CS207369B2 - Herbicide means and method of making its active substance - Google Patents
Herbicide means and method of making its active substance Download PDFInfo
- Publication number
- CS207369B2 CS207369B2 CS766148A CS614876A CS207369B2 CS 207369 B2 CS207369 B2 CS 207369B2 CS 766148 A CS766148 A CS 766148A CS 614876 A CS614876 A CS 614876A CS 207369 B2 CS207369 B2 CS 207369B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- compound
- active ingredient
- water
- point
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims abstract description 16
- 239000004009 herbicide Substances 0.000 title claims description 3
- 239000013543 active substance Substances 0.000 title claims 2
- 238000004519 manufacturing process Methods 0.000 title claims 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 28
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 7
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 4
- 239000000203 mixture Substances 0.000 claims description 24
- 239000004480 active ingredient Substances 0.000 claims description 23
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000002585 base Substances 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 239000008194 pharmaceutical composition Substances 0.000 claims 1
- 150000003839 salts Chemical class 0.000 abstract description 13
- 239000002253 acid Substances 0.000 abstract description 8
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical class OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 abstract description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract description 2
- 230000020477 pH reduction Effects 0.000 abstract description 2
- 125000005210 alkyl ammonium group Chemical group 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical class [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 14
- -1 phosphoryl glycol Chemical compound 0.000 description 13
- 239000007787 solid Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 10
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 8
- 239000003921 oil Substances 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000004606 Fillers/Extenders Substances 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 239000011574 phosphorus Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 239000004471 Glycine Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 231100000208 phytotoxic Toxicity 0.000 description 3
- 230000000885 phytotoxic effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 240000006394 Sorghum bicolor Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- QCMHWZUFWLOOGI-UHFFFAOYSA-N s-ethyl chloromethanethioate Chemical compound CCSC(Cl)=O QCMHWZUFWLOOGI-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- NDUPDOJHUQKPAG-UHFFFAOYSA-M 2,2-Dichloropropanoate Chemical compound CC(Cl)(Cl)C([O-])=O NDUPDOJHUQKPAG-UHFFFAOYSA-M 0.000 description 1
- WPMUDPXGQGWTIC-UHFFFAOYSA-N 2-(4-chloro-2-ethylphenoxy)acetic acid Chemical compound CCC1=CC(Cl)=CC=C1OCC(O)=O WPMUDPXGQGWTIC-UHFFFAOYSA-N 0.000 description 1
- STBFAYAECBXZNQ-UHFFFAOYSA-N 2-[3-methyl-n-(phosphonomethyl)anilino]-3-oxo-3-thiophen-2-ylpropanoic acid Chemical compound CC1=CC=CC(N(CP(O)(O)=O)C(C(O)=O)C(=O)C=2SC=CC=2)=C1 STBFAYAECBXZNQ-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- WRXOZRLZDJAYDR-UHFFFAOYSA-N 3-methylbenzenethiol Chemical compound CC1=CC=CC(S)=C1 WRXOZRLZDJAYDR-UHFFFAOYSA-N 0.000 description 1
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 description 1
- 208000003643 Callosities Diseases 0.000 description 1
- 235000002566 Capsicum Nutrition 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 240000008620 Fagopyrum esculentum Species 0.000 description 1
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000060234 Gmelina philippensis Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010020649 Hyperkeratosis Diseases 0.000 description 1
