CS208785B2 - Method of making the acetanilides - Google Patents
Method of making the acetanilides Download PDFInfo
- Publication number
- CS208785B2 CS208785B2 CS794827A CS482779A CS208785B2 CS 208785 B2 CS208785 B2 CS 208785B2 CS 794827 A CS794827 A CS 794827A CS 482779 A CS482779 A CS 482779A CS 208785 B2 CS208785 B2 CS 208785B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- parts
- weight
- chloro
- methyl
- phase
- Prior art date
Links
- 150000008061 acetanilides Chemical class 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000003444 phase transfer catalyst Substances 0.000 claims description 12
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 239000003513 alkali Substances 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002883 imidazolyl group Chemical group 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 2
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 2
- 125000001425 triazolyl group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000012074 organic phase Substances 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 229960001413 acetanilide Drugs 0.000 description 7
- -1 alkali metal azole salts Chemical class 0.000 description 7
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- YHZUNJIVPRPTSP-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-(2,6-dimethylphenyl)acetamide Chemical compound CC1=CC=CC(C)=C1N(CCl)C(=O)CCl YHZUNJIVPRPTSP-UHFFFAOYSA-N 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 4
- 229940073584 methylene chloride Drugs 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- BDXJANJAHYKTMI-UHFFFAOYSA-N 2,3,4,5-tetramethyl-1h-pyrrole Chemical compound CC=1NC(C)=C(C)C=1C BDXJANJAHYKTMI-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 150000003851 azoles Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- RIKMMFOAQPJVMX-UHFFFAOYSA-N fomepizole Chemical compound CC=1C=NNC=1 RIKMMFOAQPJVMX-UHFFFAOYSA-N 0.000 description 2
- 229960004285 fomepizole Drugs 0.000 description 2
- 150000004010 onium ions Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- XKFPGUWSSPXXMF-UHFFFAOYSA-N tributyl(methyl)phosphanium Chemical compound CCCC[P+](C)(CCCC)CCCC XKFPGUWSSPXXMF-UHFFFAOYSA-N 0.000 description 2
- XHTYQFMRBQUCPX-UHFFFAOYSA-N 1,1,3,3-tetramethoxypropane Chemical compound COC(OC)CC(OC)OC XHTYQFMRBQUCPX-UHFFFAOYSA-N 0.000 description 1
- 150000000177 1,2,3-triazoles Chemical class 0.000 description 1
- 150000000178 1,2,4-triazoles Chemical class 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- KCUCKJJLMMZKBV-UHFFFAOYSA-N 2,4,5-trichloro-1h-imidazole Chemical compound ClC1=NC(Cl)=C(Cl)N1 KCUCKJJLMMZKBV-UHFFFAOYSA-N 0.000 description 1
- SULQOTGFPPFUMG-UHFFFAOYSA-N 2-bromo-4,5-dichloro-1h-imidazole Chemical compound ClC=1N=C(Br)NC=1Cl SULQOTGFPPFUMG-UHFFFAOYSA-N 0.000 description 1
- CAVYVPAUPBTDIL-UHFFFAOYSA-N 2-chloro-n-(2,6-dimethylphenyl)-n-[(4-methoxypyrazol-1-yl)methyl]acetamide Chemical compound C1=C(OC)C=NN1CN(C(=O)CCl)C1=C(C)C=CC=C1C CAVYVPAUPBTDIL-UHFFFAOYSA-N 0.000 description 1
