CS195717B2 - Herbicide and method of producing the same - Google Patents
Herbicide and method of producing the same Download PDFInfo
- Publication number
- CS195717B2 CS195717B2 CS757944A CS794475A CS195717B2 CS 195717 B2 CS195717 B2 CS 195717B2 CS 757944 A CS757944 A CS 757944A CS 794475 A CS794475 A CS 794475A CS 195717 B2 CS195717 B2 CS 195717B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- carbon atoms
- group
- amine
- phenyl
- hydroxy
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 17
- 238000000034 method Methods 0.000 title claims description 3
- 239000004009 herbicide Substances 0.000 title 1
- -1 Amine salts Chemical class 0.000 claims abstract description 24
- 239000000460 chlorine Substances 0.000 claims abstract description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 13
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 9
- 150000001412 amines Chemical class 0.000 claims abstract description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 4
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 15
- 241000196324 Embryophyta Species 0.000 claims description 13
- ZUSHSDOEVHPTCU-UHFFFAOYSA-N 6-chloro-3-phenyl-1h-pyridazin-4-one Chemical compound N1C(Cl)=CC(=O)C(C=2C=CC=CC=2)=N1 ZUSHSDOEVHPTCU-UHFFFAOYSA-N 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 239000000945 filler Substances 0.000 claims description 4
- 239000000080 wetting agent Substances 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- JZOZZDCUSWCAAJ-UHFFFAOYSA-N 6-bromo-3-phenyl-1h-pyridazin-4-one Chemical compound OC1=CC(Br)=NN=C1C1=CC=CC=C1 JZOZZDCUSWCAAJ-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 244000045561 useful plants Species 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 abstract description 9
- 150000003839 salts Chemical class 0.000 abstract description 7
- 125000003277 amino group Chemical group 0.000 abstract description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 3
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 abstract 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 abstract 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000002560 nitrile group Chemical group 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 4
- 244000038559 crop plants Species 0.000 description 4
- XWSSUYOEOWLFEI-UHFFFAOYSA-N 3-phenylpyridazine Chemical class C1=CC=CC=C1C1=CC=CN=N1 XWSSUYOEOWLFEI-UHFFFAOYSA-N 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000009931 harmful effect Effects 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- BUEAACVLKZAVFX-UHFFFAOYSA-N 3-(2-methylpropylamino)propanenitrile Chemical class CC(C)CNCCC#N BUEAACVLKZAVFX-UHFFFAOYSA-N 0.000 description 1
- XBAXAJAODIQLCI-UHFFFAOYSA-N 3-(propan-2-ylamino)propanenitrile Chemical class CC(C)NCCC#N XBAXAJAODIQLCI-UHFFFAOYSA-N 0.000 description 1
- 241000602336 Anthemis arvensis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 240000004385 Centaurea cyanus Species 0.000 description 1
- 235000005940 Centaurea cyanus Nutrition 0.000 description 1
- 241001042948 Centaurea jacea Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- VPFSMQOXKJFOBP-UHFFFAOYSA-N Clc1cc(=O)c(c[nH]1)-c1ccccc1 Chemical compound Clc1cc(=O)c(c[nH]1)-c1ccccc1 VPFSMQOXKJFOBP-UHFFFAOYSA-N 0.000 description 1
- 240000003759 Erodium cicutarium Species 0.000 description 1
- 235000009967 Erodium cicutarium Nutrition 0.000 description 1
- 244000214240 Galinsoga parviflora Species 0.000 description 1
- 235000018914 Galinsoga parviflora Nutrition 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 206010053759 Growth retardation Diseases 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000006503 Lamium purpureum Species 0.000 description 1
- 240000002702 Lapsana communis Species 0.000 description 1