- 241000801963 Lebeda Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 239000006002 Pepper Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 235000016761 Piper aduncum Nutrition 0.000 description 1
- 235000017804 Piper guineense Nutrition 0.000 description 1
- 244000203593 Piper nigrum Species 0.000 description 1
- 235000008184 Piper nigrum Nutrition 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- VHHKVEXKYYHIRR-UHFFFAOYSA-N benzylsulfanyl carbonochloridate Chemical compound C(C1=CC=CC=C1)SOC(=O)Cl VHHKVEXKYYHIRR-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- KTRFZWJCHOQHMN-UHFFFAOYSA-N chloromethanethioic s-acid Chemical compound SC(Cl)=O KTRFZWJCHOQHMN-UHFFFAOYSA-N 0.000 description 1
- CWJSHJJYOPWUGX-UHFFFAOYSA-N chlorpropham Chemical compound CC(C)OC(=O)NC1=CC=CC(Cl)=C1 CWJSHJJYOPWUGX-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 206010012601 diabetes mellitus Diseases 0.000 description 1
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 1
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical class CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 description 1
- JMGZBMRVDHKMKB-UHFFFAOYSA-L disodium;2-sulfobutanedioate Chemical class [Na+].[Na+].OS(=O)(=O)C(C([O-])=O)CC([O-])=O JMGZBMRVDHKMKB-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- FBPFZTCFMRRESA-UHFFFAOYSA-N hexane-1,2,3,4,5,6-hexol Chemical compound OCC(O)C(O)C(O)C(O)CO FBPFZTCFMRRESA-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical class OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Chemical class 0.000 description 1
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 description 1
- 239000000590 phytopharmaceutical Substances 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- 230000009105 vegetative growth Effects 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3808—Acyclic saturated acids which can have further substituents on alkyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/644,784 US3991095A (en) | 1975-12-29 | 1975-12-29 | N-thiolcarbonyl derivatives of N-phosphonomethylglycine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS207369B2 true CS207369B2 (en) | 1981-07-31 |
Family
ID=24586310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS766148A CS207369B2 (en) | 1975-12-29 | 1976-09-22 | Herbicide means and method of making its active substance |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3991095A (ro) |
| JP (1) | JPS5283331A (ro) |
| AU (1) | AU501312B2 (ro) |
| BE (1) | BE849902A (ro) |
| BG (1) | BG35462A3 (ro) |
| BR (1) | BR7607156A (ro) |
| CA (1) | CA1083172A (ro) |
| CH (1) | CH626508A5 (ro) |
| CS (1) | CS207369B2 (ro) |
| DD (2) | DD128532A5 (ro) |
| DE (1) | DE2641318A1 (ro) |
| FR (1) | FR2337140A1 (ro) |
| GB (1) | GB1513347A (ro) |
| HU (1) | HU184173B (ro) |
| IL (1) | IL50476A (ro) |
| IT (1) | IT1070831B (ro) |
| MY (1) | MY7900234A (ro) |
| NL (1) | NL161162C (ro) |
| PH (1) | PH12171A (ro) |
| PL (1) | PL99757B1 (ro) |
| RO (3) | RO83585B (ro) |
| SU (1) | SU667108A3 (ro) |
| YU (1) | YU229476A (ro) |
| ZA (1) | ZA765469B (ro) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4175946A (en) * | 1978-07-10 | 1979-11-27 | Monsanto Company | Thio derivatives of N-trifluoroacetyl-N-phosphonomethylglycine |
| US4300942A (en) * | 1978-09-29 | 1981-11-17 | Monsanto Company | N-(Substituted carbonyl) derivatives of N-phos-phinylmethylglycinates and the herbicidal use thereof |
| US4251258A (en) * | 1978-09-29 | 1981-02-17 | Monsanto Company | N-(Substituted carbonyl) derivatives of N-phosphinylmethylglycinates and the herbicidal use thereof |
| US4231782A (en) * | 1978-11-03 | 1980-11-04 | Monsanto Company | N-Carbobenzoxy-N-phosphonomethylglycine thioesters |
| US4226611A (en) * | 1978-11-03 | 1980-10-07 | Monsanto Company | N-Phosphonomethylglycine thioester herbicides |
| US4251256A (en) * | 1978-12-22 | 1981-02-17 | Monsanto Company | Herbicidal N-substituted ethylene derivatives of N-phosphonomethylglycine |