- OCVXSFKKWXMYPF-UHFFFAOYSA-N 2-chloroimidazole Chemical compound ClC1=NC=CN1 OCVXSFKKWXMYPF-UHFFFAOYSA-N 0.000 description 1
- FRAKFBWDPXYIQO-UHFFFAOYSA-N 3,5-dibromo-1h-1,2,4-triazole Chemical compound BrC1=NNC(Br)=N1 FRAKFBWDPXYIQO-UHFFFAOYSA-N 0.000 description 1
- JNTFFNKMQMJJQZ-UHFFFAOYSA-N 3,5-dichloro-1h-1,2,4-triazole Chemical compound ClC1=NNC(Cl)=N1 JNTFFNKMQMJJQZ-UHFFFAOYSA-N 0.000 description 1
- OYISHIXUELPEIB-UHFFFAOYSA-N 3,5-dichloro-4-methyl-1h-pyrazole Chemical compound CC=1C(Cl)=NNC=1Cl OYISHIXUELPEIB-UHFFFAOYSA-N 0.000 description 1
- XYYXDARQOHWBPO-UHFFFAOYSA-N 3,5-dimethyl-1h-1,2,4-triazole Chemical compound CC1=NNC(C)=N1 XYYXDARQOHWBPO-UHFFFAOYSA-N 0.000 description 1
- JXHKUYQCEJILEI-UHFFFAOYSA-N 3,5-diphenyl-1h-pyrazole Chemical compound C=1C(C=2C=CC=CC=2)=NNC=1C1=CC=CC=C1 JXHKUYQCEJILEI-UHFFFAOYSA-N 0.000 description 1
- MYYYOBVDIRECDX-UHFFFAOYSA-N 4,5-dibromo-1h-imidazole Chemical compound BrC=1N=CNC=1Br MYYYOBVDIRECDX-UHFFFAOYSA-N 0.000 description 1
- DBFMQNPRKMLHLK-UHFFFAOYSA-N 4,5-dibromo-2-methyl-1h-imidazole Chemical compound CC1=NC(Br)=C(Br)N1 DBFMQNPRKMLHLK-UHFFFAOYSA-N 0.000 description 1
- QAJJXHRQPLATMK-UHFFFAOYSA-N 4,5-dichloro-1h-imidazole Chemical compound ClC=1N=CNC=1Cl QAJJXHRQPLATMK-UHFFFAOYSA-N 0.000 description 1
- QCJPFRGDWAGMDB-UHFFFAOYSA-N 4,5-dichloro-2-ethyl-1h-imidazole Chemical compound CCC1=NC(Cl)=C(Cl)N1 QCJPFRGDWAGMDB-UHFFFAOYSA-N 0.000 description 1
- ZWRYWVBALYOSPQ-UHFFFAOYSA-N 4,5-dichloro-2-methyl-1h-imidazole Chemical compound CC1=NC(Cl)=C(Cl)N1 ZWRYWVBALYOSPQ-UHFFFAOYSA-N 0.000 description 1
- WVGCPEDBFHEHEZ-UHFFFAOYSA-N 4-bromo-1h-pyrazole Chemical compound BrC=1C=NNC=1 WVGCPEDBFHEHEZ-UHFFFAOYSA-N 0.000 description 1
- BADSZRMNXWLUKO-UHFFFAOYSA-N 4-chloro-1h-pyrazole Chemical compound ClC=1C=NNC=1 BADSZRMNXWLUKO-UHFFFAOYSA-N 0.000 description 1
- IHNXHUNMFYXQCG-UHFFFAOYSA-N 4-ethyl-1h-pyrazole Chemical compound CCC=1C=NNC=1 IHNXHUNMFYXQCG-UHFFFAOYSA-N 0.000 description 1
- LLNQWPTUJJYTTE-UHFFFAOYSA-N 4-iodopyrazole Chemical compound IC=1C=NNC=1 LLNQWPTUJJYTTE-UHFFFAOYSA-N 0.000 description 1
- NCFMDIJKEYGCRD-UHFFFAOYSA-N 4-methoxy-1h-pyrazole Chemical compound COC=1C=NNC=1 NCFMDIJKEYGCRD-UHFFFAOYSA-N 0.000 description 1
- GPGKNEKFDGOXPO-UHFFFAOYSA-N 4-phenyl-1h-pyrazole Chemical compound C1=NNC=C1C1=CC=CC=C1 GPGKNEKFDGOXPO-UHFFFAOYSA-N 0.000 description 1
- WVMBISZHWMJNNM-UHFFFAOYSA-N 4-propan-2-yl-1h-pyrazole Chemical compound CC(C)C=1C=NNC=1 WVMBISZHWMJNNM-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- AKTHZWMYNACDDW-UHFFFAOYSA-N 5-chloro-2h-tetrazole Chemical compound ClC1=NN=NN1 AKTHZWMYNACDDW-UHFFFAOYSA-N 0.000 description 1
- XKVUYEYANWFIJX-UHFFFAOYSA-N 5-methyl-1h-pyrazole Chemical compound CC1=CC=NN1 XKVUYEYANWFIJX-UHFFFAOYSA-N 0.000 description 1
- XZGLNCKSNVGDNX-UHFFFAOYSA-N 5-methyl-2h-tetrazole Chemical compound CC=1N=NNN=1 XZGLNCKSNVGDNX-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000005529 alkyleneoxy group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- CYDRXTMLKJDRQH-UHFFFAOYSA-N benzododecinium Chemical compound CCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 CYDRXTMLKJDRQH-UHFFFAOYSA-N 0.000 description 1
