CH651283A5 - Explosionsfaehige wasser-in-oel-emulsionszubereitung. - Google Patents
Explosionsfaehige wasser-in-oel-emulsionszubereitung. Download PDFInfo
- Publication number
- CH651283A5 CH651283A5 CH6701/81A CH670181A CH651283A5 CH 651283 A5 CH651283 A5 CH 651283A5 CH 6701/81 A CH6701/81 A CH 6701/81A CH 670181 A CH670181 A CH 670181A CH 651283 A5 CH651283 A5 CH 651283A5
- Authority
- CH
- Switzerland
- Prior art keywords
- preparation
- explosive
- preparation according
- emulsion
- water
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 103
- 239000002360 explosive Substances 0.000 title claims description 51
- 239000007762 w/o emulsion Substances 0.000 title claims description 11
- 239000000839 emulsion Substances 0.000 claims description 41
- 150000003839 salts Chemical class 0.000 claims description 31
- 230000035945 sensitivity Effects 0.000 claims description 30
- 239000000446 fuel Substances 0.000 claims description 26
- 239000000463 material Substances 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 22
- 230000001590 oxidative effect Effects 0.000 claims description 20
- 238000005474 detonation Methods 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 17
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 16
- 239000011159 matrix material Substances 0.000 claims description 16
- 239000003995 emulsifying agent Substances 0.000 claims description 15
- 239000001993 wax Substances 0.000 claims description 15
- 239000004005 microsphere Substances 0.000 claims description 10
- 239000002245 particle Substances 0.000 claims description 10
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 9
- 239000003921 oil Substances 0.000 claims description 9
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 claims description 8
- 239000011780 sodium chloride Substances 0.000 claims description 8
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 7
- 229910052782 aluminium Inorganic materials 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 7
- 239000011521 glass Substances 0.000 claims description 7
- 235000019198 oils Nutrition 0.000 claims description 7
- 229910002651 NO3 Inorganic materials 0.000 claims description 6
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 5
- 150000003973 alkyl amines Chemical class 0.000 claims description 5
- 238000004880 explosion Methods 0.000 claims description 5
- 239000004200 microcrystalline wax Substances 0.000 claims description 5
- 235000019808 microcrystalline wax Nutrition 0.000 claims description 5
- 239000012188 paraffin wax Substances 0.000 claims description 5
- 235000019271 petrolatum Nutrition 0.000 claims description 5
- 235000010344 sodium nitrate Nutrition 0.000 claims description 5
- 239000004317 sodium nitrate Substances 0.000 claims description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 150000002823 nitrates Chemical class 0.000 claims description 4
- 239000012266 salt solution Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 235000019809 paraffin wax Nutrition 0.000 claims description 3
- 230000001235 sensitizing effect Effects 0.000 claims description 3
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 241000238631 Hexapoda Species 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 239000004264 Petrolatum Substances 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 239000012164 animal wax Substances 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims description 2
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 claims description 2
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 239000011133 lead Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 239000012184 mineral wax Substances 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 229940066842 petrolatum Drugs 0.000 claims description 2
- 239000003208 petroleum Substances 0.000 claims description 2
- 229910052709 silver Inorganic materials 0.000 claims description 2
- 239000004332 silver Substances 0.000 claims description 2
- BAZAXWOYCMUHIX-UHFFFAOYSA-M sodium perchlorate Chemical compound [Na+].[O-]Cl(=O)(=O)=O BAZAXWOYCMUHIX-UHFFFAOYSA-M 0.000 claims description 2
- 229910001488 sodium perchlorate Inorganic materials 0.000 claims description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 claims description 2
