CS223824B2 - Method of decreasing the concentration of nitroamine in dinitroanilines - Google Patents
Method of decreasing the concentration of nitroamine in dinitroanilines Download PDFInfo
- Publication number
- CS223824B2 CS223824B2 CS785688A CS568878A CS223824B2 CS 223824 B2 CS223824 B2 CS 223824B2 CS 785688 A CS785688 A CS 785688A CS 568878 A CS568878 A CS 568878A CS 223824 B2 CS223824 B2 CS 223824B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- carbon atoms
- alkyl
- nitrosamine
- phosphorus
- dinitroaniline
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 24
- CGNBQYFXGQHUQP-UHFFFAOYSA-N 2,3-dinitroaniline Chemical class NC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O CGNBQYFXGQHUQP-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 230000003247 decreasing effect Effects 0.000 title 1
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical compound N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 title 1
- XKLJHFLUAHKGGU-UHFFFAOYSA-N nitrous amide Chemical compound ON=N XKLJHFLUAHKGGU-UHFFFAOYSA-N 0.000 claims abstract description 85
- LZGUHMNOBNWABZ-UHFFFAOYSA-N n-nitro-n-phenylnitramide Chemical compound [O-][N+](=O)N([N+]([O-])=O)C1=CC=CC=C1 LZGUHMNOBNWABZ-UHFFFAOYSA-N 0.000 claims abstract description 20
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims abstract description 18
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims abstract description 18
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims abstract description 12
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 claims abstract description 11
- 150000004005 nitrosamines Chemical class 0.000 claims abstract description 10
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims abstract description 9
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 claims abstract description 8
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 claims abstract description 7
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 claims abstract 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 45
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 238000006243 chemical reaction Methods 0.000 claims description 27
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 claims description 23
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 239000003153 chemical reaction reagent Substances 0.000 claims description 9
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 claims description 8
- 239000007791 liquid phase Substances 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 7
- 125000006682 monohaloalkyl group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 238000002844 melting Methods 0.000 claims description 4
- 230000008018 melting Effects 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims 6
- 229940124530 sulfonamide Drugs 0.000 claims 6
- 229910052739 hydrogen Inorganic materials 0.000 claims 4
- 239000001257 hydrogen Substances 0.000 claims 4
- 150000003456 sulfonamides Chemical class 0.000 claims 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 239000003849 aromatic solvent Substances 0.000 claims 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 claims 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims 1
- 239000003610 charcoal Substances 0.000 claims 1
- 125000003963 dichloro group Chemical group Cl* 0.000 claims 1
- SWRNIYAQKATHDJ-UHFFFAOYSA-N dichloro(dichlorophosphanyl)phosphane Chemical compound ClP(Cl)P(Cl)Cl SWRNIYAQKATHDJ-UHFFFAOYSA-N 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 125000000449 nitro group Chemical class [O-][N+](*)=O 0.000 claims 1
- 239000012071 phase Substances 0.000 claims 1
- 125000004950 trifluoroalkyl group Chemical group 0.000 claims 1
- 229910006024 SO2Cl2 Inorganic materials 0.000 abstract description 3
- 229910020667 PBr3 Inorganic materials 0.000 abstract 1
- 229910019213 POCl3 Inorganic materials 0.000 abstract 1
- 229910018105 SCl2 Inorganic materials 0.000 abstract 1
- 229910006121 SOBr2 Inorganic materials 0.000 abstract 1
- 229910006124 SOCl2 Inorganic materials 0.000 abstract 1