- CHQVQXZFZHACQQ-UHFFFAOYSA-M benzyl(triethyl)azanium;bromide Chemical compound [Br-].CC[N+](CC)(CC)CC1=CC=CC=C1 CHQVQXZFZHACQQ-UHFFFAOYSA-M 0.000 description 1
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- WOWHHFRSBJGXCM-UHFFFAOYSA-M cetyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)C WOWHHFRSBJGXCM-UHFFFAOYSA-M 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- LNIYNESXCOYFPW-UHFFFAOYSA-N dibenzyl(dimethyl)azanium Chemical compound C=1C=CC=CC=1C[N+](C)(C)CC1=CC=CC=C1 LNIYNESXCOYFPW-UHFFFAOYSA-N 0.000 description 1
- BLHUAXIDWCQEPL-UHFFFAOYSA-M dibenzyl(dimethyl)azanium;methyl sulfate Chemical compound COS([O-])(=O)=O.C=1C=CC=CC=1C[N+](C)(C)CC1=CC=CC=C1 BLHUAXIDWCQEPL-UHFFFAOYSA-M 0.000 description 1
- 150000004816 dichlorobenzenes Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 1
- 229940073469 dimethyldodecylbenzylammonium Drugs 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000004664 distearyldimethylammonium chloride (DHTDMAC) Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- GATNOFPXSDHULC-UHFFFAOYSA-N ethylphosphonic acid Chemical class CCP(O)(O)=O GATNOFPXSDHULC-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229910001867 inorganic solvent Inorganic materials 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- YHBCVAMIJFBZIY-UHFFFAOYSA-N n-phenyl-2-(1h-pyrrol-2-yl)acetamide Chemical compound C=1C=CC=CC=1NC(=O)CC1=CC=CN1 YHBCVAMIJFBZIY-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- DLRJIFUOBPOJNS-UHFFFAOYSA-N phenetole Chemical compound CCOC1=CC=CC=C1 DLRJIFUOBPOJNS-UHFFFAOYSA-N 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 1
- RYVBINGWVJJDPU-UHFFFAOYSA-M tributyl(hexadecyl)phosphanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[P+](CCCC)(CCCC)CCCC RYVBINGWVJJDPU-UHFFFAOYSA-M 0.000 description 1
- SDSMZSUWTYFEBO-UHFFFAOYSA-M tributyl(methyl)phosphanium;bromide Chemical compound [Br-].CCCC[P+](C)(CCCC)CCCC SDSMZSUWTYFEBO-UHFFFAOYSA-M 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/68—Halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782830764 DE2830764A1 (de) | 1978-07-13 | 1978-07-13 | Acetanilide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS208785B2 true CS208785B2 (en) | 1981-09-15 |
Family
ID=6044263
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS794827A CS208785B2 (en) | 1978-07-13 | 1979-07-10 | Method of making the acetanilides |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4321395A (pt) |
| EP (1) | EP0007080B1 (pt) |
| JP (1) | JPS5513283A (pt) |
| AR (1) | AR221732A1 (pt) |
| AT (1) | ATE125T1 (pt) |
| BR (1) | BR7904345A (pt) |
| CS (1) | CS208785B2 (pt) |
| DD (1) | DD144771A5 (pt) |
| DE (2) | DE2830764A1 (pt) |
| DK (1) | DK292779A (pt) |
| HU (1) | HU180423B (pt) |
| IL (1) | IL57350A (pt) |
| PL (1) | PL114229B2 (pt) |
| ZA (1) | ZA793511B (pt) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2854598A1 (de) * | 1978-12-18 | 1980-07-03 | Basf Ag | N-substituierte carbonsaeureanilide, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE3205682A1 (de) * | 1982-02-17 | 1983-09-01 | Consortium für elektrochemische Industrie GmbH, 8000 München | Azolyl-pyrrolidinone, verfahren zu deren herstellung und ihre verwendung als fungizide |
