CS221287B2 - Herbicide means - Google Patents
Herbicide means Download PDFInfo
- Publication number
- CS221287B2 CS221287B2 CS811548A CS154881A CS221287B2 CS 221287 B2 CS221287 B2 CS 221287B2 CS 811548 A CS811548 A CS 811548A CS 154881 A CS154881 A CS 154881A CS 221287 B2 CS221287 B2 CS 221287B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- salts
- inorganic
- formula
- hydrogen
- alkyl
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 24
- 239000004009 herbicide Substances 0.000 title description 22
- IAJOBQBIJHVGMQ-BYPYZUCNSA-N glufosinate-P Chemical compound CP(O)(=O)CC[C@H](N)C(O)=O IAJOBQBIJHVGMQ-BYPYZUCNSA-N 0.000 claims abstract description 25
- 150000001875 compounds Chemical class 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 19
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 claims description 17
- 229910052921 ammonium sulfate Inorganic materials 0.000 claims description 16
- 235000011130 ammonium sulphate Nutrition 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 15
- 150000003863 ammonium salts Chemical class 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 239000004480 active ingredient Substances 0.000 claims description 8
- 239000002585 base Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- -1 hydroxyethyl group Chemical group 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 229920000388 Polyphosphate Polymers 0.000 claims description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 239000004202 carbamide Substances 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 239000001205 polyphosphate Substances 0.000 claims description 3
- 235000011176 polyphosphates Nutrition 0.000 claims description 3
- IVWWFWFVSWOTLP-YVZVNANGSA-N (3'as,4r,7'as)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3ah-[1,3]dioxolo[4,5-c]pyran]-7'-one Chemical compound C([C@@H]1OC(O[C@@H]1C1=O)(C)C)O[C@]21COC(C)(C)O2 IVWWFWFVSWOTLP-YVZVNANGSA-N 0.000 claims description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 claims description 2
- 150000001450 anions Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- GINJFDRNADDBIN-FXQIFTODSA-N bilanafos Chemical compound OC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](N)CCP(C)(O)=O GINJFDRNADDBIN-FXQIFTODSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 150000007519 polyprotic acids Polymers 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 3
- 150000002431 hydrogen Chemical class 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- IAJOBQBIJHVGMQ-UHFFFAOYSA-N Phosphinothricin Natural products CP(O)(=O)CCC(N)C(O)=O IAJOBQBIJHVGMQ-UHFFFAOYSA-N 0.000 abstract description 24
- 102000015636 Oligopeptides Human genes 0.000 abstract 1
- 108010038807 Oligopeptides Proteins 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 40
- 239000013543 active substance Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000001166 ammonium sulphate Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 241000209082 Lolium Species 0.000 description 5
- 241000743985 Alopecurus Species 0.000 description 4
- 241000192043 Echinochloa Species 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 241000209764 Avena fatua Species 0.000 description 3
- 235000007319 Avena orientalis Nutrition 0.000 description 3
- 206010011878 Deafness Diseases 0.000 description 3
