CS199682B2 - Process for the ethylation of toluene or ethylbenzene - Google Patents
Process for the ethylation of toluene or ethylbenzene Download PDFInfo
- Publication number
- CS199682B2 CS199682B2 CS774755A CS475577A CS199682B2 CS 199682 B2 CS199682 B2 CS 199682B2 CS 774755 A CS774755 A CS 774755A CS 475577 A CS475577 A CS 475577A CS 199682 B2 CS199682 B2 CS 199682B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- zeolite
- catalyst
- toluene
- sorption
- crystalline aluminosilicate
- Prior art date
Links
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 title claims abstract description 135
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 title claims abstract description 25
- 238000000034 method Methods 0.000 title claims description 33
- 230000008569 process Effects 0.000 title claims description 22
- 230000006203 ethylation Effects 0.000 title abstract description 4
- 238000006200 ethylation reaction Methods 0.000 title abstract description 4
- 239000010457 zeolite Substances 0.000 claims abstract description 183
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims abstract description 179
- 229910021536 Zeolite Inorganic materials 0.000 claims abstract description 147
- 239000003054 catalyst Substances 0.000 claims abstract description 82
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims abstract description 71
- 238000001179 sorption measurement Methods 0.000 claims abstract description 48
- 239000000377 silicon dioxide Substances 0.000 claims abstract description 33
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 32
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims abstract description 31
- 239000005977 Ethylene Substances 0.000 claims abstract description 31
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims abstract description 31
- 229910000323 aluminium silicate Inorganic materials 0.000 claims abstract description 28
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims abstract description 23
- 229910052749 magnesium Inorganic materials 0.000 claims abstract description 19
- 239000008096 xylene Substances 0.000 claims abstract description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 12
- 230000000694 effects Effects 0.000 claims abstract description 10
- 229910052796 boron Inorganic materials 0.000 claims abstract description 7
- 239000012021 ethylating agents Substances 0.000 claims abstract description 7
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 5
- 229910052770 Uranium Inorganic materials 0.000 claims abstract description 4
- 229910052787 antimony Inorganic materials 0.000 claims abstract description 3
- 239000011574 phosphorus Substances 0.000 claims description 31
- -1 ethyl halide Chemical class 0.000 claims description 28
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 25
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 18
- 239000011777 magnesium Substances 0.000 claims description 18
- 239000011230 binding agent Substances 0.000 claims description 14
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- 238000000151 deposition Methods 0.000 claims description 6
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 5
- 229940078552 o-xylene Drugs 0.000 claims description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical compound CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 239000003153 chemical reaction reagent Substances 0.000 claims description 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 claims 1
- 239000000571 coke Substances 0.000 abstract description 16
- 235000019441 ethanol Nutrition 0.000 abstract description 8
- 238000004939 coking Methods 0.000 abstract description 6
- 150000001555 benzenes Chemical class 0.000 abstract description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 abstract 1
- 229910052753 mercury Inorganic materials 0.000 abstract 1
- 238000010025 steaming Methods 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 48
- 239000000203 mixture Substances 0.000 description 32
- 150000001875 compounds Chemical class 0.000 description 30
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 28
- 239000013078 crystal Substances 0.000 description 23
- 239000000047 product Substances 0.000 description 23
- HYFLWBNQFMXCPA-UHFFFAOYSA-N 1-ethyl-2-methylbenzene Chemical compound CCC1=CC=CC=C1C HYFLWBNQFMXCPA-UHFFFAOYSA-N 0.000 description 19
- 229940091250 magnesium supplement Drugs 0.000 description 17
- 239000007788 liquid Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- 150000002430 hydrocarbons Chemical class 0.000 description 15
- 229910001868 water Inorganic materials 0.000 description 15
- 229930195733 hydrocarbon Natural products 0.000 description 14
- 239000011148 porous material Substances 0.000 description 14
