polymers 0.000 description 2
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 150000003606 tin compounds Chemical class 0.000 description 2
- MGAXYKDBRBNWKT-UHFFFAOYSA-N (5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1OC(=O)CC1 MGAXYKDBRBNWKT-UHFFFAOYSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical class FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- SHCSDWMQDARMQF-UHFFFAOYSA-N 1,1-dioxo-4-phenoxy-1,2-benzothiazol-3-amine Chemical compound C=12C(N)=NS(=O)(=O)C2=CC=CC=1OC1=CC=CC=C1 SHCSDWMQDARMQF-UHFFFAOYSA-N 0.000 description 1
- WIJQCPIRWXSWQG-UHFFFAOYSA-N 1,2-benzothiazol-3-amine Chemical compound C1=CC=C2C(N)=NSC2=C1 WIJQCPIRWXSWQG-UHFFFAOYSA-N 0.000 description 1
- QQGRFMIMXPWKPM-UHFFFAOYSA-N 2,3,4-tributylphenol Chemical compound CCCCC1=CC=C(O)C(CCCC)=C1CCCC QQGRFMIMXPWKPM-UHFFFAOYSA-N 0.000 description 1
- QJARBNAXWFCCKX-UHFFFAOYSA-N 2,3-dichlorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(Cl)=C1Cl QJARBNAXWFCCKX-UHFFFAOYSA-N 0.000 description 1
- LFEXGBPVZBXATF-UHFFFAOYSA-N 2,3-dimethylbenzenesulfonamide Chemical compound CC1=CC=CC(S(N)(=O)=O)=C1C LFEXGBPVZBXATF-UHFFFAOYSA-N 0.000 description 1
- UPTVJAJPBGIRLZ-UHFFFAOYSA-N 2-(trichloromethylsulfanyl)-3a,4,5,7a-tetrahydroisoindole-1,3-dione Chemical compound C1CC=CC2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C21 UPTVJAJPBGIRLZ-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- FICQFRCPSFCFBY-UHFFFAOYSA-N 2-[bis(methylsulfanyl)methylidene]propanedinitrile Chemical compound CSC(SC)=C(C#N)C#N FICQFRCPSFCFBY-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- KUFTUXFTFBRRLM-UHFFFAOYSA-N 2-cyano-3-fluoro-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=CC(F)=C1C#N KUFTUXFTFBRRLM-UHFFFAOYSA-N 0.000 description 1
- DXCVGMHEKUUZCL-UHFFFAOYSA-N 2-cyano-3-fluorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(F)=C1C#N DXCVGMHEKUUZCL-UHFFFAOYSA-N 0.000 description 1
- BGAALQGGQLDGFK-UHFFFAOYSA-N 2-cyano-3-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=CC(S(Cl)(=O)=O)=C1C#N BGAALQGGQLDGFK-UHFFFAOYSA-N 0.000 description 1
- JBQLFMGYMRWOCG-UHFFFAOYSA-N 2-cyano-n,n,3-trimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=CC(C)=C1C#N JBQLFMGYMRWOCG-UHFFFAOYSA-N 0.000 description 1
- KYSGBLDQRDJGKM-UHFFFAOYSA-N 2-cyano-n,n-diethyl-3-fluorobenzenesulfonamide Chemical compound CCN(CC)S(=O)(=O)C1=CC=CC(F)=C1C#N KYSGBLDQRDJGKM-UHFFFAOYSA-N 0.000 description 1
- VQUSODCVRIEHEJ-UHFFFAOYSA-N 2-cyano-n,n-dimethyl-5-(trifluoromethoxy)benzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC(OC(F)(F)F)=CC=C1C#N VQUSODCVRIEHEJ-UHFFFAOYSA-N 0.000 description 1
- FDJLJKDTMIIISE-UHFFFAOYSA-N 2-fluoro-6-piperidin-1-ylsulfonylbenzonitrile Chemical compound FC1=CC=CC(S(=O)(=O)N2CCCCC2)=C1C#N FDJLJKDTMIIISE-UHFFFAOYSA-N 0.000 description 1
- IISNHJHMDOVHRG-UHFFFAOYSA-N 2-fluoro-6-pyrrolidin-1-ylsulfonylbenzonitrile Chemical compound FC1=CC=CC(S(=O)(=O)N2CCCC2)=C1C#N IISNHJHMDOVHRG-UHFFFAOYSA-N 0.000 description 1
