CZ26693A3 - Pharmaceutical compositions - Google Patents
Pharmaceutical compositions Download PDFInfo
- Publication number
- CZ26693A3 CZ26693A3 CZ93266A CZ26693A CZ26693A3 CZ 26693 A3 CZ26693 A3 CZ 26693A3 CZ 93266 A CZ93266 A CZ 93266A CZ 26693 A CZ26693 A CZ 26693A CZ 26693 A3 CZ26693 A3 CZ 26693A3
- Authority
- CZ
- Czechia
- Prior art keywords
- optionally substituted
- alkyl
- hydrogen
- substituted phenyl
- dihydro
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 124
- 239000001257 hydrogen Substances 0.000 claims abstract description 121
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 109
- 150000001875 compounds Chemical class 0.000 claims abstract description 108
- -1 oxadiazol-2-yl Chemical group 0.000 claims abstract description 67
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 63
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 55
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 38
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 28
- 125000003831 tetrazolyl group Chemical group 0.000 claims abstract description 27
- 150000003839 salts Chemical class 0.000 claims abstract description 24
- 150000002148 esters Chemical class 0.000 claims abstract description 22
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims abstract description 19
- 125000004304 oxazol-5-yl group Chemical group O1C=NC=C1* 0.000 claims abstract description 16
- 125000002252 acyl group Chemical group 0.000 claims abstract description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 12
- 125000004496 thiazol-5-yl group Chemical group S1C=NC=C1* 0.000 claims abstract description 12
- 150000002825 nitriles Chemical group 0.000 claims abstract description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 10
- 125000004501 isothiazol-5-yl group Chemical group S1N=CC=C1* 0.000 claims abstract description 9
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 8
- 125000004499 isoxazol-5-yl group Chemical group O1N=CC=C1* 0.000 claims abstract description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 106
- 125000003545 alkoxy group Chemical group 0.000 claims description 44
- 229910052736 halogen Inorganic materials 0.000 claims description 21
- 150000002367 halogens Chemical class 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 21
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 13
- 230000008569 process Effects 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- HACHNOOYOXIAIM-UHFFFAOYSA-N 1,4,5-trihydroxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound C1=CC=C2C(=O)C3=C(O)C(C(=O)O)=CC(O)=C3C(=O)C2=C1O HACHNOOYOXIAIM-UHFFFAOYSA-N 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- UOQCLAXPTQUNAG-UHFFFAOYSA-N 1,4,5,8-tetrahydroxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound C1=CC(O)=C2C(=O)C3=C(O)C(C(=O)O)=CC(O)=C3C(=O)C2=C1O UOQCLAXPTQUNAG-UHFFFAOYSA-N 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 241001611408 Nebo Species 0.000 claims 1
- 238000005273 aeration Methods 0.000 claims 1
- 125000002971 oxazolyl group Chemical group 0.000 claims 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims 1
- 238000006467 substitution reaction Methods 0.000 claims 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 claims 1
- 239000003643 water by type Substances 0.000 claims 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract description 17
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract 2
- 125000001475 halogen functional group Chemical group 0.000 abstract 2
- 229910006069 SO3H Inorganic materials 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 122
- 239000007787 solid Substances 0.000 description 122
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 122
- 239000000243 solution Substances 0.000 description 101
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 100
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 56
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Natural products CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 53
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 50
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 47
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 46
- 238000001914 filtration Methods 0.000 description 44
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 43
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 43
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- 238000003756 stirring Methods 0.000 description 36
- 239000000725 suspension Substances 0.000 description 35
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- 235000019439 ethyl acetate Nutrition 0.000 description 34
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 33
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 31
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 30
- 230000002829 reductive effect Effects 0.000 description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 26
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 25
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 21
- 235000019341 magnesium sulphate Nutrition 0.000 description 21
- 239000012299 nitrogen atmosphere Substances 0.000 description 21
- 239000000047 product Substances 0.000 description 19
- 239000011541 reaction mixture Substances 0.000 description 19
- 239000002904 solvent Substances 0.000 description 19
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 18
- 239000003921 oil Substances 0.000 description 18
- 239000002244 precipitate Substances 0.000 description 18