- 229910003074 TiCl4 Inorganic materials 0.000 abstract 1
- 101001135436 Urodacus yaschenkoi Antimicrobial peptide scorpine-like-2 Proteins 0.000 abstract 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 15
- 239000000523 sample Substances 0.000 description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- NEKOXWSIMFDGMA-UHFFFAOYSA-N Isopropalin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(C)C)C=C1[N+]([O-])=O NEKOXWSIMFDGMA-UHFFFAOYSA-N 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- PTFJIKYUEPWBMS-UHFFFAOYSA-N Ethalfluralin Chemical compound CC(=C)CN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O PTFJIKYUEPWBMS-UHFFFAOYSA-N 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000005070 sampling Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 3
- SMDHCQAYESWHAE-UHFFFAOYSA-N benfluralin Chemical compound CCCCN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O SMDHCQAYESWHAE-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 101100139861 Arabidopsis thaliana RL2 gene Proteins 0.000 description 1
- SPNQRCTZKIBOAX-UHFFFAOYSA-N Butralin Chemical compound CCC(C)NC1=C([N+]([O-])=O)C=C(C(C)(C)C)C=C1[N+]([O-])=O SPNQRCTZKIBOAX-UHFFFAOYSA-N 0.000 description 1
- 101100352919 Caenorhabditis elegans ppm-2 gene Proteins 0.000 description 1
- MNFMIVVPXOGUMX-UHFFFAOYSA-N Fluchloralin Chemical compound CCCN(CCCl)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O MNFMIVVPXOGUMX-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- AWJGUZSYVIVZGP-YUMQZZPRSA-N Pro-Val Chemical compound CC(C)[C@@H](C(O)=O)NC(=O)[C@@H]1CCCN1 AWJGUZSYVIVZGP-YUMQZZPRSA-N 0.000 description 1
- ITVQAKZNYJEWKS-UHFFFAOYSA-N Profluralin Chemical compound [O-][N+](=O)C=1C=C(C(F)(F)F)C=C([N+]([O-])=O)C=1N(CCC)CC1CC1 ITVQAKZNYJEWKS-UHFFFAOYSA-N 0.000 description 1
- 101100141529 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) RKM4 gene Proteins 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- -1 amine nitrates Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- DVARTQFDIMZBAA-UHFFFAOYSA-O ammonium nitrate Chemical compound [NH4+].[O-][N+]([O-])=O DVARTQFDIMZBAA-UHFFFAOYSA-O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- QABCGOSYZHCPGN-UHFFFAOYSA-N chloro(dimethyl)silicon Chemical compound C[Si](C)Cl QABCGOSYZHCPGN-UHFFFAOYSA-N 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical class [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- GPRXZXFZTAPMDJ-UHFFFAOYSA-N n-propyl-4-(trifluoromethyl)aniline Chemical compound CCCNC1=CC=C(C(F)(F)F)C=C1 GPRXZXFZTAPMDJ-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 108010053725 prolylvaline Proteins 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 239000012521 purified sample Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/82—Purification; Separation; Stabilisation; Use of additives
- C07C209/84—Purification
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/52—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/10—One of the condensed rings being a six-membered aromatic ring the other ring being six-membered, e.g. tetraline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US83026177A | 1977-09-02 | 1977-09-02 | |
| US05/878,843 US4185035A (en) | 1977-09-02 | 1978-02-17 | Dinitroaniline purification with inorganic acid halides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS223824B2 true CS223824B2 (en) | 1983-11-25 |
Family
ID=27125331
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS785688A CS223824B2 (en) | 1977-09-02 | 1978-09-01 | Method of decreasing the concentration of nitroamine in dinitroanilines |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4185035A (ro) |
| JP (1) | JPS5822103B2 (ro) |
| AR (1) | AR221221A1 (ro) |
| AU (1) | AU517691B2 (ro) |
| BG (1) | BG34333A3 (ro) |
| BR (1) | BR7805718A (ro) |
| CA (1) | CA1062729A (ro) |
| CS (1) | CS223824B2 (ro) |
| DD (1) | DD138545A5 (ro) |
| DE (1) | DE2837529C2 (ro) |
| DK (1) | DK152117C (ro) |
| ES (1) | ES473012A1 (ro) |
| FR (1) | FR2401904A1 (ro) |
| GB (1) | GB2008092B (ro) |
| HU (1) | HU179968B (ro) |
| IE (1) | IE47323B1 (ro) |
| IL (1) | IL55448A (ro) |
| IT (1) | IT1098806B (ro) |
| MX (1) | MX5334E (ro) |
| NL (1) | NL187350C (ro) |
| PL (1) | PL122762B1 (ro) |
| RO (1) | RO75820A (ro) |
| SU (1) | SU833156A3 (ro) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2918023A1 (de) * | 1979-05-04 | 1980-11-13 | Bayer Ag | Verfahren zur herstellung von n-alkylierten aromatischen aminen |
| DE2926947C2 (de) * | 1979-07-04 | 1982-03-18 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Entfernung von Nitrosierungsmittel (n) aus nitrierten aromatischen Verbindungen |
| US4391992A (en) * | 1979-08-24 | 1983-07-05 | American Cyanamid Company | N-Denitration of N,2,6-trinitroanilines with phase transfer catalysts |
| EP0024503B1 (en) * | 1979-08-24 | 1983-06-15 | American Cyanamid Company | N-denitration of n,2,6-trinitroanilines with phase transfer catalysts |
| IT1131182B (it) * | 1980-05-15 | 1986-06-18 | Montedison Spa | Processo di preparazione di n-di-n-propil-2,6-dinitro-4-trifluorometilanilina a basso contenuto di nitrosammine |
| IL67948A (en) * | 1983-02-18 | 1988-05-31 | Agan Chemical Manufacturers | Method for removal of nitrosoamine impurities from herbicides |
| DE3345157A1 (de) * | 1983-12-14 | 1985-06-27 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von nitrosaminfreien n,n-disubstituierten nitroaromatischen aminen und deren stabilisierung gegen nitrosaminbildung |
| IT1190440B (it) * | 1985-12-18 | 1988-02-16 | Finchimica Spa | Procedimento migliorato per la purificazione della trifluralina |
| US4876388A (en) * | 1986-07-31 | 1989-10-24 | IΠCI. S.p.A. | Method for the purification of trifuraline |
| IT1195822B (it) * | 1986-08-12 | 1988-10-27 | I Pi Ci Spa | Procedimento per la purificazione della trifluralina |
| EP0322494B1 (en) * | 1987-12-29 | 1993-04-07 | FINCHIMICA S.p.A. | A method for the treatment of dinitroanilines to reduce their nitrosamine content and/or to stabilise them against the formation of nitrosamines |
| AU594850B2 (en) * | 1987-12-29 | 1990-03-15 | Finchimica S.P.A. | A method for the treatment of dinitroanilines to reduce their nitrosamine content and/or to stabilise them against the formation of nitrosamines |
| US5461027A (en) * | 1989-01-24 | 1995-10-24 | Griffin Corporation | Microencapsulated pendimethalin and method of making and using same |
| US5510534A (en) * | 1995-01-04 | 1996-04-23 | Atanor S.A. | Process for reducing the nitrosamine content of herbicides |
| US5728881A (en) * | 1997-03-05 | 1998-03-17 | Srm Chemical, Ltd. Co. | Process for preparing trifluralin |
| US5922915A (en) * | 1998-05-11 | 1999-07-13 | Srm Chemical, Ltd., Co. | Process for removing N-nitroso compounds from organo-amine compositions including dinitroaniline herbicides |
| CN102766056B (zh) * | 2012-08-13 | 2014-07-02 | 江西盾牌化工有限责任公司 | 一种化学除草剂仲丁灵原药含量达90±1%的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE482795C (de) * | 1927-02-06 | 1929-09-20 | Chem Fab Gruenau Landshoff & M | Verfahren zur Darstellung von sekundaeren Aminen aus den entsprechenden N-Nitrosoderivaten und deren Kernsubstitutionsprodukten |
| DE2035796A1 (de) * | 1970-07-18 | 1972-01-27 | Bayer Ag | Verfahren zum Austausch von N Nitroso |
-
1978
- 1978-02-17 US US05/878,843 patent/US4185035A/en not_active Expired - Lifetime
- 1978-08-28 AR AR273464A patent/AR221221A1/es active
- 1978-08-28 PL PL1978209254A patent/PL122762B1/pl unknown
- 1978-08-28 DE DE2837529A patent/DE2837529C2/de not_active Expired
- 1978-08-29 IL IL55448A patent/IL55448A/xx unknown
- 1978-08-29 CA CA310,233A patent/CA1062729A/en not_active Expired
- 1978-08-29 RO RO7895059A patent/RO75820A/ro unknown
- 1978-08-30 FR FR7825019A patent/FR2401904A1/fr active Granted
- 1978-08-30 MX MX787363U patent/MX5334E/es unknown
- 1978-08-30 NL NLAANVRAGE7808900,A patent/NL187350C/xx not_active IP Right Cessation
- 1978-08-31 SU SU782654652A patent/SU833156A3/ru active
- 1978-08-31 IT IT27228/78A patent/IT1098806B/it active
- 1978-08-31 AU AU39452/78A patent/AU517691B2/en not_active Expired
- 1978-08-31 ES ES473012A patent/ES473012A1/es not_active Expired
- 1978-09-01 HU HU78EI808A patent/HU179968B/hu not_active IP Right Cessation
- 1978-09-01 CS CS785688A patent/CS223824B2/cs unknown
- 1978-09-01 DK DK388278A patent/DK152117C/da not_active IP Right Cessation
- 1978-09-01 BR BR7805718A patent/BR7805718A/pt unknown
- 1978-09-01 BG BG040794A patent/BG34333A3/xx unknown
- 1978-09-01 DD DD78207612A patent/DD138545A5/xx unknown
- 1978-09-01 GB GB7835329A patent/GB2008092B/en not_active Expired
- 1978-09-01 IE IE1764/78A patent/IE47323B1/en not_active IP Right Cessation
- 1978-09-02 JP JP53108035A patent/JPS5822103B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT1098806B (it) | 1985-09-18 |
| IE47323B1 (en) | 1984-02-22 |
| NL187350C (nl) | 1991-09-02 |
| GB2008092B (en) | 1982-03-24 |
| PL122762B1 (en) | 1982-08-31 |
| DK152117B (da) | 1988-02-01 |
| BG34333A3 (en) | 1983-08-15 |
| RO75820A (ro) | 1981-03-30 |
| AR221221A1 (es) | 1981-01-15 |
| MX5334E (es) | 1983-06-24 |
| DK388278A (da) | 1979-03-03 |
| DD138545A5 (de) | 1979-11-07 |
| CA1062729A (en) | 1979-09-18 |
| JPS5448725A (en) | 1979-04-17 |
| IL55448A (en) | 1981-06-29 |
| NL7808900A (nl) | 1979-03-06 |
| PL209254A1 (pl) | 1979-05-07 |
| US4185035A (en) | 1980-01-22 |
| BR7805718A (pt) | 1979-04-17 |
| IT7827228A0 (it) | 1978-08-31 |
| GB2008092A (en) | 1979-05-31 |
| JPS5822103B2 (ja) | 1983-05-06 |
| AU517691B2 (en) | 1981-08-20 |
| ES473012A1 (es) | 1979-10-16 |
| DE2837529C2 (de) | 1983-05-11 |
| IE781764L (en) | 1979-03-02 |
| DK152117C (da) | 1988-06-20 |
| IL55448A0 (en) | 1978-10-31 |
| FR2401904B1 (ro) | 1980-10-31 |
| AU3945278A (en) | 1980-03-06 |
| DE2837529A1 (de) | 1979-03-08 |
| SU833156A3 (ru) | 1981-05-23 |
| HU179968B (en) | 1983-01-28 |
| NL187350B (nl) | 1991-04-02 |
| FR2401904A1 (fr) | 1979-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS223824B2 (en) | Method of decreasing the concentration of nitroamine in dinitroanilines | |
| KR950009750B1 (ko) | 5-클로로메틸피리딘의 제조방법 | |
| NO163661B (no) | Biocid eller biostatisk middel som inneholder 3-isotiazoloner, samt anvendelse av og fremgangsmaate til fremstillingav midlet. | |
| Mann et al. | 853. The cyanoethylation of aryl phosphines | |
| EP2389367B1 (en) | Preparation of a lead-free primary explosive | |
| IE86076B1 (en) | A method for producing sucralose-6-acylate | |
| Arceneaux et al. | N-Methyl Amides of Phosphorus (V) Acids2 | |
| CS205143B2 (en) | Process for preparing thiocarbamates | |
| US4638090A (en) | Processes for the preparation of nitrosamine-free N,N-disubstituted nitroaromatic amines and for the stabilization of these compounds against the formation of nitrosamines | |
| CS208793B2 (en) | Method of making the very pure derivatives of the pyraz | |
| Albert et al. | 245. Acridine syntheses and reactions. Part V. A new dehalogenation of 5-chloroacridine and its derivatives | |
| Baer et al. | PHOSPHONOLIPIDS: VIII. SYNTHESIS OF PHOSPHONIC ACID ANALOGUES OF DIETHER l-α-LECITHINS | |
| JP2021080214A (ja) | ビオチンの製造方法 | |
| JP5778397B2 (ja) | スルホニル化法およびパーハロゲン化スルファニリドの合成に有用な試薬 | |
| Gough et al. | CCCXXIII.—Trypanocidal action and chemical constitution. Part VIII. Derivatives of β-amino-ethyl-and γ-aminopropyl-arsinic acids | |
| Farrar | 611. Arylamides of halogenated methane-and ethane-sulphonic acids | |
| Sisler et al. | Amination of tertiary amines by hydroxylamine-O-sulfonic acid | |
| Lyashchuk et al. | Sulfene mechanism in the pyridine-catalysed reactions of alkanesulfonyl halides with phenols | |
| CS203936B2 (en) | Process for preparing thiocarbamates | |
| Burawoy et al. | 237. The organic compounds of gold. Part V. Cyano-compounds. Preliminary experiments on the production of alkyl radicals | |
| US20100179311A1 (en) | Reactions of group 16 elements | |
| Di Gregorio et al. | Mono-and polyanhydride formation by reaction of 2, 2, 4, 4, 6, 6-hexachlorotriazatriphosphorine with carboxylic acid salts under mild conditions | |
| US4229383A (en) | Process for the preparation of phosphoramidates | |
| Dixon | XL.—Certain organic phosphorus compounds | |
| Sandel et al. | 2, 3, 4, 5-Tetraphenyliodolium ion and an isomer |