| US4195983A (en) * | 1978-12-26 | 1980-04-01 | Monsanto Company | N-Trifluoroacetyl-N-phosphinothioylmethylglycine esters |
| US4211732A (en) * | 1978-12-26 | 1980-07-08 | Monsanto Company | N-Carbobenzoxy-N-phosphinothioylmethylgylcine esters |
| US4211548A (en) * | 1978-12-26 | 1980-07-08 | Monsanto Company | Esters of N-phosphinothioylmethylglycine and herbicidal method |
| US4191552A (en) * | 1979-02-02 | 1980-03-04 | Stauffer Chemical Company | Amine salts of substituted N-phosphonomethylureas and their use as plant growth regulators |
| US4261727A (en) * | 1979-08-02 | 1981-04-14 | Monsanto Company | Herbicidal N-substituted triesters of N-phosphonomethylglycine |
| US4323387A (en) * | 1980-07-28 | 1982-04-06 | Monsanto Company | N-Thiolcarbonyl derivatives of N-phosphonomethylglycinonitrile esters, herbicidal compositions and use thereof |
| US4395374A (en) * | 1981-01-02 | 1983-07-26 | Monsanto Company | Alkyl N-arylsulfenyl-N-diaryloxy-phosphinylmethylglycinates |
| US4457873A (en) * | 1983-03-24 | 1984-07-03 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4491548A (en) * | 1983-04-28 | 1985-01-01 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4548760A (en) * | 1983-04-28 | 1985-10-22 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4505736A (en) * | 1983-05-11 | 1985-03-19 | Monsanto Company | N-Phosphonomethylglycine derivatives and use as herbicides |
| US5580841A (en) * | 1985-05-29 | 1996-12-03 | Zeneca Limited | Solid, phytoactive compositions and method for their preparation |
| US5468718A (en) * | 1985-10-21 | 1995-11-21 | Ici Americas Inc. | Liquid, phytoactive compositions and method for their preparation |
| BR9806266A (pt) | 1997-02-13 | 2000-10-17 | Monsanto Co | "método de preparação de ácidos de amino carboxìlicos" |
| US8470741B2 (en) * | 2003-05-07 | 2013-06-25 | Croda Americas Llc | Homogeneous liquid saccharide and oil systems |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3455675A (en) * | 1968-06-25 | 1969-07-15 | Monsanto Co | Aminophosphonate herbicides |
| US3853530A (en) * | 1971-03-10 | 1974-12-10 | Monsanto Co | Regulating plants with n-phosphonomethylglycine and derivatives thereof |
| US3799758A (en) * | 1971-08-09 | 1974-03-26 | Monsanto Co | N-phosphonomethyl-glycine phytotoxicant compositions |
| US3835000A (en) * | 1972-12-21 | 1974-09-10 | Monsanto Co | Electrolytic process for producing n-phosphonomethyl glycine |
-
1975
- 1975-12-29 US US05/644,784 patent/US3991095A/en not_active Expired - Lifetime
-
1976
- 1976-09-09 NL NL7610010.A patent/NL161162C/xx not_active IP Right Cessation
- 1976-09-13 GB GB37789/76A patent/GB1513347A/en not_active Expired
- 1976-09-13 AU AU17675/76A patent/AU501312B2/en not_active Expired
- 1976-09-13 IL IL50476A patent/IL50476A/xx unknown
- 1976-09-13 PH PH18901A patent/PH12171A/en unknown
- 1976-09-13 ZA ZA765469A patent/ZA765469B/xx unknown
- 1976-09-13 CA CA261,030A patent/CA1083172A/en not_active Expired
- 1976-09-14 DE DE19762641318 patent/DE2641318A1/de not_active Withdrawn
- 1976-09-15 IT IT27229/76A patent/IT1070831B/it active
- 1976-09-17 JP JP11087876A patent/JPS5283331A/ja active Granted
- 1976-09-17 CH CH1178876A patent/CH626508A5/de not_active IP Right Cessation
- 1976-09-17 YU YU02294/76A patent/YU229476A/xx unknown
- 1976-09-20 HU HU76MO966A patent/HU184173B/hu unknown
- 1976-09-22 CS CS766148A patent/CS207369B2/cs unknown
- 1976-09-23 DD DD7600194958A patent/DD128532A5/xx unknown
- 1976-09-23 DD DD76203218A patent/DD134530A5/xx unknown
- 1976-09-27 PL PL1976192692A patent/PL99757B1/pl unknown
- 1976-09-27 SU SU762403951A patent/SU667108A3/ru active
- 1976-09-28 FR FR7629118A patent/FR2337140A1/fr active Granted
- 1976-10-01 RO RO103631A patent/RO83585B/ro unknown
- 1976-10-01 RO RO76114138A patent/RO88787A/ro unknown
- 1976-10-01 RO RO87879A patent/RO80036B/ro unknown
- 1976-10-21 BG BG034498A patent/BG35462A3/xx unknown
- 1976-10-26 BR BR7607156A patent/BR7607156A/pt unknown
