CS199265B2 - Process for preparing quarternary ammonium salts of n-dialkylaminoalkyl-n-/2-indanyl/anilines - Google Patents
Process for preparing quarternary ammonium salts of n-dialkylaminoalkyl-n-/2-indanyl/anilines Download PDFInfo
- Publication number
- CS199265B2 CS199265B2 CS752529A CS252975A CS199265B2 CS 199265 B2 CS199265 B2 CS 199265B2 CS 752529 A CS752529 A CS 752529A CS 252975 A CS252975 A CS 252975A CS 199265 B2 CS199265 B2 CS 199265B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- indanyl
- ammonium salts
- formula
- anilines
- dialkylaminoalkyl
- Prior art date
Links
- 150000003863 ammonium salts Chemical class 0.000 title description 2
- 150000001448 anilines Chemical class 0.000 title description 2
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 13
- 150000001450 anions Chemical class 0.000 claims abstract description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 10
- 239000002168 alkylating agent Substances 0.000 claims abstract description 5
- 229940100198 alkylating agent Drugs 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims abstract 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 238000001914 filtration Methods 0.000 claims description 3
- 239000013078 crystal Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- JKHXPOMKDVFYEJ-UHFFFAOYSA-M [Br-].C(CCC)[N+](CCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1)(CC)CC Chemical compound [Br-].C(CCC)[N+](CCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1)(CC)CC JKHXPOMKDVFYEJ-UHFFFAOYSA-M 0.000 claims 1
- 238000001816 cooling Methods 0.000 claims 1
- 238000001035 drying Methods 0.000 claims 1
- 238000005406 washing Methods 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 18
- -1 pyrrolidino, piperidino Chemical group 0.000 abstract description 15
- 206010003119 arrhythmia Diseases 0.000 abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 7
- 150000003512 tertiary amines Chemical class 0.000 abstract description 7
- 229910052736 halogen Inorganic materials 0.000 abstract description 3
- 150000002367 halogens Chemical class 0.000 abstract description 3
- 125000006729 (C2-C5) alkenyl group Chemical group 0.000 abstract description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract description 2
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 2
- 239000001257 hydrogen Substances 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 230000003444 anaesthetic effect Effects 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 description 17
- 241000282472 Canis lupus familiaris Species 0.000 description 12
- 230000000694 effects Effects 0.000 description 9
- GQCWHYJQXLHKDD-UHFFFAOYSA-N 2-(2,3-dihydro-1h-inden-1-yl)aniline Chemical compound NC1=CC=CC=C1C1C2=CC=CC=C2CC1 GQCWHYJQXLHKDD-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000034994 death Effects 0.000 description 6
- 231100000517 death Toxicity 0.000 description 6
- LOUPRKONTZGTKE-LHHVKLHASA-N quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 description 6
- 230000033764 rhythmic process Effects 0.000 description 6
- 238000011282 treatment Methods 0.000 description 6
- 239000003416 antiarrhythmic agent Substances 0.000 description 5
- NZLBHDRPUJLHCE-UHFFFAOYSA-N aprindine Chemical compound C1C2=CC=CC=C2CC1N(CCCN(CC)CC)C1=CC=CC=C1 NZLBHDRPUJLHCE-UHFFFAOYSA-N 0.000 description 5
- 230000006793 arrhythmia Effects 0.000 description 4
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000003288 anthiarrhythmic effect Effects 0.000 description 3
- 210000003169 central nervous system Anatomy 0.000 description 3
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 3