- 244000060234 Gmelina philippensis Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000000885 phytotoxic effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 230000002195 synergetic effect Effects 0.000 description 3
- UPCXAARSWVHVLY-UHFFFAOYSA-N tris(2-hydroxyethyl)azanium;acetate Chemical compound CC(O)=O.OCCN(CCO)CCO UPCXAARSWVHVLY-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 241000209136 Agropyron Species 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 241000209761 Avena Species 0.000 description 2
- 241000339490 Brachyachne Species 0.000 description 2
- 241000234653 Cyperus Species 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000021307 Triticum Nutrition 0.000 description 2
- 244000098338 Triticum aestivum Species 0.000 description 2
- 229960003767 alanine Drugs 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 230000008654 plant damage Effects 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- CMJUNAQINNWKAU-KTKRTIGZSA-N 2-[[(z)-2-oxononadec-10-enyl]amino]ethanesulfonic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)CNCCS(O)(=O)=O CMJUNAQINNWKAU-KTKRTIGZSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 241001621841 Alopecurus myosuroides Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 101001053395 Arabidopsis thaliana Acid beta-fructofuranosidase 4, vacuolar Proteins 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 235000005881 Calendula officinalis Nutrition 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- 241000234646 Cyperaceae Species 0.000 description 1
- 235000005853 Cyperus esculentus Nutrition 0.000 description 1
- 244000075634 Cyperus rotundus Species 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 241000380130 Ehrharta erecta Species 0.000 description 1
- 244000025672 Elymus canadensis Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- DEFJQIDDEAULHB-IMJSIDKUSA-N L-alanyl-L-alanine Chemical compound C[C@H](N)C(=O)N[C@@H](C)C(O)=O DEFJQIDDEAULHB-IMJSIDKUSA-N 0.000 description 1
- DEFJQIDDEAULHB-UHFFFAOYSA-N N-D-alanyl-D-alanine Natural products CC(N)C(=O)NC(C)C(O)=O DEFJQIDDEAULHB-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 240000000785 Tagetes erecta Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 108010056243 alanylalanine Proteins 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- HTHKZOCCOVYKKI-UHFFFAOYSA-N dinaphthalen-1-ylmethanedisulfonic acid;sodium Chemical compound [Na].C1=CC=C2C(C(C=3C4=CC=CC=C4C=CC=3)(S(=O)(=O)O)S(O)(=O)=O)=CC=CC2=C1 HTHKZOCCOVYKKI-UHFFFAOYSA-N 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000002389 environmental scanning electron microscopy Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000012747 synergistic agent Substances 0.000 description 1
- 239000011885 synergistic combination Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- JREYOWJEWZVAOR-UHFFFAOYSA-N triazanium;[3-methylbut-3-enoxy(oxido)phosphoryl] phosphate Chemical compound [NH4+].[NH4+].[NH4+].CC(=C)CCOP([O-])(=O)OP([O-])([O-])=O JREYOWJEWZVAOR-UHFFFAOYSA-N 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N57/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds
- A01N57/18—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-carbon bonds