| US5250503A (en) * | 1989-07-29 | 1993-10-05 | Basf Aktiengesellschaft | Monoclinic metazachlor and composition |
| DE3925253A1 (de) * | 1989-07-29 | 1991-01-31 | Basf Ag | Monoklines metazachlor und verfahren zu seiner herstellung |
| DE4436293A1 (de) | 1994-10-11 | 1996-04-18 | Basf Ag | Stabile Mischung, welche Wasser und Metazachlor enthält |
| WO2008013984A2 (en) * | 2006-07-27 | 2008-01-31 | University Of Florida Research Foundation, Inc. | Compositions and methods for treating or preventing ophthalmic disease |
| AU2007277035A1 (en) * | 2006-07-27 | 2008-01-31 | University Of Florida Research Foundation, Inc. | Compositions and methods for treating or preventing ophthalmic light toxicity |
| AU2007277032A1 (en) * | 2006-07-27 | 2008-01-31 | University Of Florida Research Foundation, Inc. | Opsin stabilizing compounds and methods of use |
| IN2012DN00352A (pt) * | 2009-06-16 | 2015-08-21 | Bikam Pharmaceuticals Inc | |
| EP2802566B1 (en) | 2012-01-13 | 2016-03-16 | Basf Se | Process for preparing acetanilides |
| CN104926727B (zh) * | 2015-07-15 | 2017-09-19 | 江苏蓝丰生物化工股份有限公司 | 吡唑草胺的制备方法 |
| GB201911300D0 (en) | 2019-08-07 | 2019-09-18 | Johnson Matthey Plc | Molecular complexes |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3004959A (en) * | 1959-09-30 | 1961-10-17 | William G Finnegan | Polymers of substituted tetrazoles |
| BR6465079D0 (pt) * | 1963-12-09 | 1973-08-07 | Monsanto Co | Composicoes herbicidas e processo para a preparacao de acetanilidas herbicidas |
| GB1227144A (pt) | 1967-04-05 | 1971-04-07 | ||
| US3442945A (en) * | 1967-05-22 | 1969-05-06 | Monsanto Co | Phytotoxic alpha-halo-acetanilides |
| US3637847A (en) * | 1969-09-03 | 1972-01-25 | Monsanto Co | N-haloalkyl-anilides |
| DE2648008C3 (de) * | 1976-10-23 | 1980-09-04 | Basf Ag, 6700 Ludwigshafen | Acetanilide |
| DE2704281A1 (de) * | 1977-02-02 | 1978-08-03 | Bayer Ag | N-substituierte halogenacetanilide, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| DE2744396A1 (de) * | 1977-10-03 | 1979-04-12 | Basf Ag | Acetanilide |
-
1978
- 1978-07-13 DE DE19782830764 patent/DE2830764A1/de not_active Withdrawn
-
1979
- 1979-05-18 US US06/040,224 patent/US4321395A/en not_active Expired - Lifetime
- 1979-05-21 IL IL57350A patent/IL57350A/xx unknown
- 1979-06-26 AR AR277057A patent/AR221732A1/es active
- 1979-07-06 JP JP8512079A patent/JPS5513283A/ja active Pending
- 1979-07-09 DE DE7979102314T patent/DE2960536D1/de not_active Expired
- 1979-07-09 EP EP79102314A patent/EP0007080B1/de not_active Expired
- 1979-07-09 BR BR7904345A patent/BR7904345A/pt unknown
- 1979-07-09 AT AT79102314T patent/ATE125T1/de active
- 1979-07-10 CS CS794827A patent/CS208785B2/cs unknown
- 1979-07-11 DD DD79214273A patent/DD144771A5/de unknown
- 1979-07-11 PL PL1979217028A patent/PL114229B2/xx unknown
- 1979-07-12 ZA ZA00793511A patent/ZA793511B/xx unknown
- 1979-07-12 HU HU79BA3810A patent/HU180423B/hu unknown
- 1979-07-12 DK DK292779A patent/DK292779A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2960536D1 (en) | 1981-10-29 |
| IL57350A0 (en) | 1979-09-30 |
| IL57350A (en) | 1982-09-30 |
| ATE125T1 (de) | 1981-08-15 |
| PL114229B2 (en) | 1981-01-31 |
| BR7904345A (pt) | 1980-04-08 |
| DD144771A5 (de) | 1980-11-05 |
| EP0007080A1 (de) | 1980-01-23 |
| AR221732A1 (es) | 1981-03-13 |
| US4321395A (en) | 1982-03-23 |
| PL217028A1 (pt) | 1980-05-19 |
| DK292779A (da) | 1980-01-14 |
| ZA793511B (en) | 1980-08-27 |
| DE2830764A1 (de) | 1980-01-31 |
| HU180423B (en) | 1983-03-28 |
| EP0007080B1 (de) | 1981-07-29 |
| JPS5513283A (en) | 1980-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS208785B2 (en) | Method of making the acetanilides | |
| NO316173B1 (no) | Tetrahydrofuran-antifungale midler | |
| CA2197672C (en) | Tetrahydrofuran antifungals | |
| HU189702B (en) | Process for preparing new triazolyl-methyl-oxirane derivatives | |
| NO166281B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 1,1-disubstituerte cyklopropanderivater. | |
| HU177458B (en) | Process for preparing new 1-/1,3-dioxolan-2-yl-methyl/-1h-imidazole derivatives | |
| HU189293B (en) | Fungicide compositions containing hydroxy-alkinyl-azolyl derivatives as active agents and process for producing the active agents | |
| HU194837B (en) | Process for preparing triazole derivatives and fungicides comprising the same as active substance | |
| NZ285539A (en) | 5-azolyl indoles and their preparation | |
| CZ20023893A3 (cs) | Způsob přípravy sulfonamidů | |
| EP0151477B1 (en) | 1h-imidazole derivatives, a process for preparing them and pharmaceutical compositions containing them | |
| EP0162265A1 (en) | The preparation of substituted gamma butyrolactones useful as intermediates for making fungicidal imidazoles and triazoles | |
| RU2170736C2 (ru) | Способ получения 2-[2,4-дифторфенил]-1,3-бис[1н-1,2,4-триазол-1-ил]пропан-2-ола и его фармацевтически приемлемых солей | |
| HU184383B (en) | Process for producing phenoxy-amino-propanol derivatives | |
| BR102013027313A2 (pt) | Processo para a preparação seletiva de (1h-1,2,4-triazol-1-il) alcanóis, composto hidrazinil alcanol obtido por tal processo e seu uso | |
| EP0122452A1 (en) | Triazolyl- and imidazolyl-substituted fluoroalkane derivatives, process for their preparation and pharmaceutical compositions containing them | |
| CA1255682A (en) | Azolylmethylcycloacetals, their preparation and their use as drugs | |
| Corral et al. | Reactions of methyl 3‐hydroxythiophene‐2‐carboxylate. Part 4. Synthesis of methyl 5‐azolyl‐3‐hydroxythiophene‐2‐carboxylates | |
| EP0358484B1 (en) | Process for preparation of 1-benzylimidazole compound, and its compound | |
| JPH09183769A (ja) | アゾール化合物およびその用途 | |
| SK12392003A3 (sk) | Spôsob prípravy monohydrátu a kryštalických modifikácií flukonazolu | |
| IE48786B1 (en) | Imidazolyl oxime ether compositions | |
| JP2961538B2 (ja) | イミダゾロンおよびイミダゾリジノン誘導体の合成中間体および製造法 | |
| KR810000676B1 (ko) | 디옥소란의 헤테로 고리치환체 제조방법 | |
| JPS5942338A (ja) | ケトアルデヒド誘導体およびその製造方法 |