- 229960004919 procaine Drugs 0.000 description 3
- 125000001453 quaternary ammonium group Chemical group 0.000 description 3
- 229960001404 quinidine Drugs 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CFIDFVNAHVRFGT-UHFFFAOYSA-N 2,3-dihydro-1h-inden-2-yl methanesulfonate Chemical compound C1=CC=C2CC(OS(=O)(=O)C)CC2=C1 CFIDFVNAHVRFGT-UHFFFAOYSA-N 0.000 description 2
- LPMXVESGRSUGHW-UHFFFAOYSA-N Acolongiflorosid K Natural products OC1C(O)C(O)C(C)OC1OC1CC2(O)CCC3C4(O)CCC(C=5COC(=O)C=5)C4(C)CC(O)C3C2(CO)C(O)C1 LPMXVESGRSUGHW-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LPMXVESGRSUGHW-GHYGWZAOSA-N Ouabain Natural products O([C@@H]1[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O1)[C@H]1C[C@@H](O)[C@@]2(CO)[C@@](O)(C1)CC[C@H]1[C@]3(O)[C@@](C)([C@H](C4=CC(=O)OC4)CC3)C[C@@H](O)[C@H]21 LPMXVESGRSUGHW-GHYGWZAOSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 244000166550 Strophanthus gratus Species 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229960004194 lidocaine Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 208000010125 myocardial infarction Diseases 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- LPMXVESGRSUGHW-HBYQJFLCSA-N ouabain Chemical compound O[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]1C[C@@]2(O)CC[C@H]3[C@@]4(O)CC[C@H](C=5COC(=O)C=5)[C@@]4(C)C[C@@H](O)[C@@H]3[C@@]2(CO)[C@H](O)C1 LPMXVESGRSUGHW-HBYQJFLCSA-N 0.000 description 2
- 229960003343 ouabain Drugs 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 239000002831 pharmacologic agent Substances 0.000 description 2
- AQHHHDLHHXJYJD-UHFFFAOYSA-N propranolol Chemical compound C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 AQHHHDLHHXJYJD-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 238000005956 quaternization reaction Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 229910001923 silver oxide Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000006033 1,1-dimethyl-2-propenyl group Chemical group 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- LMHHFZAXSANGGM-UHFFFAOYSA-N 2-aminoindane Chemical class C1=CC=C2CC(N)CC2=C1 LMHHFZAXSANGGM-UHFFFAOYSA-N 0.000 description 1
- UPSXAPQYNGXVBF-UHFFFAOYSA-N 2-bromobutane Chemical compound CCC(C)Br UPSXAPQYNGXVBF-UHFFFAOYSA-N 0.000 description 1
- 125000006029 2-methyl-2-butenyl group Chemical group 0.000 description 1
- 125000006053 2-methyl-3-pentenyl group Chemical group 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- WCIIUCOXVNJJHD-UHFFFAOYSA-N 3-[N-(2,3-dihydro-1H-inden-2-yl)anilino]propyl-diethyl-methylazanium Chemical compound C(C)[N+](CCCN(C1=CC=CC=C1)C1CC2=CC=CC=C2C1)(C)CC WCIIUCOXVNJJHD-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WWRXMKQRGARTAB-UHFFFAOYSA-N 6-iodohex-2-ene Chemical compound CC=CCCCI WWRXMKQRGARTAB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZTHQBROSBNNGPU-UHFFFAOYSA-N Butyl hydrogen sulfate Chemical compound CCCCOS(O)(=O)=O ZTHQBROSBNNGPU-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 208000012326 Rate and rhythm disease Diseases 0.000 description 1
- 206010042434 Sudden death Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 206010047281 Ventricular arrhythmia Diseases 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 206010000891 acute myocardial infarction Diseases 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 229960005015 local anesthetics Drugs 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- REQCZEXYDRLIBE-UHFFFAOYSA-N procainamide Chemical compound CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 REQCZEXYDRLIBE-UHFFFAOYSA-N 0.000 description 1