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 17
- 239000000463 material Substances 0.000 description 17
- 235000019198 oils Nutrition 0.000 description 17
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 17
- 238000001035 drying Methods 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 13
- 239000012074 organic phase Substances 0.000 description 13
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 11
- 229960000583 acetic acid Drugs 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- 239000000284 extract Substances 0.000 description 11
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 11
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- 239000004480 active ingredient Substances 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- 239000012267 brine Substances 0.000 description 7
- 239000006071 cream Substances 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- YDQWDHRMZQUTBA-UHFFFAOYSA-N Aloe emodin Chemical compound C1=CC=C2C(=O)C3=CC(CO)=CC(O)=C3C(=O)C2=C1O YDQWDHRMZQUTBA-UHFFFAOYSA-N 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 6
- 150000003857 carboxamides Chemical class 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 5
- NTOKRQNZZADXMV-UHFFFAOYSA-N 4,5-dimethoxy-9,10-dioxoanthracene-2-carbaldehyde Chemical compound O=C1C2=CC(C=O)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC NTOKRQNZZADXMV-UHFFFAOYSA-N 0.000 description 5
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 125000004093 cyano group Chemical group *C#N 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- YDGGLCBSMFIEFV-UHFFFAOYSA-N 4,5-dimethoxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC(C(O)=O)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC YDGGLCBSMFIEFV-UHFFFAOYSA-N 0.000 description 4
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- FCDLCPWAQCPTKC-UHFFFAOYSA-N Rhein Chemical compound C1=CC=C2C(=O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C2=C1O FCDLCPWAQCPTKC-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 230000003902 lesion Effects 0.000 description 4
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 201000008482 osteoarthritis Diseases 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000008107 starch Substances 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- ZCYKZIZFYFTFHV-UHFFFAOYSA-N 1,8-dihydroxy-3-(2h-tetrazol-5-yl)anthracene-9,10-dione Chemical compound C=1C(O)=C2C(=O)C=3C(O)=CC=CC=3C(=O)C2=CC=1C=1N=NNN=1 ZCYKZIZFYFTFHV-UHFFFAOYSA-N 0.000 description 3
- AWUZFRWFJUAAKS-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-1,8-dimethoxyanthracene-9,10-dione Chemical compound C1=CC=C2NC(C=3C=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(OC)C=3)OC)=NC2=C1 AWUZFRWFJUAAKS-UHFFFAOYSA-N 0.000 description 3
- TYNLGDBUJLVSMA-UHFFFAOYSA-N 4,5-diacetyloxy-9,10-dioxo-2-anthracenecarboxylic acid Chemical compound O=C1C2=CC(C(O)=O)=CC(OC(C)=O)=C2C(=O)C2=C1C=CC=C2OC(=O)C TYNLGDBUJLVSMA-UHFFFAOYSA-N 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000002198 insoluble material Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 238000003760 magnetic stirring Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 150000003536 tetrazoles Chemical class 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- SMXRCXNFUNIVSZ-UHFFFAOYSA-N 1,4,5-trimethoxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=C(OC)C(C(O)=O)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC SMXRCXNFUNIVSZ-UHFFFAOYSA-N 0.000 description 2
- FRGLGODYTDELQB-UHFFFAOYSA-N 1,4-dimethoxy-2-methylanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(OC)=C(C)C=C2OC FRGLGODYTDELQB-UHFFFAOYSA-N 0.000 description 2
- IQISOVKPFBLQIQ-UHFFFAOYSA-N 1,4-dimethoxy-2-methylbenzene Chemical compound COC1=CC=C(OC)C(C)=C1 IQISOVKPFBLQIQ-UHFFFAOYSA-N 0.000 description 2
- FPTYCJFYRIDJKD-UHFFFAOYSA-N 1,8-dimethoxy-3-(2h-tetrazol-5-yl)anthracene-9,10-dione Chemical compound C=1C(OC)=C2C(=O)C=3C(OC)=CC=CC=3C(=O)C2=CC=1C=1N=NNN=1 FPTYCJFYRIDJKD-UHFFFAOYSA-N 0.000 description 2
- ZIAQIHPONXZRSW-UHFFFAOYSA-N 1-(bromomethyl)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2CBr ZIAQIHPONXZRSW-UHFFFAOYSA-N 0.000 description 2
- IXGPFSZGFHBXGA-UHFFFAOYSA-N 1-acetyloxy-4-hydroxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC(C(O)=O)=C2OC(=O)C IXGPFSZGFHBXGA-UHFFFAOYSA-N 0.000 description 2
- 238000005160 1H NMR spectroscopy Methods 0.000 description 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 2
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 2
- AHYSKFQDXIWNLV-UHFFFAOYSA-N 2-(2,5-dimethoxy-4-methylbenzoyl)-3,6-dimethoxybenzoic acid Chemical compound C1=C(C)C(OC)=CC(C(=O)C=2C(=C(OC)C=CC=2OC)C(O)=O)=C1OC AHYSKFQDXIWNLV-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- VHBUDUULDRSEDI-UHFFFAOYSA-N 3,6-dimethoxyphthalic acid Chemical compound COC1=CC=C(OC)C(C(O)=O)=C1C(O)=O VHBUDUULDRSEDI-UHFFFAOYSA-N 0.000 description 2
- KFEFXFVWIXBBCL-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-1,8-dihydroxyanthracene-9,10-dione Chemical compound C1=CC=C2NC(C=3C=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(O)C=3)O)=NC2=C1 KFEFXFVWIXBBCL-UHFFFAOYSA-N 0.000 description 2
- OTBYRJZRBVFICG-UHFFFAOYSA-N 3-(hydroxymethyl)-1,8-dimethoxyanthracene-9,10-dione Chemical compound O=C1C2=CC(CO)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC OTBYRJZRBVFICG-UHFFFAOYSA-N 0.000 description 2
- LRJYRDODMNDLFR-UHFFFAOYSA-N 4,7-dimethoxy-2-benzofuran-1,3-dione Chemical compound COC1=CC=C(OC)C2=C1C(=O)OC2=O LRJYRDODMNDLFR-UHFFFAOYSA-N 0.000 description 2