- 150000003377 silicon compounds Chemical class 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 12
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 12
- 238000001354 calcination Methods 0.000 description 12
- 239000004215 Carbon black (E152) Substances 0.000 description 11
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 150000001340 alkali metals Chemical class 0.000 description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 10
- 229910001657 ferrierite group Inorganic materials 0.000 description 10
- 239000001301 oxygen Substances 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- 235000012245 magnesium oxide Nutrition 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- 239000000395 magnesium oxide Substances 0.000 description 8
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 8
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 8
- 230000004048 modification Effects 0.000 description 8
- 238000012986 modification Methods 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 7
- 230000007062 hydrolysis Effects 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 125000001477 organic nitrogen group Chemical group 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- JRLPEMVDPFPYPJ-UHFFFAOYSA-N 1-ethyl-4-methylbenzene Chemical compound CCC1=CC=C(C)C=C1 JRLPEMVDPFPYPJ-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 150000002681 magnesium compounds Chemical class 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910001392 phosphorus oxide Inorganic materials 0.000 description 6
- 230000008929 regeneration Effects 0.000 description 6
- 238000011069 regeneration method Methods 0.000 description 6
- 229910052710 silicon Inorganic materials 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- VSAISIQCTGDGPU-UHFFFAOYSA-N tetraphosphorus hexaoxide Chemical compound O1P(O2)OP3OP1OP2O3 VSAISIQCTGDGPU-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 5
- 238000002441 X-ray diffraction Methods 0.000 description 5
- 230000029936 alkylation Effects 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 125000001153 fluoro group Chemical group F* 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 150000002431 hydrogen Chemical group 0.000 description 5
- 235000011007 phosphoric acid Nutrition 0.000 description 5
- 239000010703 silicon Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- DSNHSQKRULAAEI-UHFFFAOYSA-N 1,4-Diethylbenzene Chemical compound CCC1=CC=C(CC)C=C1 DSNHSQKRULAAEI-UHFFFAOYSA-N 0.000 description 4
- PFEOZHBOMNWTJB-UHFFFAOYSA-N 3-methylpentane Chemical compound CCC(C)CC PFEOZHBOMNWTJB-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 229910052681 coesite Inorganic materials 0.000 description 4
- 229910052906 cristobalite Inorganic materials 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000001307 helium Substances 0.000 description 4
- 229910052734 helium Inorganic materials 0.000 description 4
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 4
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 235000012239 silicon dioxide Nutrition 0.000 description 4
- 239000002210 silicon-based material Substances 0.000 description 4
- 229910052682 stishovite Inorganic materials 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- 229910052905 tridymite Inorganic materials 0.000 description 4
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 229910001413 alkali metal ion Inorganic materials 0.000 description 3
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 239000004327 boric acid Substances 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910052593 corundum Inorganic materials 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000010304 firing Methods 0.000 description 3
- 229940097364 magnesium acetate tetrahydrate Drugs 0.000 description 3
- XKPKPGCRSHFTKM-UHFFFAOYSA-L magnesium;diacetate;tetrahydrate Chemical compound O.O.O.O.[Mg+2].CC([O-])=O.CC([O-])=O XKPKPGCRSHFTKM-UHFFFAOYSA-L 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 150000002892 organic cations Chemical class 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 150000003003 phosphines Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 3
- 229910001845 yogo sapphire Inorganic materials 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 238000006356 dehydrogenation reaction Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 2
- 238000007323 disproportionation reaction Methods 0.000 description 2
- 238000001493 electron microscopy Methods 0.000 description 2
- 229910052675 erionite Inorganic materials 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000007863 gel particle Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 229920000548 poly(silane) polymer Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- ODLMAHJVESYWTB-UHFFFAOYSA-N propylbenzene Chemical class CCCC1=CC=CC=C1 ODLMAHJVESYWTB-UHFFFAOYSA-N 0.000 description 2