- XPYOORHZRLSTSG-UHFFFAOYSA-N 2-sulfonylpiperidine Chemical compound O=S(=O)=C1CCCCN1 XPYOORHZRLSTSG-UHFFFAOYSA-N 0.000 description 1
- RUNBDDGLZNFBCO-UHFFFAOYSA-N 3-chloro-2-cyano-n-propan-2-ylbenzenesulfonamide Chemical compound CC(C)NS(=O)(=O)C1=CC=CC(Cl)=C1C#N RUNBDDGLZNFBCO-UHFFFAOYSA-N 0.000 description 1
- SLVIFRAJHNNOMS-UHFFFAOYSA-N 3-chloro-2-cyanobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(Cl)=C1C#N SLVIFRAJHNNOMS-UHFFFAOYSA-N 0.000 description 1
- WSYQJNPRQUFCGL-UHFFFAOYSA-N 3-chlorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(Cl)=C1 WSYQJNPRQUFCGL-UHFFFAOYSA-N 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- OTOIUCLFSQHFOX-UHFFFAOYSA-N 3-sulfonylmorpholine Chemical compound O=S(=O)=C1COCCN1 OTOIUCLFSQHFOX-UHFFFAOYSA-N 0.000 description 1
- CDIJOYCNNFLOAX-UHFFFAOYSA-N 4-(trichloromethylsulfanyl)isoindole-1,3-dione Chemical compound ClC(Cl)(Cl)SC1=CC=CC2=C1C(=O)NC2=O CDIJOYCNNFLOAX-UHFFFAOYSA-N 0.000 description 1
- ADWGJRRSHRRTLE-UHFFFAOYSA-N 4-chloro-1,2-benzothiazol-3-amine Chemical compound C1=CC(Cl)=C2C(N)=NSC2=C1 ADWGJRRSHRRTLE-UHFFFAOYSA-N 0.000 description 1
- DHLIRMWNYRKKPN-UHFFFAOYSA-N 4-chloro-1,2-benzothiazole Chemical compound ClC1=CC=CC2=C1C=NS2 DHLIRMWNYRKKPN-UHFFFAOYSA-N 0.000 description 1
- KNWTYMAORZWJRF-UHFFFAOYSA-N 4-methoxy-1,1-dioxo-1,2-benzothiazol-3-amine Chemical compound COC1=CC=CC2=C1C(N)=NS2(=O)=O KNWTYMAORZWJRF-UHFFFAOYSA-N 0.000 description 1
- WILUPWLPVVSGHY-UHFFFAOYSA-N 4-methoxy-1,2-benzothiazole Chemical compound COC1=CC=CC2=C1C=NS2 WILUPWLPVVSGHY-UHFFFAOYSA-N 0.000 description 1
- XLAVHWCGNBFDQB-UHFFFAOYSA-N 5-chloro-2-cyano-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC(Cl)=CC=C1C#N XLAVHWCGNBFDQB-UHFFFAOYSA-N 0.000 description 1
- 241001600407 Aphis <genus> Species 0.000 description 1
- 241000193388 Bacillus thuringiensis Species 0.000 description 1
- 239000004604 Blowing Agent Substances 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- URYAFVKLYSEINW-UHFFFAOYSA-N Chlorfenethol Chemical compound C=1C=C(Cl)C=CC=1C(O)(C)C1=CC=C(Cl)C=C1 URYAFVKLYSEINW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 235000010650 Hyssopus officinalis Nutrition 0.000 description 1
- 240000001812 Hyssopus officinalis Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000004117 Lignosulphonate Substances 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- HRYILSDLIGTCOP-UHFFFAOYSA-N N-benzoylurea Chemical compound NC(=O)NC(=O)C1=CC=CC=C1 HRYILSDLIGTCOP-UHFFFAOYSA-N 0.000 description 1
- 229910019093 NaOCl Inorganic materials 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- PKUWKAXTAVNIJR-UHFFFAOYSA-N O,O-diethyl hydrogen thiophosphate Chemical compound CCOP(O)(=S)OCC PKUWKAXTAVNIJR-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ISRUGXGCCGIOQO-UHFFFAOYSA-N Rhoden Chemical compound CNC(=O)OC1=CC=CC=C1OC(C)C ISRUGXGCCGIOQO-UHFFFAOYSA-N 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- WPMWEFXCIYCJSA-UHFFFAOYSA-N Tetraethylene glycol monododecyl ether Chemical compound CCCCCCCCCCCCOCCOCCOCCOCCO WPMWEFXCIYCJSA-UHFFFAOYSA-N 0.000 description 1
- 241000534944 Thia Species 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- BABJTMNVJXLAEX-UHFFFAOYSA-N Triamiphos Chemical compound N1=C(N)N(P(=O)(N(C)C)N(C)C)N=C1C1=CC=CC=C1 BABJTMNVJXLAEX-UHFFFAOYSA-N 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 235000002098 Vicia faba var. major Nutrition 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-O azanium;hydron;hydroxide Chemical compound [NH4+].O VHUUQVKOLVNVRT-UHFFFAOYSA-O 0.000 description 1
- 229940097012 bacillus thuringiensis Drugs 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- WCMMILVIRZAPLE-UHFFFAOYSA-M cyhexatin Chemical compound C1CCCCC1[Sn](C1CCCCC1)(O)C1CCCCC1 WCMMILVIRZAPLE-UHFFFAOYSA-M 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- BZVCTTJRBWHTOF-UHFFFAOYSA-N diethoxy-ethylsulfanyl-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(=S)(OCC)SCC BZVCTTJRBWHTOF-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- HOXINJBQVZWYGZ-UHFFFAOYSA-N fenbutatin oxide Chemical compound C=1C=CC=CC=1C(C)(C)C[Sn](O[Sn](CC(C)(C)C=1C=CC=CC=1)(CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C=1C=CC=CC=1)(CC(C)(C)C=1C=CC=CC=1)CC(C)(C)C1=CC=CC=C1 HOXINJBQVZWYGZ-UHFFFAOYSA-N 0.000 description 1
- WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 1
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000010413 gardening Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 229940091173 hydantoin Drugs 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 235000019357 lignosulphonate Nutrition 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N methyl monoether Natural products COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 230000001459 mortal effect Effects 0.000 description 1
- MRHPLGJUVLKEIN-UHFFFAOYSA-N n,n-dichloro-2-cyano-3-fluorobenzenesulfonamide Chemical compound FC1=CC=CC(S(=O)(=O)N(Cl)Cl)=C1C#N MRHPLGJUVLKEIN-UHFFFAOYSA-N 0.000 description 1
- FZIFUJULXRFHBB-UHFFFAOYSA-N n,n-diethylbenzenesulfonamide Chemical class CCN(CC)S(=O)(=O)C1=CC=CC=C1 FZIFUJULXRFHBB-UHFFFAOYSA-N 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000004045 organic chlorine compounds Chemical class 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical class O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- YFGYUFNIOHWBOB-UHFFFAOYSA-N pirimicarb Chemical compound CN(C)C(=O)OC1=NC(N(C)C)=NC(C)=C1C YFGYUFNIOHWBOB-UHFFFAOYSA-N 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002641 tar oil Substances 0.000 description 1
- MLGCXEBRWGEOQX-UHFFFAOYSA-N tetradifon Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C1=CC(Cl)=C(Cl)C=C1Cl MLGCXEBRWGEOQX-UHFFFAOYSA-N 0.000 description 1
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- AMHNZOICSMBGDH-UHFFFAOYSA-L zineb Chemical compound [Zn+2].[S-]C(=S)NCCNC([S-])=S AMHNZOICSMBGDH-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N41/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom
- A01N41/02—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a sulfur atom bound to a hetero atom containing a sulfur-to-oxygen double bond
- A01N41/04—Sulfonic acids; Derivatives thereof
- A01N41/06—Sulfonic acid amides
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL8000414 | 1980-01-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD157071A5 true DD157071A5 (de) | 1982-10-13 |
Family
ID=19834728
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD81227106A DD157071A5 (de) | 1980-01-23 | 1981-01-20 | Aphicide zusammensetzung |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4379157A (cs) |
| EP (1) | EP0033984B1 (cs) |
| JP (1) | JPS56120664A (cs) |
| AR (1) | AR226871A1 (cs) |
| AT (1) | ATE7787T1 (cs) |
| AU (1) | AU6636081A (cs) |
| BR (1) | BR8100281A (cs) |
| CA (1) | CA1167043A (cs) |
| CS (1) | CS219348B2 (cs) |
| DD (1) | DD157071A5 (cs) |
| DE (1) | DE3162624D1 (cs) |
| DK (1) | DK24181A (cs) |
| ES (2) | ES498695A0 (cs) |
| GR (1) | GR72782B (cs) |
| HU (1) | HU186379B (cs) |
| IE (1) | IE50835B1 (cs) |
| IL (1) | IL61942A (cs) |
| NZ (1) | NZ196046A (cs) |
| PL (1) | PL229285A1 (cs) |
| RO (1) | RO81451A (cs) |
| SU (1) | SU1093247A3 (cs) |
| YU (1) | YU14981A (cs) |
| ZA (1) | ZA81382B (cs) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4492705A (en) * | 1982-02-12 | 1985-01-08 | Ciba-Geigy Corporation | 3-Amidino-benzisothiazole-1,1-dioxides and their use for controlling pests |
| ZA838810B (en) * | 1982-11-26 | 1984-07-25 | Ciba Geigy Ag | Pesticidal compositions |
| EP0110829B1 (de) * | 1982-11-26 | 1990-12-27 | Ciba-Geigy Ag | Schädlingsbekämpfungsmittel |
| DE3408540A1 (de) * | 1984-03-08 | 1985-09-19 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| ZA861026B (en) * | 1985-02-13 | 1986-09-24 | Ciba Geigy Ag | Pesticidal compositions |
| US6376530B1 (en) | 1999-05-10 | 2002-04-23 | Merck & Co., Inc. | Cyclic amidines useful as NMDA NR2B antagonists |
| UA79404C2 (en) * | 2003-10-02 | 2007-06-11 | Basf Ag | 2-cyanobenzenesulfonamide for controlling pests |
| EA200700972A1 (ru) * | 2004-11-26 | 2007-12-28 | Басф Акциенгезельшафт | Новые 2-циано-3-(гало)алкоксибензолсульфонамидные соединения для борьбы с животными-вредителями |
| US20080194404A1 (en) * | 2005-03-24 | 2008-08-14 | Wolfgang Von Deyn | Sulphonyl Compounds for Seed Treatment |
| AR053834A1 (es) * | 2005-03-24 | 2007-05-23 | Basf Ag | Compuestos de 2- cianobencenosulfonamida para el tratamiento de semillas |
| EP1915344B1 (en) * | 2005-07-29 | 2009-07-01 | Basf Se | Cyanopyridine pesticides |
| WO2007045588A1 (en) * | 2005-10-21 | 2007-04-26 | Basf Se | Isothiazolopyridin-3-ylenamines for combating animal pests |
| JP2009516667A (ja) * | 2005-11-21 | 2009-04-23 | ビーエーエスエフ ソシエタス・ヨーロピア | 3−アミノ−1,2−ベンゾイソチアゾール誘導体を用いた殺虫方法 |
| JP2009517369A (ja) * | 2005-11-25 | 2009-04-30 | ビーエーエスエフ ソシエタス・ヨーロピア | 動物害虫を防除するためのシアノベンゼン化合物 |
| PE20071233A1 (es) * | 2006-02-16 | 2008-01-10 | Basf Ag | Compuestos de tioamida para combatir pestes animales |
| WO2007113119A1 (en) * | 2006-03-31 | 2007-10-11 | Basf Se | 3-amino-1,2-benzisothiazole compounds for combating animal pest |
| WO2008031712A2 (en) * | 2006-09-11 | 2008-03-20 | Basf Se | Pesticidal active mixtures comprising sulfonamides |
| ATE549325T1 (de) | 2007-01-26 | 2012-03-15 | Basf Se | 3-amino-1,2-benzisothiazol-verbindungen zur bekämpfung von tierpest ii |
| DE102007024575A1 (de) * | 2007-05-25 | 2008-11-27 | Bayer Cropscience Ag | Insektizide Zusammensetzungen von 2-Cyanobenzolsulfonamidverbindungen und ihrer isomeren Formen mit verbesserter Wirkung |
| WO2008145261A1 (en) | 2007-05-31 | 2008-12-04 | Syngenta Participations Ag | A method of protecting a plant propagation material, a plant, and/or plant organs |
| WO2009007233A2 (en) * | 2007-07-11 | 2009-01-15 | Basf Se | Pesticidal mixtures comprising sulfonamides and one or more fungicides |
| GB0800271D0 (en) * | 2008-01-08 | 2008-02-13 | Syngenta Participations Ag | Chemical compounds |
| WO2009092590A2 (en) | 2008-01-25 | 2009-07-30 | Syngenta Participations Ag | Chemical compounds |
| GB0804067D0 (en) * | 2008-03-04 | 2008-04-09 | Syngenta Participations Ag | Chemical compounds |
| EP2123159A1 (de) | 2008-05-21 | 2009-11-25 | Bayer CropScience AG | (1,2-Benzisothiazol-3-yl)(thio)carbamate und (1,2-Benzisothiazol-3-yl)(thio)oxamate und deren Oxidationsformen als Pestizide |
| GB0809355D0 (en) * | 2008-05-22 | 2008-07-02 | Syngenta Participations Ag | Chemical compounds |
| GB0820710D0 (en) * | 2008-11-12 | 2008-12-17 | Syngenta Participations Ag | Chemical compounds |
| CN102970867A (zh) | 2010-03-18 | 2013-03-13 | 拜耳知识产权有限责任公司 | 作为活性剂对抗非生物植物应激的芳基和杂芳基磺酰胺 |
| EP2471363A1 (de) | 2010-12-30 | 2012-07-04 | Bayer CropScience AG | Verwendung von Aryl-, Heteroaryl- und Benzylsulfonamidocarbonsäuren, -carbonsäureestern, -carbonsäureamiden und -carbonitrilen oder deren Salze zur Steigerung der Stresstoleranz in Pflanzen |
| CA2926250A1 (en) | 2013-10-04 | 2015-04-09 | Bayer Cropscience Aktiengesellschaft | Use of substituted dihydro-oxindolyl sulfonamides, or the salts thereof, for increasing the stress tolerance of plants |
| WO2018108627A1 (de) | 2016-12-12 | 2018-06-21 | Bayer Cropscience Aktiengesellschaft | Verwendung substituierter indolinylmethylsulfonamide oder deren salze zur steigerung der stresstoleranz in pflanzen |
| WO2019025153A1 (de) | 2017-07-31 | 2019-02-07 | Bayer Cropscience Aktiengesellschaft | Verwendung von substituierten n-sulfonyl-n'-aryldiaminoalkanen und n-sulfonyl-n'-heteroaryldiaminoalkanen oder deren salzen zur steigerung der stresstoleranz in pflanzen |
| EP3650447A1 (en) * | 2018-11-08 | 2020-05-13 | Universite de Nantes | New selective modulators of insect nicotinic acetylcholine receptors |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2751392A (en) * | 1953-11-23 | 1956-06-19 | Geschickter Fund Med Res | Tertiary amine derivatives of nu-and omicron-saccharin |