- A01N57/20—Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds having phosphorus-to-carbon bonds containing acyclic or cycloaliphatic radicals
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803008186 DE3008186A1 (de) | 1980-03-04 | 1980-03-04 | Synergistische kombinationen von phosphinothricin |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS221287B2 true CS221287B2 (en) | 1983-04-29 |
Family
ID=6096186
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS811548A CS221287B2 (en) | 1980-03-04 | 1981-03-04 | Herbicide means |
Country Status (20)
| Country | Link |
|---|---|
| EP (1) | EP0036106B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPS56135409A (cg-RX-API-DMAC7.html) |
| AU (1) | AU539256B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR8101233A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1162071A (cg-RX-API-DMAC7.html) |
| CS (1) | CS221287B2 (cg-RX-API-DMAC7.html) |
| DD (1) | DD156892A5 (cg-RX-API-DMAC7.html) |
| DE (2) | DE3008186A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK95981A (cg-RX-API-DMAC7.html) |
| ES (1) | ES499839A0 (cg-RX-API-DMAC7.html) |
| GR (1) | GR74156B (cg-RX-API-DMAC7.html) |
| HU (1) | HU186384B (cg-RX-API-DMAC7.html) |
| IL (1) | IL62241A0 (cg-RX-API-DMAC7.html) |
| MA (1) | MA19085A1 (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ196380A (cg-RX-API-DMAC7.html) |
| OA (1) | OA06759A (cg-RX-API-DMAC7.html) |
| PH (1) | PH19742A (cg-RX-API-DMAC7.html) |
| PL (1) | PL229976A1 (cg-RX-API-DMAC7.html) |
| PT (1) | PT72607B (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA811397B (cg-RX-API-DMAC7.html) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58110510A (ja) * | 1981-12-24 | 1983-07-01 | Meiji Seika Kaisha Ltd | 除草剤組成物 |
| BR8600462A (pt) * | 1986-02-04 | 1987-09-01 | Monsanto Brasil | Formulacao herbicida |
| US5491125A (en) * | 1988-03-18 | 1996-02-13 | Hoechst Aktiengesellschaft | Liquid herbicidal formulations of glufosinate |
| DE3902884A1 (de) * | 1989-02-01 | 1990-08-02 | Riedel De Haen Ag | Fluessige algizid wirkende zubereitung |
| US5364832A (en) * | 1990-08-10 | 1994-11-15 | Hoechst Aktiengesellschaft | Water-dispersible granules comprising fenoxaprop-ethyl and/or fenchlorazole |
| DE3926800A1 (de) * | 1989-08-14 | 1991-02-21 | Hoechst Ag | Wasserdispergierbare granulate zur anwendung im pflanzenschutz |
| AU4479193A (en) * | 1992-08-24 | 1994-03-03 | Monsanto Company | Herbicidal compositions |
| DE69429336T2 (de) * | 1993-02-26 | 2002-08-22 | Zeon Corp., Tokio | Zusammensetzung von Pflanzenwachstums-Beschleuniger |
| WO1995017817A1 (en) * | 1993-12-28 | 1995-07-06 | Kao Corporation | Enhancer composition for agricultural chemicals and agricultural chemical composition |
| US5622911A (en) * | 1994-02-14 | 1997-04-22 | Kao Corporation | Method for enhancing the efficacy of agricultural chemical with alkoxylated fatty acid amides |
| ES2170147T3 (es) * | 1994-06-02 | 2002-08-01 | Kao Corp | Metodo para mejorar la eficacia de los productos quimicos agricolas. |
| US5849663A (en) * | 1994-06-02 | 1998-12-15 | Kao Corporation | Enhancer for agricultural chemicals, enhancer composition for agricultural chemicals and method for enhancing the efficacy of agricultural chemical |
| CA2279383A1 (en) | 1997-01-31 | 1998-08-06 | Monsanto Company | Composition and method for treating plants with exogenous chemicals |
