CZ280197B6 - Způsob přípravy 1-(2-/(5-dimethylaminoethyl-2-fu ryl)-methylthio/-ethyl)-amino-1-methylamino-2 -nitroethylenu - Google Patents
Způsob přípravy 1-(2-/(5-dimethylaminoethyl-2-fu ryl)-methylthio/-ethyl)-amino-1-methylamino-2 -nitroethylenu Download PDFInfo
- Publication number
- CZ280197B6 CZ280197B6 CS913403A CS340391A CZ280197B6 CZ 280197 B6 CZ280197 B6 CZ 280197B6 CS 913403 A CS913403 A CS 913403A CS 340391 A CS340391 A CS 340391A CZ 280197 B6 CZ280197 B6 CZ 280197B6
- Authority
- CZ
- Czechia
- Prior art keywords
- preparation
- formula
- methylthio
- ethyl
- nitroethylene
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims abstract description 11
- 238000000034 method Methods 0.000 claims abstract description 27
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims abstract description 22
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims abstract description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 4
- 239000000243 solution Substances 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- NESLOYMMIUOLMU-UHFFFAOYSA-N 1-n'-methyl-2-nitroethene-1,1-diamine Chemical group CNC(N)=C[N+]([O-])=O NESLOYMMIUOLMU-UHFFFAOYSA-N 0.000 claims 1
- 229960000620 ranitidine Drugs 0.000 abstract description 10
- -1 5-dimethylaminomethyl-2-furyl Chemical group 0.000 abstract 1
- VMXUWOKSQNHOCA-LCYFTJDESA-N ranitidine Chemical compound [O-][N+](=O)/C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-LCYFTJDESA-N 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 11
- VMXUWOKSQNHOCA-UKTHLTGXSA-N ranitidine Chemical compound [O-][N+](=O)\C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-UKTHLTGXSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- GGWBHVILAJZWKJ-KJEVSKRMSA-N ranitidine hydrochloride Chemical compound [H+].[Cl-].[O-][N+](=O)\C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 GGWBHVILAJZWKJ-KJEVSKRMSA-N 0.000 description 3
- 229960001520 ranitidine hydrochloride Drugs 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000003932 ketenimines Chemical class 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910001961 silver nitrate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 1
- PZUSILGYGJONKA-UHFFFAOYSA-N 4-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]-2-n-methyl-1-nitrobut-1-ene-1,2-diamine Chemical group [O-][N+](=O)C(N)=C(NC)CCSCC1=CC=C(CN(C)C)O1 PZUSILGYGJONKA-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical class C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 208000007107 Stomach Ulcer Diseases 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000008395 clarifying agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229940097265 cysteamine hydrochloride Drugs 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000011403 purification operation Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/36—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU907074A HU207308B (en) | 1990-11-09 | 1990-11-09 | Process for producing 1- /2-/5-/dimethyl-amino-methyl/-2-/furyl-methyl-thio/-ethyl//- -amino-1-/methyl-amino-2-nitro-ethylene |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS340391A3 CS340391A3 (en) | 1992-05-13 |
| CZ280197B6 true CZ280197B6 (cs) | 1995-11-15 |
Family
ID=10972142
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS913403A CZ280197B6 (cs) | 1990-11-09 | 1991-11-08 | Způsob přípravy 1-(2-/(5-dimethylaminoethyl-2-fu ryl)-methylthio/-ethyl)-amino-1-methylamino-2 -nitroethylenu |
Country Status (16)
| Country | Link |
|---|---|
| KR (1) | KR920009813A (enExample) |
| CN (1) | CN1061968A (enExample) |
| AR (1) | AR248017A1 (enExample) |
| AT (1) | AT400146B (enExample) |
| CA (1) | CA2055189A1 (enExample) |
| CZ (1) | CZ280197B6 (enExample) |
| DK (1) | DK184291A (enExample) |
| ES (1) | ES2036479B1 (enExample) |
| FI (1) | FI915265A7 (enExample) |
| GR (1) | GR1002225B (enExample) |
| HU (1) | HU207308B (enExample) |
| NO (1) | NO179208C (enExample) |
| PL (1) | PL166616B1 (enExample) |
| PT (1) | PT99470A (enExample) |
| RU (1) | RU2032681C1 (enExample) |
| YU (1) | YU177391A (enExample) |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2115111B (en) * | 1982-01-25 | 1987-01-14 | Ava Int Corp | Fail safe gate valves and actuators therefor |
| YU42819B (en) * | 1982-11-22 | 1988-12-31 | Lek Tovarna Farmacevtskih | Process for preparing n-/2-///5-(dimethyl-amino)-methyl-2-furanyl/methyl/thio/ethyl-n'-methyl-2-nitro-1,1-ethene diamine |
| ES543966A0 (es) * | 1982-11-22 | 1986-03-01 | Medichem Sa | Procedimiento para la preparacion de la n-(2-(((5-(dimetila-mino)-metil-2-furanil)metil)tio)etil)-n'-metil-2-nitro-1,1- etendiamina |
| PT79699B (en) * | 1983-12-22 | 1986-12-10 | Pfizer | Process for preparing quinolone inotropic agents |
| HU196979B (en) * | 1985-01-11 | 1989-02-28 | Gyogyszerkutato Intezet | Process for producing basic thioether and salt |
| ES8603706A1 (es) * | 1985-06-12 | 1986-01-16 | Medichem Sa | Procedimiento para la preparacion de la n-(2-(((5-(dimetila-mino)metil-2-furanil)metil)tio)etil)-n'-metil-2-nitro-1,1- etilendiamina |
-
1990
- 1990-11-09 HU HU907074A patent/HU207308B/hu not_active IP Right Cessation
-
1991
- 1991-11-06 RU SU915010152A patent/RU2032681C1/ru active
- 1991-11-06 AT AT0220391A patent/AT400146B/de not_active IP Right Cessation
- 1991-11-07 GR GR910100451A patent/GR1002225B/el unknown
- 1991-11-07 YU YU177391A patent/YU177391A/sh unknown
- 1991-11-08 ES ES9102480A patent/ES2036479B1/es not_active Expired - Lifetime
- 1991-11-08 DK DK184291A patent/DK184291A/da unknown
- 1991-11-08 AR AR91321118A patent/AR248017A1/es active
- 1991-11-08 FI FI915265A patent/FI915265A7/fi not_active Application Discontinuation
- 1991-11-08 PL PL91292327A patent/PL166616B1/pl unknown
- 1991-11-08 CZ CS913403A patent/CZ280197B6/cs unknown
- 1991-11-08 NO NO914376A patent/NO179208C/no unknown
- 1991-11-08 PT PT99470A patent/PT99470A/pt not_active Application Discontinuation
- 1991-11-08 CA CA002055189A patent/CA2055189A1/en active Granted
- 1991-11-09 KR KR1019910019914A patent/KR920009813A/ko not_active Withdrawn
- 1991-11-09 CN CN91110542A patent/CN1061968A/zh active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| RU2032681C1 (ru) | 1995-04-10 |
| HU207308B (en) | 1993-03-29 |
| CS340391A3 (en) | 1992-05-13 |
| KR920009813A (ko) | 1992-06-25 |
| YU177391A (sh) | 1994-01-20 |
| DK184291D0 (da) | 1991-11-08 |
| ES2036479A1 (es) | 1993-05-16 |
| HU907074D0 (en) | 1991-05-28 |
| PT99470A (pt) | 1992-10-30 |
| ATA220391A (de) | 1995-02-15 |
| HUT59916A (en) | 1992-07-28 |
| CA2055189A1 (en) | 1992-05-10 |
| DK184291A (da) | 1992-05-10 |
| AT400146B (de) | 1995-10-25 |
| PL292327A1 (en) | 1992-07-13 |
| FI915265A0 (fi) | 1991-11-08 |
| GR910100451A (el) | 1992-10-08 |
| PL166616B1 (pl) | 1995-06-30 |
| NO179208C (no) | 1996-08-28 |
| AR248017A1 (es) | 1995-05-31 |
| NO914376D0 (no) | 1991-11-08 |
| NO914376L (no) | 1992-05-11 |
| GR1002225B (en) | 1996-04-18 |
| FI915265A7 (fi) | 1992-05-10 |
| NO179208B (no) | 1996-05-20 |
| CN1061968A (zh) | 1992-06-17 |
| ES2036479B1 (es) | 1993-12-16 |
| CA2055189C (enExample) | 1992-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS272241B2 (en) | Method of crystalline citromycindihydrate production | |
| US3736331A (en) | Isothioureas | |
| NO151876B (no) | Fremgangsmaate og anordning for foring av dyr | |
| FI80025C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara n-piperazinylalkanoylanilidderivat. | |
| JPH0579061B2 (enExample) | ||
| US4157340A (en) | N,N'-[Bis(N-cyanoguanyl)]cystamine derivatives | |
| CZ280197B6 (cs) | Způsob přípravy 1-(2-/(5-dimethylaminoethyl-2-fu ryl)-methylthio/-ethyl)-amino-1-methylamino-2 -nitroethylenu | |
| AU2010305397B2 (en) | Method for the synthesis of 2-thiohistidine and the like | |
| CY1463A (en) | A new crystal modification of cimetidine and process for preparing and using same | |
| CS261232B2 (en) | Method of 1(2-/5-dimethylamino methyl-2(furylmethylthio)ethyl/)amino-1-methylamino-2-nitroethylene production | |
| JPS6296481A (ja) | N−スルフアミル−3−(2−グアニジノ−チアゾ−ル−4−イル−メチルチオ)−プロピオンアミジンの製造方法 | |
| NO792406L (no) | Analogifremgangsmaate for fremstilling av substituerte 2-fenylamino-imidazoliner | |
| CS220346B2 (en) | Method of preparing crystalline cimetidine | |
| JP2578797B2 (ja) | N−(スルホニルメチル)ホルムアミド類の製造法 | |
| US5473072A (en) | Process for the preparation of high purity buspiron and the hydrochloride thereof | |
| JPS62155268A (ja) | ナイザチジンの合成法 | |
| HU196386B (en) | Process for production of derivatives of substituated ethan-diimid-amid | |
| US4753949A (en) | 2-chloronicergoline having antihypoxic activity | |
| EP0001266B1 (en) | Substituted 2-aminomethylphenyl sulfamates, process for preparing, and pharmaceutical compositions containing the same | |
| HU195782B (en) | Process for production of n-cyan-n'-methil-n''-/2///-5-methil-1h-imidasole-4-il/-methil/-tio/-ethil/-guanidine | |
| KR790001260B1 (ko) | 크산틴 유도체의 제조방법 | |
| CA1238318A (en) | Double salt, process for its preparation and pharmaceutical composition containing it | |
| PL162556B1 (pl) | Sposób wytwarzania nowych pochodnych Imidazolu PL | |
| CS259878B2 (en) | Method of additive salt preparation with acid derived from 2(/2-aminoethyl/thiomethyl)-5-dimethylaminomethyl furane | |
| HU197891B (en) | Process for producing basic thioether and its salt |