- 235000006761 Lapsana communis Nutrition 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical class NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 244000286177 Raphanus raphanistrum Species 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 241001166549 Veronica hederifolia Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 231100000001 growth retardation Toxicity 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- GQAUCEDULBAZQL-UHFFFAOYSA-L magnesium;2-(4-chloro-2-methylphenoxy)propanoate Chemical compound [Mg+2].[O-]C(=O)C(C)OC1=CC=C(Cl)C=C1C.[O-]C(=O)C(C)OC1=CC=C(Cl)C=C1C GQAUCEDULBAZQL-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000003956 methylamines Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000005080 plant death Effects 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 150000004892 pyridazines Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/06—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D237/10—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D237/14—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT1007374A AT334133B (de) | 1974-12-17 | 1974-12-17 | Herbizides mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS195717B2 true CS195717B2 (en) | 1980-02-29 |
Family
ID=3619675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS757944A CS195717B2 (en) | 1974-12-17 | 1975-11-24 | Herbicide and method of producing the same |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4058390A (show.php) |
| JP (1) | JPS5186131A (show.php) |
| AT (1) | AT334133B (show.php) |
| BE (1) | BE836691A (show.php) |
| BR (1) | BR7508389A (show.php) |
| CA (1) | CA1053232A (show.php) |
| CH (1) | CH595043A5 (show.php) |
| CS (1) | CS195717B2 (show.php) |
| DD (1) | DD122470A1 (show.php) |
| DE (1) | DE2551975A1 (show.php) |
| DK (1) | DK537475A (show.php) |
| ES (1) | ES443536A1 (show.php) |
| FR (1) | FR2295028A1 (show.php) |
| GB (1) | GB1474896A (show.php) |
| HU (1) | HU173972B (show.php) |
| IL (1) | IL48636A (show.php) |
| LU (1) | LU74020A1 (show.php) |
| NL (1) | NL7514641A (show.php) |
| PL (1) | PL97265B1 (show.php) |
| SU (1) | SU625576A3 (show.php) |
| ZA (1) | ZA757673B (show.php) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2741260A1 (de) * | 1977-09-14 | 1979-03-22 | Bayer Ag | Neue 1,4-dihydropyridazine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2745496A1 (de) * | 1977-10-10 | 1979-05-17 | Bayer Ag | Neue 1-n-substituierte 1.4-dihydropyridazine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US4187097A (en) * | 1977-12-16 | 1980-02-05 | Monsanto Company | N-hydrazides of 2-benzothiazolinone as plant growth regulants |
| AT397598B (de) * | 1990-04-05 | 1994-05-25 | Agrolinz Agrarchemikalien | Herbizides mittel |
| AT397085B (de) * | 1992-02-17 | 1994-01-25 | Agrolinz Agrarchemikalien | Herbizide n-cyanopyridazinone |
| CN110128352A (zh) * | 2018-02-02 | 2019-08-16 | 青岛清原化合物有限公司 | 哒嗪醇类化合物及其衍生物、制备方法、除草组合物和应用 |
| CN111820224B (zh) * | 2019-04-22 | 2022-04-05 | 江苏清原农冠杂草防治有限公司 | 包含三氟甲基哒嗪醇类化合物的除草组合物及其应用 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2805926A (en) * | 1956-04-11 | 1957-09-10 | Us Rubber Co | Plant growth regulants |
| DE2129109C3 (de) * | 1971-06-11 | 1979-06-07 | Lentia Gmbh | Phenylpyridazine, ihre Herstellung und sie enthaltende herbizide Mittel |
| DE2341629A1 (de) * | 1973-08-17 | 1975-02-27 | Basf Ag | Herbizid |
| DE2351553A1 (de) * | 1973-10-13 | 1975-04-24 | Basf Ag | Herbizid |
-
1974
- 1974-12-17 AT AT1007374A patent/AT334133B/de not_active IP Right Cessation
-
1975
- 1975-11-19 DE DE19752551975 patent/DE2551975A1/de not_active Withdrawn
- 1975-11-24 CS CS757944A patent/CS195717B2/cs unknown
- 1975-11-28 DK DK537475A patent/DK537475A/da unknown
- 1975-12-08 CA CA241,581A patent/CA1053232A/en not_active Expired
- 1975-12-08 ZA ZA757673A patent/ZA757673B/xx unknown
- 1975-12-08 GB GB5028475A patent/GB1474896A/en not_active Expired
- 1975-12-09 HU HU75CE1071A patent/HU173972B/hu unknown
- 1975-12-09 IL IL48636A patent/IL48636A/xx unknown
- 1975-12-10 FR FR7537757A patent/FR2295028A1/fr active Granted
- 1975-12-15 LU LU74020A patent/LU74020A1/xx unknown
- 1975-12-15 PL PL1975185576A patent/PL97265B1/pl unknown
- 1975-12-15 DD DD190157A patent/DD122470A1/xx unknown
- 1975-12-16 BE BE162786A patent/BE836691A/xx unknown
- 1975-12-16 US US05/641,588 patent/US4058390A/en not_active Expired - Lifetime
- 1975-12-16 ES ES443536A patent/ES443536A1/es not_active Expired
- 1975-12-16 NL NL7514641A patent/NL7514641A/xx not_active Application Discontinuation
- 1975-12-17 BR BR7508389*A patent/BR7508389A/pt unknown
- 1975-12-17 JP JP50149641A patent/JPS5186131A/ja active Pending
- 1975-12-17 CH CH1634775A patent/CH595043A5/xx not_active IP Right Cessation
- 1975-12-17 SU SU752199208A patent/SU625576A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| ATA1007374A (de) | 1976-04-15 |
| US4058390A (en) | 1977-11-15 |
| SU625576A3 (ru) | 1978-09-25 |
| ES443536A1 (es) | 1977-05-01 |
| DE2551975A1 (de) | 1976-07-01 |
| IL48636A0 (en) | 1976-02-29 |
| AU8741375A (en) | 1977-06-16 |
| CH595043A5 (show.php) | 1978-01-31 |
| CA1053232A (en) | 1979-04-24 |
| PL97265B1 (pl) | 1978-02-28 |
| JPS5186131A (show.php) | 1976-07-28 |
| DK537475A (da) | 1976-06-18 |
| AT334133B (de) | 1976-12-27 |
| GB1474896A (en) | 1977-05-25 |
| BR7508389A (pt) | 1976-08-24 |
| ZA757673B (en) | 1976-11-24 |
| FR2295028A1 (fr) | 1976-07-16 |
| IL48636A (en) | 1978-12-17 |
| DD122470A1 (show.php) | 1976-10-12 |
| FR2295028B1 (show.php) | 1979-06-29 |
| BE836691A (fr) | 1976-06-16 |
| NL7514641A (nl) | 1976-06-21 |
| HU173972B (hu) | 1979-10-28 |
| LU74020A1 (show.php) | 1976-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4394159A (en) | 2-Chloro-3-(phenoxy or phenylthio)-6-6-nitro -anilines | |
| DD229015A5 (de) | Neue n-alkoxy- und n-alkylsulfonylaminosulfonylharnstoffe, und neue (pyrimido) triazino-thiadiazinoxide als vorprodukte | |
| US3367949A (en) | Sulfanilamides | |
| US4561880A (en) | 1H[1,2,4]-Triazolo[1,2-a]pyridazine-1,3-diones useful as herbicides | |
| US3790571A (en) | Phenylpyridazines | |
| DE69126836T2 (de) | Herbizide | |
| JPS58103371A (ja) | 除草剤用スルホンアミド類 | |
| US4738961A (en) | Pyridazinone derivatives, their preparation and their use in agricultural compositions and the treatment of seed and plants | |
| CS195717B2 (en) | Herbicide and method of producing the same | |
| US4331807A (en) | Pyridazine urea plant growth regulators | |
| PH26301A (en) | N-phenylalkylbenzamide fungicides | |
| US4144049A (en) | N-(4-Benzyloxyphenyl)-N-methyl-N-methoxyurea | |
| US3932405A (en) | Phenylpyridazines | |
| GB2050349A (en) | Isonicotinoyl derivatives of aminoacids | |
| HU176584B (en) | Herbicide preparation containing of active mateirals of two types | |
| US3999974A (en) | Barbituric acid derivatives | |
| GB2137092A (en) | Phenoxypropionic Acid Derivatives for Selective Herbicides in Rice Crops | |
| EP0052668B1 (en) | N-(4-pyridazinyl)-n'-phenylureas and -thioureas as well as plant growth regulators containing same | |
| DE69823191T2 (de) | 1,2,3-thiadiazol-derivate, mittel zur kontrolle von pflanzenkrankheiten und methode zu seiner anwendung | |
| DD220217A5 (de) | Herbizide und wachstumregulierende mittel | |
| US4068081A (en) | Δ-Triazine-2,6-dione | |
| US3969362A (en) | Isopropyl-N-(5-bromo or chloropyridyl-2)carbamate | |
| US4213775A (en) | Diphenyl ether derivatives and herbicidal compositions containing the same | |
| DE3330602A1 (de) | Neue pyrazolyl- und isoxazolylsulfonylharnstoffe | |
| US3355352A (en) | Fungicidal composition |