| GB0328529D0 (en) * | 2003-12-09 | 2004-01-14 | Syngenta Ltd | Agrochemical composition |
| US20070082819A1 (en) * | 2003-12-09 | 2007-04-12 | Perry Richard B | Agrochemical compositions |
| DE102005059471A1 (de) | 2005-12-13 | 2007-07-12 | Bayer Cropscience Ag | Herbizide Zusammensetzungen mit verbesserter Wirkung |
| DE102005059469A1 (de) | 2005-12-13 | 2007-06-14 | Bayer Cropscience Ag | Insektizide Zusammensetzungen mit verbesserter Wirkung |
| DE102005059891A1 (de) | 2005-12-15 | 2007-06-28 | Bayer Cropscience Ag | 3'-Alkoxy-spirocyclopentyl substituierte Tetram- und Tetronsäuren |
| DE102006007882A1 (de) | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| DE102006018828A1 (de) | 2006-04-22 | 2007-10-25 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| DE102006025874A1 (de) | 2006-06-02 | 2007-12-06 | Bayer Cropscience Ag | Alkoxyalkyl-substituierte cyclische Ketoenole |
| DE102006050148A1 (de) | 2006-10-25 | 2008-04-30 | Bayer Cropscience Ag | Trifluormethoxy-phenylsubstituierte Tetramsäure-Derivate |
| DE102006057037A1 (de) | 2006-12-04 | 2008-06-05 | Bayer Cropscience Ag | cis-Alkoxyspirocyclische biphenylsubstituierte Tetramsäure-Derivate |
| DE102006057036A1 (de) | 2006-12-04 | 2008-06-05 | Bayer Cropscience Ag | Biphenylsubstituierte spirocyclische Ketoenole |
| DE102007024575A1 (de) | 2007-05-25 | 2008-11-27 | Bayer Cropscience Ag | Insektizide Zusammensetzungen von 2-Cyanobenzolsulfonamidverbindungen und ihrer isomeren Formen mit verbesserter Wirkung |
| EP2020413A1 (de) | 2007-08-02 | 2009-02-04 | Bayer CropScience AG | Oxaspirocyclische-spiro-substituierte Tetram- und Tetronsäure-Derivate |
| EP2045240A1 (de) | 2007-09-25 | 2009-04-08 | Bayer CropScience AG | Halogenalkoxyspirocyclische Tetram- und Tetronsäure-Derivate |
| EP2092824A1 (de) | 2008-02-25 | 2009-08-26 | Bayer CropScience AG | Heterocyclyl-Pyrimidine |
| EP2103615A1 (de) | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
| EP2123159A1 (de) | 2008-05-21 | 2009-11-25 | Bayer CropScience AG | (1,2-Benzisothiazol-3-yl)(thio)carbamate und (1,2-Benzisothiazol-3-yl)(thio)oxamate und deren Oxidationsformen als Pestizide |
| US8367873B2 (en) | 2008-10-10 | 2013-02-05 | Bayer Cropscience Ag | Phenyl-substituted bicyclooctane-1,3-dione derivatives |
| US8389443B2 (en) | 2008-12-02 | 2013-03-05 | Bayer Cropscience Ag | Geminal alkoxy/alkylspirocyclic substituted tetramate derivatives |
| US8846946B2 (en) | 2008-12-02 | 2014-09-30 | Bayer Cropscience Ag | Germinal alkoxy/alkylspirocyclic substituted tetramate derivatives |
| EP2196461A1 (de) | 2008-12-15 | 2010-06-16 | Bayer CropScience AG | 4-Amino-1,2,3-benzoxathiazin-Derivate als Pestizide |
| PL2484676T3 (pl) | 2008-12-18 | 2015-06-30 | Bayer Cropscience Ag | Podstawione tetrazolem amidy kwasu antranilowego jako pestycydy |
| EP2223598A1 (de) | 2009-02-23 | 2010-09-01 | Bayer CropScience AG | Insektizide Zusammensetzungen mit verbesserter Wirkung |
| KR101703633B1 (ko) | 2009-03-11 | 2017-02-07 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | 할로겐알킬메틸렌옥시페닐-치환된 케토에놀 |
| BRPI1011208B1 (pt) | 2009-05-19 | 2018-01-02 | Bayer Intellectual Property Gmbh | Compostos herbicidas e praguicidas derivados do ácido tetrônico espiroheterocíclico, método para a fabricação dos compostos, agentes para o controle de pragas e/ou do crescimento indesejado de plantas, método para o controle de pragas animais e/ou do crescimento indesejado de plantas, uso dos compostos, método para a fabricação dos agentes e uso dos agentes |
