CH669390A5 - - Google Patents
Download PDFInfo
- Publication number
- CH669390A5 CH669390A5 CH2928/87A CH292887A CH669390A5 CH 669390 A5 CH669390 A5 CH 669390A5 CH 2928/87 A CH2928/87 A CH 2928/87A CH 292887 A CH292887 A CH 292887A CH 669390 A5 CH669390 A5 CH 669390A5
- Authority
- CH
- Switzerland
- Prior art keywords
- mass
- ice
- agent according
- concentrate
- alcohol
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 23
- 239000003795 chemical substances by application Substances 0.000 claims description 22
- 239000012141 concentrate Substances 0.000 claims description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 17
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 13
- 239000002699 waste material Substances 0.000 claims description 11
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 10
- 239000004576 sand Substances 0.000 claims description 10
- 239000011780 sodium chloride Substances 0.000 claims description 10
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 claims description 8
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 7
- 239000000654 additive Substances 0.000 claims description 7
- 239000001110 calcium chloride Substances 0.000 claims description 7
- 229910001628 calcium chloride Inorganic materials 0.000 claims description 7
- 238000007710 freezing Methods 0.000 claims description 7
- 230000008014 freezing Effects 0.000 claims description 7
- 235000013379 molasses Nutrition 0.000 claims description 6
- 235000013877 carbamide Nutrition 0.000 claims description 5
- 239000004202 carbamide Substances 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- -1 river gravel Substances 0.000 claims description 5
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 4
- 230000000996 additive effect Effects 0.000 claims description 4
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 3
- 239000001103 potassium chloride Substances 0.000 claims description 2
- 235000011164 potassium chloride Nutrition 0.000 claims description 2
- 239000002893 slag Substances 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 239000000126 substance Substances 0.000 description 17
- 235000002639 sodium chloride Nutrition 0.000 description 16
- 230000000694 effects Effects 0.000 description 13
- 239000000243 solution Substances 0.000 description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 230000007797 corrosion Effects 0.000 description 7
- 238000005260 corrosion Methods 0.000 description 7
- 238000010257 thawing Methods 0.000 description 7
- 230000007613 environmental effect Effects 0.000 description 5
- 230000009931 harmful effect Effects 0.000 description 5
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 4
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 4
- 229910052742 iron Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000003892 spreading Methods 0.000 description 4
- 230000007480 spreading Effects 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 3
- 239000003245 coal Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 238000000855 fermentation Methods 0.000 description 3
- 230000004151 fermentation Effects 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000010426 asphalt Substances 0.000 description 2
- 150000001720 carbohydrates Chemical class 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 239000004567 concrete Substances 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 102100033067 Growth factor receptor-bound protein 2 Human genes 0.000 description 1