- 229910052761 rare earth metal Inorganic materials 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229910003452 thorium oxide Inorganic materials 0.000 description 2
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- XCTNDJAFNBCVOM-UHFFFAOYSA-N 1h-imidazo[4,5-b]pyridin-2-ylmethanamine Chemical compound C1=CC=C2NC(CN)=NC2=N1 XCTNDJAFNBCVOM-UHFFFAOYSA-N 0.000 description 1
- 102100037563 40S ribosomal protein S2 Human genes 0.000 description 1
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 1
- 101100305864 Alteromonas mediterranea (strain DSM 17117 / CIP 110805 / LMG 28347 / Deep ecotype) rph2 gene Proteins 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- 101001098029 Homo sapiens 40S ribosomal protein S2 Proteins 0.000 description 1
- MQHWFIOJQSCFNM-UHFFFAOYSA-L Magnesium salicylate Chemical compound [Mg+2].OC1=CC=CC=C1C([O-])=O.OC1=CC=CC=C1C([O-])=O MQHWFIOJQSCFNM-UHFFFAOYSA-L 0.000 description 1
- MXRIRQGCELJRSN-UHFFFAOYSA-N O.O.O.[Al] Chemical compound O.O.O.[Al] MXRIRQGCELJRSN-UHFFFAOYSA-N 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 101100135363 Yarrowia lipolytica (strain CLIB 122 / E 150) RIM101 gene Proteins 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000004416 alkarylalkyl group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- JYIBXUUINYLWLR-UHFFFAOYSA-N aluminum;calcium;potassium;silicon;sodium;trihydrate Chemical compound O.O.O.[Na].[Al].[Si].[K].[Ca] JYIBXUUINYLWLR-UHFFFAOYSA-N 0.000 description 1
- HPTYUNKZVDYXLP-UHFFFAOYSA-N aluminum;trihydroxy(trihydroxysilyloxy)silane;hydrate Chemical group O.[Al].[Al].O[Si](O)(O)O[Si](O)(O)O HPTYUNKZVDYXLP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052810 boron oxide Inorganic materials 0.000 description 1
- OOSPDKSZPPFOBR-UHFFFAOYSA-N butyl dihydrogen phosphite Chemical compound CCCCOP(O)O OOSPDKSZPPFOBR-UHFFFAOYSA-N 0.000 description 1
- DLIJPAHLBJIQHE-UHFFFAOYSA-N butylphosphane Chemical compound CCCCP DLIJPAHLBJIQHE-UHFFFAOYSA-N 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical class [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 235000012255 calcium oxide Nutrition 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- KMJJJTCKNZYTEY-UHFFFAOYSA-N chloro-diethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(Cl)(=S)OCC KMJJJTCKNZYTEY-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910001603 clinoptilolite Inorganic materials 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical compound CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 1
- RDXABLXNTVBVML-UHFFFAOYSA-N diethoxyphosphanyl diethyl phosphite Chemical compound CCOP(OCC)OP(OCC)OCC RDXABLXNTVBVML-UHFFFAOYSA-N 0.000 description 1
- UCQFCFPECQILOL-UHFFFAOYSA-N diethyl hydrogen phosphate Chemical compound CCOP(O)(=O)OCC UCQFCFPECQILOL-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- BEQVQKJCLJBTKZ-UHFFFAOYSA-N diphenylphosphinic acid Chemical compound C=1C=CC=CC=1P(=O)(O)C1=CC=CC=C1 BEQVQKJCLJBTKZ-UHFFFAOYSA-N 0.000 description 1
- NFORZJQPTUSMRL-UHFFFAOYSA-N dipropan-2-yl hydrogen phosphite Chemical compound CC(C)OP(O)OC(C)C NFORZJQPTUSMRL-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- SCQDGHBIWNKIRJ-UHFFFAOYSA-N ethene propylbenzene Chemical compound C1(=CC=CC=C1)CCC.C=C SCQDGHBIWNKIRJ-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000003709 fluoroalkyl group Chemical group 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052621 halloysite Inorganic materials 0.000 description 1
- 229910052677 heulandite Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002468 indanes Chemical class 0.000 description 1
- 125000003454 indenyl group Chemical class C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical compound [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 description 1
- 229940069446 magnesium acetate Drugs 0.000 description 1
- 239000011654 magnesium acetate Substances 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- PJJZFXPJNUVBMR-UHFFFAOYSA-L magnesium benzoate Chemical compound [Mg+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 PJJZFXPJNUVBMR-UHFFFAOYSA-L 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- CQQJGTPWCKCEOQ-UHFFFAOYSA-L magnesium dipropionate Chemical compound [Mg+2].CCC([O-])=O.CCC([O-])=O CQQJGTPWCKCEOQ-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 229960000816 magnesium hydroxide Drugs 0.000 description 1
- OVGXLJDWSLQDRT-UHFFFAOYSA-L magnesium lactate Chemical compound [Mg+2].CC(O)C([O-])=O.CC(O)C([O-])=O OVGXLJDWSLQDRT-UHFFFAOYSA-L 0.000 description 1
- 239000000626 magnesium lactate Substances 0.000 description 1
- 235000015229 magnesium lactate Nutrition 0.000 description 1
- 229960004658 magnesium lactate Drugs 0.000 description 1