- 229960000244 procainamide Drugs 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-O propan-1-aminium Chemical compound CCC[NH3+] WGYKZJWCGVVSQN-UHFFFAOYSA-O 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 229960003712 propranolol Drugs 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003087 receptor blocking agent Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 208000003663 ventricular fibrillation Diseases 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US460643A US3917679A (en) | 1974-04-12 | 1974-04-12 | Quaternary ammonium salts of N-dialkylaminoalkyl-N-(2-indanyl)anilines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS199265B2 true CS199265B2 (en) | 1980-07-31 |
Family
ID=23829512
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS752529A CS199265B2 (en) | 1974-04-12 | 1975-04-11 | Process for preparing quarternary ammonium salts of n-dialkylaminoalkyl-n-/2-indanyl/anilines |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3917679A (fr) |
| JP (1) | JPS50135211A (fr) |
| AR (1) | AR208307A1 (fr) |
| AT (1) | AT342037B (fr) |
| BE (1) | BE827764A (fr) |
| CA (1) | CA1026757A (fr) |
| CH (1) | CH609330A5 (fr) |
| CS (1) | CS199265B2 (fr) |
| DD (1) | DD118612A5 (fr) |
| DE (1) | DE2515548A1 (fr) |
| DK (1) | DK156975A (fr) |
| ES (1) | ES436555A1 (fr) |
| FR (1) | FR2267092B1 (fr) |
| GB (1) | GB1497149A (fr) |
| HU (1) | HU174568B (fr) |
| IE (1) | IE40971B1 (fr) |
| IL (1) | IL47060A (fr) |
| NL (1) | NL7504392A (fr) |
| PL (1) | PL98607B1 (fr) |
| RO (1) | RO75281A (fr) |
| SE (1) | SE7504099L (fr) |
| SU (1) | SU575022A3 (fr) |
| YU (1) | YU90375A (fr) |
| ZA (1) | ZA752333B (fr) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5259995A (en) * | 1975-11-12 | 1977-05-17 | Nippon Keibi Hosho Kk | Chemical fire extinguishing method |
| JPS5259996A (en) * | 1975-11-12 | 1977-05-17 | Nippon Keibi Hosho Kk | Chemical fire extinguishing method |
| US4321386A (en) * | 1981-01-28 | 1982-03-23 | Mead Johnson & Company | Quaternary piperidinium halides |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1768500A1 (de) * | 1968-05-18 | 1972-01-05 | Degussa | Verfahren zur Herstellung von Alkoxygruppen enthaltenden Aminoketonen II |
| FR111F (fr) * | 1964-03-27 | |||
| US3468951A (en) * | 1965-06-14 | 1969-09-23 | American Hospital Supply Corp | Bis-(alkoxyaryl)alkyl-n-alkenyl-and-alkynyl-amines |
| SE354866B (fr) * | 1968-10-09 | 1973-03-26 | Leo Ab | |
| US3875215A (en) * | 1971-07-19 | 1975-04-01 | Dow Chemical Co | Substituted phenoxyalkyl quaternary ammonium compounds |
-
1974
- 1974-04-12 US US460643A patent/US3917679A/en not_active Expired - Lifetime
-
1975
- 1975-01-01 AR AR258299A patent/AR208307A1/es active
- 1975-04-01 JP JP50040204A patent/JPS50135211A/ja active Pending
- 1975-04-09 YU YU00903/76A patent/YU90375A/xx unknown
- 1975-04-09 DE DE19752515548 patent/DE2515548A1/de not_active Withdrawn
- 1975-04-09 IL IL47060A patent/IL47060A/en unknown
- 1975-04-09 FR FR7511072A patent/FR2267092B1/fr not_active Expired
- 1975-04-09 SE SE7504099A patent/SE7504099L/xx unknown
- 1975-04-09 IE IE802/75A patent/IE40971B1/xx unknown
- 1975-04-09 SU SU7502121143A patent/SU575022A3/ru active
- 1975-04-09 CA CA224,219A patent/CA1026757A/fr not_active Expired
- 1975-04-10 GB GB14664/75A patent/GB1497149A/en not_active Expired
- 1975-04-10 BE BE1006586A patent/BE827764A/fr unknown
- 1975-04-10 PL PL1975179520A patent/PL98607B1/pl unknown
- 1975-04-11 DK DK156975A patent/DK156975A/da unknown
- 1975-04-11 DD DD185391A patent/DD118612A5/xx unknown
- 1975-04-11 HU HUEI000612 patent/HU174568B/hu unknown
- 1975-04-11 ZA ZA752333A patent/ZA752333B/xx unknown
- 1975-04-11 CH CH466375A patent/CH609330A5/xx not_active IP Right Cessation