- 108091009389 Growth factor receptor-bound protein 2 Proteins 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 229910003251 Na K Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- DVARTQFDIMZBAA-UHFFFAOYSA-O ammonium nitrate Chemical class [NH4+].[O-][N+]([O-])=O DVARTQFDIMZBAA-UHFFFAOYSA-O 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 230000002528 anti-freeze Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 230000000711 cancerogenic effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 231100000315 carcinogenic Toxicity 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 238000007728 cost analysis Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229940005740 hexametaphosphate Drugs 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000011147 magnesium chloride Nutrition 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N methyl undecanoic acid Natural products CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- RAFRTSDUWORDLA-UHFFFAOYSA-N phenyl 3-chloropropanoate Chemical compound ClCCC(=O)OC1=CC=CC=C1 RAFRTSDUWORDLA-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000012113 quantitative test Methods 0.000 description 1
- 239000011150 reinforced concrete Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000002352 surface water Substances 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
- 229960001763 zinc sulfate Drugs 0.000 description 1
- 229910000368 zinc sulfate Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K3/00—Materials not provided for elsewhere
- C09K3/18—Materials not provided for elsewhere for application to surfaces to minimize adherence of ice, mist or water thereto; Thawing or antifreeze materials for application to surfaces
- C09K3/185—Thawing materials
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Combustion & Propulsion (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Materials Applied To Surfaces To Minimize Adherence Of Mist Or Water (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PCT/HU1985/000071 WO1987003293A1 (fr) | 1985-11-29 | 1985-11-29 | Produit antigel pouvant etre utilise aussi pour le deneigement et le degivrage |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH669390A5 true CH669390A5 (enExample) | 1989-03-15 |
Family
ID=10980629
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH2928/87A CH669390A5 (enExample) | 1985-11-29 | 1987-11-29 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4676918A (enExample) |
| AT (1) | AT393275B (enExample) |
| CH (1) | CH669390A5 (enExample) |
| FR (1) | FR2591229B1 (enExample) |
| WO (1) | WO1987003293A1 (enExample) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1222403B (it) * | 1987-07-30 | 1990-09-05 | Alberto Canzani | Composizione leggera attivante di attrico e dotata di proprieta' disgelanti,particolarmente per impiego su superfici innevate o gelate |
| US4953360A (en) * | 1989-09-27 | 1990-09-04 | Slick Ice Limited | Additive for treating water used to form ice |
| FR2682682B1 (fr) * | 1991-10-21 | 2002-07-19 | Rene Mathieu | Composition deglacante et antiderapante pour entretien des chaussees. |
| US5599475A (en) * | 1995-09-15 | 1997-02-04 | Ossian, Inc. | De-icing composition and method for making same |
| US5922240A (en) * | 1995-11-09 | 1999-07-13 | Ice Ban Usa, Inc. | Deicing composition and method |
| US5733590A (en) * | 1995-11-17 | 1998-03-31 | Holladay; Wayland | Slow release non-protein nitrogen source for ruminant feed and process of making |
| US5635101A (en) * | 1996-01-22 | 1997-06-03 | Janke George A | Deicing composition and method |
| US5709813A (en) * | 1996-03-21 | 1998-01-20 | Janke; George A. | Deicing composition and method |
| US5709812A (en) * | 1996-04-25 | 1998-01-20 | Janke; George A. | Deicing composition and method |
| US6506318B1 (en) * | 1997-09-30 | 2003-01-14 | Mli Associates, Llc | Environmentally benign anti-icing or deicing fluids |
| US5876621A (en) | 1997-09-30 | 1999-03-02 | Sapienza; Richard | Environmentally benign anti-icing or deicing fluids |
| US20070012896A1 (en) * | 1997-09-30 | 2007-01-18 | Richard Sapienza | Environmentally benign anti-icing or deicing fluids |
| US20030168625A1 (en) * | 1997-09-30 | 2003-09-11 | Richard Sapienza | Environmentally benign anti-icing or deicing fluids |
| US6596188B1 (en) | 1998-01-07 | 2003-07-22 | Sears Petroleum & Transport Corp. | Deicing solution |
| US7045076B2 (en) * | 1998-01-07 | 2006-05-16 | Sears Petroleum & Transport Corp. & Sears Ecological Applications Co., Llc | Deicing solution |
| US6299793B1 (en) | 1998-01-07 | 2001-10-09 | Sears Petroleum & Transport Corp. | Deicing solution |
| US6440325B1 (en) * | 1998-01-07 | 2002-08-27 | Sears Petroleum & Transport Corporation | De-icing solution |
| US6582622B1 (en) * | 1998-01-07 | 2003-06-24 | Sears Petroleum & Transport Corp. | De-icing solution |
| US6599440B2 (en) | 1998-01-07 | 2003-07-29 | Sears Petroleum & Transport Corporation | Deicing solution |
| US6436310B1 (en) * | 1998-01-07 | 2002-08-20 | Sears Petroleum & Transport Corporation | Deicing solution |
| US7135126B2 (en) * | 1998-01-07 | 2006-11-14 | Sears Petroleum & Transport Corp. And Sears Ecological Applications Co., Llc | Deicing formulation having improved stickiness |
| RU2123022C1 (ru) * | 1998-02-17 | 1998-12-10 | Кальнер Вениамин Давыдович | Способ получения реагента на основе комплексных соединений кальция и магния |
| AU3515899A (en) * | 1998-03-12 | 1999-09-27 | Klaus Hofmann | Winter grit |
| AT2291U1 (de) * | 1998-04-28 | 1998-08-25 | Mitterlehner Hans | Frostschutzeinrichtung |
| US6156226A (en) * | 1998-06-10 | 2000-12-05 | Thermo Fibergen, Inc. | Liquid and solid de-icing and anti-icing compositions and methods for making same |
| US6149834A (en) * | 1998-10-27 | 2000-11-21 | The Dow Chemical Company | Corrosion inhibited chloride salt de-icers |
| US6080330A (en) * | 1999-06-14 | 2000-06-27 | Bloomer; Todd A. | Anti-freezing and deicing composition and method |
| EP1190012B1 (en) * | 1999-02-24 | 2009-07-29 | Todd A. Bloomer | Anti-freezing and deicing composition and method |
| US6156227A (en) * | 1999-03-01 | 2000-12-05 | Cargill, Incorporated | Deicer composition which includes a plant material which is a corrosion inhibitor |
| CN1370212A (zh) * | 1999-07-26 | 2002-09-18 | 明尼苏达粮食加工公司 | 去冰组合物及方法 |
| US7814512B2 (en) * | 2002-09-27 | 2010-10-12 | Microsoft Corporation | Dynamic adjustment of EPG level of detail based on user behavior |
| US7563386B2 (en) * | 1999-07-26 | 2009-07-21 | Archer-Daniels-Midland Company | De-icing composition and method |
| EP1259575B1 (en) * | 2000-02-28 | 2006-09-27 | Cargill Incorporated | Improved deicer and pre-wetting agent |
| US6800217B2 (en) * | 2000-02-28 | 2004-10-05 | Cargill, Incorporated | Deicer and pre-wetting agent |
| US6416684B1 (en) * | 2001-06-26 | 2002-07-09 | Grain Processing Corp | Anti-freezing and deicing composition and method |
| US7033422B2 (en) * | 2002-09-11 | 2006-04-25 | Grain Processing Corporation | Release agents, related anti-freezing/deicing compositions, and related methods |
| US20090314983A1 (en) * | 2003-01-13 | 2009-12-24 | Richard Sapienza | Environmentally benign anti-icing or deicing fluids |
| US6861009B1 (en) * | 2003-03-06 | 2005-03-01 | E. Greg Leist | Deicing compositions and methods of use |
| US20060169947A1 (en) * | 2003-03-06 | 2006-08-03 | Leist E G | Deicing compositions and methods of use |
| US7270768B2 (en) * | 2003-09-23 | 2007-09-18 | Mli Associates, Llc | Environmentally benign anti-icing or deicing fluids employing triglyceride processing by-products |
| US8313667B2 (en) | 2003-09-23 | 2012-11-20 | Mli Associates, L.L.C. | Environmentally benign anti-icing or deicing fluids employing triglyceride processing by-products |
| US6890451B2 (en) * | 2003-09-23 | 2005-05-10 | Richard Sapienza | Environmentally benign anti-icing or deicing fluids employing triglyceride processing by-products |