- UHNWOJJPXCYKCG-UHFFFAOYSA-L magnesium oxalate Chemical compound [Mg+2].[O-]C(=O)C([O-])=O UHNWOJJPXCYKCG-UHFFFAOYSA-L 0.000 description 1
- 229940063002 magnesium palmitate Drugs 0.000 description 1
- 229940072082 magnesium salicylate Drugs 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229940057948 magnesium stearate Drugs 0.000 description 1
- QENHCSSJTJWZAL-UHFFFAOYSA-N magnesium sulfide Chemical compound [Mg+2].[S-2] QENHCSSJTJWZAL-UHFFFAOYSA-N 0.000 description 1
- PKMBLJNMKINMSK-UHFFFAOYSA-N magnesium;azanide Chemical compound [NH2-].[NH2-].[Mg+2] PKMBLJNMKINMSK-UHFFFAOYSA-N 0.000 description 1
- GMDNUWQNDQDBNQ-UHFFFAOYSA-L magnesium;diformate Chemical compound [Mg+2].[O-]C=O.[O-]C=O GMDNUWQNDQDBNQ-UHFFFAOYSA-L 0.000 description 1
- BJZBHTNKDCBDNQ-UHFFFAOYSA-L magnesium;dodecanoate Chemical compound [Mg+2].CCCCCCCCCCCC([O-])=O.CCCCCCCCCCCC([O-])=O BJZBHTNKDCBDNQ-UHFFFAOYSA-L 0.000 description 1
- ABSWXCXMXIZDSN-UHFFFAOYSA-L magnesium;hexadecanoate Chemical compound [Mg+2].CCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCC([O-])=O ABSWXCXMXIZDSN-UHFFFAOYSA-L 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- CAAULPUQFIIOTL-UHFFFAOYSA-N methyl dihydrogen phosphate Chemical compound COP(O)(O)=O CAAULPUQFIIOTL-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052680 mordenite Inorganic materials 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003008 phosphonic acid esters Chemical class 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 229920001843 polymethylhydrosiloxane Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 101150085857 rpo2 gene Proteins 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- XJKVPKYVPCWHFO-UHFFFAOYSA-N silicon;hydrate Chemical compound O.[Si] XJKVPKYVPCWHFO-UHFFFAOYSA-N 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- WSANLGASBHUYGD-UHFFFAOYSA-N sulfidophosphanium Chemical group S=[PH3] WSANLGASBHUYGD-UHFFFAOYSA-N 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 150000008027 tertiary esters Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N titanium dioxide Inorganic materials O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000005208 trialkylammonium group Chemical group 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- WVLBCYQITXONBZ-UHFFFAOYSA-N trimethyl phosphate Chemical compound COP(=O)(OC)OC WVLBCYQITXONBZ-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 235000014692 zinc oxide Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2/00—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms
- C07C2/86—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon
- C07C2/862—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon the non-hydrocarbon contains only oxygen as hetero-atoms
- C07C2/865—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon the non-hydrocarbon contains only oxygen as hetero-atoms the non-hydrocarbon is an ether
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J29/00—Catalysts comprising molecular sieves
- B01J29/04—Catalysts comprising molecular sieves having base-exchange properties, e.g. crystalline zeolites
- B01J29/06—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof
- B01J29/061—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof containing metallic elements added to the zeolite
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J29/00—Catalysts comprising molecular sieves
- B01J29/04—Catalysts comprising molecular sieves having base-exchange properties, e.g. crystalline zeolites
- B01J29/06—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof
- B01J29/40—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof of the pentasil type, e.g. types ZSM-5, ZSM-8 or ZSM-11, as exemplified by patent documents US3702886, GB1334243 and US3709979, respectively
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2/00—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms
- C07C2/54—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by addition of unsaturated hydrocarbons to saturated hydrocarbons or to hydrocarbons containing a six-membered aromatic ring with no unsaturation outside the aromatic ring
- C07C2/64—Addition to a carbon atom of a six-membered aromatic ring
- C07C2/66—Catalytic processes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2/00—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms
- C07C2/86—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon
- C07C2/861—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon the non-hydrocarbon contains only halogen as hetero-atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2/00—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms
- C07C2/86—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon
- C07C2/862—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon the non-hydrocarbon contains only oxygen as hetero-atoms