- 239000008158 vegetable oil Substances 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 claims 2
- 239000007884 disintegrant Substances 0.000 claims 2
- SPSSULHKWOKEEL-UHFFFAOYSA-N 2,4,6-trinitrotoluene Chemical compound CC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O SPSSULHKWOKEEL-UHFFFAOYSA-N 0.000 claims 1
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 claims 1
- 239000000026 Pentaerythritol tetranitrate Substances 0.000 claims 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims 1
- 239000000654 additive Substances 0.000 claims 1
- 239000003245 coal Substances 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 238000005065 mining Methods 0.000 claims 1
- 229960004321 pentaerithrityl tetranitrate Drugs 0.000 claims 1
- 150000003464 sulfur compounds Chemical class 0.000 claims 1
- 239000000015 trinitrotoluene Substances 0.000 claims 1
- -1 sodium chloride Chemical class 0.000 description 12
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- FONBHTQCMAUYEF-UHFFFAOYSA-N ethane-1,2-diamine;nitric acid Chemical compound NCCN.O[N+]([O-])=O.O[N+]([O-])=O FONBHTQCMAUYEF-UHFFFAOYSA-N 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- PTIUDKQYXMFYAI-UHFFFAOYSA-N methylammonium nitrate Chemical compound NC.O[N+]([O-])=O PTIUDKQYXMFYAI-UHFFFAOYSA-N 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 235000013871 bee wax Nutrition 0.000 description 2
- 239000012166 beeswax Substances 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- DSEKYWAQQVUQTP-XEWMWGOFSA-N (2r,4r,4as,6as,6as,6br,8ar,12ar,14as,14bs)-2-hydroxy-4,4a,6a,6b,8a,11,11,14a-octamethyl-2,4,5,6,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydro-1h-picen-3-one Chemical compound C([C@H]1[C@]2(C)CC[C@@]34C)C(C)(C)CC[C@]1(C)CC[C@]2(C)[C@H]4CC[C@@]1(C)[C@H]3C[C@@H](O)C(=O)[C@@H]1C DSEKYWAQQVUQTP-XEWMWGOFSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- CMCBDXRRFKYBDG-UHFFFAOYSA-N 1-dodecoxydodecane Chemical compound CCCCCCCCCCCCOCCCCCCCCCCCC CMCBDXRRFKYBDG-UHFFFAOYSA-N 0.000 description 1
- HBXWUCXDUUJDRB-UHFFFAOYSA-N 1-octadecoxyoctadecane Chemical compound CCCCCCCCCCCCCCCCCCOCCCCCCCCCCCCCCCCCC HBXWUCXDUUJDRB-UHFFFAOYSA-N 0.000 description 1
- WHQOKFZWSDOTQP-UHFFFAOYSA-N 2,3-dihydroxypropyl 4-aminobenzoate Chemical compound NC1=CC=C(C(=O)OCC(O)CO)C=C1 WHQOKFZWSDOTQP-UHFFFAOYSA-N 0.000 description 1
- DYSXLQBUUOPLBB-UHFFFAOYSA-N 2,3-dinitrotoluene Chemical compound CC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O DYSXLQBUUOPLBB-UHFFFAOYSA-N 0.000 description 1
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000007049 Juglans regia Species 0.000 description 1
- 235000009496 Juglans regia Nutrition 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- IYFATESGLOUGBX-YVNJGZBMSA-N Sorbitan monopalmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O IYFATESGLOUGBX-YVNJGZBMSA-N 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- IJCWFDPJFXGQBN-RYNSOKOISA-N [(2R)-2-[(2R,3R,4S)-4-hydroxy-3-octadecanoyloxyoxolan-2-yl]-2-octadecanoyloxyethyl] octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCCCCCCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCCCCCCCCCCCC IJCWFDPJFXGQBN-RYNSOKOISA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 1
- 229910001964 alkaline earth metal nitrate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- KZTZJUQNSSLNAG-UHFFFAOYSA-N aminoethyl nitrate Chemical compound NCCO[N+]([O-])=O KZTZJUQNSSLNAG-UHFFFAOYSA-N 0.000 description 1
- HHEFNVCDPLQQTP-UHFFFAOYSA-N ammonium perchlorate Chemical class [NH4+].[O-]Cl(=O)(=O)=O HHEFNVCDPLQQTP-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000012174 chinese wax Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- AHRQMWOXLCFNAV-UHFFFAOYSA-O ethylammonium nitrate Chemical compound CC[NH3+].[O-][N+]([O-])=O AHRQMWOXLCFNAV-UHFFFAOYSA-O 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000012170 montan wax Substances 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 229910001487 potassium perchlorate Inorganic materials 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229940035044 sorbitan monolaurate Drugs 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 239000001570 sorbitan monopalmitate Substances 0.000 description 1
- 235000011071 sorbitan monopalmitate Nutrition 0.000 description 1