| GB951651A (en) * | 1960-02-17 | 1964-03-11 | Shell Res Ltd | Substituted benzonitriles, their preparation and compositions containing them |
| DE1543380A1 (de) * | 1966-11-09 | 1969-09-11 | Beiersdorf Ag | 4-Chlor-5-sulfamylsalicylsaeurenitril und dessen Salze sowie Verfahren zu deren Herstellung |
| DE1670797A1 (de) * | 1967-02-10 | 1971-03-25 | Hoechst Ag | Benzisothiazol-1,1-dioxyde und Verfahren zu ihrer Herstellung |
| JPS4824735B1 (cs) * | 1970-01-26 | 1973-07-24 | ||
| US3888897A (en) * | 1972-04-12 | 1975-06-10 | Du Pont | Cyano-and cyanomethyl-benzensulfonamides |
| US3901935A (en) * | 1974-02-19 | 1975-08-26 | Dow Chemical Co | Cyanophenyl sulfoxides and sulfones |
| DE2860554D1 (en) * | 1977-12-30 | 1981-04-16 | Ciba Geigy Ag | Process for preparing arylthiols and the compounds thus obtained |
-
1981
- 1981-01-15 AT AT81200042T patent/ATE7787T1/de not_active IP Right Cessation
- 1981-01-15 EP EP81200042A patent/EP0033984B1/en not_active Expired
- 1981-01-15 DE DE8181200042T patent/DE3162624D1/de not_active Expired
- 1981-01-19 US US06/226,533 patent/US4379157A/en not_active Expired - Lifetime
- 1981-01-19 BR BR8100281A patent/BR8100281A/pt unknown
- 1981-01-20 AR AR283996A patent/AR226871A1/es active
- 1981-01-20 PL PL22928581A patent/PL229285A1/xx unknown
- 1981-01-20 IE IE103/81A patent/IE50835B1/en not_active IP Right Cessation
- 1981-01-20 IL IL61942A patent/IL61942A/xx not_active IP Right Cessation
- 1981-01-20 YU YU00149/81A patent/YU14981A/xx unknown
- 1981-01-20 DD DD81227106A patent/DD157071A5/de unknown
- 1981-01-20 AU AU66360/81A patent/AU6636081A/en not_active Abandoned
- 1981-01-20 DK DK24181A patent/DK24181A/da not_active Application Discontinuation
- 1981-01-20 ZA ZA00810382A patent/ZA81382B/xx unknown
- 1981-01-20 NZ NZ196046A patent/NZ196046A/xx unknown
- 1981-01-20 GR GR63942A patent/GR72782B/el unknown
- 1981-01-20 JP JP604381A patent/JPS56120664A/ja active Pending
- 1981-01-20 RO RO81103171A patent/RO81451A/ro unknown
- 1981-01-21 CS CS81439A patent/CS219348B2/cs unknown
- 1981-01-21 ES ES498695A patent/ES498695A0/es active Granted
- 1981-01-21 CA CA000368982A patent/CA1167043A/en not_active Expired
- 1981-01-22 HU HU81134A patent/HU186379B/hu unknown
- 1981-03-24 ES ES500638A patent/ES500638A0/es active Granted
- 1981-06-19 SU SU813328851A patent/SU1093247A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| IE50835B1 (en) | 1986-07-23 |
| IL61942A (en) | 1985-11-29 |
| YU14981A (en) | 1983-10-31 |
| AU6636081A (en) | 1981-07-30 |
| ES8201965A1 (es) | 1982-01-01 |
| ATE7787T1 (de) | 1984-06-15 |
| DE3162624D1 (en) | 1984-07-12 |
| EP0033984A1 (en) | 1981-08-19 |
| HU186379B (en) | 1985-07-29 |
| IL61942A0 (en) | 1981-02-27 |
| US4379157A (en) | 1983-04-05 |
| AR226871A1 (es) | 1982-08-31 |
| BR8100281A (pt) | 1981-08-04 |
| PL229285A1 (cs) | 1982-04-13 |
| GR72782B (cs) | 1983-12-05 |
| DK24181A (da) | 1981-07-24 |
| ES500638A0 (es) | 1982-01-01 |
