DD142770A5 - Elektrische gasentladungslampe - Google Patents
Elektrische gasentladungslampe Download PDFInfo
- Publication number
- DD142770A5 DD142770A5 DD79212095A DD21209579A DD142770A5 DD 142770 A5 DD142770 A5 DD 142770A5 DD 79212095 A DD79212095 A DD 79212095A DD 21209579 A DD21209579 A DD 21209579A DD 142770 A5 DD142770 A5 DD 142770A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- discharge vessel
- current
- discharge lamp
- lamp
- gas discharge
- Prior art date
Links
- 210000002105 tongue Anatomy 0.000 claims description 9
- 239000000919 ceramic Substances 0.000 claims description 8
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 238000005452 bending Methods 0.000 description 2
- 229910010293 ceramic material Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000007790 scraping Methods 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 238000003754 machining Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052594 sapphire Inorganic materials 0.000 description 1
- 239000010980 sapphire Substances 0.000 description 1
- 239000003566 sealing material Substances 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/36—Seals between parts of vessels; Seals for leading-in conductors; Leading-in conductors
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7803763,A NL178108C (nl) | 1978-04-10 | 1978-04-10 | Elektrische gasontladingslamp. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD142770A5 true DD142770A5 (de) | 1980-07-09 |
Family
ID=19830618
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD79212095A DD142770A5 (de) | 1978-04-10 | 1979-04-09 | Elektrische gasentladungslampe |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4283652A (enExample) |
| JP (1) | JPS54136769A (enExample) |
| BE (1) | BE875434A (enExample) |
| BR (1) | BR7902176A (enExample) |
| CA (1) | CA1135762A (enExample) |
| DD (1) | DD142770A5 (enExample) |
| DE (1) | DE2913740A1 (enExample) |
| FR (1) | FR2423059A1 (enExample) |
| GB (1) | GB2019087B (enExample) |
| HU (1) | HU184667B (enExample) |
| IT (1) | IT1112464B (enExample) |
| NL (1) | NL178108C (enExample) |
| SE (1) | SE7903069L (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL185482C (nl) * | 1980-09-05 | 1991-01-16 | Philips Nv | Hogedrukontladingslamp. |
| EP0187401A1 (en) * | 1984-12-18 | 1986-07-16 | Koninklijke Philips Electronics N.V. | High-pressure discharge lamp |
| US5178808A (en) * | 1988-10-05 | 1993-01-12 | Makar Frank B | End seal manufacture for ceramic arc tubes |
| DE202011002638U1 (de) * | 2011-02-11 | 2012-02-27 | Osram Ag | Stromzuführung, Stromzuführungssystem und Lampe mit derartiger Stromzuführung |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE899090C (de) * | 1940-12-24 | 1953-12-07 | Siemens Ag | Vorrichtung zur Befestigung von Anodenkoepfen, vorzugsweise aus Graphit, am Anodenbolzen bei elektrischen Entladungsapparaten |
| US3351803A (en) * | 1964-11-12 | 1967-11-07 | Westinghouse Electric Corp | Seal and lead-in conductor assembly for gaseous discharge lamps |
| NL154865B (nl) * | 1967-03-31 | 1977-10-17 | Philips Nv | Elektrische gasontladingslamp met een omhulling van dichtgesinterd aluminiumoxyde en werkwijze voor het vervaardigen van een dergelijke gasontladingslamp. |
| GB1204624A (en) * | 1968-02-22 | 1970-09-09 | Thorn Lighting Ltd Formerly Kn | Electric lamps |
| US3558963A (en) * | 1968-08-16 | 1971-01-26 | Gen Electric | High-intensity vapor arc-lamp |
| GB1361225A (en) * | 1971-06-30 | 1974-07-24 | Gen Electric Co Ltd | Method of bonding alumina to a refractory metal or alloy |
| US3746907A (en) * | 1971-09-08 | 1973-07-17 | Westinghouse Electric Corp | End cap configuration for ceramic discharge lamp |
| JPS5056783A (enExample) * | 1973-09-19 | 1975-05-17 | ||
| US3986236A (en) * | 1974-02-25 | 1976-10-19 | Gte Sylvania Incorporated | Method of sealing alumina arc tube |
| NL7511416A (nl) * | 1975-09-29 | 1977-03-31 | Philips Nv | Elektrische ontladingslamp. |
-
1978
- 1978-04-10 NL NLAANVRAGE7803763,A patent/NL178108C/xx not_active IP Right Cessation
-
1979
- 1979-03-22 US US06/022,745 patent/US4283652A/en not_active Expired - Lifetime
- 1979-04-05 CA CA000324969A patent/CA1135762A/en not_active Expired
- 1979-04-05 DE DE19792913740 patent/DE2913740A1/de not_active Ceased
- 1979-04-06 SE SE7903069A patent/SE7903069L/ unknown
- 1979-04-06 GB GB7912238A patent/GB2019087B/en not_active Expired
- 1979-04-06 IT IT7921661A patent/IT1112464B/it active
- 1979-04-06 HU HU79PI672A patent/HU184667B/hu not_active IP Right Cessation
- 1979-04-07 JP JP4242279A patent/JPS54136769A/ja active Granted
- 1979-04-09 FR FR7908956A patent/FR2423059A1/fr active Granted
- 1979-04-09 BE BE0/194489A patent/BE875434A/xx not_active IP Right Cessation
- 1979-04-09 BR BR7902176A patent/BR7902176A/pt unknown
- 1979-04-09 DD DD79212095A patent/DD142770A5/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2913740A1 (de) | 1979-10-11 |
| NL7803763A (nl) | 1979-10-12 |
| FR2423059B1 (enExample) | 1984-02-24 |
| NL178108C (nl) | 1986-10-16 |
| US4283652A (en) | 1981-08-11 |
| SE7903069L (sv) | 1979-10-11 |
| BE875434A (fr) | 1979-10-09 |
| IT1112464B (it) | 1986-01-13 |
| CA1135762A (en) | 1982-11-16 |
| NL178108B (nl) | 1985-08-16 |
| FR2423059A1 (fr) | 1979-11-09 |
| GB2019087B (en) | 1982-04-15 |
| JPS54136769A (en) | 1979-10-24 |
| HU184667B (en) | 1984-09-28 |
| IT7921661A0 (it) | 1979-04-06 |
| GB2019087A (en) | 1979-10-24 |
| JPH0122706B2 (enExample) | 1989-04-27 |
| BR7902176A (pt) | 1979-12-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2623099C2 (de) | Kurzbogenentladungslampe | |
| EP0479087A1 (de) | Hochdruckentladungslampe | |
| DE69403176T2 (de) | Elektrische Lampe | |
| DE69603926T2 (de) | Beleuchtungseinheit, elektrodenlose niederdruckentladungslampe und entladungsgefäss zur verwendung in der beleuchtungseinheit | |
| DE3616330A1 (de) | Kurzbogenlampe | |
| DE2641867A1 (de) | Elektrische entladungslampe | |
| DE680475C (de) | Elektrische Hochdruckdampfentladungslampe mit Quarzgefaess | |
| DE69826960T2 (de) | Kurzbogenlampe | |
| DE2548301C3 (de) | Natriumdampf-Hochdrucklampe | |
| DE2814411A1 (de) | Hochdruckmetalldampfentladungslampe | |
| DE2732060C2 (de) | Elektrische Leuchtstofflampe | |
| DD142770A5 (de) | Elektrische gasentladungslampe | |
| WO2006058513A1 (de) | Hochdruckentladungslampe | |
| DE2713702C3 (enExample) | ||
| EP0825636A2 (de) | Hochdruckentladungslampe | |
| DE1489616B2 (de) | Kurzbogen-Entladungslampe | |
| EP0560063B1 (de) | Niederdruckentladungslampe | |
| DE2304771C3 (de) | Elektrische Entladungsröhre mit einer direkt heizbaren Kathode | |
| DE3305468C2 (enExample) | ||
| DE2656264C3 (de) | Leitungseinführung für eine Hochdruck-Dampfentladungslampe | |
| DE69707350T2 (de) | Elektrodenanordnung für Natrium-Hochdruckentladungslampe und deren Herstellungsverfahren | |
| EP0154383B1 (de) | Heizbare Elektrode für Hochdruck-Gasentladungslampen | |
| DE10214777A1 (de) | Metallhalogenidlampe mit keramischem Entladungsgefäß | |
| DE3227380A1 (de) | Elektrische entladungslampe | |
| DE2941114C2 (de) | Hochdruck-Natriumdampf-Entladungslampe |