- IXYWSLFEVMNIFG-UHFFFAOYSA-N 8-fluoro-4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound C1=CC(F)=C2C(=O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C2=C1O IXYWSLFEVMNIFG-UHFFFAOYSA-N 0.000 description 2
- FKPXPDYWTMEGFK-UHFFFAOYSA-N 8-fluoro-5-methoxy-1-oxo-3,4-dihydro-2h-naphthalene-2-carbaldehyde Chemical compound O=C1C(C=O)CCC2=C1C(F)=CC=C2OC FKPXPDYWTMEGFK-UHFFFAOYSA-N 0.000 description 2
- WOHCNXDGQODXHD-UHFFFAOYSA-N 8-fluoro-5-methoxynaphthalen-1-ol Chemical compound C1=CC=C2C(OC)=CC=C(F)C2=C1O WOHCNXDGQODXHD-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 208000001132 Osteoporosis Diseases 0.000 description 2
- KNSWMTRABJOMFS-UHFFFAOYSA-N [8-acetyloxy-6-(1-methylbenzimidazol-2-yl)-9,10-dioxoanthracen-1-yl] acetate Chemical compound C1=CC=C2N(C)C(C=3C=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(OC(C)=O)C=3)OC(=O)C)=NC2=C1 KNSWMTRABJOMFS-UHFFFAOYSA-N 0.000 description 2
- SSTWKJQWBFCJPD-UHFFFAOYSA-N [8-acetyloxy-6-(1h-benzimidazol-2-yl)-9,10-dioxoanthracen-1-yl] acetate Chemical compound C1=CC=C2NC(C=3C=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(OC(C)=O)C=3)OC(=O)C)=NC2=C1 SSTWKJQWBFCJPD-UHFFFAOYSA-N 0.000 description 2
- RLKNQWWDLPDSFW-UHFFFAOYSA-N [9,10-dioxo-8-propanoyloxy-6-(2h-tetrazol-5-yl)anthracen-1-yl] propanoate Chemical compound C=1C(OC(=O)CC)=C2C(=O)C=3C(OC(=O)CC)=CC=CC=3C(=O)C2=CC=1C=1N=NNN=1 RLKNQWWDLPDSFW-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 210000000845 cartilage Anatomy 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 210000001612 chondrocyte Anatomy 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 229940126214 compound 3 Drugs 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 208000018631 connective tissue disease Diseases 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 230000004069 differentiation Effects 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 2
- BTJNSKRJTWQUNP-UHFFFAOYSA-N methyl 4,5-dimethoxy-9,10-dioxoanthracene-2-carboxylate Chemical compound C1=CC=C2C(=O)C3=CC(C(=O)OC)=CC(OC)=C3C(=O)C2=C1OC BTJNSKRJTWQUNP-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- NXXQPXWMCRRNAB-UHFFFAOYSA-N n-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methanesulfonamide Chemical compound C1=CC=C2C(=O)C3=CC(NS(=O)(=O)C)=CC(O)=C3C(=O)C2=C1O NXXQPXWMCRRNAB-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000012363 selectfluor Substances 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 2
- 235000010262 sodium metabisulphite Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- UDYFLDICVHJSOY-UHFFFAOYSA-N sulfur trioxide-pyridine complex Substances O=S(=O)=O.C1=CC=NC=C1 UDYFLDICVHJSOY-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- JAJOZNVOGLDIHJ-UHFFFAOYSA-N triphenyl(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-ylmethyl)phosphanium Chemical compound C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)CC1=NN=N[N-]1 JAJOZNVOGLDIHJ-UHFFFAOYSA-N 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-Me3C6H3 Natural products CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- HLWPXRDVZZOLHS-UHFFFAOYSA-N 1,3-diethyl-1,3-diazinan-2-one Chemical compound CCN1CCCN(CC)C1=O HLWPXRDVZZOLHS-UHFFFAOYSA-N 0.000 description 1
- ZCBQRUIWOOEFCB-UHFFFAOYSA-N 1,3-diethylpyrrolidin-2-one Chemical compound CCC1CCN(CC)C1=O ZCBQRUIWOOEFCB-UHFFFAOYSA-N 0.000 description 1
- VGCARTVCUFWTEG-UHFFFAOYSA-N 1,4,5,8-tetramethoxy-2-methylanthracene-9,10-dione Chemical compound O=C1C2=C(OC)C(C)=CC(OC)=C2C(=O)C2=C1C(OC)=CC=C2OC VGCARTVCUFWTEG-UHFFFAOYSA-N 0.000 description 1
- MIFYRRGRNRIGGZ-UHFFFAOYSA-N 1,4,5,8-tetramethoxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=C(OC)C(C(O)=O)=CC(OC)=C2C(=O)C2=C1C(OC)=CC=C2OC MIFYRRGRNRIGGZ-UHFFFAOYSA-N 0.000 description 1
- UUPOKBMXKZVTTM-UHFFFAOYSA-N 1,4,5-triacetyloxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=C(OC(C)=O)C(C(O)=O)=CC(OC(C)=O)=C2C(=O)C2=C1C=CC=C2OC(=O)C UUPOKBMXKZVTTM-UHFFFAOYSA-N 0.000 description 1
- CEENWJSRRGDMRY-UHFFFAOYSA-N 1,4-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(OC(C)=O)=C(C(O)=O)C=C2OC(=O)C CEENWJSRRGDMRY-UHFFFAOYSA-N 0.000 description 1
- SJOVOXDYBBDMLU-UHFFFAOYSA-N 1,4-dimethoxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(OC)=C(C(O)=O)C=C2OC SJOVOXDYBBDMLU-UHFFFAOYSA-N 0.000 description 1
- LGMFLBOGHZBOBF-UHFFFAOYSA-N 1,8-dihydroxy-3-(1-methylbenzimidazol-2-yl)anthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(C=4N(C5=CC=CC=C5N=4)C)=CC(O)=C3C(=O)C2=C1O LGMFLBOGHZBOBF-UHFFFAOYSA-N 0.000 description 1
- UWQBPPCWOCADRX-UHFFFAOYSA-N 1,8-dimethoxy-3-(1-methylbenzimidazol-2-yl)anthracene-9,10-dione Chemical compound C1=CC=C2N(C)C(C=3C=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(OC)C=3)OC)=NC2=C1 UWQBPPCWOCADRX-UHFFFAOYSA-N 0.000 description 1
- MUVQKFGNPGZBII-UHFFFAOYSA-N 1-anthrol Chemical compound C1=CC=C2C=C3C(O)=CC=CC3=CC2=C1 MUVQKFGNPGZBII-UHFFFAOYSA-N 0.000 description 1
- QXQAPNSHUJORMC-UHFFFAOYSA-N 1-chloro-4-propylbenzene Chemical compound CCCC1=CC=C(Cl)C=C1 QXQAPNSHUJORMC-UHFFFAOYSA-N 0.000 description 1
- VIPWUFMFHBIKQI-UHFFFAOYSA-N 1-fluoro-4-methoxybenzene Chemical compound COC1=CC=C(F)C=C1 VIPWUFMFHBIKQI-UHFFFAOYSA-N 0.000 description 1
- LUPNLHBSWQYEQR-UHFFFAOYSA-N 1-hydroxy-2h-tetrazol-5-one Chemical compound OC1=NN=NN1O LUPNLHBSWQYEQR-UHFFFAOYSA-N 0.000 description 1
- FBJMHOLXOBXAOZ-UHFFFAOYSA-N 2-(2,5-dimethoxy-4-methylbenzoyl)benzoic acid Chemical compound C1=C(C)C(OC)=CC(C(=O)C=2C(=CC=CC=2)C(O)=O)=C1OC FBJMHOLXOBXAOZ-UHFFFAOYSA-N 0.000 description 1