| ES8200654A1 (es) | 1981-11-01 |
| JPS56120664A (en) | 1981-09-22 |
| CA1167043A (en) | 1984-05-08 |
| CS219348B2 (en) | 1983-03-25 |
| RO81451A (ro) | 1984-04-02 |
| NZ196046A (en) | 1983-04-12 |
| ES498695A0 (es) | 1981-11-01 |
| SU1093247A3 (ru) | 1984-05-15 |
| ZA81382B (en) | 1982-02-24 |
| IE810103L (en) | 1981-07-23 |
| EP0033984B1 (en) | 1984-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD157071A5 (de) | Aphicide zusammensetzung | |
| DE2129678A1 (de) | Herbizide und pestizide Mittel | |
| DE2648008A1 (de) | Acetanilide | |
| EP0272594A1 (de) | Bicyclische Imide, Verfahren zu ihrer Herstellung sowie ihre Verwendung im Pflanzenschutz | |
| DE69126836T2 (de) | Herbizide | |
| EP0039310A2 (de) | Phosphonomethylglycylhydroxamsäure und Salze derselben, deren Herstellung und Verwendung in herbiziden Mitteln | |
| DE1274401B (de) | Herbicides Mittel | |
| DD149452A5 (de) | Fungizide zusammensetzung | |
| EP0122231B1 (de) | Herbizides Mittel | |
| DE3533440A1 (de) | N-substituierte 3,4,5,6-tetrahydrophthalimide, verfahren zu ihrer herstellung sowie ihre verwendung im pflanzenschutz | |
| DE3101889A1 (de) | "neue phenoxycarbonsaeureamide, verfahren zu ihrer herstellung und ihre verwendung als herbizide" | |
| DD240494A5 (de) | Pestizide zusammensetzung | |
| DE2524578A1 (de) | Barbitursaeurederivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| EP0062254A1 (de) | Substituierte Acetanilide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| EP0319689B1 (de) | Heterocyclisch substituierte N-Sultam-sulfonamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide und Pflanzenwachstumsregulatoren | |
| CH631721A5 (de) | Pflanzenschutzmittel. | |
| DE3227869A1 (de) | Herbizide phenoxybenzoesaeureverbindungen | |
| DE2256172A1 (de) | Phenylpyridazine, ihre herstellung und verwendung als herbizide | |
| DD251067A5 (de) | Herbizide zusammensetzung | |
| EP0011802B1 (de) | Neue Phenoxy-phenoxypropionsäureamide, Verfahren zu ihrer Herstellung, sie enthaltende herbizide Mittel und ihre Verwendung zur Bekämpfung von Schadpflanzen | |
| EP0071572A2 (de) | Derivate der 2-Nitro-4- oder 5-Pyridyloxy-phenylphosphonsäure, Verfahren zu ihrer Herstellung, ihre Verwendung als Herbizide und/oder Pflanzenwachstumsregulatoren und/oder Mikrobizide, sowie zur Herstellung der Derivate verwendete Zwischenprodukte, Verfahren zu deren Herstellung und deren Verwendung als Herbizide | |
| IL31205A (en) | (thiono)carbamates of dithiacycloheptanone-oxime | |
| EP0007066A1 (de) | 4-Alkyl- und 4-Allyl-merkapto-, sulfinyl- und sulfonyl-methyl-2-amino-6-N,N'-dimethylcarbamoyloxy-pyrimidine, Verfahren zu ihrer Herstellung, Mittel welche diese Pyrimidine enthalten und deren Verwendung zur Bekämpfung von Insekten | |
| DE2431801C3 (de) | Benzothiazolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur selektiven Unkrautbekämpfung in Reis- oder Weizenkulturen | |
| DE2043209A1 (de) | 3 Hydroxyisothiazole und deren Ver wendung als Biozide |