- 229940031953 sorbitan monopalmitate Drugs 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- 239000001589 sorbitan tristearate Substances 0.000 description 1
- 235000011078 sorbitan tristearate Nutrition 0.000 description 1
- 229960004129 sorbitan tristearate Drugs 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 235000020234 walnut Nutrition 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
- C06B47/145—Water in oil emulsion type explosives in which a carbonaceous fuel forms the continuous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Colloid Chemistry (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/201,208 US4371408A (en) | 1980-10-27 | 1980-10-27 | Low water emulsion explosive compositions optionally containing inert salts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH651283A5 true CH651283A5 (de) | 1985-09-13 |
Family
ID=22744913
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH6701/81A CH651283A5 (de) | 1980-10-27 | 1981-10-20 | Explosionsfaehige wasser-in-oel-emulsionszubereitung. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4371408A (enExample) |
| CA (1) | CA1160052A (enExample) |
| CH (1) | CH651283A5 (enExample) |
| DE (1) | DE3141980A1 (enExample) |
| IN (2) | IN158492B (enExample) |
| MX (1) | MX160778A (enExample) |
| PH (1) | PH15234A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2123489C1 (ru) * | 1996-11-05 | 1998-12-20 | Закрытое акционерное общество "Кузбассэмульсия" | Состав эмульсии для эмульсионных взрывчатых веществ и способ ее изготовления |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6028796B2 (ja) * | 1982-01-27 | 1985-07-06 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬の製造法 |
| CA1162744A (en) * | 1982-02-02 | 1984-02-28 | Howard A. Bampfield | Emulsion explosive compositions and method of preparation |
| SE457952B (sv) * | 1982-09-15 | 1989-02-13 | Nitro Nobel Ab | Spraengaemne |
| US4428784A (en) | 1983-03-07 | 1984-01-31 | Ireco Chemicals | Blasting compositions containing sodium nitrate |
| DE3380302D1 (en) * | 1983-03-18 | 1989-09-07 | Prb Nobel Explosifs Societe An | Compositions of the "emulsion explosive" type, process for their manufacture and use of these compositions |
| US4419155A (en) * | 1983-04-29 | 1983-12-06 | The United States Of America As Represented By The Secretary Of The Navy | Method for preparing ternary mixtures of ethylenediamine dinitrate, ammonium nitrate and potassium nitrate |
| US4501061A (en) * | 1983-05-31 | 1985-02-26 | Advanced Micro Devices, Inc. | Fluorine plasma oxidation of residual sulfur species |
| JPS6090887A (ja) * | 1983-10-21 | 1985-05-22 | 日本油脂株式会社 | 油中水型エマルシヨン爆薬組成物 |
| SE459419B (sv) * | 1985-05-08 | 1989-07-03 | Nitro Nobel Ab | Foerfarande foer framstaellning av ett emulsionsspraengaemne av typen vatten-i-olja, en braenslefas foer anvaendning vid saadant foerfarande samt ett spraengaemnessystem |
| US4664729A (en) * | 1986-04-14 | 1987-05-12 | Independent Explosives Co. Of Penna. | Water-in-oil explosive emulsion composition |
| JPH0684273B2 (ja) * | 1987-08-25 | 1994-10-26 | 日本油脂株式会社 | 油中水型エマルション爆薬組成物 |
| US5089652A (en) * | 1990-01-17 | 1992-02-18 | Atlas Powder Company | Nitrate ester preparation |
| US4980000A (en) * | 1990-01-17 | 1990-12-25 | Atlas Powder Company | Nitrostarch emulsion explosives production process |
| US5051142A (en) * | 1990-01-17 | 1991-09-24 | Atlas Powder Company | Emulsion explosive containing nitrostarch |
| US5920031A (en) * | 1992-03-17 | 1999-07-06 | The Lubrizol Corporation | Water-in-oil emulsions |
| FR2780726B1 (fr) * | 1998-07-03 | 2000-08-25 | Nobel Explosifs France | Emulsions explosives encartouchees energetiques |
| US6451920B1 (en) | 1999-11-09 | 2002-09-17 | Chevron Chemical Company Llc | Process for making polyalkylene/maleic anhydride copolymer |
| US6893790B2 (en) * | 2003-08-26 | 2005-05-17 | Eastman Kodak Company | Photopatterning of conductive electrode layers containing electrically-conductive polymer particles |
| CN104502561B (zh) * | 2014-11-24 | 2016-06-08 | 葛洲坝易普力股份有限公司 | 一种混装炸药科研试验平台 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3447978A (en) * | 1967-08-03 | 1969-06-03 | Atlas Chem Ind | Ammonium nitrate emulsion blasting agent and method of preparing same |