- LLISHSYKUHTUSP-UHFFFAOYSA-N 2-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)ethenylphosphonic acid Chemical compound O=C1C2=CC(C=CP(O)(O)=O)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC LLISHSYKUHTUSP-UHFFFAOYSA-N 0.000 description 1
- VBLXCTYLWZJBKA-UHFFFAOYSA-N 2-(trifluoromethyl)aniline Chemical compound NC1=CC=CC=C1C(F)(F)F VBLXCTYLWZJBKA-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- ODTQUKVFOLFLIQ-UHFFFAOYSA-N 2-[di(propan-2-yloxy)phosphorylmethyl-propan-2-yloxyphosphoryl]oxypropane Chemical compound CC(C)OP(=O)(OC(C)C)CP(=O)(OC(C)C)OC(C)C ODTQUKVFOLFLIQ-UHFFFAOYSA-N 0.000 description 1
- JFTHBDBUVHRREF-UHFFFAOYSA-N 2-acetamidopropanedioic acid Chemical compound CC(=O)NC(C(O)=O)C(O)=O JFTHBDBUVHRREF-UHFFFAOYSA-N 0.000 description 1
- FBPINGSGHKXIQA-UHFFFAOYSA-N 2-amino-3-(2-carboxyethylsulfanyl)propanoic acid Chemical compound OC(=O)C(N)CSCCC(O)=O FBPINGSGHKXIQA-UHFFFAOYSA-N 0.000 description 1
- AQQMMYLHGUFGFC-UHFFFAOYSA-N 2-amino-3-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)propanoic acid Chemical compound C1=CC=C2C(=O)C3=CC(CC(N)C(O)=O)=CC(O)=C3C(=O)C2=C1O AQQMMYLHGUFGFC-UHFFFAOYSA-N 0.000 description 1
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 1
- GWSTUUNCARBYBG-UHFFFAOYSA-N 2-ethylbutanamide;propanedioic acid Chemical compound OC(=O)CC(O)=O.CCC(CC)C(N)=O GWSTUUNCARBYBG-UHFFFAOYSA-N 0.000 description 1
- XFKCVVFQGHCLIP-UHFFFAOYSA-N 2-ethylbutanedioyl dichloride Chemical compound CCC(C(Cl)=O)CC(Cl)=O XFKCVVFQGHCLIP-UHFFFAOYSA-N 0.000 description 1
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- RBECBXIJJTWGFS-UHFFFAOYSA-N 3,6-dimethoxybenzene-1,2-dicarbonitrile Chemical compound COC1=CC=C(OC)C(C#N)=C1C#N RBECBXIJJTWGFS-UHFFFAOYSA-N 0.000 description 1
- WSKNNUXPCPEFJX-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-8-hydroxy-1-methoxyanthracene-9,10-dione Chemical compound C1=CC=C2NC(C=3C=C(C=4C(=O)C5=C(O)C=CC=C5C(=O)C=4C=3)OC)=NC2=C1 WSKNNUXPCPEFJX-UHFFFAOYSA-N 0.000 description 1
- HZLDTTNIJNQGEP-UHFFFAOYSA-N 3-(bromomethyl)-1,8-dihydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC(CBr)=CC(O)=C2C(=O)C2=C1C=CC=C2O HZLDTTNIJNQGEP-UHFFFAOYSA-N 0.000 description 1
- AHMYMRZBFMJZCL-UHFFFAOYSA-N 3-(hydroxyiminomethyl)-1,8-dimethoxyanthracene-9,10-dione Chemical compound O=C1C2=CC(C=NO)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC AHMYMRZBFMJZCL-UHFFFAOYSA-N 0.000 description 1
- RXTKXDINFNFORF-UHFFFAOYSA-N 3-[(1,5-dimethoxynaphthalen-2-yl)methylidene]hexanedioic acid Chemical compound OC(=O)CCC(CC(O)=O)=CC1=CC=C2C(OC)=CC=CC2=C1OC RXTKXDINFNFORF-UHFFFAOYSA-N 0.000 description 1
- OJQLWNBSRZYJQR-UHFFFAOYSA-N 3-amino-1,8-dihydroxyanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(N)=CC(O)=C3C(=O)C2=C1O OJQLWNBSRZYJQR-UHFFFAOYSA-N 0.000 description 1
- UMWMWKPGJCZWFT-UHFFFAOYSA-N 3-amino-1,8-dimethoxyanthracene-9,10-dione Chemical compound O=C1C2=CC(N)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC UMWMWKPGJCZWFT-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- JDQDSEVNMTYMOC-UHFFFAOYSA-N 3-methylbenzenesulfonic acid Chemical compound CC1=CC=CC(S(O)(=O)=O)=C1 JDQDSEVNMTYMOC-UHFFFAOYSA-N 0.000 description 1
- XYBQTPMOOBAPTL-UHFFFAOYSA-N 4,5-dimethoxy-8-nitro-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC(C(O)=O)=CC(OC)=C2C(=O)C2=C1C([N+]([O-])=O)=CC=C2OC XYBQTPMOOBAPTL-UHFFFAOYSA-N 0.000 description 1
- STJIMPFXIFHKRR-UHFFFAOYSA-N 4,5-dimethoxy-9,10-dioxoanthracene-2-carbonitrile Chemical compound O=C1C2=CC(C#N)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC STJIMPFXIFHKRR-UHFFFAOYSA-N 0.000 description 1
- YMRKWKCBIMINBQ-UHFFFAOYSA-N 4,5-dimethoxy-9,10-dioxoanthracene-2-carbonyl azide Chemical compound O=C1C2=CC(C(=O)N=[N+]=[N-])=CC(OC)=C2C(=O)C2=C1C=CC=C2OC YMRKWKCBIMINBQ-UHFFFAOYSA-N 0.000 description 1
- UVSQWKNFZKDFJF-UHFFFAOYSA-N 4,5-dimethoxy-n-methyl-9,10-dioxo-n-phenylmethoxyanthracene-2-carboxamide Chemical compound C=1C(OC)=C2C(=O)C=3C(OC)=CC=CC=3C(=O)C2=CC=1C(=O)N(C)OCC1=CC=CC=C1 UVSQWKNFZKDFJF-UHFFFAOYSA-N 0.000 description 1
- DTTDGMKWTYRLSM-UHFFFAOYSA-N 4,6-dimethoxy-2-benzofuran-1,3-dione Chemical compound COC1=CC(OC)=CC2=C1C(=O)OC2=O DTTDGMKWTYRLSM-UHFFFAOYSA-N 0.000 description 1
- HPXLWICMZMEFPV-UHFFFAOYSA-N 4-(5-fluoro-2-methoxyphenyl)butanoic acid Chemical compound COC1=CC=C(F)C=C1CCCC(O)=O HPXLWICMZMEFPV-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- CIZPPCOGVVYLBA-UHFFFAOYSA-N 5,5-dimethoxytetrazole Chemical compound COC1(N=NN=N1)OC CIZPPCOGVVYLBA-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- WYGRASSQZOYWAK-UHFFFAOYSA-N 5-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-phosphonoheptanoic acid Chemical compound CC(C)(C)OC(=O)C(CC)(CC)C(CCC(O)=O)P(O)(O)=O WYGRASSQZOYWAK-UHFFFAOYSA-N 0.000 description 1
- XAHQTDJQXASNNJ-UHFFFAOYSA-N 6-fluoro-4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound FC1=CC=C2C(=O)C3=CC(C(=O)O)=CC(O)=C3C(=O)C2=C1O XAHQTDJQXASNNJ-UHFFFAOYSA-N 0.000 description 1
- IUYJYUIMBDDHPV-UHFFFAOYSA-N 6-fluoro-4,5-dimethoxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC=C(F)C(OC)=C2C(=O)C2=C1C=C(C(O)=O)C=C2OC IUYJYUIMBDDHPV-UHFFFAOYSA-N 0.000 description 1
- BRYUSMOTMZPNDV-UHFFFAOYSA-N 8-fluoro-1-hydroxy-5-methoxynaphthalene-2-carbaldehyde Chemical compound O=CC1=CC=C2C(OC)=CC=C(F)C2=C1O BRYUSMOTMZPNDV-UHFFFAOYSA-N 0.000 description 1
- DTYIBZSSCUATNM-UHFFFAOYSA-N 8-fluoro-4,5-dimethoxy-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC(C(O)=O)=CC(OC)=C2C(=O)C2=C1C(F)=CC=C2OC DTYIBZSSCUATNM-UHFFFAOYSA-N 0.000 description 1
- UKTORPDEFRENTM-UHFFFAOYSA-N 8-fluoro-5-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=C1C(F)=CC=C2OC UKTORPDEFRENTM-UHFFFAOYSA-N 0.000 description 1
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- SMOXLGSFWOUPHC-UHFFFAOYSA-N C(=C)P(O)(O)O Chemical class C(=C)P(O)(O)O SMOXLGSFWOUPHC-UHFFFAOYSA-N 0.000 description 1
- 125000006414 CCl Chemical group ClC* 0.000 description 1
- GIOGSGNEMASXFZ-UHFFFAOYSA-N COC1(C(C=C(C2=CC3=C(C=CC=C3C=C12)OC)OC)C)O Chemical compound COC1(C(C=C(C2=CC3=C(C=CC=C3C=C12)OC)OC)C)O GIOGSGNEMASXFZ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 101100010343 Drosophila melanogaster lobo gene Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- COLNVLDHVKWLRT-QMMMGPOBSA-N L-phenylalanine Chemical compound OC(=O)[C@@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-QMMMGPOBSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 208000008558 Osteophyte Diseases 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- 229920001030 Polyethylene Glycol 4000 Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 241000219061 Rheum Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- CIMCSQHBZVZJHF-UHFFFAOYSA-N [8-acetyloxy-6-(1h-benzimidazol-2-yl)-9,10-dioxoanthracen-1-yl] acetate;hydrochloride Chemical compound Cl.C1=CC=C2NC(C=3C=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(OC(C)=O)C=3)OC(=O)C)=NC2=C1 CIMCSQHBZVZJHF-UHFFFAOYSA-N 0.000 description 1
- CRTHIFYTSHONAZ-UHFFFAOYSA-N [8-acetyloxy-6-(1h-benzimidazol-2-yl)-9,10-dioxoanthracen-1-yl] acetate;methanesulfonic acid Chemical compound CS(O)(=O)=O.C1=CC=C2NC(C=3C=C4C(=O)C=5C=CC=C(C=5C(=O)C4=C(OC(C)=O)C=3)OC(=O)C)=NC2=C1 CRTHIFYTSHONAZ-UHFFFAOYSA-N 0.000 description 1
- PRMCBUMDLLRCKE-UHFFFAOYSA-N [8-acetyloxy-9,10-dioxo-6-(2h-tetrazol-5-yl)anthracen-1-yl] acetate Chemical compound C=1C(OC(C)=O)=C2C(=O)C=3C(OC(=O)C)=CC=CC=3C(=O)C2=CC=1C=1N=NNN=1 PRMCBUMDLLRCKE-UHFFFAOYSA-N 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- RZRJYURCNBXIST-UHFFFAOYSA-M anthracene-2-carboxylate Chemical compound C1=CC=CC2=CC3=CC(C(=O)[O-])=CC=C3C=C21 RZRJYURCNBXIST-UHFFFAOYSA-M 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- IYYIVELXUANFED-UHFFFAOYSA-N bromo(trimethyl)silane Chemical compound C[Si](C)(C)Br IYYIVELXUANFED-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- CMDKPGRTAQVGFQ-RMKNXTFCSA-N cinoxate Chemical compound CCOCCOC(=O)\C=C\C1=CC=C(OC)C=C1 CMDKPGRTAQVGFQ-RMKNXTFCSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- ARPLQAMUUDIHIT-UHFFFAOYSA-M cyanomethyl(triphenyl)phosphanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC#N)C1=CC=CC=C1 ARPLQAMUUDIHIT-UHFFFAOYSA-M 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- 229960004590 diacerein Drugs 0.000 description 1
- ISOLMABRZPQKOV-UHFFFAOYSA-N diethyl 2-acetamidopropanedioate Chemical compound CCOC(=O)C(NC(C)=O)C(=O)OCC ISOLMABRZPQKOV-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- MYTMXVHNEWBFAL-UHFFFAOYSA-L dipotassium;carbonate;hydrate Chemical compound O.[K+].[K+].[O-]C([O-])=O MYTMXVHNEWBFAL-UHFFFAOYSA-L 0.000 description 1
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 description 1
- MCPLVIGCWWTHFH-UHFFFAOYSA-M disodium;4-[4-[[4-(4-sulfoanilino)phenyl]-[4-(4-sulfonatophenyl)azaniumylidenecyclohexa-2,5-dien-1-ylidene]methyl]anilino]benzenesulfonate Chemical compound [Na+].[Na+].C1=CC(S(=O)(=O)O)=CC=C1NC1=CC=C(C(=C2C=CC(C=C2)=[NH+]C=2C=CC(=CC=2)S([O-])(=O)=O)C=2C=CC(NC=3C=CC(=CC=3)S([O-])(=O)=O)=CC=2)C=C1 MCPLVIGCWWTHFH-UHFFFAOYSA-M 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- UBMSZRWDHVYRRP-UHFFFAOYSA-N ethyl 4-acetyloxy-8-fluoro-5,10-dimethoxyanthracene-2-carboxylate Chemical compound COC1=CC=C(F)C2=CC3=CC(C(=O)OCC)=CC(OC(C)=O)=C3C(OC)=C21 UBMSZRWDHVYRRP-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 210000003414 extremity Anatomy 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000004896 high resolution mass spectrometry Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- RGZRSLKIOCHTSI-UHFFFAOYSA-N hydron;n-methylhydroxylamine;chloride Chemical compound Cl.CNO RGZRSLKIOCHTSI-UHFFFAOYSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 238000010874 in vitro model Methods 0.000 description 1
- 238000012750 in vivo screening Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000007373 indentation Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 210000000629 knee joint Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 210000003041 ligament Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 210000004698 lymphocyte Anatomy 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- MEMCLKKCKLUCDK-UHFFFAOYSA-N methyl 6-fluoro-4,5-dimethoxy-9,10-dioxoanthracene-2-carboxylate Chemical compound FC1=CC=C2C(=O)C3=CC(C(=O)OC)=CC(OC)=C3C(=O)C2=C1OC MEMCLKKCKLUCDK-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000003226 mitogen Substances 0.000 description 1
- 230000000897 modulatory effect Effects 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- QWHJTBHNATVVFG-UHFFFAOYSA-N n-(4,5-dimethoxy-9,10-dioxoanthracen-2-yl)methanesulfonamide Chemical compound O=C1C2=CC(NS(C)(=O)=O)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC QWHJTBHNATVVFG-UHFFFAOYSA-N 0.000 description 1
- PAMCRRDMORMCSM-UHFFFAOYSA-N n-(trifluoromethyl)benzamide Chemical compound FC(F)(F)NC(=O)C1=CC=CC=C1 PAMCRRDMORMCSM-UHFFFAOYSA-N 0.000 description 1
- AQEBWGMABWCUOJ-UHFFFAOYSA-N n-hydroxy-4,5-dimethoxy-n-methyl-9,10-dioxoanthracene-2-carboxamide Chemical compound O=C1C2=CC(C(=O)N(C)O)=CC(OC)=C2C(=O)C2=C1C=CC=C2OC AQEBWGMABWCUOJ-UHFFFAOYSA-N 0.000 description 1
- VJNPVRSPFLPBHV-UHFFFAOYSA-N n-phenylmethoxymethanamine;hydrobromide Chemical compound Br.CNOCC1=CC=CC=C1 VJNPVRSPFLPBHV-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 101150009274 nhr-1 gene Proteins 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- HYDZPXNVHXJHBG-UHFFFAOYSA-N o-benzylhydroxylamine;hydron;chloride Chemical compound Cl.NOCC1=CC=CC=C1 HYDZPXNVHXJHBG-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- COLNVLDHVKWLRT-UHFFFAOYSA-N phenylalanine Natural products OC(=O)C(N)CC1=CC=CC=C1 COLNVLDHVKWLRT-UHFFFAOYSA-N 0.000 description 1
- 125000002071 phenylalkoxy group Chemical group 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical compound [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 201000003068 rheumatic fever Diseases 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 101150101156 slc51a gene Proteins 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 159000000000 sodium salts Chemical group 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000007619 statistical method Methods 0.000 description 1
- 210000000130 stem cell Anatomy 0.000 description 1
- 239000012058 sterile packaged powder Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 230000035900 sweating Effects 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 230000004565 tumor cell growth Effects 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 231100000397 ulcer Toxicity 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- ZTWTYVWXUKTLCP-UHFFFAOYSA-N vinylphosphonic acid Chemical compound OP(O)(=O)C=C ZTWTYVWXUKTLCP-UHFFFAOYSA-N 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/32—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing keto groups
- C07C65/34—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing keto groups polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/08—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease
- A61P19/10—Drugs for skeletal disorders for bone diseases, e.g. rachitism, Paget's disease for osteoporosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/24—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings
- C07C225/26—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings
- C07C225/32—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings of condensed quinone ring systems formed by at least three rings
- C07C225/34—Amino anthraquinones
- C07C225/36—Amino anthraquinones the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/34—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton containing six-membered aromatic rings
- C07C229/36—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton containing six-membered aromatic rings with at least one amino group and one carboxyl group bound to the same carbon atom of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/45—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups
- C07C233/46—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom
- C07C233/51—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by carboxyl groups with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by an acyclic carbon atom having the carbon atom of the carboxamide group bound to an acyclic carbon atom of a carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/70—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/84—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups and doubly-bound oxygen atoms bound to the same carbon skeleton with the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/88—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having the nitrogen atom of at least one of the carboxamide groups further acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/32—Oximes
- C07C251/34—Oximes with oxygen atoms of oxyimino groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
- C07C251/48—Oximes with oxygen atoms of oxyimino groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals with the carbon atom of at least one of the oxyimino groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/56—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and doubly-bound oxygen atoms bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/04—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids
- C07C259/10—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids having carbon atoms of hydroxamic groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C307/00—Amides of sulfuric acids, i.e. compounds having singly-bound oxygen atoms of sulfate groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C307/02—Monoamides of sulfuric acids or esters thereof, e.g. sulfamic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/02—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C311/08—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C66/00—Quinone carboxylic acids
- C07C66/02—Anthraquinone carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/18—Benzimidazoles; Hydrogenated benzimidazoles with aryl radicals directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/10—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3826—Acyclic unsaturated acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4015—Esters of acyclic unsaturated acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Molecular Biology (AREA)
- Biochemistry (AREA)
- Physical Education & Sports Medicine (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Rheumatology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Obesity (AREA)
- Pain & Pain Management (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB929204302A GB9204302D0 (en) | 1992-02-28 | 1992-02-28 | Pharmaceutical compounds |
| GB929222650A GB9222650D0 (en) | 1992-10-28 | 1992-10-28 | Pharmaceutical compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ26693A3 true CZ26693A3 (en) | 1993-12-15 |
Family
ID=26300391
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ93266A CZ26693A3 (en) | 1992-02-28 | 1993-02-24 | Pharmaceutical compositions |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US5480873A (index.php) |
| EP (1) | EP0570091A1 (index.php) |
| JP (1) | JPH07285855A (index.php) |
| KR (1) | KR930017576A (index.php) |
| CN (1) | CN1079732A (index.php) |
| AU (1) | AU666704B2 (index.php) |
| CA (1) | CA2090743A1 (index.php) |
| CZ (1) | CZ26693A3 (index.php) |
| FI (1) | FI930882A7 (index.php) |
| HU (1) | HUT64734A (index.php) |
| IL (1) | IL104852A0 (index.php) |
| MX (1) | MX9301032A (index.php) |
| NO (1) | NO179941C (index.php) |
| NZ (1) | NZ245989A (index.php) |
| PH (1) | PH30215A (index.php) |
| TW (1) | TW235959B (index.php) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9316912D0 (en) * | 1993-08-13 | 1993-09-29 | Lilly Industries Ltd | Pharmaceutical compounds |
| GB9316923D0 (en) * | 1993-08-13 | 1993-09-29 | Lilly Industries Ltd | Pharmaceutical compounds |
| GB9417102D0 (en) * | 1994-08-24 | 1994-10-12 | Lilly Industries Ltd | Pharmaceutical compounds |
| US6797289B2 (en) * | 1998-02-13 | 2004-09-28 | Nutramax Laboratories, Inc. | Use of anabolic agents, anti-catabolic agents, antioxidant agents, and analgesics for protection, treatment and repair of connective tissues in humans and animals |
| US20070141181A1 (en) * | 1998-02-13 | 2007-06-21 | Nutramax Laboratories, Inc. | Use of anabolic agents, anti-catabolic agents, antioxidant agents, and analgesics for protection, treatment and repair of connective tissues in humans and animals |
| US6451771B1 (en) | 1999-02-12 | 2002-09-17 | Nutramax Laboratories, Inc. | Use of anabolic agents anti-catabolic agents and antioxidant agents for protection treatment and repair of connective tissues in humans and animals |
| US6600057B2 (en) * | 2000-12-29 | 2003-07-29 | Kimberly-Clark Worldwide, Inc. | Matrix metalloproteinase inhibitors |
| AU2003230891A1 (en) * | 2002-04-15 | 2003-11-03 | Michigan State University | Anticancer anthraquinones and method of use thereof |
| US6800615B2 (en) * | 2002-04-15 | 2004-10-05 | Board Of Trustees Of Michigan State University | Antihelminthic anthraquinones and method of use thereof |
| RU2228924C1 (ru) * | 2002-12-02 | 2004-05-20 | Ивановский государственный химико-технологический университет | Способ получения 2,3,-дикарбокси-9,10-антрахинона |
| US20040127511A1 (en) * | 2002-12-12 | 2004-07-01 | Pharmacia Corporation | Tricyclic aminocyanopyridine inhibitors of mitogen activated protein kinase-activated protein kinase-2 |
| US20040127519A1 (en) * | 2002-12-12 | 2004-07-01 | Pharmacia Corporation | Method of using aminocyanopyridine compounds as mitogen activated protein kinase-activated protein kinase-2 inhibitors |
| GB2398780A (en) * | 2003-02-26 | 2004-09-01 | Arakis Ltd | 1,8-dihydroxyanthraquinone-6-carboxamide derivatives as inhibitors of T-cell proliferation for treatment of autoimmune or inflammatory conditions |
| GB2398779A (en) * | 2003-02-26 | 2004-09-01 | Arakis Ltd | 1,8-dihydroxyanthraquinone-6-carboxamide derivatives as modulators of IL-10 production for treatment of autoimmune or inflammatory conditions |
| US7199144B2 (en) | 2003-04-21 | 2007-04-03 | Teva Pharmaceuticals Industries, Ltd. | Process for the preparation of valsartan and intermediates thereof |
| CN1791393A (zh) * | 2003-04-08 | 2006-06-21 | 麒麟麦酒株式会社 | 用于抑制或预防骨密度减少的组合物、食品和饮料 |
| EP1556363A2 (en) * | 2003-04-21 | 2005-07-27 | Teva Pharmaceutical Industries Limited | Process for the preparation of valsartan and intermediates thereof |
| TW200505879A (en) | 2003-04-21 | 2005-02-16 | Teva Pharma | Process for the preparation of valsartan |
| ITMI20040347A1 (it) * | 2004-02-26 | 2004-05-26 | Pharma Medical Ltd | Nuovo farmaco di associazione |
| RU2282617C1 (ru) * | 2005-04-26 | 2006-08-27 | Государственное образовательное учреждение высшего профессионального образования "Ивановский государственный химико-технологический университет" | 2,3-дикарбокси-6-бром-7-метоксиантрахинон |
| EP2060562A1 (en) | 2007-11-16 | 2009-05-20 | Laboratoire Medidom S.A. | Dioxoanthracene sulphonate derivatives |
| WO2011030350A1 (en) * | 2009-09-08 | 2011-03-17 | Lupin Limited | Eco-friendly method for catalytic aerial oxidation of aloe-emodin to rheinal |
| CN102225896B (zh) * | 2011-04-07 | 2013-10-30 | 栗进才 | 大黄酸的醚衍生物以及它们的治疗用途 |
| CN102627593A (zh) * | 2012-02-23 | 2012-08-08 | 河南师范大学 | 具有抗癌活性的1,4-二羟基-2-甲酰基-9,10蒽醌缩氨硫脲新化合物及制备方法 |
| CN104507902A (zh) * | 2012-07-10 | 2015-04-08 | 佐治亚州立大学研究基金会公司 | 蒽醌类似物以及其制备和使用方法 |
| CN103709052B (zh) * | 2014-01-12 | 2016-01-27 | 何黎琴 | 一种大黄酸胺基醇酯类化合物、其制备方法及医药用途 |
| CN103936788B (zh) * | 2014-02-22 | 2016-03-30 | 福州大学 | 具有抗肿瘤活性的大黄素季鏻盐及其制备方法 |
| CN104892453A (zh) * | 2015-01-27 | 2015-09-09 | 邵阳学院 | 大黄类抗菌、抗肿瘤化合物及其应用 |
| CN105884645B (zh) * | 2016-05-06 | 2018-06-26 | 上海市伤骨科研究所 | 一类大黄酸类化合物及其用途 |
| CN107698434A (zh) * | 2016-08-09 | 2018-02-16 | 常州高新技术产业开发区三维工业技术研究所有限公司 | 一种大黄酸的合成工艺 |
| CN110317137B (zh) * | 2018-03-29 | 2022-04-19 | 复旦大学 | 9,10-蒽醌类化合物或其药学上可接受的盐及其药物用途 |
| CN110668961B (zh) * | 2018-07-02 | 2022-12-23 | 成都阿奇生物医药科技有限公司 | 芦荟大黄素衍生物 |
| CN112920141B (zh) * | 2019-12-05 | 2023-03-17 | 中检科医药科技(北京)集团有限公司 | 一类大黄酸衍生物及其抗病毒用途 |
| CN118084744A (zh) * | 2024-03-22 | 2024-05-28 | 广西民族大学 | 一种芦荟大黄素衍生物及其制备方法和应用 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU50233A1 (index.php) * | 1966-01-10 | 1967-07-10 | ||
| US3752813A (en) * | 1969-06-25 | 1973-08-14 | Merck & Co Inc | Ortho hydroxy dihydro phenozine carboxylic acids and derivatives |
| US3984429A (en) * | 1970-11-27 | 1976-10-05 | Allen & Hanburys Limited | Pharmaceutically active compounds |
| US3984534A (en) * | 1970-11-27 | 1976-10-05 | Allen & Hanburys Limited | Tetrazolyl anthraquinones for inhibiting the release of spasmogen mediators |
| ZA761627B (en) * | 1976-03-16 | 1978-01-25 | C Friedmann | Improvements in or relating to the treatment of arthritis |
| DE2652940C2 (de) * | 1976-11-22 | 1985-12-05 | Siemens AG, 1000 Berlin und 8000 München | Röntgendiagnostikgenerator mit direkt geheizter Röntgenröhre |
| IT1189097B (it) * | 1986-05-02 | 1988-01-28 | Proter Spa | Sali di diacetilreina e loro impiego terapeutico nel trattamento dell'artrosi |
| JPH0652327B2 (ja) * | 1986-06-17 | 1994-07-06 | 三菱化成株式会社 | 偏光フイルム |
| IT1244886B (it) * | 1990-12-11 | 1994-09-13 | Gentili Ist Spa | Dicarbonati e uretani dell'acido 4,5-diidrossi- e 4,5,8-triidrossi- 9,10-diidro-9,10-diosso-2-antracencarbossilico ad azione terapeutica |
| IT1244773B (it) * | 1991-03-12 | 1994-08-08 | Gentili Ist Spa | N-(4,5-diidrossi-e 4,5,8-triidrossi-9,10-diidro-9,10-diosso-2- antracen-il)carbonil) amminoacidi utilizzabili nella terapia delle affezioni osteoarticolari |
-
1993
- 1993-02-24 CZ CZ93266A patent/CZ26693A3/cs unknown
- 1993-02-24 AU AU33732/93A patent/AU666704B2/en not_active Ceased
- 1993-02-24 CA CA002090743A patent/CA2090743A1/en not_active Abandoned
- 1993-02-24 NZ NZ245989A patent/NZ245989A/en unknown
- 1993-02-24 EP EP93301356A patent/EP0570091A1/en not_active Withdrawn
- 1993-02-25 TW TW082101374A patent/TW235959B/zh active
- 1993-02-25 IL IL104852A patent/IL104852A0/xx unknown
- 1993-02-25 NO NO930677A patent/NO179941C/no unknown
- 1993-02-25 MX MX9301032A patent/MX9301032A/es unknown
- 1993-02-25 US US08/023,220 patent/US5480873A/en not_active Expired - Fee Related
- 1993-02-26 JP JP5078506A patent/JPH07285855A/ja active Pending
- 1993-02-26 HU HU9300536A patent/HUT64734A/hu unknown
- 1993-02-26 FI FI930882A patent/FI930882A7/fi not_active Application Discontinuation
- 1993-02-27 KR KR1019930002922A patent/KR930017576A/ko not_active Withdrawn
- 1993-02-27 CN CN93103579A patent/CN1079732A/zh active Pending
- 1993-04-24 PH PH45769A patent/PH30215A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0570091A1 (en) | 1993-11-18 |
| MX9301032A (es) | 1993-09-01 |
| CA2090743A1 (en) | 1993-08-29 |
| US5480873A (en) | 1996-01-02 |
| NO930677L (no) | 1993-08-30 |
| JPH07285855A (ja) | 1995-10-31 |
| FI930882A0 (fi) | 1993-02-26 |
| CN1079732A (zh) | 1993-12-22 |
| PH30215A (en) | 1997-02-05 |
| TW235959B (index.php) | 1994-12-11 |
| AU666704B2 (en) | 1996-02-22 |
| NO179941B (no) | 1996-10-07 |
| KR930017576A (ko) | 1993-09-20 |
| AU3373293A (en) | 1993-09-02 |
| HU9300536D0 (en) | 1993-05-28 |
| NZ245989A (en) | 1995-02-24 |
| IL104852A0 (en) | 1993-06-10 |
| NO179941C (no) | 1997-01-15 |
| FI930882A7 (fi) | 1993-08-29 |
| NO930677D0 (no) | 1993-02-25 |
| HUT64734A (en) | 1994-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CZ26693A3 (en) | Pharmaceutical compositions | |
| KR0174752B1 (ko) | 이환식 헤테로환 함유 술폰아미드 유도체 및 그 제조방법 | |
| DE60316542T2 (de) | 7-azaindole als inhibitoren c-jun n-terminaler kinasen zur behandlung neurodegenerativer störungen | |
| DE60204718T2 (de) | 3-substituierte oxindol beta 3 agonisten | |
| CA2472479C (en) | Deazapurines and uses thereof | |
| FI102611B (fi) | Menetelmä terapeuttisesti käyttökelpoisten 1-(4-asyyliaminofenyyli)-ja /tai-3-asyyli-7,8-metyleenidioksi-5H-2,3-bentsodiatsepiini-johdannaist en valmistamiseksi | |
| JP4836396B2 (ja) | ナフタレン誘導体 | |
| DE60225174T2 (de) | Beta-3 adrenergische agonisten | |
| CA3064794A1 (en) | Lactam compound as fxr receptor agonist | |
| CN109475528A (zh) | 用于egfr降解的双功能分子和使用方法 | |
| CA2104883A1 (fr) | Derives d'acide thienyl ou pyrrolyl carboxyliques, leur preparation et medicaments les contenant | |
| WO2006128184A2 (en) | Pyrimidine or triazine fused bicyclic metalloprotease inhibitors | |
| EP2460787A1 (en) | Amide compounds and their use as PGE2 antagonists. | |
| CZ256795A3 (en) | Derivatives of cycloalkanoindole and cyclalkanoazaindole, process of their preparation, pharmaceutical compositions containing thereof and their use | |
| KR20000035324A (ko) | 발기부전 치료에 효과를 갖는 피라졸로피리미디논 화합물 | |
| UA78016C2 (uk) | 1,2,3-заміщені похідні індолізину, інгібітори fgfs, спосіб їх отримання та фармацевтична композиція, що їх містить | |
| JPH01503233A (ja) | 製薬活性化合物 | |
| CA3064484A1 (fr) | Composes inhibiteurs des canaux ioniques pour le traitement du cancer | |
| PL208673B1 (pl) | Pochodne indolu, sposób wytwarzania pochodnych indolu, zastosowanie pochodnych indolu do wytwarzania leków oraz lek zawierający pochodną indolu | |
| US20040248922A1 (en) | Lavendamycin analogs, quinoline-5,8-diones and methods of using them | |
| HK1006570A1 (en) | 1,7-fused 1h-indole-2-carboxylic n-(1,4-benzodiazepin-3-yl)-amides | |
| HK1006570B (en) | 1,7-fused 1h-indole-2-carboxylic n-(1,4-benzodiazepin-3-yl)-amides | |
| NZ554469A (en) | Non-peptide bradykinin antagonists and pharmaceutical compositions therefrom | |
| CN116655557A (zh) | 苯并噻唑类化合物、其制备方法及应用 | |
| US5023261A (en) | Acylated benzofuro[3,2-c]quinoline compounds with utility as treatments for osteoporosis |