DD151935A5 - Verfahren zur kontinuierlichen herstellung von lauroylperoxid - Google Patents
Verfahren zur kontinuierlichen herstellung von lauroylperoxid Download PDFInfo
- Publication number
- DD151935A5 DD151935A5 DD80222457A DD22245780A DD151935A5 DD 151935 A5 DD151935 A5 DD 151935A5 DD 80222457 A DD80222457 A DD 80222457A DD 22245780 A DD22245780 A DD 22245780A DD 151935 A5 DD151935 A5 DD 151935A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- reaction mixture
- temperature
- lauroyl peroxide
- reaction
- reaction vessel
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 35
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 title claims abstract description 21
- 238000010924 continuous production Methods 0.000 title claims abstract description 7
- 238000006243 chemical reaction Methods 0.000 claims abstract description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims abstract description 21
- 239000011541 reaction mixture Substances 0.000 claims abstract description 18
- 239000003960 organic solvent Substances 0.000 claims abstract description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 9
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 8
- 238000001816 cooling Methods 0.000 claims abstract description 6
- NQGIJDNPUZEBRU-UHFFFAOYSA-N dodecanoyl chloride Chemical compound CCCCCCCCCCCC(Cl)=O NQGIJDNPUZEBRU-UHFFFAOYSA-N 0.000 claims abstract description 6
- 238000002844 melting Methods 0.000 claims abstract description 5
- 230000008018 melting Effects 0.000 claims abstract description 5
- 239000000376 reactant Substances 0.000 claims abstract description 4
- 101000588924 Anthopleura elegantissima Delta-actitoxin-Ael1a Proteins 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 4
- 229910001385 heavy metal Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000002904 solvent Substances 0.000 abstract description 3
- 239000003054 catalyst Substances 0.000 abstract description 2
- 238000006116 polymerization reaction Methods 0.000 abstract description 2
- 101100072620 Streptomyces griseus ind2 gene Proteins 0.000 abstract 2
- 235000011121 sodium hydroxide Nutrition 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 238000002360 preparation method Methods 0.000 abstract 1
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000002699 waste material Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000002351 wastewater Substances 0.000 description 5
- 239000005639 Lauric acid Substances 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000005187 foaming Methods 0.000 description 3
- 159000000014 iron salts Chemical class 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 150000002978 peroxides Chemical class 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000005188 flotation Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 238000003915 air pollution Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- -1 iron ion Chemical class 0.000 description 1
- 229910000358 iron sulfate Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/32—Peroxy compounds the —O—O— group being bound between two >C=O groups
- C07C409/34—Peroxy compounds the —O—O— group being bound between two >C=O groups both belonging to carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2928020A DE2928020C2 (de) | 1979-07-11 | 1979-07-11 | Verfahren zur kontinuierlichen Herstellung von Lauroylperoxid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD151935A5 true DD151935A5 (de) | 1981-11-11 |
Family
ID=6075453
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD80222457A DD151935A5 (de) | 1979-07-11 | 1980-07-07 | Verfahren zur kontinuierlichen herstellung von lauroylperoxid |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4782189A (enExample) |
| JP (1) | JPS5649349A (enExample) |
| AU (1) | AU537837B2 (enExample) |
| BE (1) | BE884227A (enExample) |
| BR (1) | BR8004292A (enExample) |
| CA (1) | CA1138001A (enExample) |
| DD (1) | DD151935A5 (enExample) |
| DE (1) | DE2928020C2 (enExample) |
| DK (1) | DK298780A (enExample) |
| ES (1) | ES8104221A1 (enExample) |
| FR (1) | FR2460928A1 (enExample) |
| GB (1) | GB2054583B (enExample) |
| IT (1) | IT1129816B (enExample) |
| NL (1) | NL188903C (enExample) |
| NO (1) | NO152170C (enExample) |
| SE (1) | SE430985B (enExample) |
| ZA (1) | ZA803674B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3224244B1 (de) * | 2014-11-28 | 2019-01-30 | United Initiators Gmbh | Verfahren zur herstellung von pulverförmigem lauroylperoxid |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD38072A (enExample) * | ||||
| US2771492A (en) * | 1953-08-07 | 1956-11-20 | Ici Ltd | Production of dodecanoyl peroxide |
| FR1329593A (fr) * | 1960-10-31 | 1963-06-14 | Montedison Spa | Procédé de préparation des diacylperoxydes |
| DE1290545B (de) * | 1965-10-20 | 1969-03-13 | Elektrochem Werke Muenchen Ag | Verfahren und Vorrichtung zur Trocknung fester, zersetzlicher Diacylperoxyde |
| DE1643599B1 (de) * | 1967-10-17 | 1972-09-21 | Argus Chem | Verfahren zur Isolierung und Reinigung von bei Raumtemperatur festen Diacylperoxyden |
| DE1793327A1 (de) * | 1968-09-02 | 1972-05-18 | Peroxid Chemie Gmbh | Verfahren zur Herstellung von Diacylperoxyden |
| DE1935297A1 (de) * | 1969-07-11 | 1971-01-14 | Degussa | Verfahren zur Herstellung von Diaroyl- und Diacylperoxiden |
-
1979
- 1979-07-11 DE DE2928020A patent/DE2928020C2/de not_active Expired
-
1980
- 1980-06-11 CA CA000353755A patent/CA1138001A/en not_active Expired
- 1980-06-19 ZA ZA00803674A patent/ZA803674B/xx unknown
- 1980-06-20 NL NLAANVRAGE8003574,A patent/NL188903C/xx not_active IP Right Cessation
- 1980-06-26 SE SE8004735A patent/SE430985B/sv unknown
- 1980-07-03 AU AU60065/80A patent/AU537837B2/en not_active Ceased
- 1980-07-07 DD DD80222457A patent/DD151935A5/de unknown
- 1980-07-07 GB GB8022207A patent/GB2054583B/en not_active Expired
- 1980-07-09 FR FR8015336A patent/FR2460928A1/fr active Granted
- 1980-07-09 BE BE1/9891A patent/BE884227A/fr not_active IP Right Cessation
- 1980-07-09 JP JP9282780A patent/JPS5649349A/ja active Pending
- 1980-07-10 IT IT68098/80A patent/IT1129816B/it active
- 1980-07-10 NO NO802070A patent/NO152170C/no unknown
- 1980-07-10 BR BR8004292A patent/BR8004292A/pt unknown
- 1980-07-10 ES ES493289A patent/ES8104221A1/es not_active Expired
- 1980-07-10 DK DK298780A patent/DK298780A/da not_active Application Discontinuation
-
1987
- 1987-09-15 US US07/096,851 patent/US4782189A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4782189A (en) | 1988-11-01 |
| AU6006580A (en) | 1981-01-15 |
| BR8004292A (pt) | 1981-01-27 |
| IT1129816B (it) | 1986-06-11 |
| DE2928020C2 (de) | 1985-01-10 |
| SE430985B (sv) | 1983-12-27 |
| ES493289A0 (es) | 1981-04-16 |
| NO152170C (no) | 1985-08-14 |
| AU537837B2 (en) | 1984-07-12 |
| NL188903B (nl) | 1992-06-01 |
| NO802070L (no) | 1981-01-12 |
| DK298780A (da) | 1981-01-12 |
| IT8068098A0 (it) | 1980-07-10 |
| DE2928020A1 (de) | 1981-01-29 |
| NL8003574A (nl) | 1981-01-13 |
| GB2054583A (en) | 1981-02-18 |
| ES8104221A1 (es) | 1981-04-16 |
| CA1138001A (en) | 1982-12-21 |
| ZA803674B (en) | 1981-07-29 |
| NL188903C (nl) | 1992-11-02 |
| JPS5649349A (en) | 1981-05-02 |
| FR2460928A1 (fr) | 1981-01-30 |
| NO152170B (no) | 1985-05-06 |
| SE8004735L (sv) | 1981-01-12 |
| GB2054583B (en) | 1983-03-02 |
| FR2460928B1 (enExample) | 1983-01-21 |
| BE884227A (fr) | 1981-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE857810C (de) | Verfahren zur Herstellung von aliphatischen und cycloaliphatischen Hydroperoxyden | |
| DE3025475C2 (de) | Verfahren zur Herstellung von aromatischen Dialdehyden | |
| EP0068219B1 (de) | Verfahren zur Herstellung von Carbonsäuren und N-tert. Alkylaminen | |
| DE2648300B2 (de) | Verfahren zur Herstellung von Alkalisalzen der 33J>imethyl-2-oxo-buttersäure | |
| DD301934A9 (de) | Verfahren zur Herstellung von schwachsauren Kationenaustauschharzen | |
| DD151935A5 (de) | Verfahren zur kontinuierlichen herstellung von lauroylperoxid | |
| DE3101459C2 (de) | Verfahren zur Herstellung von Peroxyestern | |
| DE3049541A1 (de) | Verfahren zur herstellung von 2,4-dichlor- bzw. 2-methyl-4-chlorphenoxyessigsaeure | |
| DE68923918T2 (de) | Katalysatoren, die auf Ton oder wasserhaltiges Silikat aufgebrachte Metallverbindungen enthalten, und ihre Verwendung. | |
| EP0005849B1 (de) | Verfahren zur Herstellung von Alpha-Chlor-N-monoalkyl-acetoacetamiden | |
| EP0518889B1 (de) | Verfahren zur herstellung von 3'-aminopropyl-2-sulfatoethylsulfon | |
| DE69508864T2 (de) | Verfahren zur Herstellung von Pikrinsaüre | |
| EP1633705B1 (de) | Oxidation von mercaptoethanol | |
| EP0897910B1 (de) | Verfahren zur Herstellung von 2-Carboxyy-5-nitro-benzolsulfonsäure und deren Salzen durch Oxidation | |
| DE19633608A1 (de) | Verfahren zur Herstellung von p-Kresol | |
| EP0013859A1 (de) | Verfahren zur Herstellung von Benzimidazolon-(2) | |
| DE3135367A1 (de) | "verfahren zur herstellung von nitrophenyl-(beta)-hydroxyaethylsulfid- und -(beta)-hydroxyaethylsulfon-derivaten" | |
| EP0143750B1 (de) | Verfahren zur Herstellung von 4-Nitrotoluol-2-sulfonsäure | |
| EP0575852B1 (de) | Verfahren zur Herstellung von Dinitro-polyalkylenbenzolen | |
| EP0050290A1 (de) | Verfahren zur Herstellung von Alkalisalzen der Imidodisulfonsäure | |
| EP0123042B1 (de) | Verfahren zur Herstellung von Quadratsäure | |
| DE2816503C3 (de) | Verfahren zur Herstellung von 2-Mercaptobenzthiazol | |
| EP0066770B1 (de) | Verfahren zur Herstellung von 3-Hydroxybenzoesäure | |
| EP0216204B1 (de) | Verfahren zur Herstellung von 1,3,6,8-Tetrabrompyren | |
| EP0691323A1 (de) | Verfahren zur Herstellung von 3,5-Dihydroxy-4-brombenzoesäure |