| US3674578A (en) * | 1970-02-17 | 1972-07-04 | Du Pont | Water-in-oil emulsion type blasting agent |
| US3770522A (en) * | 1970-08-18 | 1973-11-06 | Du Pont | Emulsion type explosive composition containing ammonium stearate or alkali metal stearate |
| US3715247A (en) * | 1970-09-03 | 1973-02-06 | Ici America Inc | Water-in-oil emulsion explosive containing entrapped gas |
| US3765964A (en) * | 1972-10-06 | 1973-10-16 | Ici America Inc | Water-in-oil emulsion type explosive compositions having strontium-ion detonation catalysts |
| AU515896B2 (en) * | 1976-11-09 | 1981-05-07 | Atlas Powder Company | Water-in-oil explosive |
| US4096003A (en) * | 1977-06-10 | 1978-06-20 | Atlas Powder Company | Aluminum, amine nitrate sensitized gel explosive compositions |
| CA1071875A (en) * | 1977-06-23 | 1980-02-19 | Canadian Industries Limited | Thickened aqueous slurry explosive compositions |
| US4149917A (en) * | 1977-11-03 | 1979-04-17 | Atlas Powder Company | Cap sensitive emulsions without any sensitizer other than occluded air |
| US4149916A (en) * | 1977-11-03 | 1979-04-17 | Atlas Powder Company | Cap sensitive emulsions containing perchlorates and occluded air and method |
| US4141767A (en) * | 1978-03-03 | 1979-02-27 | Ireco Chemicals | Emulsion blasting agent |
| US4216040A (en) * | 1979-01-19 | 1980-08-05 | Ireco Chemicals | Emulsion blasting composition |
| US4231821A (en) * | 1979-05-21 | 1980-11-04 | Ireco Chemicals | Emulsion blasting agent sensitized with perlite |
-
1980
- 1980-10-27 US US06/201,208 patent/US4371408A/en not_active Expired - Lifetime
-
1981
- 1981-10-15 PH PH26892A patent/PH15234A/en unknown
- 1981-10-17 IN IN1148/CAL/81A patent/IN158492B/en unknown
- 1981-10-17 IN IN1147/CAL/81A patent/IN158849B/en unknown
- 1981-10-19 CA CA000388195A patent/CA1160052A/en not_active Expired
- 1981-10-20 CH CH6701/81A patent/CH651283A5/de not_active IP Right Cessation
- 1981-10-22 DE DE19813141980 patent/DE3141980A1/de active Granted
- 1981-10-27 MX MX189820A patent/MX160778A/es unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2123489C1 (ru) * | 1996-11-05 | 1998-12-20 | Закрытое акционерное общество "Кузбассэмульсия" | Состав эмульсии для эмульсионных взрывчатых веществ и способ ее изготовления |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3141980A1 (de) | 1982-06-16 |
| DE3141980C2 (enExample) | 1990-08-23 |
| IN158492B (enExample) | 1986-11-29 |
| CA1160052A (en) | 1984-01-10 |
| IN158849B (enExample) | 1987-02-07 |
| PH15234A (en) | 1982-10-05 |
| MX160778A (es) | 1990-05-16 |
| US4371408A (en) | 1983-02-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3141979C2 (enExample) | ||
| DE2731609C2 (de) | Wasser-in-Öl-Emulsionssprengstoffmischung | |
| DE3141980C2 (enExample) | ||
| DE2947982C3 (de) | Wasser-in-Öl-Sprengmittelemulsionen | |
| DE2948465C2 (enExample) | ||
| DE2948332C2 (de) | Wasser-in-Öl-Sprengmittelemulsion | |
| DE2948463A1 (de) | Sprengmittelzusammensetzung in form von wasser-in-oel-emulsionen | |
| DE2350200A1 (de) | Explosivmaterialien | |
| DE3210273C2 (enExample) | ||
| DE3840735A1 (de) | Verfahren zur herstellung eines sprengstoffs | |
| DE69220157T2 (de) | Emulsionssprengstoff | |
| DE2141213A1 (de) | Emulsionssprengstoff | |
| DE3786115T2 (de) | Gegossene sprengstoffzusammensetzung und verfahren. | |
| GB2086363A (en) | Emulsion explosives containing a reduced amount of water | |
| DE3700783A1 (de) | Wasser-in-oel-emulsionssprengstoff | |
| DE3108803A1 (de) | Wasser-in-oel-emulsions-sprengstoff | |
| DE69005735T2 (de) | Emulsionssprengstoff vom Wasser-in-Öl-Typ. | |
| DE3134639C2 (enExample) | ||
| DE69032230T2 (de) | Wasser-in-öl-emulsion-sprengstoffzusammensetzung | |
| DE69906626T2 (de) | Patronierte energetische Emulsionssprengstoffe | |
| DE1009990B (de) | Plastischer Sicherheitssprengstoff mit ausgeglichener Sauerstoffbilanz | |
| DE2832737A1 (de) | Wasser-in-oel-emulsionssprengstoffmischung | |
| DE2640799C2 (de) | Verfahren zum Aufrüsten mehrerer Explosivvorrichtungen mit einem Zündsatz | |
| DE2212278C3 (enExample) | ||
| DE2116353B2 (de) | Pulverförmiger, von flüssigen Salpetersäureestern freier, Ammoniumnitratsprengstoff hoher Wasserfestigkeit und Dichte |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |