CS195736B2 - Herbicide and process for preparing effective compound thereof - Google Patents
Herbicide and process for preparing effective compound thereof Download PDFInfo
- Publication number
- CS195736B2 CS195736B2 CS766660A CS666076A CS195736B2 CS 195736 B2 CS195736 B2 CS 195736B2 CS 766660 A CS766660 A CS 766660A CS 666076 A CS666076 A CS 666076A CS 195736 B2 CS195736 B2 CS 195736B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- hydrogen
- chloro
- fluorine
- chlorine
- formula
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims abstract description 41
- 150000001875 compounds Chemical class 0.000 title abstract description 90
- 239000004009 herbicide Substances 0.000 title abstract description 12
- 238000004519 manufacturing process Methods 0.000 title description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 79
- 239000000203 mixture Substances 0.000 claims abstract description 79
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 64
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 58
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 35
- 239000007787 solid Substances 0.000 claims abstract description 24
- 239000004094 surface-active agent Substances 0.000 claims abstract description 16
- 239000007788 liquid Substances 0.000 claims abstract description 15
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 9
- 239000000460 chlorine Chemical group 0.000 claims description 153
- 239000001257 hydrogen Substances 0.000 claims description 71
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 46
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 44
- 238000000034 method Methods 0.000 claims description 42
- 239000011737 fluorine Substances 0.000 claims description 39
- 238000002360 preparation method Methods 0.000 claims description 34
- -1 4-chloro-2-fluorophenyl Chemical group 0.000 claims description 33
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 31
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 27
- 239000004480 active ingredient Substances 0.000 claims description 27
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 26
- 125000001153 fluoro group Chemical group F* 0.000 claims description 22
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 21
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 17
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 10
- 230000008569 process Effects 0.000 claims description 10
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 4
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052698 phosphorus Inorganic materials 0.000 claims description 2
- 239000011574 phosphorus Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 11
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical group [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 9
- 239000003085 diluting agent Substances 0.000 abstract description 11
- 229910052727 yttrium Inorganic materials 0.000 abstract description 4
- 239000000243 solution Substances 0.000 description 52
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 40
- 241000196324 Embryophyta Species 0.000 description 38
- 239000008187 granular material Substances 0.000 description 37
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 239000002904 solvent Substances 0.000 description 30
- 239000011541 reaction mixture Substances 0.000 description 23
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 240000007594 Oryza sativa Species 0.000 description 21
- 235000007164 Oryza sativa Nutrition 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- 235000009566 rice Nutrition 0.000 description 21
- 239000000126 substance Substances 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- 241000209140 Triticum Species 0.000 description 14
- 235000021307 Triticum Nutrition 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 239000002689 soil Substances 0.000 description 14
- 238000012360 testing method Methods 0.000 description 14
- 244000038559 crop plants Species 0.000 description 13
- 239000000463 material Substances 0.000 description 13
- 239000008188 pellet Substances 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 11
- 240000008042 Zea mays Species 0.000 description 11
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 11
- 125000000217 alkyl group Chemical group 0.000 description 11
- 229960000892 attapulgite Drugs 0.000 description 11
- 229910052625 palygorskite Inorganic materials 0.000 description 11
- 238000011282 treatment Methods 0.000 description 11
- 210000003414 extremity Anatomy 0.000 description 10
- 239000002245 particle Substances 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 244000060234 Gmelina philippensis Species 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 125000004093 cyano group Chemical group *C#N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 7
- 239000013543 active substance Substances 0.000 description 7
- 235000005822 corn Nutrition 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- CSFDTBRRIBJILD-UHFFFAOYSA-N 4-chloro-2-fluoroaniline Chemical compound NC1=CC=C(Cl)C=C1F CSFDTBRRIBJILD-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 6
- 244000037364 Cinnamomum aromaticum Species 0.000 description 6
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 238000005507 spraying Methods 0.000 description 6
- HPKBNVJFGMBBFK-UHFFFAOYSA-N (4-chloro-2-fluorophenyl)hydrazine;hydrochloride Chemical compound Cl.NNC1=CC=C(Cl)C=C1F HPKBNVJFGMBBFK-UHFFFAOYSA-N 0.000 description 5
- GZRMNMGWNKSANY-UHFFFAOYSA-N 4-bromo-2-fluoroaniline Chemical compound NC1=CC=C(Br)C=C1F GZRMNMGWNKSANY-UHFFFAOYSA-N 0.000 description 5
- VGVHNLRUAMRIEW-UHFFFAOYSA-N 4-methylcyclohexan-1-one Chemical compound CC1CCC(=O)CC1 VGVHNLRUAMRIEW-UHFFFAOYSA-N 0.000 description 5
- 235000010469 Glycine max Nutrition 0.000 description 5
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- 150000001989 diazonium salts Chemical class 0.000 description 5
- 230000002349 favourable effect Effects 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- TZZUKRWKJHFYJQ-UHFFFAOYSA-N 4-chloro-2-fluoroaniline;hydrochloride Chemical compound Cl.NC1=CC=C(Cl)C=C1F TZZUKRWKJHFYJQ-UHFFFAOYSA-N 0.000 description 4
- 241001290610 Abildgaardia Species 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 208000003643 Callosities Diseases 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 229940126062 Compound A Drugs 0.000 description 4
- 244000058871 Echinochloa crus-galli Species 0.000 description 4
- 241000289659 Erinaceidae Species 0.000 description 4
- 244000068988 Glycine max Species 0.000 description 4
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 4
- 206010020649 Hyperkeratosis Diseases 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 4
- 240000008467 Oryza sativa Japonica Group Species 0.000 description 4
- 235000011999 Panicum crusgalli Nutrition 0.000 description 4
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 4
- 244000046052 Phaseolus vulgaris Species 0.000 description 4
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 229920005610 lignin Polymers 0.000 description 4
- 235000009973 maize Nutrition 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- AUZPZBPZWHEIDY-UHFFFAOYSA-N n-(2-fluorophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC=C1F AUZPZBPZWHEIDY-UHFFFAOYSA-N 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 239000004576 sand Substances 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 238000000859 sublimation Methods 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- YQVZREHUWCCHHX-UHFFFAOYSA-N (4-chlorophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=C(Cl)C=C1 YQVZREHUWCCHHX-UHFFFAOYSA-N 0.000 description 3
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 3
- CCHNWURRBFGQCD-UHFFFAOYSA-N 2-chlorocyclohexan-1-one Chemical compound ClC1CCCCC1=O CCHNWURRBFGQCD-UHFFFAOYSA-N 0.000 description 3
- FTZQXOJYPFINKJ-UHFFFAOYSA-N 2-fluoroaniline Chemical compound NC1=CC=CC=C1F FTZQXOJYPFINKJ-UHFFFAOYSA-N 0.000 description 3
- 235000007320 Avena fatua Nutrition 0.000 description 3
- 235000016068 Berberis vulgaris Nutrition 0.000 description 3
- 241000335053 Beta vulgaris Species 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- 206010011878 Deafness Diseases 0.000 description 3
- 244000299507 Gossypium hirsutum Species 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 3
- 235000005043 Oryza sativa Japonica Group Nutrition 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- 240000003829 Sorghum propinquum Species 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 150000001448 anilines Chemical class 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 3
- 239000000440 bentonite Substances 0.000 description 3
- 229910000278 bentonite Inorganic materials 0.000 description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 3
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000005660 chlorination reaction Methods 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 239000002274 desiccant Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002429 hydrazines Chemical class 0.000 description 3
- 150000007857 hydrazones Chemical class 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000011368 organic material Substances 0.000 description 3
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 description 3
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 230000008022 sublimation Effects 0.000 description 3
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- XPCUCLZMXMWSNS-UHFFFAOYSA-N (4-chloro-2-fluorophenyl)hydrazine Chemical compound NNC1=CC=C(Cl)C=C1F XPCUCLZMXMWSNS-UHFFFAOYSA-N 0.000 description 2
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical class NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 description 2
- ICEREUXJSSDKRC-UHFFFAOYSA-N 2-(4-chloro-2-fluorophenyl)-3-fluoro-4,5,6,7-tetrahydroindazole Chemical compound FC1=C2CCCCC2=NN1C1=CC=C(Cl)C=C1F ICEREUXJSSDKRC-UHFFFAOYSA-N 0.000 description 2
- HVQNGMGGOLAHMN-UHFFFAOYSA-N 2-(4-chlorophenyl)-4,5,6,7-tetrahydro-1h-indazol-3-one Chemical compound C1=CC(Cl)=CC=C1N1C(=O)C(CCCC2)=C2N1 HVQNGMGGOLAHMN-UHFFFAOYSA-N 0.000 description 2
- YXLSKCJEXMHMIV-UHFFFAOYSA-N 3-chloro-2-(4-chloro-2-fluorophenyl)-4,5,6,7-tetrahydroindazole Chemical compound FC1=CC(Cl)=CC=C1N1C(Cl)=C2CCCCC2=N1 YXLSKCJEXMHMIV-UHFFFAOYSA-N 0.000 description 2
- BOCVKFJJYLBKCU-UHFFFAOYSA-N 3-chloro-2-(4-chlorophenyl)-5,6,7,8-tetrahydro-4h-cyclohepta[c]pyrazole Chemical compound ClC1=C2CCCCCC2=NN1C1=CC=C(Cl)C=C1 BOCVKFJJYLBKCU-UHFFFAOYSA-N 0.000 description 2
- UJBOOUHRTQVGRU-UHFFFAOYSA-N 3-methylcyclohexan-1-one Chemical compound CC1CCCC(=O)C1 UJBOOUHRTQVGRU-UHFFFAOYSA-N 0.000 description 2
- RLMBRRQWBTWGMB-UHFFFAOYSA-N 4-amino-3-fluorobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1F RLMBRRQWBTWGMB-UHFFFAOYSA-N 0.000 description 2
- XXNOGQJZAOXWAQ-UHFFFAOYSA-N 4-chlorophenylhydrazine Chemical compound NNC1=CC=C(Cl)C=C1 XXNOGQJZAOXWAQ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 240000001592 Amaranthus caudatus Species 0.000 description 2
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 241000209761 Avena Species 0.000 description 2
- 235000005781 Avena Nutrition 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- 235000003351 Brassica cretica Nutrition 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 235000003343 Brassica rupestris Nutrition 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- 235000002566 Capsicum Nutrition 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- 235000021506 Ipomoea Nutrition 0.000 description 2
- 241000207783 Ipomoea Species 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 2
- 244000061176 Nicotiana tabacum Species 0.000 description 2
- 239000006002 Pepper Substances 0.000 description 2
- 235000016761 Piper aduncum Nutrition 0.000 description 2
- 240000003889 Piper guineense Species 0.000 description 2
- 235000017804 Piper guineense Nutrition 0.000 description 2
- 235000008184 Piper nigrum Nutrition 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 150000008061 acetanilides Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000013043 chemical agent Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002081 enamines Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- FGSGHBPKHFDJOP-UHFFFAOYSA-N ethyl 2-oxocyclohexane-1-carboxylate Chemical compound CCOC(=O)C1CCCCC1=O FGSGHBPKHFDJOP-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- MQWCXKGKQLNYQG-UHFFFAOYSA-N methyl cyclohexan-4-ol Natural products CC1CCC(O)CC1 MQWCXKGKQLNYQG-UHFFFAOYSA-N 0.000 description 2
- 235000010460 mustard Nutrition 0.000 description 2
- 230000017074 necrotic cell death Effects 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 235000020232 peanut Nutrition 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000011158 quantitative evaluation Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229960001866 silicon dioxide Drugs 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- 239000012485 toluene extract Substances 0.000 description 2
- QGERBEFFJDZVKR-UHFFFAOYSA-N (2-chloro-4-fluorophenyl)hydrazine Chemical compound NNC1=CC=C(F)C=C1Cl QGERBEFFJDZVKR-UHFFFAOYSA-N 0.000 description 1
- IRCLVUNYLCCMEX-UHFFFAOYSA-N (2-fluoro-4-methoxyphenyl)hydrazine;hydrochloride Chemical compound Cl.COC1=CC=C(NN)C(F)=C1 IRCLVUNYLCCMEX-UHFFFAOYSA-N 0.000 description 1
- PWRFDGYYJWQIAB-UHFFFAOYSA-N 1,3,5-trifluoro-2-nitrobenzene Chemical compound [O-][N+](=O)C1=C(F)C=C(F)C=C1F PWRFDGYYJWQIAB-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- CEPCPXLLFXPZGW-UHFFFAOYSA-N 2,4-difluoroaniline Chemical compound NC1=CC=C(F)C=C1F CEPCPXLLFXPZGW-UHFFFAOYSA-N 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- NRGICBYVFJHWFF-UHFFFAOYSA-N 2-(4-chloro-2-fluorophenyl)-4,5,6,7-tetrahydro-1h-indazol-3-one Chemical compound FC1=CC(Cl)=CC=C1N1C(=O)C(CCCC2)=C2N1 NRGICBYVFJHWFF-UHFFFAOYSA-N 0.000 description 1
- UWQGFEMGPHFPQO-UHFFFAOYSA-N 2-(4-chlorophenyl)-1,4,5,6,7,8-hexahydrocyclohepta[c]pyrazol-3-one Chemical compound C1=CC(Cl)=CC=C1N1C(=O)C(CCCCC2)=C2N1 UWQGFEMGPHFPQO-UHFFFAOYSA-N 0.000 description 1
- MCQGRCFWKVAZLV-UHFFFAOYSA-N 2-(4-chlorophenyl)-1,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one Chemical compound C1=CC(Cl)=CC=C1N1C(=O)C(CCC2)=C2N1 MCQGRCFWKVAZLV-UHFFFAOYSA-N 0.000 description 1
- DQKMSMPGCAABNY-UHFFFAOYSA-N 2-(4-chlorophenyl)-4,5,6,7-tetrahydroindazol-3-amine Chemical compound NC1=C2CCCCC2=NN1C1=CC=C(Cl)C=C1 DQKMSMPGCAABNY-UHFFFAOYSA-N 0.000 description 1
- TXQCFWXPBBCRTP-UHFFFAOYSA-N 2-chloro-2-fluoro-n-phenylacetamide Chemical compound FC(Cl)C(=O)NC1=CC=CC=C1 TXQCFWXPBBCRTP-UHFFFAOYSA-N 0.000 description 1
- AXDZFGRFZOQVBV-UHFFFAOYSA-N 2-chlorocyclopentan-1-one Chemical compound ClC1CCCC1=O AXDZFGRFZOQVBV-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- LETNCFZQCNCACQ-UHFFFAOYSA-N 2-fluoro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1F LETNCFZQCNCACQ-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 description 1
- RWMVCOUKVCLWIC-UHFFFAOYSA-N 2-oxocyclohexane-1-carbonitrile Chemical compound O=C1CCCCC1C#N RWMVCOUKVCLWIC-UHFFFAOYSA-N 0.000 description 1
- FXBPINRBSNMESY-UHFFFAOYSA-N 2-oxocyclopentane-1-carboxylic acid Chemical compound OC(=O)C1CCCC1=O FXBPINRBSNMESY-UHFFFAOYSA-N 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- XPZHAVVNJSBVPS-UHFFFAOYSA-N 3-bromo-2-(4-chlorophenyl)-4,5,6,7-tetrahydroindazole Chemical compound C1=CC(Cl)=CC=C1N1C(Br)=C2CCCCC2=N1 XPZHAVVNJSBVPS-UHFFFAOYSA-N 0.000 description 1
- ILXVZDZMSDWRPK-UHFFFAOYSA-N 3-chloro-2-(4-chloro-2-fluorophenyl)-5,6-dihydro-4h-cyclopenta[c]pyrazole Chemical compound FC1=CC(Cl)=CC=C1N1C(Cl)=C2CCCC2=N1 ILXVZDZMSDWRPK-UHFFFAOYSA-N 0.000 description 1
- GMOFNHKUGGOHBQ-UHFFFAOYSA-N 3-chloro-2-(4-chlorophenyl)-5,6-dihydro-4h-cyclopenta[c]pyrazole Chemical compound ClC1=C2CCCC2=NN1C1=CC=C(Cl)C=C1 GMOFNHKUGGOHBQ-UHFFFAOYSA-N 0.000 description 1
- CTSLUCNDVMMDHG-UHFFFAOYSA-N 5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione Chemical compound CCC(C)N1C(=O)NC(C)=C(Br)C1=O CTSLUCNDVMMDHG-UHFFFAOYSA-N 0.000 description 1
- 240000006995 Abutilon theophrasti Species 0.000 description 1
- 240000007087 Apium graveolens Species 0.000 description 1
- 235000015849 Apium graveolens Dulce Group Nutrition 0.000 description 1
- 235000010591 Appio Nutrition 0.000 description 1
- 235000015763 Artemisia ludoviciana Nutrition 0.000 description 1
- 235000004535 Avena sterilis Nutrition 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 244000078782 Brassica arvensis Species 0.000 description 1
- 235000008427 Brassica arvensis Nutrition 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241000209202 Bromus secalinus Species 0.000 description 1
- 241000544742 Bromus squarrosus Species 0.000 description 1
- 241001148727 Bromus tectorum Species 0.000 description 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 240000008853 Datura stramonium Species 0.000 description 1
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 239000005510 Diuron Substances 0.000 description 1
- 241000608847 Gnaphalium Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000002678 Ipomoea batatas Nutrition 0.000 description 1
- 244000017020 Ipomoea batatas Species 0.000 description 1
- 241000207890 Ipomoea purpurea Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000110847 Kochia Species 0.000 description 1
- LEVWYRKDKASIDU-IMJSIDKUSA-N L-cystine Chemical compound [O-]C(=O)[C@@H]([NH3+])CSSC[C@H]([NH3+])C([O-])=O LEVWYRKDKASIDU-IMJSIDKUSA-N 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 235000019687 Lamb Nutrition 0.000 description 1
- 241000088861 Latua Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- HFEFMUSTGZNOPY-UHFFFAOYSA-N OOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOO HFEFMUSTGZNOPY-UHFFFAOYSA-N 0.000 description 1
- 239000008896 Opium Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- 241001355178 Setaria faberi Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 235000002597 Solanum melongena Nutrition 0.000 description 1
- 244000061458 Solanum melongena Species 0.000 description 1
- 241000209072 Sorghum Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 244000223014 Syzygium aromaticum Species 0.000 description 1
- 235000016639 Syzygium aromaticum Nutrition 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 241000005601 Trisetum Species 0.000 description 1
- 241001506773 Xanthium sp. Species 0.000 description 1
- 230000009102 absorption Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 210000001099 axilla Anatomy 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- 229960003067 cystine Drugs 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LRCFXGAMWKDGLA-UHFFFAOYSA-N dioxosilane;hydrate Chemical compound O.O=[Si]=O LRCFXGAMWKDGLA-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 244000013123 dwarf bean Species 0.000 description 1
- 235000005489 dwarf bean Nutrition 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- MKRBAWHVHOVBOQ-UHFFFAOYSA-N ethyl 2-oxocycloheptane-1-carboxylate Chemical compound CCOC(=O)C1CCCCCC1=O MKRBAWHVHOVBOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000005243 fluidization Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- CYPPCCJJKNISFK-UHFFFAOYSA-J kaolinite Chemical compound [OH-].[OH-].[OH-].[OH-].[Al+3].[Al+3].[O-][Si](=O)O[Si]([O-])=O CYPPCCJJKNISFK-UHFFFAOYSA-J 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- KTGCFXSELRVRFH-UHFFFAOYSA-N methyl 3-oxocyclopentane-1-carboxylate Chemical compound COC(=O)C1CCC(=O)C1 KTGCFXSELRVRFH-UHFFFAOYSA-N 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 description 1
- GVRKNSAEOVXHOS-UHFFFAOYSA-N n-(4-chloro-2-fluorophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(Cl)C=C1F GVRKNSAEOVXHOS-UHFFFAOYSA-N 0.000 description 1
- HLWWUAGXWCWAKG-UHFFFAOYSA-N n-ethyl-1,3,5-triazin-2-amine Chemical compound CCNC1=NC=NC=N1 HLWWUAGXWCWAKG-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 231100000404 nontoxic agent Toxicity 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 229960001027 opium Drugs 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- 235000020030 perry Nutrition 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 238000006303 photolysis reaction Methods 0.000 description 1
- 230000015843 photosynthesis, light reaction Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229940088417 precipitated calcium carbonate Drugs 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229960004029 silicic acid Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 229910002029 synthetic silica gel Inorganic materials 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M thiocyanate group Chemical group [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- HTSABYAWKQAHBT-UHFFFAOYSA-N trans 3-methylcyclohexanol Natural products CC1CCCC(O)C1 HTSABYAWKQAHBT-UHFFFAOYSA-N 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000003232 water-soluble binding agent Substances 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
- C07D231/56—Benzopyrazoles; Hydrogenated benzopyrazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/54—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US62276375A | 1975-10-15 | 1975-10-15 | |
| US64034875A | 1975-12-12 | 1975-12-12 | |
| US05/717,014 US4059434A (en) | 1975-10-15 | 1976-08-26 | Cycloalkanapyrazole herbicides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS195736B2 true CS195736B2 (en) | 1980-02-29 |
Family
ID=27417327
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS766660A CS195736B2 (en) | 1975-10-15 | 1976-10-14 | Herbicide and process for preparing effective compound thereof |
Country Status (28)
| Country | Link |
|---|---|
| JP (1) | JPS5251365A (de) |
| AR (1) | AR216639A1 (de) |
| AT (1) | AT359328B (de) |
| BG (1) | BG27527A3 (de) |
| BR (1) | BR7606869A (de) |
| CA (1) | CA1071216A (de) |
| CS (1) | CS195736B2 (de) |
| DD (1) | DD129030A5 (de) |
| DE (1) | DE2646628A1 (de) |
| DK (1) | DK464176A (de) |
| ES (1) | ES452444A1 (de) |
| FR (1) | FR2327990A1 (de) |
| GB (1) | GB1519906A (de) |
| GR (1) | GR61664B (de) |
| IE (1) | IE43776B1 (de) |
| IL (1) | IL50676A (de) |
| IT (1) | IT1067700B (de) |
| LU (1) | LU76020A1 (de) |
| NL (1) | NL7611362A (de) |
| NZ (1) | NZ182335A (de) |
| OA (1) | OA05451A (de) |
| PH (1) | PH13355A (de) |
| PL (1) | PL117660B1 (de) |
| PT (1) | PT65713B (de) |
| RO (1) | RO72558A (de) |
| SE (1) | SE7610459L (de) |
| SU (1) | SU670196A3 (de) |
| TR (1) | TR19709A (de) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK574976A (da) * | 1976-01-16 | 1977-07-17 | Du Pont | Substituerede cycloalkanpyrazoler samt deres fremstilling og anvendelse |
| PH18938A (en) * | 1982-09-28 | 1985-11-11 | Sumitomo Chemical Co | 2-substituted phenyl-4,5,6,7-tetrahydro-2h-indazoles and their use |
| US4666507A (en) * | 1985-01-16 | 1987-05-19 | Nippon Kayaku Kabushiki Kaisha | Herbicidal 5-halo-1-[5-(N-substituted sulfonylamino)phenyl]pyrazole derivatives |
| AU7865000A (en) | 1999-10-06 | 2001-05-10 | 3-Dimensional Pharmaceuticals, Inc. | Fused 1-(2,6-dichloro-4-trifluoromethylphenyl)-pyrazoles, the synthesis thereof and the use thereof as pesticides |
| EP2944325A1 (de) * | 2014-05-16 | 2015-11-18 | Université de Strasbourg | Sydnon-Derivate zur Konjugation von Verbindungen von Interesse |
-
1976
- 1976-09-21 SE SE7610459A patent/SE7610459L/xx not_active Application Discontinuation
- 1976-10-13 SU SU762407713A patent/SU670196A3/ru active
- 1976-10-13 BR BR7606869A patent/BR7606869A/pt unknown
- 1976-10-13 IT IT28271/76A patent/IT1067700B/it active
- 1976-10-13 FR FR7630753A patent/FR2327990A1/fr active Granted
- 1976-10-14 DD DD7600195268A patent/DD129030A5/de unknown
- 1976-10-14 CS CS766660A patent/CS195736B2/cs unknown
- 1976-10-14 DK DK464176A patent/DK464176A/da not_active Application Discontinuation
- 1976-10-14 GR GR51941A patent/GR61664B/el unknown
- 1976-10-14 NZ NZ182335A patent/NZ182335A/xx unknown
- 1976-10-14 PH PH19011A patent/PH13355A/en unknown
- 1976-10-14 PT PT65713A patent/PT65713B/pt unknown
- 1976-10-14 CA CA263,344A patent/CA1071216A/en not_active Expired
- 1976-10-14 JP JP51122368A patent/JPS5251365A/ja active Pending
- 1976-10-14 IL IL50676A patent/IL50676A/xx unknown
- 1976-10-14 NL NL7611362A patent/NL7611362A/xx not_active Application Discontinuation
- 1976-10-14 GB GB42776/76A patent/GB1519906A/en not_active Expired
- 1976-10-15 DE DE19762646628 patent/DE2646628A1/de not_active Withdrawn
- 1976-10-15 TR TR19709A patent/TR19709A/xx unknown
- 1976-10-15 PL PL1976193059A patent/PL117660B1/pl unknown
- 1976-10-15 LU LU76020A patent/LU76020A1/xx unknown
- 1976-10-15 ES ES452444A patent/ES452444A1/es not_active Expired
- 1976-10-15 AR AR265124A patent/AR216639A1/es active
- 1976-10-15 IE IE2271/76A patent/IE43776B1/en unknown
- 1976-10-15 AT AT770576A patent/AT359328B/de not_active IP Right Cessation
- 1976-10-15 RO RO7688024A patent/RO72558A/ro unknown
- 1976-10-15 OA OA55952A patent/OA05451A/xx unknown
- 1976-10-15 BG BG034454A patent/BG27527A3/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE43776B1 (en) | 1981-05-20 |
| DE2646628A1 (de) | 1977-04-21 |
| FR2327990A1 (fr) | 1977-05-13 |
| NL7611362A (nl) | 1977-04-19 |
| RO72558A (ro) | 1982-09-09 |
| ES452444A1 (es) | 1978-01-16 |
| LU76020A1 (de) | 1978-05-16 |
| IT1067700B (it) | 1985-03-16 |
| GR61664B (en) | 1978-12-05 |
| SU670196A3 (ru) | 1979-06-25 |
| PH13355A (en) | 1980-03-20 |
| FR2327990B1 (de) | 1983-06-24 |
| AR216639A1 (es) | 1980-01-15 |
| AT359328B (de) | 1980-11-10 |
| DD129030A5 (de) | 1977-12-21 |
| DK464176A (da) | 1977-04-16 |
| GB1519906A (en) | 1978-08-02 |
| IL50676A0 (en) | 1976-12-31 |
| IE43776L (en) | 1977-04-15 |
| PT65713B (en) | 1978-06-12 |
| SE7610459L (sv) | 1977-04-16 |
| NZ182335A (en) | 1979-01-11 |
| TR19709A (tr) | 1979-10-11 |
| BR7606869A (pt) | 1977-08-30 |
| PL117660B1 (en) | 1981-08-31 |
| CA1071216A (en) | 1980-02-05 |
| PT65713A (en) | 1976-11-01 |
| BG27527A3 (en) | 1979-11-12 |
| ATA770576A (de) | 1980-03-15 |
| OA05451A (fr) | 1981-03-31 |
| IL50676A (en) | 1979-10-31 |
| JPS5251365A (en) | 1977-04-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69104071T2 (de) | Uracilderivate und Pestizide, die diese als wirksame Stoffe enthalten. | |
| JPH08506107A (ja) | 置換された縮合ピラゾロ化合物および除草剤としてのその使用 | |
| EP0974587A1 (de) | In 1-stellung substituierte 4-carbamoyl-1,2,4-triazol-5-on-derivate und herbizide | |
| JPWO1998038176A1 (ja) | 1−置換−4−カルバモイル−1,2,4−トリアゾール−5−オン誘導体及び除草剤 | |
| US4001272A (en) | Herbicidal 2-fluoro-4-halo-phenyl-4,5,6,7-tetrahydro-2h-isoindole-1,3-diones | |
| US4059434A (en) | Cycloalkanapyrazole herbicides | |
| US4032326A (en) | Herbicidal 2-substituted aryl-4,5,6,7-tetrahydro-2h-isoindole-1,3-diones | |
| JPH085875B2 (ja) | 除草性ピリジンスルフオニルウレア類 | |
| EP0207894A1 (de) | Herbizid wirkende Derivate des N-Phenyl-3,4,5,6-tetrahydrophthalsäureimides | |
| CS207657B2 (en) | Herbicide means and method of making the active substances | |
| US4124373A (en) | Tetrahydroindazole herbicides | |
| TW492842B (en) | Dihydropyridazinones and pyridazinones and their use as fungicides and insecticides | |
| EP0103537A2 (de) | N-Arylsulfonyl-N'-triazolylharnstoffe | |
| AU3789593A (en) | Novel arylindazoles and their use as herbicides | |
| CS195736B2 (en) | Herbicide and process for preparing effective compound thereof | |
| US4124374A (en) | Alkyl-substituted cycloalkanapyrazole herbicides | |
| US4042373A (en) | 2-Aryl-3-chloro-2,4,6,7-tetrahydrothiopyrano[4,3-c]-pyrazoles | |
| US4108628A (en) | Cycloalkanopyrazole herbicides mixtures | |
| US4111681A (en) | Cycloalkanapyrazole-3-carbonitrile herbicides | |
| US4123252A (en) | Methoxy substituted cycloalkanapyrazole herbicides | |
| JPH0215082A (ja) | 新規ヘテロ環式化合物及び除草剤 | |
| DE2701467A1 (de) | Substituierte cycloalkanapyrazole, sie enthaltende herbizide und verfahren zur kontrolle von unerwuenschter vegetation | |
| US4120693A (en) | Substituted isoindoles | |
| CS207497B2 (en) | Herbicide means | |
| US4192669A (en) | Herbicidal ethers |