- C07C2/864—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon the non-hydrocarbon contains only oxygen as hetero-atoms the non-hydrocarbon is an alcohol
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2/00—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms
- C07C2/86—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon
- C07C2/868—Preparation of hydrocarbons from hydrocarbons containing a smaller number of carbon atoms by condensation between a hydrocarbon and a non-hydrocarbon the non-hydrocarbon contains sulfur as hetero-atom
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2229/00—Aspects of molecular sieve catalysts not covered by B01J29/00
- B01J2229/10—After treatment, characterised by the effect to be obtained
- B01J2229/26—After treatment, characterised by the effect to be obtained to stabilize the total catalyst structure
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2229/00—Aspects of molecular sieve catalysts not covered by B01J29/00
- B01J2229/30—After treatment, characterised by the means used
- B01J2229/36—Steaming
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J2229/00—Aspects of molecular sieve catalysts not covered by B01J29/00
- B01J2229/30—After treatment, characterised by the means used
- B01J2229/42—Addition of matrix or binder particles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2529/00—Catalysts comprising molecular sieves
- C07C2529/04—Catalysts comprising molecular sieves having base-exchange properties, e.g. crystalline zeolites, pillared clays
- C07C2529/06—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof
- C07C2529/40—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof of the pentasil type, e.g. types ZSM-5, ZSM-8 or ZSM-11
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/706,981 US4086287A (en) | 1976-07-19 | 1976-07-19 | Selective ethylation of mono alkyl benzenes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS199682B2 true CS199682B2 (en) | 1980-07-31 |
Family
ID=24839877
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS774755A CS199682B2 (en) | 1976-07-19 | 1977-07-18 | Process for the ethylation of toluene or ethylbenzene |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4086287A (OSRAM) |
| JP (1) | JPS5312816A (OSRAM) |
| AR (1) | AR218259A1 (OSRAM) |
| BE (1) | BE856820A (OSRAM) |
| CA (1) | CA1084532A (OSRAM) |
| CS (1) | CS199682B2 (OSRAM) |
| DD (1) | DD132778A5 (OSRAM) |
| DE (1) | DE2730989A1 (OSRAM) |
| ES (1) | ES460830A1 (OSRAM) |
| FR (1) | FR2359104A1 (OSRAM) |
| GB (1) | GB1536828A (OSRAM) |
| IN (1) | IN146056B (OSRAM) |
| IT (1) | IT1085095B (OSRAM) |
| MX (1) | MX5122E (OSRAM) |
| NL (1) | NL7707999A (OSRAM) |
| PL (2) | PL199748A1 (OSRAM) |
| ZA (1) | ZA774347B (OSRAM) |
Families Citing this family (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN147121B (OSRAM) * | 1977-05-27 | 1979-11-17 | Mobil Oil Corp | |
| US4104319A (en) * | 1977-06-23 | 1978-08-01 | Mobil Oil Corporation | Ethylation of mono alkyl benzene |
| US4117024A (en) * | 1977-07-29 | 1978-09-26 | Mobil Oil Corporation | Ethylation of aromatic compounds |
| US4250345A (en) * | 1978-01-10 | 1981-02-10 | Mobil Oil Corporation | Selective production of para-xylene |
| US4176144A (en) * | 1978-01-19 | 1979-11-27 | Mobil Oil Corporation | Block copolymers |
| US4306049A (en) * | 1978-01-19 | 1981-12-15 | Mobil Oil Corporation | Polymers of methyl ethenyl benzene |
| US4205114A (en) | 1978-09-18 | 1980-05-27 | Mobil Oil Corporation | Heat and grease resistant containers comprising poly (p-methylstyrene) |
| CA1135286A (en) * | 1978-12-14 | 1982-11-09 | Mobil Oil Corporation | Alkylation of aromatic hydrocarbons |
| CA1128549A (en) * | 1978-12-14 | 1982-07-27 | Lewis B. Young | Production of 3-methylphenol |
| US4822943A (en) * | 1978-12-14 | 1989-04-18 | Mobil Oil Corporation | Production of para-diisopropylbenzene |
| US4281083A (en) * | 1978-12-20 | 1981-07-28 | Mobil Oil Corporation | Blends of poly(p-methylstyrene) with polyfunctional monomer |
| AU538578B2 (en) * | 1979-01-31 | 1984-08-23 | Mobil Oil Corp. | Zeolite catalyst containing gp za or gp8 metal and its use to convert hydrocarbons |
| JPS55141685U (OSRAM) * | 1979-03-30 | 1980-10-09 | ||
| US4230836A (en) * | 1979-04-26 | 1980-10-28 | Mobil Oil Corporation | Chemically cross-linked poly(p-methylstyrene) |
| US4584422A (en) * | 1979-06-06 | 1986-04-22 | Mobil Oil Corporation | Selective alkylation of xylenes with ethylene |
| CA1142552A (en) * | 1979-06-06 | 1983-03-08 | Warren W. Kaeding | Selective alkylation of xylenes with ethylene |
| US5288396A (en) * | 1979-10-15 | 1994-02-22 | Union Oil Company Of California | Hydrocracking process using a catalyst selective for making middle distillates |