| WO2011098443A1 (de) | 2010-02-10 | 2011-08-18 | Bayer Cropscience Ag | Spiroheterocyclisch-substituierte tetramsäure-derivate |
| ES2700996T3 (es) | 2010-02-10 | 2019-02-20 | Bayer Cropscience Ag | Cetoenoles cíclicos sustituidos con bifenilo |
| EP2560487A1 (de) | 2010-04-20 | 2013-02-27 | Bayer Intellectual Property GmbH | Insektizide und/oder herbizide zusammensetzung mit verbesserter wirkung auf basis von spiroheterocyclisch-substituierten tetramsäure-derivaten |
| KR20130039331A (ko) | 2010-06-29 | 2013-04-19 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | 사이클릭 카보닐아미딘을 포함하는 개량된 살충성 조성물 |
| CA2816415A1 (en) | 2010-11-02 | 2012-05-10 | Bayer Intellectual Property Gmbh | Phenyl-substituted bicyclooctane-1,3-dione-derivatives |
| US8946124B2 (en) | 2011-02-17 | 2015-02-03 | Bayer Intellectual Property Gmbh | Substituted 3-(biphenyl-3-yl)-8,8-difluoro-4-hydroxy-1-azaspiro[4.5]dec-3-en-2-ones for therapy and halogen-substituted spirocyclic ketoenols |
| EP2505061A1 (en) * | 2011-03-30 | 2012-10-03 | Rhodia Opérations | New uses of choline chloride in agrochemical formulations |
| AU2012222517B2 (en) | 2011-03-01 | 2016-09-22 | Bayer Intellectual Property Gmbh | 2-acyloxy-pyrrolin-4-ones |
| WO2016001129A1 (de) | 2014-07-01 | 2016-01-07 | Bayer Cropscience Aktiengesellschaft | Verbesserte insektizide zusammensetzungen |
| WO2019197619A1 (de) | 2018-04-13 | 2019-10-17 | Bayer Cropscience Aktiengesellschaft | Suspensionskonzentrate auf ölbasis |
| WO2019197621A1 (de) | 2018-04-13 | 2019-10-17 | Bayer Cropscience Aktiengesellschaft | Suspensionskonzentrate auf ölbasis |
| CN109369712B (zh) * | 2018-12-12 | 2019-10-29 | 浙江大学 | 一种用钙盐分离提纯草铵膦的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3231509A (en) * | 1964-06-11 | 1966-01-25 | Betz Laboratories | Slimicidal composition and method |
| DE2717440C2 (de) * | 1976-05-17 | 1984-04-05 | Hoechst Ag, 6230 Frankfurt | Unkrautbekämpfung mit [(3-Amino-3-carboxy)-propyl-1]-methylphosphinsäure-Derivaten |
| GB2007976B (en) * | 1977-11-08 | 1982-06-09 | Meiji Seika Kaisha | Herbicidal composition and herbicidal processes |
| JPS5484529A (en) * | 1977-12-19 | 1979-07-05 | Meiji Seika Kaisha Ltd | Production of d,l-2-amino-4-methylphosphinobutyric acid |
| US4226610A (en) * | 1978-04-15 | 1980-10-07 | Meiji Selka Kaisha, Ltd. | Herbicidal compounds, preparation thereof and herbicides containing the same |
-
1980
- 1980-03-04 DE DE19803008186 patent/DE3008186A1/de not_active Withdrawn
-
1981
- 1981-02-23 DE DE8181101282T patent/DE3160991D1/de not_active Expired
- 1981-02-23 EP EP81101282A patent/EP0036106B1/de not_active Expired
- 1981-02-26 ES ES499839A patent/ES499839A0/es active Granted
- 1981-02-27 MA MA19289A patent/MA19085A1/fr unknown
- 1981-02-27 BR BR8101233A patent/BR8101233A/pt unknown
- 1981-02-27 DD DD81227943A patent/DD156892A5/de unknown
- 1981-03-02 PT PT72607A patent/PT72607B/pt not_active IP Right Cessation
- 1981-03-02 IL IL62241A patent/IL62241A0/xx unknown
- 1981-03-02 PH PH25291A patent/PH19742A/en unknown
- 1981-03-02 GR GR64267A patent/GR74156B/el unknown