- 1975-04-11 ES ES436555A patent/ES436555A1/es not_active Expired
- 1975-04-11 AT AT278475A patent/AT342037B/de not_active IP Right Cessation
- 1975-04-11 NL NL7504392A patent/NL7504392A/xx not_active Application Discontinuation
- 1975-04-11 CS CS752529A patent/CS199265B2/cs unknown
- 1975-04-12 RO RO7581973A patent/RO75281A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH609330A5 (fr) | 1979-02-28 |
| DE2515548A1 (de) | 1975-10-23 |
| NL7504392A (fr) | 1975-10-14 |
| IE40971L (en) | 1975-10-12 |
| RO75281A (fr) | 1980-11-30 |
| SE7504099L (sv) | 1975-10-13 |
| DK156975A (da) | 1975-10-13 |
| IL47060A (en) | 1977-12-30 |
| PL98607B1 (pl) | 1978-05-31 |
| AT342037B (de) | 1978-03-10 |
| GB1497149A (en) | 1978-01-05 |
| ES436555A1 (es) | 1977-04-01 |
| IE40971B1 (en) | 1979-09-26 |
| BE827764A (fr) | 1975-10-10 |
| US3917679A (en) | 1975-11-04 |
| HU174568B (hu) | 1980-02-28 |
| JPS50135211A (fr) | 1975-10-27 |
| AR208307A1 (es) | 1976-12-20 |
| FR2267092A1 (fr) | 1975-11-07 |
| DD118612A5 (fr) | 1976-03-12 |
| SU575022A3 (ru) | 1977-09-30 |
| ZA752333B (en) | 1976-11-24 |
| FR2267092B1 (fr) | 1978-08-04 |
| CA1026757A (fr) | 1978-02-21 |
| IL47060A0 (en) | 1975-06-25 |
| AU7999675A (en) | 1976-10-14 |
| ATA278475A (de) | 1977-07-15 |
| YU90375A (en) | 1982-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2513916C2 (de) | N-(2-Piperidylmethyl)-2,5-bis (2,2,2-trifluoräthoxy)-benzamid | |
| EP0164865B1 (fr) | N-(aminoalcoylphényl)sulfonamides, leur préparation et leur utilisation thérapeutique | |
| PL83097B1 (fr) | ||
| US4067904A (en) | Alkylsulfonylphenoxypropanolamine derivatives | |
| CH643809A5 (de) | Aminoalkohol-derivate. | |
| US3742023A (en) | Novel 1-substituted phenoxy-2-hydroxy-3-isopropylamino-propanes | |
| CS199265B2 (en) | Process for preparing quarternary ammonium salts of n-dialkylaminoalkyl-n-/2-indanyl/anilines | |
| FI65425C (fi) | Foerfarande foer framstaellning av ett terapeutiskt anvaendbart kvaternaert ammoniumsalt av fenylalkylamin | |
| DE2623314C2 (de) | 1-Aryloxy-2-Hydroxy-3-aminopropane, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| US3383415A (en) | 2-tertiary-aminomethyl-nu-(loweralkyl) anilines | |
| DE1936206A1 (de) | Diphenylmethoxyaethylaminoderivate und Verfahren zu ihrer Herstellung | |
| EP0011747B1 (fr) | Dérivés aminopropanols de 6-hydroxy-2,3,4,5-tétrahydro-1H-1-benzazépin-2-ones, procédé pour leur préparation, et compositions pharmaceutiques les contenant | |
| CA1129875A (fr) | Derives de chromone | |
| IL43218A (en) | 2-n-phenyl-n-aminoalkyl-aminoindanes their preparation and pharmaceutical compositions containing them | |
| DE69022442T2 (de) | Aminoalkoxyphenyl-Derivate, Verfahren zu ihrer Herstellung und diese enthaltende Zusammensetzungen. | |
| US4034011A (en) | 1,1-Diphenyl-4-(substituted-amino)butanes | |
| DE2540552A1 (de) | Cycloalkylderivate von 1-aryloxy-3- amino-2-propanolen | |
| DE2409791C3 (de) | Derivate von 2-Aminoindan und'sie enthaltende Arzneimittel | |
| US5096929A (en) | 2-amino-1,2,3,4-tetrahydronaphthalene derivatives with cardiovascular activity, process for their preparation and pharmaceutical compositions containing them | |
| DE3788207T2 (de) | Indol-Carboxamid-Derivate und ihre Salze, Verfahren und Zwischenprodukte zur Herstellung, Anwendung als Heilmittel und Zusammenstellungen, die sie enthalten. | |
| US4526891A (en) | Substituted alkyl amine derivatives of 6,11-dihydro-11-oxodibenz[b,e]oxepins | |
| US3360562A (en) | 2-tertiaryaminomethyl-n-acylanilines | |
| DE3207813C2 (fr) | ||
| US2846438A (en) | Nu-(beta-diethylaminoethyl) isonicotinamide | |
| DE2318575A1 (de) | Neue oxazolidinone |