| US20050133757A1 (en) * | 2003-12-22 | 2005-06-23 | Shinya Satoh | Cold Storage agent, cold preserving material, and freezer |
| US20060202156A1 (en) * | 2005-02-02 | 2006-09-14 | Richard Sapienza | Environmentally benign anti-icing or deicing fluids employing industrial streams comprising hydroxycarboxylic acid salts and/or other effective deicing/anti-icing agents |
| RU2293755C2 (ru) * | 2005-04-08 | 2007-02-20 | ЗАО "Бенатекс" | Состав для удаления снежно-ледяных образований |
| US20060270866A1 (en) * | 2005-05-25 | 2006-11-30 | Richard Sapienza | Processes for production of esters from olefin-containing hydrocarbon streams and vegetable or animal oils |
| RU2287005C1 (ru) * | 2005-10-06 | 2006-11-10 | Общество с ограниченной ответственностью "СБГ-Трейдинг" | Препарат для удаления снежно-ледяного покрова |
| US20070110909A1 (en) * | 2005-11-14 | 2007-05-17 | Isakoff Louis A | Reduction or elimination of microbial growth and biofouling of salted wet biomass byproducts |
| KR100689296B1 (ko) | 2006-01-25 | 2007-03-02 | 정승철 | 제설제 및 그 제조방법 |
| US7736411B2 (en) * | 2006-05-26 | 2010-06-15 | Michael Maffei | Renewable process for manufacturing ground and soil treatment compounds using plant by-products |
| GB0712175D0 (en) * | 2007-06-23 | 2007-08-01 | Salt Union Ltd | De-icing method |
| US20090166582A1 (en) * | 2007-12-27 | 2009-07-02 | Sears Petroleum & Transport Corporation | Calcium chloride solution having improved corrosion resistance |
| US20090169422A1 (en) * | 2007-12-27 | 2009-07-02 | Sears Petroleum & Transport Corporation and Sears Ecological Applications Co., LLC | Corrosion resistance of industrial brine solutions |
| US7556742B1 (en) * | 2008-03-08 | 2009-07-07 | Shahram Ghaemaghami Rad | Deicing and anti-icing composition having anti-corrosion properties and method for making same |
| CA2725367C (en) * | 2008-06-09 | 2018-01-23 | Sears Petroleum & Transport Corporation & Sears Ecological Applications Co., Llc | Anticorrosive composition |
| US7972531B2 (en) * | 2008-08-25 | 2011-07-05 | Natural Alternatives, Llc | Anti-freezing/deicing agent and related methods |
| US8262926B2 (en) | 2011-02-14 | 2012-09-11 | Kassouni Van M | Method of making calcium chloride—aggregate composition |
| LT6141B (lt) | 2013-12-19 | 2015-04-27 | UAB "ARVI" ir ko | Sniego-ledo tirpinimo mišinys |
| US10609765B2 (en) | 2017-05-23 | 2020-03-31 | Nathaniel Johnson | Ice melting assembly |
| WO2020030830A1 (es) * | 2018-08-06 | 2020-02-13 | Success World, S.L. | Composición ignífuga |
| CN113613964A (zh) * | 2019-03-20 | 2021-11-05 | 株式会社小糸制作所 | 传感器系统 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2410910A (en) * | 1944-03-27 | 1946-11-12 | Bertrand H Wait | Material for providing traction |
| CH399508A (fr) * | 1961-07-10 | 1965-09-30 | Mo Och Domsjoe Ab | Procédé de traitement de la neige ou de la glace pour accélérer sa fusion |
| US3712802A (en) * | 1969-06-02 | 1973-01-23 | Marketing And Res Services Inc | Composition and method for treating plants and trees |
| US3712123A (en) * | 1971-01-07 | 1973-01-23 | Blh Electronics | Compound-plate strain gage transducer |
| DE2236811C3 (de) * | 1972-07-27 | 1979-12-06 | Basf Ag, 6700 Ludwigshafen | Verwendung von Lösungen zum Auftauen von vereisten Flächen |
| DD111523A3 (enExample) * | 1973-02-13 | 1975-02-20 | ||
| CH599967A5 (enExample) * | 1975-11-25 | 1978-06-15 | Plastiroute Sa | |
| SU800177A1 (ru) * | 1977-04-20 | 1981-01-30 | Сибирский Научно-Исследовательс-Кий И Проектный Институт Цемент-Ной Промышленности | Средство против примерзани СыпучиХ МАТЕРиАлОВ K ВНуТРЕННЕйпОВЕРХНОСТи ТРАНСпОРТНыХ СРЕдСТВ |
| SU652138A1 (ru) * | 1977-05-12 | 1979-03-15 | Херсонский Сельскохозяйственный Институт Им.А.Д.Цюрупы | Бетонна смесь |
| DE2834225C3 (de) * | 1978-08-04 | 1985-12-05 | Hoechst Ag, 6230 Frankfurt | Mittel zum Auftauen von eis- und/oder schneebedeckten Flächen und Verfahren zum Auftauen von vereisten Flugplatzflächen |
| DE3001930A1 (de) * | 1980-01-19 | 1981-07-23 | Erich Friedrich Metalle-Hüttenprodukte (GmbH & Co) KG, 2000 Hamburg | Streumittel fuer rutschige wege und strassen |
| US4439337A (en) * | 1981-11-20 | 1984-03-27 | The Dow Chemical Company | Composition and method for preventing freezing together of various surfaces |
| FR2516956A1 (fr) * | 1981-11-23 | 1983-05-27 | Autoroutes Cie Financ Indle | Epandeuse de deverglacage |
| DE3200734C2 (de) * | 1982-01-13 | 1983-12-08 | Hebel Gasbetonwerk Alzenau GmbH, 8755 Alzenau | Streumittel zur Beseitigung oder Verhinderung von Schnee- und bzw. oder Eisglätte |
| EP0114927A3 (en) * | 1983-01-04 | 1985-07-31 | Wallace Rippie | De-icing composition and process for preparation |
| US4512907A (en) * | 1984-02-06 | 1985-04-23 | Koos, Inc. | Ice melter and method of making same |
-
1985
- 1985-11-29 WO PCT/HU1985/000071 patent/WO1987003293A1/de not_active Ceased
- 1985-11-29 AT AT9087/85A patent/AT393275B/de active
- 1985-12-06 FR FR8518091A patent/FR2591229B1/fr not_active Expired
-
1986
- 1986-01-28 US US06/823,327 patent/US4676918A/en not_active Expired - Lifetime
-
1987
- 1987-11-29 CH CH2928/87A patent/CH669390A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2591229B1 (fr) | 1987-12-24 |
| AT393275B (de) | 1991-09-25 |
| US4676918A (en) | 1987-06-30 |
| FR2591229A1 (fr) | 1987-06-12 |
| WO1987003293A1 (fr) | 1987-06-04 |
| ATA908785A (de) | 1991-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT393275B (de) | Frostschutzmittel auf basis von melasseschlempe | |
| DE68917477T2 (de) | Verfahren zur schaffung einer grenzschicht zwischen substrat und atmosphäre. | |
| AT394199B (de) | Gefrierschutz- und eisloesemittel enthaltend polycarbonsaeuren | |
| DE2100627A1 (de) | Verfahren zur Abfallbeseitigung | |
| LT4864B (lt) | Sapropelio trąšos ir jų gavimo būdas | |
| CZ299898A3 (cs) | Prostředek pro odstraňování ledu a způsob jeho provedení | |
| DE2306845B2 (de) | Mittel zur beschleunigten Beseitigung von Erdölprodukten durch biologischen Abbau | |
| DE2104230C3 (enExample) | ||
| EP0500199B1 (de) | Verfahren zum Aufbereiten von kontaminierten Gewässersedimenten | |
| DE69828439T2 (de) | Stabilisierte flüssige kalk dispersion für abwasserbehandlung | |
| DE112005001511T5 (de) | Schneeschmelz-/Gefrierschutzmittel | |
| DE102017104529B4 (de) | Verwendung eines Gemisches von Tierexkrementen und Laub zur Geruchsreduzierung der Tierexkremente | |
| DE2417431A1 (de) | Verfahren zum konditionieren von frisch- und seewasser von oel | |
| AT394851B (de) | Verfahren zum herstellen von hochwertigem duenger aus pansenmist | |
| DE2249168C2 (de) | Nicht-emulgierendes Präparat in flüssiger Form zur Beseitigung von Ölverschmutzungen auf Wasser- und Sandflächen und seine Verwendung | |
| DE3141644A1 (de) | Umweltfreundliches streusalz und verfahren zu seiner herstellung | |
| DE2849810B2 (de) | Streumittel zur Beseitigung oder Verhinderung von Schnee- und/oder Eisglätte | |
| RU2787505C1 (ru) | Способ укрепления поверхности деградированной почвы | |
| AT158750B (de) | Verfahren, um frischen Meeresschlick bzw. schlickähnliche Massen in der Urform transportfähig zu machen. | |
| SU1555335A1 (ru) | Эмульси дл обеспыливани дорожных и аэродромных покрытий | |
| HU206225B (en) | Melting mixture for removing snow and ice from surfaces, particularly for ensuring winter traffic on public roads | |
| DE2649696A1 (de) | Mischgut zur herstellung eines eine eisbildung hemmenden und schnee tauenden strassenbelags | |
| DE1771525C3 (de) | Die Korrosion hemmende Salzmischungen | |
| DE2803251C3 (de) | Mittel und Verfahren zur Versiegelung der Oberflächen von Halden und Deponien | |
| SU834083A1 (ru) | Состав дл обеспыливани грунтов |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |