CZ285592A3 - Benzanilide derivatives, process of their preparation and pharmaceutical compositions containing them - Google Patents
Benzanilide derivatives, process of their preparation and pharmaceutical compositions containing them Download PDFInfo
- Publication number
- CZ285592A3 CZ285592A3 CS922855A CS285592A CZ285592A3 CZ 285592 A3 CZ285592 A3 CZ 285592A3 CS 922855 A CS922855 A CS 922855A CS 285592 A CS285592 A CS 285592A CZ 285592 A3 CZ285592 A3 CZ 285592A3
- Authority
- CZ
- Czechia
- Prior art keywords
- methyl
- carbon atoms
- alkyl
- phenyl
- group
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 25
- 238000000034 method Methods 0.000 title claims description 19
- ZVSKZLHKADLHSD-UHFFFAOYSA-N benzanilide Chemical class C=1C=CC=CC=1C(=O)NC1=CC=CC=C1 ZVSKZLHKADLHSD-UHFFFAOYSA-N 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 6
- 230000008569 process Effects 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 178
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 45
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 33
- 150000003839 salts Chemical class 0.000 claims abstract description 32
- 238000011282 treatment Methods 0.000 claims abstract description 26
- 239000012453 solvate Substances 0.000 claims abstract description 23
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 21
- 125000001424 substituent group Chemical group 0.000 claims abstract description 20
- 125000005843 halogen group Chemical group 0.000 claims abstract description 14
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 9
- 150000002367 halogens Chemical class 0.000 claims abstract description 9
- 238000011321 prophylaxis Methods 0.000 claims abstract description 5
- 239000000203 mixture Substances 0.000 claims description 124
- 125000004432 carbon atom Chemical group C* 0.000 claims description 92
- -1 methoxyethyl group Chemical group 0.000 claims description 89
- 125000000217 alkyl group Chemical group 0.000 claims description 71
- 229910052757 nitrogen Inorganic materials 0.000 claims description 67
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 41
- 125000003545 alkoxy group Chemical group 0.000 claims description 28
- 239000001257 hydrogen Substances 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 229910052799 carbon Inorganic materials 0.000 claims description 17
- 125000000623 heterocyclic group Chemical group 0.000 claims description 16
- 125000006413 ring segment Chemical group 0.000 claims description 15
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 14
- 125000004429 atom Chemical group 0.000 claims description 12
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 12
- 229910052760 oxygen Inorganic materials 0.000 claims description 12
- 239000001301 oxygen Substances 0.000 claims description 12
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 11
- 150000002148 esters Chemical class 0.000 claims description 10
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 229910052740 iodine Inorganic materials 0.000 claims description 9
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 8
- 150000008064 anhydrides Chemical class 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 125000004434 sulfur atom Chemical group 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 claims description 7
- 206010012289 Dementia Diseases 0.000 claims description 6
- 208000018737 Parkinson disease Diseases 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000006239 protecting group Chemical group 0.000 claims description 6
- 206010034010 Parkinsonism Diseases 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- 208000026139 Memory disease Diseases 0.000 claims description 4
- 208000027089 Parkinsonian disease Diseases 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 4
- 125000004043 oxo group Chemical group O=* 0.000 claims description 4
- 230000028327 secretion Effects 0.000 claims description 4
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical group C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims description 4
- IJUKXLYWNIOUOH-UHFFFAOYSA-N 4-(4-carbamoylphenyl)benzamide Chemical compound C1=CC(C(=O)N)=CC=C1C1=CC=C(C(N)=O)C=C1 IJUKXLYWNIOUOH-UHFFFAOYSA-N 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 3
- 208000019022 Mood disease Diseases 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 206010043118 Tardive Dyskinesia Diseases 0.000 claims description 3
- 239000000935 antidepressant agent Substances 0.000 claims description 3
- 229940005513 antidepressants Drugs 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 230000004899 motility Effects 0.000 claims description 3
- 239000003176 neuroleptic agent Substances 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- IAJBAULWDWHFHZ-UHFFFAOYSA-N 3-chloro-4-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-n,n-dimethylbenzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(C(=O)N(C)C)C=C1Cl IAJBAULWDWHFHZ-UHFFFAOYSA-N 0.000 claims description 2
- SOZBFMCPRKQOGN-UHFFFAOYSA-N 4-(4-cyano-2-methylphenyl)-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(C#N)C=C1C SOZBFMCPRKQOGN-UHFFFAOYSA-N 0.000 claims description 2
- PFPQIHWZKYHBJH-UHFFFAOYSA-N 4-[4-(2-methoxyethoxymethyl)-2-methylphenyl]-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide Chemical compound CC1=CC(COCCOC)=CC=C1C1=CC=C(C(=O)NC=2C=C(C(OC)=CC=2)N2CCN(C)CC2)C=C1 PFPQIHWZKYHBJH-UHFFFAOYSA-N 0.000 claims description 2
- 208000008811 Agoraphobia Diseases 0.000 claims description 2
- 208000031091 Amnestic disease Diseases 0.000 claims description 2
- 208000019901 Anxiety disease Diseases 0.000 claims description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 2
- 208000030814 Eating disease Diseases 0.000 claims description 2
- 208000019454 Feeding and Eating disease Diseases 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 241001465754 Metazoa Species 0.000 claims description 2
- 208000021384 Obsessive-Compulsive disease Diseases 0.000 claims description 2
- 206010033670 Panic reaction Diseases 0.000 claims description 2
- 206010041250 Social phobia Diseases 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 239000000939 antiparkinson agent Substances 0.000 claims description 2
- 235000010290 biphenyl Nutrition 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 2
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 2
- 235000014632 disordered eating Nutrition 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims description 2
- 208000024732 dysthymic disease Diseases 0.000 claims description 2
- 208000037870 generalized anxiety Diseases 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000002490 anilino group Chemical class [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims 2
- UZEACFSGGQBGFN-UHFFFAOYSA-N 4-[4-(dimethylamino)-2-methylphenyl]-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(N(C)C)C=C1C UZEACFSGGQBGFN-UHFFFAOYSA-N 0.000 claims 1
- DGLGRPPFBPHHJR-UHFFFAOYSA-N 4-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-n,n,3-trimethylbenzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(C(=O)N(C)C)C=C1C DGLGRPPFBPHHJR-UHFFFAOYSA-N 0.000 claims 1
- 206010002650 Anorexia nervosa and bulimia Diseases 0.000 claims 1
- 208000020401 Depressive disease Diseases 0.000 claims 1
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims 1
- 230000032683 aging Effects 0.000 claims 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 claims 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 239000012188 paraffin wax Substances 0.000 claims 1
- 208000028173 post-traumatic stress disease Diseases 0.000 claims 1
- 239000004001 serotonin 1D antagonist Substances 0.000 claims 1
- 208000012201 sexual and gender identity disease Diseases 0.000 claims 1
- 208000015891 sexual disease Diseases 0.000 claims 1
- 238000002560 therapeutic procedure Methods 0.000 claims 1
- 208000015114 central nervous system disease Diseases 0.000 abstract description 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 abstract 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 159
- 239000000543 intermediate Substances 0.000 description 159
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 130
- 239000000243 solution Substances 0.000 description 124
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 110
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 86
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 83
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 82
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 77
- 239000007787 solid Substances 0.000 description 69
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 64
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 63
- 238000004809 thin layer chromatography Methods 0.000 description 58
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- 239000000284 extract Substances 0.000 description 45
- 238000003818 flash chromatography Methods 0.000 description 42
- 229910000029 sodium carbonate Inorganic materials 0.000 description 40
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 38
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 36
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 235000019441 ethanol Nutrition 0.000 description 32
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical group COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 31
- 239000002904 solvent Substances 0.000 description 29
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 28
- 239000006260 foam Substances 0.000 description 27
- 239000003921 oil Substances 0.000 description 26
- 235000019198 oils Nutrition 0.000 description 26
- 239000000725 suspension Substances 0.000 description 25
- 238000010992 reflux Methods 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- 238000004458 analytical method Methods 0.000 description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000002253 acid Substances 0.000 description 15
- 239000000741 silica gel Substances 0.000 description 15
- 229910002027 silica gel Inorganic materials 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- KWVXDZLVCISXIB-UHFFFAOYSA-N 4-bromo-3-methylbenzoic acid Chemical compound CC1=CC(C(O)=O)=CC=C1Br KWVXDZLVCISXIB-UHFFFAOYSA-N 0.000 description 13
- 238000001704 evaporation Methods 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- 239000000843 powder Substances 0.000 description 13
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 12
- 230000008020 evaporation Effects 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- 108020003175 receptors Proteins 0.000 description 12
- 102000005962 receptors Human genes 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 208000035475 disorder Diseases 0.000 description 10
- 238000000605 extraction Methods 0.000 description 10
- 239000000377 silicon dioxide Substances 0.000 description 10
- 239000002585 base Substances 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 9
- 239000012230 colorless oil Substances 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 239000006071 cream Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000000600 sorbitol Substances 0.000 description 8
- 235000010356 sorbitol Nutrition 0.000 description 8
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 8
- 238000005303 weighing Methods 0.000 description 8
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 7
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 238000003786 synthesis reaction Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 6
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 6
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 6
- 239000004327 boric acid Substances 0.000 description 6
- 238000007796 conventional method Methods 0.000 description 6
- 229920001971 elastomer Polymers 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 239000013543 active substance Substances 0.000 description 5
- 238000004090 dissolution Methods 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 5
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 5
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 208000031879 Chédiak-Higashi syndrome Diseases 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- 208000025517 cannabinoid hyperemesis syndrome Diseases 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- QZIQJVCYUQZDIR-UHFFFAOYSA-N mechlorethamine hydrochloride Chemical compound Cl.ClCCN(C)CCCl QZIQJVCYUQZDIR-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000010502 orange oil Substances 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N 1H-imidazole Chemical compound C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 108091032151 5-hydroxytryptamine receptor family Proteins 0.000 description 3
- 102000040125 5-hydroxytryptamine receptor family Human genes 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 3
- 235000019502 Orange oil Nutrition 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 229910000085 borane Inorganic materials 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 229940099112 cornstarch Drugs 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000010511 deprotection reaction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000008108 microcrystalline cellulose Substances 0.000 description 3
- 229940016286 microcrystalline cellulose Drugs 0.000 description 3
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 150000002940 palladium Chemical class 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 229940032147 starch Drugs 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 210000002784 stomach Anatomy 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- YLRBJYMANQKEAW-UHFFFAOYSA-N 1-bromo-4-(bromomethyl)benzene Chemical compound BrCC1=CC=C(Br)C=C1 YLRBJYMANQKEAW-UHFFFAOYSA-N 0.000 description 2
- QGNLHMKIGMZKJX-UHFFFAOYSA-N 3-chloro-4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C(Cl)=C1 QGNLHMKIGMZKJX-UHFFFAOYSA-N 0.000 description 2
- HUECCDWHZJPDBS-UHFFFAOYSA-N 4-[4-(methanesulfonamido)-2-methylphenyl]-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(NS(C)(=O)=O)C=C1C HUECCDWHZJPDBS-UHFFFAOYSA-N 0.000 description 2
- MMEGELSFOYDPQW-UHFFFAOYSA-N 4-bromo-3-methylaniline Chemical compound CC1=CC(N)=CC=C1Br MMEGELSFOYDPQW-UHFFFAOYSA-N 0.000 description 2
- SKXUZFJOLNNWIG-UHFFFAOYSA-N 4-bromo-3-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC=C1Br SKXUZFJOLNNWIG-UHFFFAOYSA-N 0.000 description 2
- BRRVYBRXLUEEJP-UHFFFAOYSA-N 4-bromo-n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=C(Br)C=C1 BRRVYBRXLUEEJP-UHFFFAOYSA-N 0.000 description 2
- NGRRREPRVBZRID-UHFFFAOYSA-N 4-methoxy-3-(4-methylpiperazin-1-yl)aniline Chemical compound COC1=CC=C(N)C=C1N1CCN(C)CC1 NGRRREPRVBZRID-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- BCNVOUKBLGLBEZ-UHFFFAOYSA-N CC1=C(C=CC(C1)(C(=O)NC2=CC(=C(C=C2)OC)N3CCN(CC3)C)S(=O)C)C4=CC=CC=C4 Chemical compound CC1=C(C=CC(C1)(C(=O)NC2=CC(=C(C=C2)OC)N3CCN(CC3)C)S(=O)C)C4=CC=CC=C4 BCNVOUKBLGLBEZ-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- WTDRDQBEARUVNC-LURJTMIESA-N L-DOPA Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 description 2
- WTDRDQBEARUVNC-UHFFFAOYSA-N L-Dopa Natural products OC(=O)C(N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- BKRGVLQUQGGVSM-KBXCAEBGSA-N Revanil Chemical compound C1=CC(C=2[C@H](N(C)C[C@H](C=2)NC(=O)N(CC)CC)C2)=C3C2=CNC3=C1 BKRGVLQUQGGVSM-KBXCAEBGSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 206010047163 Vasospasm Diseases 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 125000002015 acyclic group Chemical group 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000003042 antagnostic effect Effects 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical class C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 229960004205 carbidopa Drugs 0.000 description 2
- TZFNLOMSOLWIDK-JTQLQIEISA-N carbidopa (anhydrous) Chemical compound NN[C@@](C(O)=O)(C)CC1=CC=C(O)C(O)=C1 TZFNLOMSOLWIDK-JTQLQIEISA-N 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000003954 decarboxylase inhibitor Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000003291 dopaminomimetic effect Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- UEXQBEVWFZKHNB-UHFFFAOYSA-N intermediate 29 Natural products C1=CC(N)=CC=C1NC1=NC=CC=N1 UEXQBEVWFZKHNB-UHFFFAOYSA-N 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 229960004502 levodopa Drugs 0.000 description 2
- 229960003587 lisuride Drugs 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- RYVDMDOIIUHMTJ-UHFFFAOYSA-N n-butyl-4-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-n,3-dimethylbenzamide Chemical compound CC1=CC(C(=O)N(C)CCCC)=CC=C1C1=CC=C(C(=O)NC=2C=C(C(OC)=CC=2)N2CCN(C)CC2)C=C1 RYVDMDOIIUHMTJ-UHFFFAOYSA-N 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000007935 oral tablet Substances 0.000 description 2
- 229940096978 oral tablet Drugs 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 229960004851 pergolide Drugs 0.000 description 2
- YEHCICAEULNIGD-MZMPZRCHSA-N pergolide Chemical compound C1=CC([C@H]2C[C@@H](CSC)CN([C@@H]2C2)CCC)=C3C2=CNC3=C1 YEHCICAEULNIGD-MZMPZRCHSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920006254 polymer film Polymers 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 229940023144 sodium glycolate Drugs 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000008109 sodium starch glycolate Substances 0.000 description 2
- 229940079832 sodium starch glycolate Drugs 0.000 description 2
- 229920003109 sodium starch glycolate Polymers 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 150000003555 thioacetals Chemical class 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- JEJAMASKDTUEBZ-UHFFFAOYSA-N tris(1,1,3-tribromo-2,2-dimethylpropyl) phosphate Chemical compound BrCC(C)(C)C(Br)(Br)OP(=O)(OC(Br)(Br)C(C)(C)CBr)OC(Br)(Br)C(C)(C)CBr JEJAMASKDTUEBZ-UHFFFAOYSA-N 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical class [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- AHOUBRCZNHFOSL-YOEHRIQHSA-N (+)-Casbol Chemical compound C1=CC(F)=CC=C1[C@H]1[C@H](COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-YOEHRIQHSA-N 0.000 description 1
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 description 1
- GKHHRIKNJHEVTE-UHFFFAOYSA-N (4-acetyl-2-methoxyphenyl) trifluoromethanesulfonate Chemical compound COC1=CC(C(C)=O)=CC=C1OS(=O)(=O)C(F)(F)F GKHHRIKNJHEVTE-UHFFFAOYSA-N 0.000 description 1
- JEUWNXRWCUJXTM-UHFFFAOYSA-N (4-acetylphenoxy)boronic acid Chemical compound CC(=O)C1=CC=C(OB(O)O)C=C1 JEUWNXRWCUJXTM-UHFFFAOYSA-N 0.000 description 1
- SGINYRFXUUMFLE-UHFFFAOYSA-N (4-bromo-3-methylphenyl)-morpholin-4-ylmethanone Chemical compound C1=C(Br)C(C)=CC(C(=O)N2CCOCC2)=C1 SGINYRFXUUMFLE-UHFFFAOYSA-N 0.000 description 1
- NUWRMNDFKGVDBT-UHFFFAOYSA-N (4-bromo-3-methylphenyl)methanamine Chemical compound CC1=CC(CN)=CC=C1Br NUWRMNDFKGVDBT-UHFFFAOYSA-N 0.000 description 1
- HBSHHYYUASJVCG-UHFFFAOYSA-N (4-bromo-3-methylphenyl)methanol Chemical compound CC1=CC(CO)=CC=C1Br HBSHHYYUASJVCG-UHFFFAOYSA-N 0.000 description 1
- MBXRMKXNASLKHL-UHFFFAOYSA-N (4-bromophenyl) n,n-dimethylcarbamate Chemical compound CN(C)C(=O)OC1=CC=C(Br)C=C1 MBXRMKXNASLKHL-UHFFFAOYSA-N 0.000 description 1
- FIPZWVLCZIYEMW-UHFFFAOYSA-N (4-cyanophenoxy)boronic acid Chemical compound OB(O)OC1=CC=C(C#N)C=C1 FIPZWVLCZIYEMW-UHFFFAOYSA-N 0.000 description 1
- IVUHTLFKBDDICS-UHFFFAOYSA-N (4-methylsulfanylphenyl)boronic acid Chemical compound CSC1=CC=C(B(O)O)C=C1 IVUHTLFKBDDICS-UHFFFAOYSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- SZLJIZCLWIILLB-UHFFFAOYSA-N 1,3-thiazinan-2-one Chemical group O=C1NCCCS1 SZLJIZCLWIILLB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HVMHVTKWTDEDMG-UHFFFAOYSA-N 1-(2-bromo-5-nitrophenyl)-4-methylpiperazine Chemical compound C1CN(C)CCN1C1=CC([N+]([O-])=O)=CC=C1Br HVMHVTKWTDEDMG-UHFFFAOYSA-N 0.000 description 1
- BBEHRXGLHAJECJ-UHFFFAOYSA-N 1-(2-chloro-5-nitrophenyl)-4-methylpiperazine Chemical compound C1CN(C)CCN1C1=CC([N+]([O-])=O)=CC=C1Cl BBEHRXGLHAJECJ-UHFFFAOYSA-N 0.000 description 1
- LFXUXLIOVCWBIX-UHFFFAOYSA-N 1-(2-fluoro-5-nitrophenyl)-4-methylpiperazine Chemical compound C1CN(C)CCN1C1=CC([N+]([O-])=O)=CC=C1F LFXUXLIOVCWBIX-UHFFFAOYSA-N 0.000 description 1
- JYAQYXOVOHJRCS-UHFFFAOYSA-N 1-(3-bromophenyl)ethanone Chemical compound CC(=O)C1=CC=CC(Br)=C1 JYAQYXOVOHJRCS-UHFFFAOYSA-N 0.000 description 1
- SVPWYIIREAOWLM-UHFFFAOYSA-N 1-(4-bromo-3-methylphenyl)-n-methylmethanamine Chemical compound CNCC1=CC=C(Br)C(C)=C1 SVPWYIIREAOWLM-UHFFFAOYSA-N 0.000 description 1
- QRTFRIPKQPOIPI-UHFFFAOYSA-N 1-(4-bromo-3-methylphenyl)ethanone Chemical compound CC(=O)C1=CC=C(Br)C(C)=C1 QRTFRIPKQPOIPI-UHFFFAOYSA-N 0.000 description 1
- BBJNIFKPPMMYKA-UHFFFAOYSA-N 1-(4-bromophenyl)pentan-2-one Chemical compound CCCC(=O)CC1=CC=C(Br)C=C1 BBJNIFKPPMMYKA-UHFFFAOYSA-N 0.000 description 1
- YINFEFUSAQRZGG-UHFFFAOYSA-N 1-(4-bromophenyl)pyrrolidin-2-one Chemical compound C1=CC(Br)=CC=C1N1C(=O)CCC1 YINFEFUSAQRZGG-UHFFFAOYSA-N 0.000 description 1
- HKRUXZJKSFFSGF-UHFFFAOYSA-N 1-[4-hydroxy-3-(trifluoromethyl)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(O)C(C(F)(F)F)=C1 HKRUXZJKSFFSGF-UHFFFAOYSA-N 0.000 description 1
- CPJBTFSEQFLPDQ-UHFFFAOYSA-N 1-bromo-4-(2-methoxyethoxymethyl)-2-methylbenzene Chemical compound COCCOCC1=CC=C(Br)C(C)=C1 CPJBTFSEQFLPDQ-UHFFFAOYSA-N 0.000 description 1
- YEUYZNNBXLMFCW-UHFFFAOYSA-N 1-bromo-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(Br)C=C1 YEUYZNNBXLMFCW-UHFFFAOYSA-N 0.000 description 1
- MPOPDYTWAYBUOD-UHFFFAOYSA-N 1-bromo-4-methylsulfinylbenzene Chemical compound CS(=O)C1=CC=C(Br)C=C1 MPOPDYTWAYBUOD-UHFFFAOYSA-N 0.000 description 1
- BHPJMWUXVOTGQU-UHFFFAOYSA-N 1-methoxy-2-(trifluoromethyl)benzene Chemical compound COC1=CC=CC=C1C(F)(F)F BHPJMWUXVOTGQU-UHFFFAOYSA-N 0.000 description 1
- LNETULKMXZVUST-UHFFFAOYSA-N 1-naphthoic acid Chemical class C1=CC=C2C(C(=O)O)=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- GFOGBVQXIQGBKG-UHFFFAOYSA-N 2-(4-bromophenyl)-2-methyl-1,3-dioxolane Chemical compound C=1C=C(Br)C=CC=1C1(C)OCCO1 GFOGBVQXIQGBKG-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- IDRUFHLMTBZQBT-IHWYPQMZSA-N 2-[(Z)-prop-1-enyl]propanedioic acid Chemical compound C\C=C/C(C(O)=O)C(O)=O IDRUFHLMTBZQBT-IHWYPQMZSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- KWIXNFOTNVKIGM-UHFFFAOYSA-N 2-chloro-5-nitroaniline Chemical compound NC1=CC([N+]([O-])=O)=CC=C1Cl KWIXNFOTNVKIGM-UHFFFAOYSA-N 0.000 description 1
- KJVBJICWGQIMOZ-UHFFFAOYSA-N 2-fluoro-5-nitroaniline Chemical compound NC1=CC([N+]([O-])=O)=CC=C1F KJVBJICWGQIMOZ-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical class C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- LYFOXLMDPGHOLL-UHFFFAOYSA-N 3-(4-bromo-3-methylphenyl)-1,2,4-oxadiazole Chemical compound C1=C(Br)C(C)=CC(C2=NOC=N2)=C1 LYFOXLMDPGHOLL-UHFFFAOYSA-N 0.000 description 1
- RGAWTLPWDVXMAH-UHFFFAOYSA-N 3-chloro-4-hydroxy-n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=C(O)C(Cl)=C1 RGAWTLPWDVXMAH-UHFFFAOYSA-N 0.000 description 1
- CDEOKTMGFJLBPP-UHFFFAOYSA-N 4-(3-acetylphenyl)-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-2-methylbenzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C(=C1)C)=CC=C1C1=CC=CC(C(C)=O)=C1 CDEOKTMGFJLBPP-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- OSNDQQHXQLUMAE-UHFFFAOYSA-N 4-(4-acetyl-2-methoxyphenyl)-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(C(C)=O)C=C1OC OSNDQQHXQLUMAE-UHFFFAOYSA-N 0.000 description 1
- XZZJCBUPSXRDJA-UHFFFAOYSA-N 4-(4-acetylphenyl)-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1C)=CC=C1C1=CC=C(C(C)=O)C=C1 XZZJCBUPSXRDJA-UHFFFAOYSA-N 0.000 description 1
- VXJHSDRLBRNMPB-UHFFFAOYSA-N 4-(4-hydroxyphenyl)-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(O)C=C1 VXJHSDRLBRNMPB-UHFFFAOYSA-N 0.000 description 1
- BAYGVMXZJBFEMB-UHFFFAOYSA-N 4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1 BAYGVMXZJBFEMB-UHFFFAOYSA-N 0.000 description 1
- KWJZFQQTDGVBOX-UHFFFAOYSA-N 4-[(4-bromophenyl)methyl]morpholine Chemical compound C1=CC(Br)=CC=C1CN1CCOCC1 KWJZFQQTDGVBOX-UHFFFAOYSA-N 0.000 description 1
- QRJPSPKQDYBMGV-UHFFFAOYSA-N 4-[(4-bromophenyl)methyl]thiomorpholine Chemical compound C1=CC(Br)=CC=C1CN1CCSCC1 QRJPSPKQDYBMGV-UHFFFAOYSA-N 0.000 description 1
- CVABCVVPUHSHIM-UHFFFAOYSA-N 4-[4-(dimethylcarbamoyl)-2-methylphenyl]benzoic acid Chemical compound CC1=CC(C(=O)N(C)C)=CC=C1C1=CC=C(C(O)=O)C=C1 CVABCVVPUHSHIM-UHFFFAOYSA-N 0.000 description 1
- MGSGZQSAIZFIGO-UHFFFAOYSA-N 4-[4-(hydroxymethyl)phenyl]-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1C)=CC=C1C1=CC=C(CO)C=C1 MGSGZQSAIZFIGO-UHFFFAOYSA-N 0.000 description 1
- IHLHRIOAFLQNLV-UHFFFAOYSA-N 4-[4-[[4-bromo-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-n,n,3-trimethylbenzamide Chemical compound CC1=CC(C(=O)N(C)C)=CC=C1C1=CC=C(C(=O)NC=2C=C(C(Br)=CC=2)N2CCN(C)CC2)C=C1 IHLHRIOAFLQNLV-UHFFFAOYSA-N 0.000 description 1
- SDCPFJIHUUMVDR-UHFFFAOYSA-N 4-boronooxybenzoic acid Chemical compound OB(O)OC1=CC=C(C(O)=O)C=C1 SDCPFJIHUUMVDR-UHFFFAOYSA-N 0.000 description 1
- YAPGTWIWNDWSNB-UHFFFAOYSA-N 4-bromo-3-(4-methylpiperazin-1-yl)aniline Chemical compound C1CN(C)CCN1C1=CC(N)=CC=C1Br YAPGTWIWNDWSNB-UHFFFAOYSA-N 0.000 description 1
- CSCIVZVHQMKBJI-UHFFFAOYSA-N 4-bromo-3-methyl-n,n-dipropylbenzamide Chemical compound CCCN(CCC)C(=O)C1=CC=C(Br)C(C)=C1 CSCIVZVHQMKBJI-UHFFFAOYSA-N 0.000 description 1
- KTOXSFXMKFCJGE-UHFFFAOYSA-N 4-bromo-n,3-dimethylaniline Chemical compound CNC1=CC=C(Br)C(C)=C1 KTOXSFXMKFCJGE-UHFFFAOYSA-N 0.000 description 1
- OLSYYPCJYYWIAA-UHFFFAOYSA-N 4-bromo-n,3-dimethylbenzamide Chemical compound CNC(=O)C1=CC=C(Br)C(C)=C1 OLSYYPCJYYWIAA-UHFFFAOYSA-N 0.000 description 1
- PVDRRFQPBXBPNQ-UHFFFAOYSA-N 4-bromo-n,n-diethyl-3-methylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(Br)C(C)=C1 PVDRRFQPBXBPNQ-UHFFFAOYSA-N 0.000 description 1
- NQAUNPZZVCXYEJ-UHFFFAOYSA-N 4-bromo-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=C(Br)C=C1 NQAUNPZZVCXYEJ-UHFFFAOYSA-N 0.000 description 1
- SQTLUXJWUCHKMT-UHFFFAOYSA-N 4-bromo-n,n-diphenylaniline Chemical compound C1=CC(Br)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 SQTLUXJWUCHKMT-UHFFFAOYSA-N 0.000 description 1
- RAFBQOZOCSTINZ-UHFFFAOYSA-N 4-bromo-n-(2-methoxyethyl)-3-methylbenzamide Chemical compound COCCNC(=O)C1=CC=C(Br)C(C)=C1 RAFBQOZOCSTINZ-UHFFFAOYSA-N 0.000 description 1
- OUXUWBFHULCLHD-UHFFFAOYSA-N 4-bromo-n-(2-methoxyethyl)-n,3-dimethylbenzamide Chemical compound COCCN(C)C(=O)C1=CC=C(Br)C(C)=C1 OUXUWBFHULCLHD-UHFFFAOYSA-N 0.000 description 1
- GULFHUMYUCZNOA-UHFFFAOYSA-N 4-bromo-n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methylbenzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C1=CC=C(Br)C(C)=C1 GULFHUMYUCZNOA-UHFFFAOYSA-N 0.000 description 1
- OQIREZZUEPXXKP-UHFFFAOYSA-N 4-bromo-n-tert-butyl-3-methylbenzamide Chemical compound CC1=CC(C(=O)NC(C)(C)C)=CC=C1Br OQIREZZUEPXXKP-UHFFFAOYSA-N 0.000 description 1
- KMMHZIBWCXYAAH-UHFFFAOYSA-N 4-bromobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(Br)C=C1 KMMHZIBWCXYAAH-UHFFFAOYSA-N 0.000 description 1
- DENKGPBHLYFNGK-UHFFFAOYSA-N 4-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Br)C=C1 DENKGPBHLYFNGK-UHFFFAOYSA-N 0.000 description 1
- XSHXAICMBSBZQJ-UHFFFAOYSA-N 4-chloro-3-(4-methylpiperazin-1-yl)aniline Chemical compound C1CN(C)CCN1C1=CC(N)=CC=C1Cl XSHXAICMBSBZQJ-UHFFFAOYSA-N 0.000 description 1
- LZWADEXTXMZMHI-UHFFFAOYSA-N 4-fluoro-3-(4-methylpiperazin-1-yl)aniline Chemical compound C1CN(C)CCN1C1=CC(N)=CC=C1F LZWADEXTXMZMHI-UHFFFAOYSA-N 0.000 description 1
- LDCYZAJDBXYCGN-VIFPVBQESA-N 5-hydroxy-L-tryptophan Chemical compound C1=C(O)C=C2C(C[C@H](N)C(O)=O)=CNC2=C1 LDCYZAJDBXYCGN-VIFPVBQESA-N 0.000 description 1
- XKFPYPQQHFEXRZ-UHFFFAOYSA-N 5-methyl-N'-(phenylmethyl)-3-isoxazolecarbohydrazide Chemical compound O1C(C)=CC(C(=O)NNCC=2C=CC=CC=2)=N1 XKFPYPQQHFEXRZ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- 235000019489 Almond oil Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 208000000044 Amnesia Diseases 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 206010006550 Bulimia nervosa Diseases 0.000 description 1
- ZORIFEXFBLGLFG-UHFFFAOYSA-N COC1=C(C=CC=C1)N1CCN(CC1)C.CN1CCN(CC1)C1=C(C=CC(=C1)[N+](=O)[O-])OC Chemical compound COC1=C(C=CC=C1)N1CCN(CC1)C.CN1CCN(CC1)C1=C(C=CC(=C1)[N+](=O)[O-])OC ZORIFEXFBLGLFG-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- GDLIGKIOYRNHDA-UHFFFAOYSA-N Clomipramine Chemical compound C1CC2=CC=C(Cl)C=C2N(CCCN(C)C)C2=CC=CC=C21 GDLIGKIOYRNHDA-UHFFFAOYSA-N 0.000 description 1
- 208000004117 Congenital Myasthenic Syndromes Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229940123736 Decarboxylase inhibitor Drugs 0.000 description 1
- HCYAFALTSJYZDH-UHFFFAOYSA-N Desimpramine Chemical compound C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 HCYAFALTSJYZDH-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 239000003810 Jones reagent Substances 0.000 description 1
- 150000000994 L-ascorbates Chemical class 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229940123685 Monoamine oxidase inhibitor Drugs 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 1
- PHVGLTMQBUFIQQ-UHFFFAOYSA-N Nortryptiline Chemical compound C1CC2=CC=CC=C2C(=CCCNC)C2=CC=CC=C21 PHVGLTMQBUFIQQ-UHFFFAOYSA-N 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- AHOUBRCZNHFOSL-UHFFFAOYSA-N Paroxetine hydrochloride Natural products C1=CC(F)=CC=C1C1C(COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-UHFFFAOYSA-N 0.000 description 1
- RMUCZJUITONUFY-UHFFFAOYSA-N Phenelzine Chemical compound NNCCC1=CC=CC=C1 RMUCZJUITONUFY-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 102000003946 Prolactin Human genes 0.000 description 1
- 108010057464 Prolactin Proteins 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 101100321769 Takifugu rubripes htr1d gene Proteins 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 229940123445 Tricyclic antidepressant Drugs 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DJHQEXVEXPOXGG-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl] trifluoromethanesulfonate Chemical compound FC(F)(F)C1=CC=C(OS(=O)(=O)C(F)(F)F)C=C1 DJHQEXVEXPOXGG-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000556 agonist Substances 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000008168 almond oil Substances 0.000 description 1
- CEGOLXSVJUTHNZ-UHFFFAOYSA-K aluminium tristearate Chemical compound [Al+3].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CEGOLXSVJUTHNZ-UHFFFAOYSA-K 0.000 description 1
- 229940063655 aluminum stearate Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229960000836 amitriptyline Drugs 0.000 description 1
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 1
- 230000006986 amnesia Effects 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- DFYRUELUNQRZTB-UHFFFAOYSA-N apocynin Chemical compound COC1=CC(C(C)=O)=CC=C1O DFYRUELUNQRZTB-UHFFFAOYSA-N 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- KBYKAKOYINOWPA-UHFFFAOYSA-N azetidin-1-yl-(4-bromo-3-methylphenyl)methanone Chemical compound C1=C(Br)C(C)=CC(C(=O)N2CCC2)=C1 KBYKAKOYINOWPA-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- BNQDCRGUHNALGH-UHFFFAOYSA-N benserazide Chemical compound OCC(N)C(=O)NNCC1=CC=C(O)C(O)=C1O BNQDCRGUHNALGH-UHFFFAOYSA-N 0.000 description 1
- 229960000911 benserazide Drugs 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 239000002876 beta blocker Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 239000000337 buffer salt Substances 0.000 description 1
- 229960004301 butriptyline Drugs 0.000 description 1
- ALELTFCQZDXAMQ-UHFFFAOYSA-N butriptyline Chemical compound C1CC2=CC=CC=C2C(CC(C)CN(C)C)C2=CC=CC=C21 ALELTFCQZDXAMQ-UHFFFAOYSA-N 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 210000003710 cerebral cortex Anatomy 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 229960004606 clomipramine Drugs 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 229940125936 compound 42 Drugs 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 229960003914 desipramine Drugs 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940042935 dichlorodifluoromethane Drugs 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- DAKIDYQCFJQMDF-UHFFFAOYSA-N dichloromethane;pyridine Chemical compound ClCCl.C1=CC=NC=C1 DAKIDYQCFJQMDF-UHFFFAOYSA-N 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229940052760 dopamine agonists Drugs 0.000 description 1
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- CJOFXWAVKWHTFT-XSFVSMFZSA-N fluvoxamine Chemical compound COCCCC\C(=N/OCCN)C1=CC=C(C(F)(F)F)C=C1 CJOFXWAVKWHTFT-XSFVSMFZSA-N 0.000 description 1
- 229960004038 fluvoxamine Drugs 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- VGGRCVDNFAQIKO-UHFFFAOYSA-N formic anhydride Chemical compound O=COC=O VGGRCVDNFAQIKO-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N glutaric acid Chemical class OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- VYXVPOVYYRXJCS-UHFFFAOYSA-N hydroxylamine;dihydrochloride Chemical compound Cl.Cl.ON VYXVPOVYYRXJCS-UHFFFAOYSA-N 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 229960004801 imipramine Drugs 0.000 description 1
- BCGWQEUPMDMJNV-UHFFFAOYSA-N imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229960002844 iprindole Drugs 0.000 description 1
- PLIGPBGDXASWPX-UHFFFAOYSA-N iprindole Chemical compound C1CCCCCC2=C1N(CCCN(C)C)C1=CC=CC=C12 PLIGPBGDXASWPX-UHFFFAOYSA-N 0.000 description 1
- 229960002672 isocarboxazid Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 229960001375 lactose Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 150000002641 lithium Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 206010027175 memory impairment Diseases 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- QVDWKLDUBSJEOG-UHFFFAOYSA-N methyl 3-amino-4-methoxybenzoate Chemical compound COC(=O)C1=CC=C(OC)C(N)=C1 QVDWKLDUBSJEOG-UHFFFAOYSA-N 0.000 description 1
- GTZTYNPAPQKIIR-UHFFFAOYSA-N methyl 4-bromo-3-methylbenzoate Chemical compound COC(=O)C1=CC=C(Br)C(C)=C1 GTZTYNPAPQKIIR-UHFFFAOYSA-N 0.000 description 1
- IVFZVIXGGJBFRP-UHFFFAOYSA-N methyl 4-methoxy-3-(4-methylpiperazin-1-yl)benzoate;hydrochloride Chemical compound Cl.COC(=O)C1=CC=C(OC)C(N2CCN(C)CC2)=C1 IVFZVIXGGJBFRP-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000002899 monoamine oxidase inhibitor Substances 0.000 description 1
- 230000036651 mood Effects 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 210000002200 mouth mucosa Anatomy 0.000 description 1
- DHXLBEVBTDIODW-UHFFFAOYSA-N n-(4-bromo-3-methylphenyl)-n-methylacetamide Chemical compound CC(=O)N(C)C1=CC=C(Br)C(C)=C1 DHXLBEVBTDIODW-UHFFFAOYSA-N 0.000 description 1
- GSIVQZPQVOVJKT-UHFFFAOYSA-N n-(4-bromo-3-methylphenyl)methanesulfonamide Chemical compound CC1=CC(NS(C)(=O)=O)=CC=C1Br GSIVQZPQVOVJKT-UHFFFAOYSA-N 0.000 description 1
- VSQBGZVITXCFJD-UHFFFAOYSA-N n-[(4-bromo-3-methylphenyl)methyl]-2-methoxy-n-methylacetamide Chemical compound COCC(=O)N(C)CC1=CC=C(Br)C(C)=C1 VSQBGZVITXCFJD-UHFFFAOYSA-N 0.000 description 1
- ZSOGVLHSDVPOCU-UHFFFAOYSA-N n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methyl-4-(4-methylsulfanylphenyl)benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1C)=CC=C1C1=CC=C(SC)C=C1 ZSOGVLHSDVPOCU-UHFFFAOYSA-N 0.000 description 1
- TYKWKHKQDSOKHO-UHFFFAOYSA-N n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methyl-4-(4-pentanoylphenyl)benzamide Chemical compound C1=CC(C(=O)CCCC)=CC=C1C1=CC=C(C(=O)NC=2C=C(C(OC)=CC=2)N2CCN(C)CC2)C=C1C TYKWKHKQDSOKHO-UHFFFAOYSA-N 0.000 description 1
- WEADMUBMVFXDJU-UHFFFAOYSA-N n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methyl-4-[4-(methylsulfamoyl)phenyl]benzamide Chemical compound C1=CC(S(=O)(=O)NC)=CC=C1C1=CC=C(C(=O)NC=2C=C(C(OC)=CC=2)N2CCN(C)CC2)C=C1C WEADMUBMVFXDJU-UHFFFAOYSA-N 0.000 description 1
- KSFHOEVXJYVHCE-UHFFFAOYSA-N n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methyl-4-[4-(morpholin-4-ylmethyl)phenyl]benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1C)=CC=C1C(C=C1)=CC=C1CN1CCOCC1 KSFHOEVXJYVHCE-UHFFFAOYSA-N 0.000 description 1
- SFKXFGXNAUYIHY-UHFFFAOYSA-N n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-[2-methyl-4-(methylamino)phenyl]benzamide Chemical compound CC1=CC(NC)=CC=C1C1=CC=C(C(=O)NC=2C=C(C(OC)=CC=2)N2CCN(C)CC2)C=C1 SFKXFGXNAUYIHY-UHFFFAOYSA-N 0.000 description 1
- VDVCZXWJQDXSDW-UHFFFAOYSA-N n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-[2-methyl-4-(morpholine-4-carbonyl)phenyl]benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C(C(=C1)C)=CC=C1C(=O)N1CCOCC1 VDVCZXWJQDXSDW-UHFFFAOYSA-N 0.000 description 1
- JFFSZGIPPPJPNY-UHFFFAOYSA-N n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-[2-methyl-4-(pyrrolidine-1-carbonyl)phenyl]benzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C(C(=C1)C)=CC=C1C(=O)N1CCCC1 JFFSZGIPPPJPNY-UHFFFAOYSA-N 0.000 description 1
- PMZGTKNOGMSBIF-UHFFFAOYSA-N n-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-4-phenylbenzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=CC=C1 PMZGTKNOGMSBIF-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PLCXISBILVVVMU-UHFFFAOYSA-N n-tert-butyl-4-[4-[[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]carbamoyl]phenyl]-3-methylbenzamide Chemical compound C1=C(N2CCN(C)CC2)C(OC)=CC=C1NC(=O)C(C=C1)=CC=C1C1=CC=C(C(=O)NC(C)(C)C)C=C1C PLCXISBILVVVMU-UHFFFAOYSA-N 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 210000001577 neostriatum Anatomy 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 210000000653 nervous system Anatomy 0.000 description 1
- 230000000701 neuroleptic effect Effects 0.000 description 1
- 210000002569 neuron Anatomy 0.000 description 1
- 239000002858 neurotransmitter agent Substances 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 229960001158 nortriptyline Drugs 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- VEDDBHYQWFOITD-UHFFFAOYSA-N para-bromobenzyl alcohol Chemical compound OCC1=CC=C(Br)C=C1 VEDDBHYQWFOITD-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 229960002296 paroxetine Drugs 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229960000964 phenelzine Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Chemical class O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 125000005544 phthalimido group Chemical group 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000012254 powdered material Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 229940097325 prolactin Drugs 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical class CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 230000037047 psychomotor activity Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 150000003873 salicylate salts Chemical class 0.000 description 1
- 208000012672 seasonal affective disease Diseases 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 229960002073 sertraline Drugs 0.000 description 1
- VGKDLMBJGBXTGI-SJCJKPOMSA-N sertraline Chemical compound C1([C@@H]2CC[C@@H](C3=CC=CC=C32)NC)=CC=C(Cl)C(Cl)=C1 VGKDLMBJGBXTGI-SJCJKPOMSA-N 0.000 description 1
- 230000036299 sexual function Effects 0.000 description 1
- 238000005055 short column chromatography Methods 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- QJDUDPQVDAASMV-UHFFFAOYSA-M sodium;ethanethiolate Chemical compound [Na+].CC[S-] QJDUDPQVDAASMV-UHFFFAOYSA-M 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical class NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 239000003029 tricyclic antidepressant agent Substances 0.000 description 1
- 238000007039 two-step reaction Methods 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000004457 water analysis Methods 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229940124629 β-receptor antagonist Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/192—Radicals derived from carboxylic acids from aromatic carboxylic acids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/26—Psychostimulants, e.g. nicotine, cocaine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/135—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/155—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Psychiatry (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Cardiology (AREA)
- Diabetes (AREA)
- Child & Adolescent Psychology (AREA)
- Heart & Thoracic Surgery (AREA)
- Hospice & Palliative Care (AREA)
- Anesthesiology (AREA)
- Pain & Pain Management (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919119920A GB9119920D0 (en) | 1991-09-18 | 1991-09-18 | Chemical compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ285592A3 true CZ285592A3 (en) | 1993-04-14 |
Family
ID=10701597
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS922855A CZ285592A3 (en) | 1991-09-18 | 1992-09-17 | Benzanilide derivatives, process of their preparation and pharmaceutical compositions containing them |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5356893A (enExample) |
| EP (1) | EP0533266A1 (enExample) |
| JP (1) | JPH06107649A (enExample) |
| KR (1) | KR930005995A (enExample) |
| CN (1) | CN1071922A (enExample) |
| AU (1) | AU2452992A (enExample) |
| CA (1) | CA2078506A1 (enExample) |
| CZ (1) | CZ285592A3 (enExample) |
| FI (1) | FI924159A7 (enExample) |
| GB (1) | GB9119920D0 (enExample) |
| HU (1) | HUT66319A (enExample) |
| IL (1) | IL103197A0 (enExample) |
| IS (1) | IS3914A (enExample) |
| MX (1) | MX9205279A (enExample) |
| NO (1) | NO923617L (enExample) |
| PL (1) | PL295961A1 (enExample) |
| TW (1) | TW221989B (enExample) |
| ZA (1) | ZA927107B (enExample) |
Families Citing this family (69)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2276165A (en) * | 1993-03-17 | 1994-09-21 | Glaxo Group Ltd | Aniline and benzanilide compounds. |
| EP0712397B1 (en) * | 1993-08-06 | 1999-04-21 | Smithkline Beecham Plc | Amide derivatives as 5ht1d receptor antagonists |
| DE69411176T2 (de) * | 1993-08-20 | 1998-11-12 | Smithkline Beecham Plc | Amide und harnstoffderivate als 5ht1d rezeptor antagonisten |
| DE69417427T2 (de) * | 1993-09-03 | 1999-11-25 | Smithkline Beecham P.L.C., Brentford | Indol- und indolin-derivate als 5ht1d rezeptor antagonisten |
| EP0716656A1 (en) * | 1993-09-03 | 1996-06-19 | Smithkline Beecham Plc | Amide derivatives as 5ht1d receptor antagonists |