| EP0030796B1 (en) * | 1979-12-13 | 1982-11-10 | Mobil Oil Corporation | Rejuvenation of alkylation catalyst |
| US4418235A (en) * | 1980-02-14 | 1983-11-29 | Mobil Oil Corporation | Hydrocarbon conversion with zeolite having enhanced catalytic activity |
| US4357264A (en) * | 1980-03-10 | 1982-11-02 | Mobil Oil Corporation | Alkaline earth metal modified zeolite catalysts |
| US4288647A (en) * | 1980-03-10 | 1981-09-08 | Mobil Oil Corporation | Shape selective reactions with alkaline earth-modified zeolite catalysts |
| US4384155A (en) * | 1980-04-11 | 1983-05-17 | Mobil Oil Corporation | Shape selective reactions with cadmium-modified zeolite catalysts |
| US4380685A (en) * | 1980-05-19 | 1983-04-19 | Mobil Oil Corporation | Shape selective reactions with zeolite catalysts modified with iron and/or cobalt |
| US4335181A (en) * | 1980-07-01 | 1982-06-15 | Mobil Oil Corporation | Microwaveable heat and grease resistant containers |
| US4387012A (en) * | 1980-08-01 | 1983-06-07 | Mobil Oil Corporation | Blends of poly(p-methylstyrene) with polyfunctional monomer and shaped article |
| US4302620A (en) * | 1980-10-29 | 1981-11-24 | Mobil Oil Corporation | Reactions involving zeolite catalysts modified with group IV A metals |
| US4486574A (en) * | 1980-11-21 | 1984-12-04 | Mobil Oil Corporation | Polymers of methyl ethenyl benzene |
| US4704495A (en) * | 1980-12-29 | 1987-11-03 | Mobil Oil Corporation | Catalytic conversions using shape selective metallic catalysts |
| US4421941A (en) * | 1981-01-08 | 1983-12-20 | Mobil Oil Corporation | Catalyst and process for selective production of para-dialkysubstituted benzenes |
| US4362854A (en) * | 1981-12-30 | 1982-12-07 | Mobil Oil Corporation | Poly(p-methylstyrene) with broad molecular weight distribution and process for preparation |
| US4520220A (en) * | 1982-02-22 | 1985-05-28 | Cosden Technology, Inc. | Alkylation of aromatics employing silicalite catalysts |
| US4489214A (en) * | 1982-03-01 | 1984-12-18 | Cosden Technology, Inc. | Production of ortho-suppressed dialkyl benzenes |
| US4469806A (en) * | 1982-03-18 | 1984-09-04 | Mobil Oil Corporation | Organophosphorus-treated zeolite catalysts for para-selective aromatics conversion |
| US4554394A (en) * | 1982-03-18 | 1985-11-19 | Mobil Oil Corporation | Organophosphorus-treated zeolite catalysts for para-selective aromatics conversion |
| US4409132A (en) * | 1982-03-18 | 1983-10-11 | Mobil Oil Corporation | Organophosphorus-treated zeolite catalysts for para-selective aromatics conversion |
| US4505961A (en) * | 1982-04-30 | 1985-03-19 | Mobil Oil Corporation | Microwavable heat and grease resistant containers and method for their preparation |
| US4508836A (en) * | 1982-07-27 | 1985-04-02 | Mobil Oil Corporation | Catalytic conversion process for aromatic feedstocks with hydrogen regeneration of coke-selectivated zeolite catalyst |
| US4491678A (en) * | 1982-10-19 | 1985-01-01 | Idemitsu Kosan Company Limited | Process for the production of para-xylene |
| US4447666A (en) * | 1982-12-30 | 1984-05-08 | Mobil Oil Corporation | Para-selective alkylation catalysts and processes |
| DE3361440D1 (en) * | 1982-12-30 | 1986-01-16 | Asahi Chemical Ind | A crystalline aluminosilicate, a process for producing the same, and a catalyst comprising the crystalline aluminosilicate |
| US4525395A (en) * | 1983-01-03 | 1985-06-25 | Mobil Oil Corporation | Shaped articles from poly (p-methylstyrene) blends |
| US4732747A (en) * | 1983-04-11 | 1988-03-22 | The Dow Chemical Company | Magnesium silicate compositions and process for making |
| US4665256A (en) * | 1983-04-29 | 1987-05-12 | The Dow Chemical Company | Alkylation of aromatic mixtures |
| US4503187A (en) * | 1983-12-05 | 1985-03-05 | Mobil Oil Corporation | P-Methylstyrene copolymer blends |
| US4689367A (en) * | 1983-12-05 | 1987-08-25 | Mobil Oil Corporation | P-methylstyrene polymer blends |
| AU3595984A (en) * | 1984-01-04 | 1985-07-11 | Mobil Oil Corp. | Para-diisopropylbenzene and hydroquinone from cumene |
| JPS60224643A (ja) * | 1984-04-23 | 1985-11-09 | Idemitsu Kosan Co Ltd | デユレンの製造方法 |
| US4613717A (en) * | 1984-06-25 | 1986-09-23 | Research Association For Utilization Of Light Oil | Process for producing a 1,4-dialkylbenzene |
| US4560818A (en) * | 1984-12-24 | 1985-12-24 | Mobil Oil Corporation | Process for the oxidative dehydrogenation of ethyltoluene to methylstyrene |
| US4812536A (en) * | 1986-08-29 | 1989-03-14 | Amoco Corporation | Selective para-ethylation of toluene with magnesium compound-impregnated, crystalline, gallosilicate based, molecular sieve catalyst compositions |
| US5157185A (en) * | 1989-09-01 | 1992-10-20 | Mobil Oil Corporation | Alkylation of aromatics |
| WO1993025502A1 (en) * | 1992-06-05 | 1993-12-23 | Mobil Oil Corporation | Production of ethyltoluene |
