IT7827228A0 - Procedimento per ridurre il contenuto di nitrosammine nelle dinitroaniline. - Google Patents
Procedimento per ridurre il contenuto di nitrosammine nelle dinitroaniline.Info
- Publication number
- IT7827228A0 IT7827228A0 IT7827228A IT2722878A IT7827228A0 IT 7827228 A0 IT7827228 A0 IT 7827228A0 IT 7827228 A IT7827228 A IT 7827228A IT 2722878 A IT2722878 A IT 2722878A IT 7827228 A0 IT7827228 A0 IT 7827228A0
- Authority
- IT
- Italy
- Prior art keywords
- dinitroanilines
- procedure
- reducing
- nitrosamine content
- nitrosamine
- Prior art date
Links
- CGNBQYFXGQHUQP-UHFFFAOYSA-N 2,3-dinitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O CGNBQYFXGQHUQP-UHFFFAOYSA-N 0.000 title 1
- XKLJHFLUAHKGGU-UHFFFAOYSA-N nitrous amide Chemical compound ON=N XKLJHFLUAHKGGU-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/82—Purification; Separation; Stabilisation; Use of additives
- C07C209/84—Purification
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/52—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/10—One of the condensed rings being a six-membered aromatic ring the other ring being six-membered, e.g. tetraline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US83026177A | 1977-09-02 | 1977-09-02 | |
| US05/878,843 US4185035A (en) | 1977-09-02 | 1978-02-17 | Dinitroaniline purification with inorganic acid halides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IT7827228A0 true IT7827228A0 (it) | 1978-08-31 |
| IT1098806B IT1098806B (it) | 1985-09-18 |
Family
ID=27125331
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IT27228/78A IT1098806B (it) | 1977-09-02 | 1978-08-31 | Procedimento per ridurre il contenuto di nitrosammine nelle dinitroaniline |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4185035A (it) |
| JP (1) | JPS5822103B2 (it) |
| AR (1) | AR221221A1 (it) |
| AU (1) | AU517691B2 (it) |
| BG (1) | BG34333A3 (it) |
| BR (1) | BR7805718A (it) |
| CA (1) | CA1062729A (it) |
| CS (1) | CS223824B2 (it) |
| DD (1) | DD138545A5 (it) |
| DE (1) | DE2837529C2 (it) |
| DK (1) | DK152117C (it) |
| ES (1) | ES473012A1 (it) |
| FR (1) | FR2401904A1 (it) |
| GB (1) | GB2008092B (it) |
| HU (1) | HU179968B (it) |
| IE (1) | IE47323B1 (it) |
| IL (1) | IL55448A (it) |
| IT (1) | IT1098806B (it) |
| MX (1) | MX5334E (it) |
| NL (1) | NL187350C (it) |
| PL (1) | PL122762B1 (it) |
| RO (1) | RO75820A (it) |
| SU (1) | SU833156A3 (it) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2918023A1 (de) * | 1979-05-04 | 1980-11-13 | Bayer Ag | Verfahren zur herstellung von n-alkylierten aromatischen aminen |
| DE2926947C2 (de) * | 1979-07-04 | 1982-03-18 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Entfernung von Nitrosierungsmittel (n) aus nitrierten aromatischen Verbindungen |
| US4391992A (en) * | 1979-08-24 | 1983-07-05 | American Cyanamid Company | N-Denitration of N,2,6-trinitroanilines with phase transfer catalysts |
| EP0024503B1 (en) * | 1979-08-24 | 1983-06-15 | American Cyanamid Company | N-denitration of n,2,6-trinitroanilines with phase transfer catalysts |
| IT1131182B (it) * | 1980-05-15 | 1986-06-18 | Montedison Spa | Processo di preparazione di n-di-n-propil-2,6-dinitro-4-trifluorometilanilina a basso contenuto di nitrosammine |
| IL67948A (en) * | 1983-02-18 | 1988-05-31 | Agan Chemical Manufacturers | Method for removal of nitrosoamine impurities from herbicides |
| DE3345157A1 (de) * | 1983-12-14 | 1985-06-27 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von nitrosaminfreien n,n-disubstituierten nitroaromatischen aminen und deren stabilisierung gegen nitrosaminbildung |
| IT1190440B (it) * | 1985-12-18 | 1988-02-16 | Finchimica Spa | Procedimento migliorato per la purificazione della trifluralina |
| US4876388A (en) * | 1986-07-31 | 1989-10-24 | IΠCI. S.p.A. | Method for the purification of trifuraline |
| IT1195822B (it) * | 1986-08-12 | 1988-10-27 | I Pi Ci Spa | Procedimento per la purificazione della trifluralina |
| AU594850B2 (en) * | 1987-12-29 | 1990-03-15 | Finchimica S.P.A. | A method for the treatment of dinitroanilines to reduce their nitrosamine content and/or to stabilise them against the formation of nitrosamines |
| EP0322494B1 (en) * | 1987-12-29 | 1993-04-07 | FINCHIMICA S.p.A. | A method for the treatment of dinitroanilines to reduce their nitrosamine content and/or to stabilise them against the formation of nitrosamines |
| US5461027A (en) * | 1989-01-24 | 1995-10-24 | Griffin Corporation | Microencapsulated pendimethalin and method of making and using same |
| US5510534A (en) * | 1995-01-04 | 1996-04-23 | Atanor S.A. | Process for reducing the nitrosamine content of herbicides |
| US5728881A (en) * | 1997-03-05 | 1998-03-17 | Srm Chemical, Ltd. Co. | Process for preparing trifluralin |
| US5922915A (en) * | 1998-05-11 | 1999-07-13 | Srm Chemical, Ltd., Co. | Process for removing N-nitroso compounds from organo-amine compositions including dinitroaniline herbicides |
| CN102766056B (zh) * | 2012-08-13 | 2014-07-02 | 江西盾牌化工有限责任公司 | 一种化学除草剂仲丁灵原药含量达90±1%的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE482795C (de) * | 1927-02-06 | 1929-09-20 | Chem Fab Gruenau Landshoff & M | Verfahren zur Darstellung von sekundaeren Aminen aus den entsprechenden N-Nitrosoderivaten und deren Kernsubstitutionsprodukten |
| DE2035796A1 (de) * | 1970-07-18 | 1972-01-27 | Bayer Ag | Verfahren zum Austausch von N Nitroso |
-
1978
- 1978-02-17 US US05/878,843 patent/US4185035A/en not_active Expired - Lifetime
- 1978-08-28 PL PL1978209254A patent/PL122762B1/pl unknown
- 1978-08-28 AR AR273464A patent/AR221221A1/es active
- 1978-08-28 DE DE2837529A patent/DE2837529C2/de not_active Expired
- 1978-08-29 CA CA310,233A patent/CA1062729A/en not_active Expired
- 1978-08-29 IL IL55448A patent/IL55448A/xx unknown
- 1978-08-29 RO RO7895059A patent/RO75820A/ro unknown
- 1978-08-30 MX MX787363U patent/MX5334E/es unknown
- 1978-08-30 FR FR7825019A patent/FR2401904A1/fr active Granted
- 1978-08-30 NL NLAANVRAGE7808900,A patent/NL187350C/xx not_active IP Right Cessation
- 1978-08-31 ES ES473012A patent/ES473012A1/es not_active Expired
- 1978-08-31 SU SU782654652A patent/SU833156A3/ru active
- 1978-08-31 IT IT27228/78A patent/IT1098806B/it active
- 1978-08-31 AU AU39452/78A patent/AU517691B2/en not_active Expired
- 1978-09-01 DK DK388278A patent/DK152117C/da not_active IP Right Cessation
- 1978-09-01 BG BG7840794A patent/BG34333A3/xx not_active Expired
- 1978-09-01 GB GB7835329A patent/GB2008092B/en not_active Expired
- 1978-09-01 BR BR7805718A patent/BR7805718A/pt unknown
- 1978-09-01 IE IE1764/78A patent/IE47323B1/en not_active IP Right Cessation
- 1978-09-01 HU HU78EI808A patent/HU179968B/hu not_active IP Right Cessation
- 1978-09-01 CS CS785688A patent/CS223824B2/cs unknown
- 1978-09-01 DD DD78207612A patent/DD138545A5/xx unknown
- 1978-09-02 JP JP53108035A patent/JPS5822103B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BG34333A3 (en) | 1983-08-15 |
| NL187350B (nl) | 1991-04-02 |
| GB2008092B (en) | 1982-03-24 |
| AU517691B2 (en) | 1981-08-20 |
| ES473012A1 (es) | 1979-10-16 |
| IL55448A (en) | 1981-06-29 |
| GB2008092A (en) | 1979-05-31 |
| IE781764L (en) | 1979-03-02 |
| BR7805718A (pt) | 1979-04-17 |
| DE2837529C2 (de) | 1983-05-11 |
| MX5334E (es) | 1983-06-24 |
| AR221221A1 (es) | 1981-01-15 |
| DK152117C (da) | 1988-06-20 |
| DK152117B (da) | 1988-02-01 |
| DD138545A5 (de) | 1979-11-07 |
| SU833156A3 (ru) | 1981-05-23 |
| HU179968B (en) | 1983-01-28 |
| DK388278A (da) | 1979-03-03 |
| NL187350C (nl) | 1991-09-02 |
| FR2401904A1 (fr) | 1979-03-30 |
| IL55448A0 (en) | 1978-10-31 |
| PL209254A1 (pl) | 1979-05-07 |
| FR2401904B1 (it) | 1980-10-31 |
| AU3945278A (en) | 1980-03-06 |
| JPS5448725A (en) | 1979-04-17 |
| CS223824B2 (en) | 1983-11-25 |
| RO75820A (ro) | 1981-03-30 |
| NL7808900A (nl) | 1979-03-06 |
| IT1098806B (it) | 1985-09-18 |
| JPS5822103B2 (ja) | 1983-05-06 |
| US4185035A (en) | 1980-01-22 |
| PL122762B1 (en) | 1982-08-31 |
| IE47323B1 (en) | 1984-02-22 |
| DE2837529A1 (de) | 1979-03-08 |
| CA1062729A (en) | 1979-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT1105412B (it) | Procedimento per preparare 1,2 poli butadiene | |
| IT7827228A0 (it) | Procedimento per ridurre il contenuto di nitrosammine nelle dinitroaniline. | |
| NO801060L (no) | Elektrolyseapparat. | |
| AR220892A1 (es) | Procedimiento para preparar(piridazinil-3)-5-ditiol-1,2 tiona-3 | |
| IT8020508A0 (it) | 24,24-difluoro-1alfa,25-diidrossicolecalciferolo. | |
| ES505456A0 (es) | Procedimiento para preparar 1-azabiciclo(3.3.0)octano-2,8- diona | |
| DK425183D0 (da) | 3-hydroxy-24, 24-difluor-25-hydroxycholestand-5,7-dien | |
| IT7823209A0 (it) | Valvola, in particolare per apparecchi igienico-sanitari. | |
| NO800690L (no) | Elektrolyseapparat. | |
| DK152113C (da) | Fremgangsmaade til formindskelse af nitrosaminindholdet i dinitroaniliner | |
| ES508729A0 (es) | Procedimiento para preparar amidas. | |
| DK152116C (da) | Fremgangsmaade til formindskelse af nitrosaminindholdet i dinitroaniliner | |
| IT8020039A0 (it) | Griglia in fusione, specialemnte per porcilaie. | |
| IT1117958B (it) | Procedimento per preparare 2,6-diterz.butilfenolo | |
| IT1196913B (it) | 6,7 secoergoline | |
| IT8222063A0 (it) | Dispositivo polverizzatore, in particolare per il trattamento di piante. | |
| IT8019697A0 (it) | Apparecchio per tagliare pellicce. | |
| DK244580A (da) | Glycolaldehyd-n,o-acetaler fremstilling deraf og anvendelse deraf som fungicider | |
| IT7923375A0 (it) | Struttura di miscelatore perfezionato, in particolare per apparecchi igienico-sanitari esimili. | |
| ES236243Y (es) | Bloque para asientos perfeccionado. | |
| ES241063Y (es) | Armazon perfeccionado, para coches-silla | |
| IT1099496B (it) | Procedimento per preparare 2. 6-metano, 2h-benzossicine | |
| ES245413Y (es) | Expositor filatelico,perfeccionado | |
| ES238486Y (es) | Estructura eliptica para invernaderos. | |
| ES238741Y (es) | Sujetador perfeccionado para el cabello. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| TA | Fee payment date (situation as of event date), data collected since 19931001 |
Effective date: 19960616 |