| EP0724580A1 (en) * | 1993-10-19 | 1996-08-07 | Smithkline Beecham Plc | Benzanilide derivatives as 5ht-1d receptor antagonists |
| GB9326008D0 (en) * | 1993-12-21 | 1994-02-23 | Smithkline Beecham Plc | Novel compounds |
| DE69505362T2 (de) * | 1994-03-26 | 1999-04-29 | Smithkline Beecham P.L.C., Brentford, Middlesex | Biphenyl-derivate als 5ht1d antagonisten |
| US5756496A (en) * | 1994-05-28 | 1998-05-26 | Smithkline Beecham P.L.C. | Amide derivatives having 5HT1D-antagonist activity |
| FR2722788B1 (fr) * | 1994-07-20 | 1996-10-04 | Pf Medicament | Nouvelles piperazides derivees d'aryl piperazine, leurs procedes de preparation, leur utilisation a titre de medicament et les compositions pharmaceutiques les comprenant |
| GB9416972D0 (en) * | 1994-08-23 | 1994-10-12 | Smithkline Beecham Plc | Carbon side chain/indole/indolene |
| GB9507203D0 (en) * | 1995-04-07 | 1995-05-31 | Smithkline Beecham Plc | Novel compounds |
| FR2737721B1 (fr) * | 1995-08-08 | 1997-09-05 | Roussel Uclaf | Nouveaux composes biphenyles, leur procede de preparation et les intermediaires de ce procede, leur application a titre de medicament et les compositions pharmaceutiques les contenant |
| FR2740134B1 (fr) * | 1995-10-18 | 1998-01-09 | Pf Medicament | Derives d'amines cycliques d'aryl-piperazines, leur preparation et les compositions pharmaceutiques les contenant |
| GB9522845D0 (en) * | 1995-11-08 | 1996-01-10 | Smithkline Beecham Plc | Novel compounds |
| FR2744449B1 (fr) * | 1996-02-02 | 1998-04-24 | Pf Medicament | Nouvelles piperazines aromatiques derivees de cycloazanes substitues, ainsi que leur procede de preparation, les compositions pharmaceutiques et leur utilisation comme medicaments |
| FR2744450A1 (fr) * | 1996-02-02 | 1997-08-08 | Pf Medicament | Nouvelles naphtylpiperazines derivees de cycloazanes substitues, ainsi que leur procede de preparation, les compositions pharmaceutiques et leur utilisation comme medicaments |
| GB9605883D0 (en) * | 1996-03-20 | 1996-05-22 | Smithkline Beecham Plc | Novel compounds |
| SE9601110D0 (sv) * | 1996-03-22 | 1996-03-22 | Astra Ab | Substituted 1,2,3,4-tetrahydronaphthalene derivatives |
| EP0889892A1 (en) * | 1996-03-27 | 1999-01-13 | Smithkline Beecham Plc | Azaspiro derivatives |
| US6156783A (en) * | 1996-04-30 | 2000-12-05 | Smithkline Beecham P.L.C. | Spiroazabicyclic compounds, processes for their preparation, and their pharmaceutical use |
| DE69724801T2 (de) * | 1996-09-16 | 2004-06-17 | Pfizer Inc. | Verfahren und zwischenprodukte zur herstellung substituierter chromanolderivate |
| WO1998027058A2 (en) * | 1996-12-19 | 1998-06-25 | Smithkline Beecham Plc | N-piperazin-1-ylphenyl-benzamide derivatives |
| IL132409A0 (en) * | 1997-04-18 | 2001-03-19 | Smithkline Beecham Plc | Indole derivatives having combined 5ht1a 5ht1b and 5ht1d receptor antagonist activity |
| SE9900190D0 (sv) | 1999-01-22 | 1999-01-22 | Astra Ab | New compounds |
| SE9702799D0 (sv) | 1997-07-25 | 1997-07-25 | Astra Ab | New compounds |
| WO1999007700A1 (en) * | 1997-08-09 | 1999-02-18 | Smithkline Beecham Plc | Bicyclic compounds as ligands for 5-ht1 receptors |
| JP2002521377A (ja) * | 1998-07-20 | 2002-07-16 | メルク パテント ゲゼルシャフト ミット ベシュレンクテル ハフトング | ビフェニル誘導体 |
| GB9826412D0 (en) * | 1998-12-03 | 1999-01-27 | Glaxo Group Ltd | Chemical compounds |
| CA2386474A1 (en) | 1999-09-20 | 2001-03-29 | Takeda Chemical Industries, Ltd. | Melanin concentrating hormone antagonist |
| SE9904723D0 (sv) | 1999-12-22 | 1999-12-22 | Carlsson A Research Ab | New modulators of dopamine neurotransmission II |
| USRE46117E1 (en) | 1999-12-22 | 2016-08-23 | Teva Pharmaceuticals International Gmbh | Modulators of dopamine neurotransmission |
| SE9904724D0 (sv) | 1999-12-22 | 1999-12-22 | Carlsson A Research Ab | New modulators of dopamine neurotransmission I |
| EP1285651B1 (en) | 2000-04-28 | 2010-09-01 | Takeda Pharmaceutical Company Limited | Melanin concentrating hormone antagonists |
| EP1295867A4 (en) | 2000-06-28 | 2005-03-30 | Takeda Pharmaceutical | BIPHENYL COMPOUND |
| AU2001277750A1 (en) * | 2000-08-10 | 2002-02-25 | Takeda Chemical Industries Ltd. | Use of polypeptide |
| PE20020506A1 (es) | 2000-08-22 | 2002-07-09 | Glaxo Group Ltd | Derivados de pirazol fusionados como inhibidores de la proteina cinasa |
| EP1331010A4 (en) * | 2000-08-25 | 2008-08-06 | Takeda Pharmaceutical | MEANS FOR THE PREVENTION AND TREATMENT OF DISEASES OF THE CENTRAL NERVOUS SYSTEM |
| US6617125B2 (en) * | 2001-06-29 | 2003-09-09 | Perkinelmer Life Sciences, Inc. | Compositions for enhanced catalyzed reporter deposition |
| US7041280B2 (en) * | 2001-06-29 | 2006-05-09 | Genzyme Corporation | Aryl boronate functionalized polymers for treating obesity |
| US6858592B2 (en) * | 2001-06-29 | 2005-02-22 | Genzyme Corporation | Aryl boronic acids for treating obesity |
| GB0124934D0 (en) | 2001-10-17 | 2001-12-05 | Glaxo Group Ltd | Chemical compounds |
| GB0124931D0 (en) | 2001-10-17 | 2001-12-05 | Glaxo Group Ltd | Chemical compounds |
| GB0124933D0 (en) | 2001-10-17 | 2001-12-05 | Glaxo Group Ltd | Chemical compounds |
| GB0124939D0 (en) | 2001-10-17 | 2001-12-05 | Glaxo Group Ltd | Chemical compounds |
| GB0124941D0 (en) | 2001-10-17 | 2001-12-05 | Glaxo Group Ltd | Chemical compounds |
| GB0124936D0 (en) | 2001-10-17 | 2001-12-05 | Glaxo Group Ltd | Chemical compounds |
| GB0124938D0 (en) | 2001-10-17 | 2001-12-05 | Glaxo Group Ltd | Chemical compounds |
| EP1466904A4 (en) * | 2001-12-28 | 2005-12-14 | Takeda Pharmaceutical | BIARYL CONNECTION AND ITS USE |
| WO2003068747A1 (en) | 2002-02-12 | 2003-08-21 | Smithkline Beecham Corporation | Nicotinamide derivates useful as p38 inhibitors |
| AU2004212985B2 (en) | 2003-02-20 | 2010-10-14 | Encysive Pharmaceuticals Inc. | Phenylenediamine urotensin-II receptor antagonists and CCR-9 antagonists |
| US7288538B2 (en) | 2003-02-20 | 2007-10-30 | Encysive Pharmaceuticals, Inc. | Phenylenediamine urotensin-II receptor antagonists and CCR-9 antagonists |
| GB0308185D0 (en) | 2003-04-09 | 2003-05-14 | Smithkline Beecham Corp | Novel compounds |
| GB0308186D0 (en) | 2003-04-09 | 2003-05-14 | Smithkline Beecham Corp | Novel compounds |
| GB0308201D0 (en) | 2003-04-09 | 2003-05-14 | Smithkline Beecham Corp | Novel compounds |
| GB0318814D0 (en) | 2003-08-11 | 2003-09-10 | Smithkline Beecham Corp | Novel compounds |
| MXPA06013941A (es) | 2004-06-08 | 2007-12-10 | Neurosearch Sweden Ab | Fenilpiperidinas disustituidas, novedosas, como moduladores de la neurotransmision de dopamina y serotonina. |
| US7851629B2 (en) | 2004-06-08 | 2010-12-14 | Nsab, Filial Af Neurosearch Sweden Ab, Sverige | Disubstituted phenylpiperidines as modulators of dopamine and serotonin neurotransmission |
| WO2006040155A1 (en) | 2004-10-13 | 2006-04-20 | Neurosearch Sweden Ab | Process for the synthesis of 4-(3-methanesulfonylphenyl)-1-n-propyl-piperidine |
| KR20080050490A (ko) * | 2005-09-16 | 2008-06-05 | 애로우 쎄라퓨틱스 리미티드 | 바이페닐 유도체, 및 c형 간염 치료에 있어서의 그의 용도 |
| US7676466B2 (en) * | 2005-09-27 | 2010-03-09 | Match.Com, L.L.C. | System and method for providing enhanced questions for matching in a network environment |
| SE529246C2 (sv) | 2005-10-13 | 2007-06-12 | Neurosearch Sweden Ab | Nya disubstituerade fenyl-piperidiner som modulatorer för dopaminneurotransmission |
| EP3150589A1 (en) | 2007-06-08 | 2017-04-05 | MannKind Corporation | Ire-1a inhibitors |
| EP2787997A4 (en) | 2011-12-08 | 2015-05-27 | Ivax Int Gmbh | HYDROBROMIDE SALT OF PRIDOPIDINE |
| EP2844346B1 (en) | 2012-04-04 | 2020-01-01 | Prilenia Neurotherapeutics Ltd. | Pharmaceutical compositions for combination therapy |
| EP3381917B1 (en) | 2013-01-31 | 2021-09-08 | Bellus Health Cough Inc. | Imidazopyridine compounds and uses thereof |
| EP3200752A1 (en) * | 2014-09-30 | 2017-08-09 | Avon Products, Inc. | Topical compositions and methods for skin lightening |
| AU2020228760A1 (en) | 2019-02-25 | 2021-09-23 | Glaxosmithkline Intellectual Property (No. 3) Limited | Treatment with P2X3 modulators |
| WO2020183011A1 (en) | 2019-03-14 | 2020-09-17 | Institut Curie | Htr1d inhibitors and uses thereof in the treatment of cancer |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3192213A (en) * | 1962-10-12 | 1965-06-29 | Olin Mathieson | Aminoalkyl anilides |
| DE1668723A1 (de) * | 1966-09-16 | 1971-04-08 | Toyo Jozo Kk | Verfahren zum Herstellen von Verbindungen mit Saeureamid-Bindung |
| AU499714B2 (en) * | 1974-10-14 | 1979-05-03 | Chugai Seiyaku Kabushiki Kaisha | Bis(benzamido)-benzene derivatives & process for preparing thesame |
| US4058523A (en) * | 1974-10-14 | 1977-11-15 | Chugai Seiyaku Kabushiki Kaisha | Bis(benzamido)-benzene derivatives |
| US4013647A (en) * | 1976-03-23 | 1977-03-22 | American Home Products Corporation | Morpholine containing tetrazole-5-carboxamide derivatives |
| US4735959A (en) * | 1981-01-10 | 1988-04-05 | Dr. Karl Thomae Gmbh | Carboxylic acid amides and pharmaceutical compositions containing them |
| DE3100575A1 (de) * | 1981-01-10 | 1982-09-02 | Dr. Karl Thomae Gmbh, 7950 Biberach | "neue benzoesaeuren, ihre herstellung und ihre verwendung als arzneimittel" |
| US4562201A (en) * | 1982-07-26 | 1985-12-31 | American Hospital Supply Corporation | Aminomethyl benzanilides |
| US4778796A (en) * | 1985-07-19 | 1988-10-18 | Dainippon Pharmaceutical Co., Ltd. | ω-(3-pyridyl)alkenamide derivatives and anti-allergenic pharmaceutical compositions containing same |
| US4826990A (en) * | 1987-09-30 | 1989-05-02 | American Home Products Corporation | 2-aryl substituted heterocyclic compounds as antiallergic and antiinflammatory agents |
| DK5489A (da) * | 1988-01-11 | 1989-07-12 | Duphar Int Res | Anvendelse af substituerede amidforbindelser til fremstilling af farmaceutiske praeparater til behandling af haematologiske sygdomme |
| DE68903263T2 (de) * | 1988-10-10 | 1993-05-19 | Akzo Nv | Substituierte aromatische verbindungen mit zentraler nervensystem-wirkung. |
-
1991
- 1991-09-18 GB GB919119920A patent/GB9119920D0/en active Pending
-
1992
- 1992-09-14 EP EP92202804A patent/EP0533266A1/en not_active Withdrawn
- 1992-09-17 IS IS3914A patent/IS3914A/is unknown
- 1992-09-17 MX MX9205279A patent/MX9205279A/es unknown
- 1992-09-17 ZA ZA927107A patent/ZA927107B/xx unknown
- 1992-09-17 NO NO92923617A patent/NO923617L/no unknown
- 1992-09-17 US US07/945,878 patent/US5356893A/en not_active Expired - Fee Related
- 1992-09-17 JP JP4273659A patent/JPH06107649A/ja active Pending
- 1992-09-17 AU AU24529/92A patent/AU2452992A/en not_active Abandoned
- 1992-09-17 CA CA002078506A patent/CA2078506A1/en not_active Abandoned
- 1992-09-17 TW TW081107318A patent/TW221989B/zh active
- 1992-09-17 KR KR1019920016905A patent/KR930005995A/ko not_active Withdrawn
- 1992-09-17 CZ CS922855A patent/CZ285592A3/cs unknown
- 1992-09-17 IL IL103197A patent/IL103197A0/xx unknown
- 1992-09-17 FI FI924159A patent/FI924159A7/fi not_active Application Discontinuation
- 1992-09-17 CN CN92111662A patent/CN1071922A/zh active Pending
- 1992-09-17 PL PL29596192A patent/PL295961A1/xx unknown
- 1992-09-17 HU HU9202969A patent/HUT66319A/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IS3914A (is) | 1993-03-19 |
| PL295961A1 (en) | 1993-09-06 |
| AU2452992A (en) | 1993-03-25 |
| MX9205279A (es) | 1993-03-01 |
| IL103197A0 (en) | 1993-02-21 |
| NO923617D0 (no) | 1992-09-17 |
| GB9119920D0 (en) | 1991-10-30 |
| NO923617L (no) | 1993-03-19 |
| CA2078506A1 (en) | 1993-03-19 |
| FI924159A0 (fi) | 1992-09-17 |
| EP0533266A1 (en) | 1993-03-24 |
| HU9202969D0 (en) | 1992-12-28 |
| US5356893A (en) | 1994-10-18 |
| FI924159L (fi) | 1993-03-19 |
| TW221989B (enExample) | 1994-04-01 |
| CN1071922A (zh) | 1993-05-12 |
| KR930005995A (ko) | 1993-04-20 |
| JPH06107649A (ja) | 1994-04-19 |
| FI924159A7 (fi) | 1993-03-19 |
| HUT66319A (en) | 1994-11-28 |
| ZA927107B (en) | 1993-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CZ285592A3 (en) | Benzanilide derivatives, process of their preparation and pharmaceutical compositions containing them | |
| DE69232003T2 (de) | Benzanilidderivate als 5-HT1D-Antagonisten | |
| DE69615025T2 (de) | Benzamid-derivate und deren verwendung als vasopressin-antagonisten | |
| US6043284A (en) | Anti-atherosclerotic diaryl compounds | |
| DE69504637T2 (de) | Indolderivate zur behandlung von östrogenabhängigen neoplasmen und krankheiten | |
| DE69507293T2 (de) | Benzamid-derivate als vasopressin-antagonisten | |
| CZ61194A3 (en) | Benzanilide derivatives, process of their preparation and pharmaceutical preparations in which they are comprised | |
| SK404191A3 (en) | Indole derivatives, method of their production and pharmaceutical preparation with their contents | |
| HUT60462A (en) | Process for producing biphenyl derivatives and pharmaceutical compositions comprising same | |
| HUP0103884A2 (hu) | Arilszulfonanilidkarbamid-származékok, ezeket tartalmazó gyógyszerkészítmények és alkalmazásuk | |
| JPH09500883A (ja) | α1A−アドレナリン受容体アンタゴニストとしてのピペラジン誘導体 | |
| FR2596049A1 (fr) | Derives de dichloroaniline | |
| JPH01265100A (ja) | 2―置換アデノシン誘導体 | |
| JP2018527324A (ja) | ガンを処置するのに使用するための置換疎水性ベンゼンスルホンアミドチアゾール化合物 | |
| CS235306B2 (en) | Method of new aminocompounds production | |
| PT726265E (pt) | 10-amino-alifatil-dibenzo¬b,f| oxepinas com accao antineurodegenerativa | |
| US6646129B2 (en) | Cyanoguanidines as cell proliferation inhibitors | |
| WO2023091565A1 (en) | Nsd2-targeted chemical degraders and compositions and methods of use thereof | |
| HU199124B (en) | Process for producing benzazepine sulfonamides and antiarrhythmic agents comprising these compounds | |
| EP3628664A1 (en) | Irreversible inhibitors of kras g12c mutant | |
| HU210683B (en) | Process for producing n-benzyl-n1-(phenyl-alkyl)-thiourea derivatives and pharmaceutical compositions containing the same | |
| US5202351A (en) | 1-phenylalkyl-3-phenylurea derivative | |
| EP0752982B1 (en) | Biphenyl derivatives as 5ht1d antagonists | |
| KR100556157B1 (ko) | 바닐로이드 수용체의 효현제로서 강력한 진통효과를나타내는 단순구조의 레시니페라톡신 동족체 및 이를함유하는 약학적 조성물 | |
| KR100503518B1 (ko) | 2-(4-알킬-1-피페라지닐)-벤즈알데하이드 및 -벤질리데닐화합물의 제조 방법 |