| KR100290970B1 (ko) * | 1992-06-05 | 2001-06-01 | 데니스 피. 산티니 | 에틸톨루엔의 제조 방법 |
| US5365004A (en) * | 1993-05-28 | 1994-11-15 | Mobil Oil Corp. | Selective toluene disproportionation process (STDP) with ex situ selectivated zeolite catalysts |
| US5530170A (en) * | 1993-05-28 | 1996-06-25 | Mobil Oil Corporation | Ethylbenzene alkylation with ethylene to produce para-diethylbenzene |
| US5698756A (en) * | 1993-05-28 | 1997-12-16 | Mobil Oil Corporation | Toluene alkylation with ethylene to produce para-ethyloluene |
| US5406015A (en) * | 1993-05-28 | 1995-04-11 | Mobil Oil Corp. | Selective ethylbenzene disproportionation processes (SEBDP) with ex situ selectivated zeolite catalyst |
| US5403800A (en) * | 1993-05-28 | 1995-04-04 | Mobil Oil Corp. | Multiple impregnation technique for the preparation of ex situ selectivated zeolite catalysts |
| US5367099A (en) * | 1993-05-28 | 1994-11-22 | Mobil Oil Corp. | Selective toluene disproportionation process (STDP) with ex situ selectivated zeolite catalyst |
| US5659098A (en) * | 1993-05-28 | 1997-08-19 | Beck; Jeffrey S. | High conversion touluene disproportionation with ex situ selectivated zeolite catalysts |
| US6576582B1 (en) | 1993-05-28 | 2003-06-10 | Exxonmobil Oil Corporation | Binderless ex situ selectivated zeolite catalyst |
| US5476823A (en) * | 1993-05-28 | 1995-12-19 | Mobil Oil Corp. | Method of preparation of ex situ selectivated zeolite catalysts for enhanced shape selective applications and method to increase the activity thereof |
| US5382737A (en) * | 1993-05-28 | 1995-01-17 | Mobil Oil Corp. | Selective ethylbenzene disproportionation process (SEBDP) with ex situ selectivated zeolite catalysts |
| US5726114A (en) * | 1993-10-27 | 1998-03-10 | Mobil Oil Corporation | Method of preparation of ex situ selectivated zeolite catalysts for enhanced shape selective applications and methods to increase the activity thereof |
| US5430211A (en) * | 1993-10-29 | 1995-07-04 | The Dow Chemical Company | Process of preparing ethylbenzene or substituted derivatives thereof |
| US5625104A (en) * | 1995-06-06 | 1997-04-29 | Mobil Oil Corporation | Alkali metal ion exchanged selectivated zeolite catalyst |
| US5849968A (en) * | 1995-06-06 | 1998-12-15 | Mobil Oil Corporation | Hydrocarbon conversion process with alkaline earth metal ion exchanged selectivated zeolite catalyst |
| DE19538799A1 (de) * | 1995-10-18 | 1997-04-24 | Sued Chemie Ag | Wabenförmiger Katalysatorträger |
| US5773679A (en) * | 1995-12-26 | 1998-06-30 | Mobil Oil Corporation | Performance enhancement of zeolite catalysts with water cofeed |
| US6670517B1 (en) | 2000-08-24 | 2003-12-30 | Exxon Mobil Chemical Patents Inc. | Process for alkylating aromatics |
| KR100818438B1 (ko) * | 2003-03-21 | 2008-04-02 | 스톤 앤드 웹스터 인코포레이티드 | 촉매 재활성화를 통한 알킬 방향족 화합물의 생산 |
| CN1902147B (zh) * | 2003-12-31 | 2010-08-25 | 埃克森美孚化学专利公司 | 芳族化合物的烷基化方法 |
| AU2006292708A1 (en) * | 2005-09-16 | 2007-03-29 | Shell Internationale Research Maatschappij B.V. | A method of making aromatic products |
| US20100144513A1 (en) * | 2008-12-09 | 2010-06-10 | Nicholas Christopher P | Catalyst for Olefin Upgrading |
| US20100144514A1 (en) * | 2008-12-09 | 2010-06-10 | Nicholas Christopher P | Process for Making Catalyst for Olefin Upgrading |
| US8062987B2 (en) * | 2009-10-05 | 2011-11-22 | Saudi Basic Industries Corporation | Phosphorus-containing zeolite catalysts and their method of preparation |
| JP2015501209A (ja) * | 2011-10-17 | 2015-01-15 | エクソンモービル リサーチ アンド エンジニアリング カンパニーＥｘｘｏｎ Ｒｅｓｅａｒｃｈ Ａｎｄ Ｅｎｇｉｎｅｅｒｉｎｇ Ｃｏｍｐａｎｙ | リン変性ゼオライト触媒の製造方法 |
| US9278342B2 (en) | 2012-07-02 | 2016-03-08 | Saudi Basic Industries Corporation | Method of modifying a phosphorus-containing zeolite catalyst |
| CN107913727B (zh) * | 2017-10-31 | 2020-05-29 | 中海油天津化工研究设计院有限公司 | 一种乙苯高效烷基化制对二乙苯催化剂的制备方法 |
| CN115121282B (zh) * | 2022-05-27 | 2024-06-07 | 陕西延长石油（集团）有限责任公司 | 一种催化乙醇和苯制备乙苯的催化剂及其应用 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3299155A (en) * | 1964-02-24 | 1967-01-17 | Shell Oil Co | Oxidative dehydrogenation of alkyl benzenes with canipo4 and so2 |
| US3525776A (en) * | 1968-11-12 | 1970-08-25 | Universal Oil Prod Co | Alkylation-dehydrogenation process |
| US3695209A (en) * | 1970-08-21 | 1972-10-03 | Tomlinson Ind Inc | Vessel mooring devices |
| US3751506A (en) * | 1972-05-12 | 1973-08-07 | Mobil Oil Corp | Vapor-phase alkylation in presence of crystalline aluminosilicate catalyst |
| US3856873A (en) * | 1973-09-13 | 1974-12-24 | Mobil Oil Corp | Xylene isomerization |
| US4002697A (en) * | 1973-12-03 | 1977-01-11 | Mobil Oil Corporation | Selective production of para-xylene |
| US3965208A (en) * | 1975-01-06 | 1976-06-22 | Mobil Oil Corporation | Methylation of toluene |
| US3965209A (en) * | 1975-01-06 | 1976-06-22 | Mobil Oil Corporation | Selective production of para-xylene |