- 1981-03-02 NZ NZ196380A patent/NZ196380A/xx unknown
- 1981-03-03 PL PL22997681A patent/PL229976A1/xx unknown
- 1981-03-03 HU HU81523A patent/HU186384B/hu not_active IP Right Cessation
- 1981-03-03 CA CA000372216A patent/CA1162071A/en not_active Expired
- 1981-03-03 DK DK95981A patent/DK95981A/da not_active Application Discontinuation
- 1981-03-03 AU AU68018/81A patent/AU539256B2/en not_active Ceased
- 1981-03-03 JP JP2947781A patent/JPS56135409A/ja active Granted
- 1981-03-03 ZA ZA00811397A patent/ZA811397B/xx unknown
- 1981-03-04 CS CS811548A patent/CS221287B2/cs unknown
- 1981-03-04 OA OA57344A patent/OA06759A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU186384B (en) | 1985-07-29 |
| DE3008186A1 (de) | 1981-10-15 |
| EP0036106A2 (de) | 1981-09-23 |
| DK95981A (da) | 1981-09-05 |
| JPS56135409A (en) | 1981-10-22 |
| PH19742A (en) | 1986-06-23 |
| PT72607B (en) | 1982-07-13 |
| PT72607A (en) | 1981-04-01 |
| DE3160991D1 (en) | 1983-11-03 |
| ES8201001A1 (es) | 1981-12-16 |
| NZ196380A (en) | 1983-05-10 |
| AU6801881A (en) | 1981-09-10 |
| IL62241A0 (en) | 1981-05-20 |
| CA1162071A (en) | 1984-02-14 |
| ZA811397B (en) | 1982-03-31 |
| ES499839A0 (es) | 1981-12-16 |
| OA06759A (fr) | 1982-06-30 |
| PL229976A1 (cg-RX-API-DMAC7.html) | 1981-10-30 |
| MA19085A1 (fr) | 1981-10-01 |
| GR74156B (cg-RX-API-DMAC7.html) | 1984-06-06 |
| EP0036106B1 (de) | 1983-09-28 |
| DD156892A5 (de) | 1982-09-29 |
| BR8101233A (pt) | 1981-09-08 |
| AU539256B2 (en) | 1984-09-20 |
| EP0036106A3 (en) | 1981-09-30 |
| JPH0124125B2 (cg-RX-API-DMAC7.html) | 1989-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS221287B2 (en) | Herbicide means | |
| RU2084150C1 (ru) | Фунгицидная синергитическая композиция и способ борьбы с грибками | |
| KR101525558B1 (ko) | 벼농사에 사용되는 벤조일사이클로헥산디온 그룹의 상승적 작물 내성 제초제 배합물 | |
| DE19836660A1 (de) | Herbizide Mittel für tolerante oder resistente Sojakulturen | |
| EP1008297B1 (de) | Mischungen aus Herbiziden und Antidots | |
| DE19836700A1 (de) | Herbizide Mittel für tolerante oder resistente Getreidekulturen | |
| DE19836684A1 (de) | Herbizide Mittel für tolerante oder resistente Reiskulturen | |
| AU605484B2 (en) | Herbicides | |
| EP1296558A1 (de) | Herbizide mittel | |
| DE19836673A1 (de) | Herbizide Mittel für tolerante oder resistente Zuckerrübenkulturen | |
| CA1334249C (en) | Herbicidal composition | |
| EP0230596B1 (en) | Synergistic herbicide combinations and method of application | |
| US4622060A (en) | Herbicidal compositions and herbicidal processes | |
| PL129545B1 (en) | Pesticide | |
| RO109419B1 (ro) | Compozitie erbicida | |
| EP2959776B1 (en) | Use of an herbicidal composition comprising flazasulfuron and mesotrione | |
| JPH10512272A (ja) | 除草用組成物 | |
| AU2008243445A1 (en) | Defoliant | |
| WO2023079575A1 (en) | Herbicidal composition comprising sulfonyl urea and triazine | |
| JPS5857404B2 (ja) | 除草剤組成物 | |
| US5110346A (en) | Herbicidal composition and method for killing weeds using the same | |
| US3961935A (en) | Synergistic herbicidal composition comprising O-methyl or O-ethyl-O-(3-methyl-6-nitrophenyl)-N-secondary-butylphosphorothioamidate and a phenoxy-type herbicide | |
| CN109452301B (zh) | 一种含丙嗪嘧磺隆的三元除草组合物 | |
| KR840001667B1 (ko) | 포스피노트리신 조성물 | |
| US5024692A (en) | Herbicidal composition and herbicidal method |