- 1976-12-28 BE BE173674A patent/BE849902A/xx not_active IP Right Cessation
-
1979
- 1979-12-30 MY MY234/79A patent/MY7900234A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BG35462A3 (en) | 1984-04-15 |
| PL99757B1 (pl) | 1978-08-31 |
| US3991095A (en) | 1976-11-09 |
| MY7900234A (en) | 1979-12-31 |
| IL50476A (en) | 1980-10-26 |
| AU1767576A (en) | 1978-03-23 |
| RO80036A (ro) | 1983-02-15 |
| GB1513347A (en) | 1978-06-07 |
| CH626508A5 (ro) | 1981-11-30 |
| JPS5623436B2 (ro) | 1981-05-30 |
| AU501312B2 (en) | 1979-06-14 |
| NL161162C (nl) | 1980-01-15 |
| BR7607156A (pt) | 1977-09-13 |
| NL7610010A (nl) | 1977-07-01 |
| RO80036B (ro) | 1983-02-28 |
| CA1083172A (en) | 1980-08-05 |
| FR2337140B1 (ro) | 1979-08-17 |
| DD128532A5 (de) | 1977-11-23 |
| PH12171A (en) | 1978-11-21 |
| IL50476A0 (en) | 1976-11-30 |
| RO88787A (ro) | 1986-03-15 |
| BE849902A (fr) | 1977-06-28 |
| DE2641318A1 (de) | 1977-07-07 |
| JPS5283331A (en) | 1977-07-12 |
| DD134530A5 (de) | 1979-03-07 |
| SU667108A3 (ru) | 1979-06-05 |
| FR2337140A1 (fr) | 1977-07-29 |
| NL161162B (nl) | 1979-08-15 |
| IT1070831B (it) | 1985-04-02 |
| ZA765469B (en) | 1977-08-31 |
| RO83585A (ro) | 1984-06-21 |
| YU229476A (en) | 1983-01-21 |
| RO83585B (ro) | 1984-08-30 |
| HU184173B (en) | 1984-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS207369B2 (en) | Herbicide means and method of making its active substance | |
| RU2241705C2 (ru) | Замещенные изоксазолины, способ их получения, средство защиты зерновых культур от повреждающего действия ряда гербицидов производных феноксипропионовой кислоты, сульфомочевины, бензоилциклогександиона и бензоилизоксазола, и способ защиты зерновых культур от фитотоксичных побочных действий ряда гербицидов феноксипропионовой кислоты, сульфонилмочевины, бензоилциклогександиона и бензоилизоксазола | |
| SU668569A3 (ru) | Гербицидна композици | |
| EP0014684B1 (de) | 2-Substituierte 5-Phenoxy-phenylphosphonsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| HU184659B (en) | Process for preparing sesquisodium-n-/phosphono-methyl/-glycine and herbicide compositions containing such compound | |
| US3894078A (en) | 5-Acetamido-2,4-dimethyltrifluoromethanesulfonanilide | |
| US4221583A (en) | N-Phosphonomethylglycinonitrile and certain derivatives thereof | |
| FI60020C (fi) | Som herbicid anvaendbart 2-karboxietyl-n-fosfonometylglycinat och dess salter | |
| CZ366992A3 (en) | Novel non-hygroscopic monoammonium salts | |
| PL150568B1 (en) | Herbicide | |
| FI62842B (fi) | N-karboximetyl-n-fosfonometyl-amidsyror anvaendbara som ograesmedel | |
| CA1117306A (en) | Grass growth control compositions | |
| HU185006B (en) | Herbicides and process for the preparation of n-/trifluoro-acetyl/-n/phosphono-methyl/-glycine derivative active ingredients | |
| RU2100346C1 (ru) | Производные глиоксил-циклогексендиона, способ их получения, гербицидная композиция, способ подавления нежелательного роста растений | |
| EP0902621B1 (en) | Herbicidal and plant growth regulant compositions and their use | |
| US3819353A (en) | Plant growth regulant carbamoylphosphonates | |
| EP0007210B1 (en) | Ester derivatives of n-trifluoro-acetyl-n-phosphonomethylglycine and the herbicidal use thereof | |
| US4251256A (en) | Herbicidal N-substituted ethylene derivatives of N-phosphonomethylglycine | |
| US5679620A (en) | Herbicidal and plant growth regulant compositions and their use | |
| HU184234B (en) | Preparations for controlling the plant growth | |
| PL149348B1 (en) | Nematocides and insecticides | |
| US3445484A (en) | Organic phosphorus compounds | |
| US4531967A (en) | Substituted phenylalkyl quinclidinum salts and their use as plant growth control agents | |
| US4461639A (en) | N-Halo phosphonomethylamine derivatives as herbicides | |
| HU186459B (en) | Herbicide compositions containing alkyl-n-bracket-aryl-sulfenyl-bracket closed-n-bracket-diaryl-oxy-phosphinyl-methyl-bracket closed-glycinates |