| US4001346A (en) * | 1975-01-06 | 1977-01-04 | Mobil Oil Corporation | Selective production of para-xylene |
| US3965207A (en) * | 1975-01-06 | 1976-06-22 | Mobil Oil Corporation | Selective production of para-xylene |
| US4016218A (en) * | 1975-05-29 | 1977-04-05 | Mobil Oil Corporation | Alkylation in presence of thermally modified crystalline aluminosilicate catalyst |
| US4007231A (en) * | 1975-11-24 | 1977-02-08 | Mobil Oil Corporation | Selective production of para-xylene |
| NZ183608A (en) * | 1976-03-31 | 1978-12-18 | Mobil Oil Corp | Aluminosilicate zeolite catalyst for selectine production of para-diakyl substituted benzenes |
| US4011276A (en) * | 1976-04-28 | 1977-03-08 | Mobil Oil Corporation | Disproportionation of toluene |
| US4104319A (en) * | 1977-06-23 | 1978-08-01 | Mobil Oil Corporation | Ethylation of mono alkyl benzene |
-
1976
- 1976-07-19 PL PL19974876A patent/PL199748A1/xx not_active IP Right Cessation
- 1976-07-19 US US05/706,981 patent/US4086287A/en not_active Expired - Lifetime
-
1977
- 1977-04-15 US US05/787,716 patent/US4094921A/en not_active Expired - Lifetime
- 1977-06-27 CA CA281,493A patent/CA1084532A/en not_active Expired
- 1977-06-28 IN IN975/CAL/77A patent/IN146056B/en unknown
- 1977-07-04 GB GB27883/77A patent/GB1536828A/en not_active Expired
- 1977-07-08 DE DE19772730989 patent/DE2730989A1/de not_active Withdrawn
- 1977-07-08 JP JP8113377A patent/JPS5312816A/ja active Granted
- 1977-07-13 FR FR7721610A patent/FR2359104A1/fr active Granted
- 1977-07-14 BE BE179349A patent/BE856820A/xx not_active IP Right Cessation
- 1977-07-15 DD DD7700200089A patent/DD132778A5/xx unknown
- 1977-07-15 MX MX775904U patent/MX5122E/es unknown
- 1977-07-16 ES ES460830A patent/ES460830A1/es not_active Expired
- 1977-07-18 NL NL7707999A patent/NL7707999A/xx not_active Application Discontinuation
- 1977-07-18 IT IT25836/77A patent/IT1085095B/it active
- 1977-07-18 CS CS774755A patent/CS199682B2/cs unknown
- 1977-07-19 PL PL1977199748A patent/PL108320B1/pl unknown
- 1977-07-19 ZA ZA00774347A patent/ZA774347B/xx unknown
- 1977-07-19 AR AR268482A patent/AR218259A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| CA1084532A (en) | 1980-08-26 |
| FR2359104B1 (OSRAM) | 1983-09-16 |
| IT1085095B (it) | 1985-05-28 |
| FR2359104A1 (fr) | 1978-02-17 |
| JPS5312816A (en) | 1978-02-04 |
| IN146056B (OSRAM) | 1979-02-10 |
| US4094921A (en) | 1978-06-13 |
| JPS615454B2 (OSRAM) | 1986-02-18 |
| GB1536828A (en) | 1978-12-20 |
| US4086287A (en) | 1978-04-25 |
| PL199748A1 (pl) | 1978-04-24 |
| MX5122E (es) | 1983-03-24 |
| DE2730989A1 (de) | 1978-02-02 |
| ZA774347B (en) | 1979-02-28 |
| PL108320B1 (en) | 1980-04-30 |
| ES460830A1 (es) | 1978-04-16 |
| AR218259A1 (es) | 1980-05-30 |
| DD132778A5 (de) | 1978-11-01 |
| BE856820A (fr) | 1978-01-16 |
| NL7707999A (nl) | 1978-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS199682B2 (en) | Process for the ethylation of toluene or ethylbenzene | |
| US4465886A (en) | Silica-modified catalyst and use for selective production of para-dialkyl substituted benzenes | |
| US4477583A (en) | Silica-modified catalyst and use for selective production of para-dialkyl substituted benzenes | |
| US3965208A (en) | Methylation of toluene | |
| JPS6247854B2 (OSRAM) | ||
| CA1086707A (en) | Catalyst and process for selective production of para dialkyl substituted benzenes | |
| US4117024A (en) | Ethylation of aromatic compounds | |
| JPH0454620B2 (OSRAM) | ||
| US4361713A (en) | Para-selective zeolite catalysts treated with halogen compounds | |
| US4276438A (en) | Shape selective reactions with group IB modified zeolite catalysts | |
| US4143084A (en) | Di-alkylbenzene isomer mixtures | |
| JP2769044B2 (ja) | 接触分解方法 | |
| JPS5815443B2 (ja) | 結晶性アルミノシリケ−トゼオライトの製法 | |
| EP0039536B1 (en) | Shape selective reactions with zeolite catalysts modified with group 1a metals | |
| JPH0141382B2 (OSRAM) | ||
| US4379761A (en) | Catalyst and process for making said catalyst | |
| US4365104A (en) | Para-selective zeolite catalysts treated with sulfur compounds | |
| NZ196343A (en) | Alkylation of aromatics using zeolite catalyst having sc,y and rare earths deposited thereon:production of para-xylene | |
| CS207627B2 (en) | Method of ethylation of the monoalcylbenzene | |
| KR100452940B1 (ko) | 형태 선택적 제올라이트 촉매 및 방향족 화합물 전환을 위한 그의 용도 | |
| EP0036249B1 (en) | Shape selective reactions with group viia metal modified zeolite catalysts | |
| US4357264A (en) | Alkaline earth metal modified zeolite catalysts | |
| US4349461A (en) | Group VIIA metal-modified zeolite catalysts | |
| US4421941A (en) | Catalyst and process for selective production of para-dialkysubstituted benzenes | |
| US4374045A (en) | Group IB metal modified zeolite catalysts |