CH650501A5 - Chinolin-carbonsaeurederivate. - Google Patents
Chinolin-carbonsaeurederivate. Download PDFInfo
- Publication number
- CH650501A5 CH650501A5 CH1071/81A CH107181A CH650501A5 CH 650501 A5 CH650501 A5 CH 650501A5 CH 1071/81 A CH1071/81 A CH 1071/81A CH 107181 A CH107181 A CH 107181A CH 650501 A5 CH650501 A5 CH 650501A5
- Authority
- CH
- Switzerland
- Prior art keywords
- dihydro
- carboxylic acid
- difluoro
- ethyl
- oxoquinoline
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 title 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 title 1
- 229910052799 carbon Inorganic materials 0.000 title 1
- 150000003839 salts Chemical class 0.000 claims description 24
- 150000004677 hydrates Chemical class 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 9
- -1 4-ethyl-1-piperazinyl Chemical group 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 claims description 6
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 4
- WAQBNLMSCUJTCU-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-(3-hydroxypiperidin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCCC(O)C1 WAQBNLMSCUJTCU-UHFFFAOYSA-N 0.000 claims description 3
- KKRGWLBIQBKEGK-UHFFFAOYSA-N 6,8-difluoro-4-oxo-7-piperazin-1-yl-1-propylquinoline-3-carboxylic acid Chemical compound FC1=C2N(CCC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNCC1 KKRGWLBIQBKEGK-UHFFFAOYSA-N 0.000 claims description 3
- BHZGFPAWRPRLSV-UHFFFAOYSA-N 7-[4-(dimethylamino)piperidin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCC(N(C)C)CC1 BHZGFPAWRPRLSV-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical compound C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 2
- HFMBQTZRNSPHRY-UHFFFAOYSA-N 6,8-difluoro-1-(2-fluoroethyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound FC=1C=C2C(=O)C(C(=O)O)=CN(CCF)C2=C(F)C=1N1CCNCC1 HFMBQTZRNSPHRY-UHFFFAOYSA-N 0.000 claims 1
- WUSHYDGSOVRPHJ-UHFFFAOYSA-N ethyl 7-(4-acetylpiperazin-1-yl)-1-(2-chloroethyl)-6,8-difluoro-4-oxoquinoline-3-carboxylate Chemical compound FC=1C=C2C(=O)C(C(=O)OCC)=CN(CCCl)C2=C(F)C=1N1CCN(C(C)=O)CC1 WUSHYDGSOVRPHJ-UHFFFAOYSA-N 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 39
- 239000000203 mixture Substances 0.000 description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 32
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 28
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 12
- 125000004494 ethyl ester group Chemical group 0.000 description 12
- 239000012044 organic layer Substances 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 239000012670 alkaline solution Substances 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- IVKSZMQEAVLDBO-UHFFFAOYSA-N 6,7,8-trifluoro-1-(2-hydroxyethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(CCO)C=C(C(O)=O)C(=O)C2=C1 IVKSZMQEAVLDBO-UHFFFAOYSA-N 0.000 description 2
- POHNZQDUMULBNN-UHFFFAOYSA-N 6,7,8-trifluoro-1-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=C2N(C)C=C(C(O)=O)C(=O)C2=C1 POHNZQDUMULBNN-UHFFFAOYSA-N 0.000 description 2
- QXMZLXSHMCFPDC-UHFFFAOYSA-N 7-(4-acetylpiperazin-1-yl)-1-(2-chloroethyl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C(=O)C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CCCl)C2=C1F QXMZLXSHMCFPDC-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JHOHWJIKUDBVDP-UHFFFAOYSA-N 1,2-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1=CC=C2C(=O)C(C(=O)O)=C(F)N(F)C2=C1 JHOHWJIKUDBVDP-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- KISVXYVZDKDDSV-UHFFFAOYSA-N 1-ethenyl-6,8-difluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound FC=1C=C2C(=O)C(C(=O)O)=CN(C=C)C2=C(F)C=1N1CCNCC1 KISVXYVZDKDDSV-UHFFFAOYSA-N 0.000 description 1
- CTGLNLHAZKCBET-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-[4-(2-hydroxyethyl)piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCN(CCO)CC1 CTGLNLHAZKCBET-UHFFFAOYSA-N 0.000 description 1
- DASUZCVFUIROFI-UHFFFAOYSA-N 1-ethyl-6,8-difluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C2N(CC)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCOCC1 DASUZCVFUIROFI-UHFFFAOYSA-N 0.000 description 1
- UVIPVURSKTWVJH-UHFFFAOYSA-N 1-ethyl-7-(4-ethylpiperazin-1-yl)-6,8-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(CC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CC)C2=C1F UVIPVURSKTWVJH-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- KRBQJNAQTNYREQ-UHFFFAOYSA-N 6,7,8-trifluoro-1-(2-fluoroethyl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=C(F)C=C2C(=O)C(C(=O)O)=CN(CCF)C2=C1F KRBQJNAQTNYREQ-UHFFFAOYSA-N 0.000 description 1
- QHDWSQNLUDZXKQ-UHFFFAOYSA-N 6,7,8-trifluoro-4-oxo-1h-quinoline-3-carboxylic acid Chemical compound FC1=C(F)C(F)=CC2=C(O)C(C(=O)O)=CN=C21 QHDWSQNLUDZXKQ-UHFFFAOYSA-N 0.000 description 1
- HKFZCDVQUWJWNB-UHFFFAOYSA-N 6,8-difluoro-1-(2-fluoroethyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride Chemical compound [Cl-].C1C[NH+](C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(CCF)C2=C1F HKFZCDVQUWJWNB-UHFFFAOYSA-N 0.000 description 1
- PTVXWODULAQLPD-UHFFFAOYSA-N 6,8-difluoro-1-(2-hydroxyethyl)-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.FC1=C2N(CCO)C=C(C(O)=O)C(=O)C2=CC(F)=C1N1CCNCC1 PTVXWODULAQLPD-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 241001541756 Acinetobacter calcoaceticus subsp. anitratus Species 0.000 description 1
- 241000588813 Alcaligenes faecalis Species 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 241000588919 Citrobacter freundii Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000588697 Enterobacter cloacae Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000588767 Proteus vulgaris Species 0.000 description 1
- 241001354013 Salmonella enterica subsp. enterica serovar Enteritidis Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000191963 Staphylococcus epidermidis Species 0.000 description 1
- 241000607447 Yersinia enterocolitica Species 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- 229940005347 alcaligenes faecalis Drugs 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 208000027096 gram-negative bacterial infections Diseases 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- AGJSNMGHAVDLRQ-HUUJSLGLSA-N methyl (2s)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-amino-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,3-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound SC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(=O)N[C@@H](CCSC)C(=O)OC)CC1=CC=C(O)C(C)=C1C AGJSNMGHAVDLRQ-HUUJSLGLSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- YFJAIURZMRJPDB-UHFFFAOYSA-N n,n-dimethylpiperidin-4-amine Chemical compound CN(C)C1CCNCC1 YFJAIURZMRJPDB-UHFFFAOYSA-N 0.000 description 1
- MHWLWQUZZRMNGJ-UHFFFAOYSA-N nalidixic acid Chemical compound C1=C(C)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHWLWQUZZRMNGJ-UHFFFAOYSA-N 0.000 description 1
- 229960000210 nalidixic acid Drugs 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- JOHZPMXAZQZXHR-UHFFFAOYSA-N pipemidic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CN=C1N1CCNCC1 JOHZPMXAZQZXHR-UHFFFAOYSA-N 0.000 description 1
- 229960001732 pipemidic acid Drugs 0.000 description 1
- BIWOSRSKDCZIFM-UHFFFAOYSA-N piperidin-3-ol Chemical compound OC1CCCNC1 BIWOSRSKDCZIFM-UHFFFAOYSA-N 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- RCIMBBZXSXFZBV-UHFFFAOYSA-N piromidic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CN=C1N1CCCC1 RCIMBBZXSXFZBV-UHFFFAOYSA-N 0.000 description 1
- 229960004444 piromidic acid Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 229940007042 proteus vulgaris Drugs 0.000 description 1
- LOAUVZALPPNFOQ-UHFFFAOYSA-N quinaldic acid Chemical class C1=CC=CC2=NC(C(=O)O)=CC=C21 LOAUVZALPPNFOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229940098232 yersinia enterocolitica Drugs 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE2059018 | 1981-02-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH650501A5 true CH650501A5 (de) | 1985-07-31 |
Family
ID=3865537
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1071/81A CH650501A5 (de) | 1981-02-19 | 1981-02-18 | Chinolin-carbonsaeurederivate. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4398029A (enExample) |
| CA (1) | CA1159831A (enExample) |
| CH (1) | CH650501A5 (enExample) |
| DE (1) | DE3106013A1 (enExample) |
| FR (2) | FR2499990B1 (enExample) |
| SE (1) | SE440354B (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4665079A (en) * | 1984-02-17 | 1987-05-12 | Warner-Lambert Company | Antibacterial agents |
| JPS59128383A (ja) * | 1982-12-29 | 1984-07-24 | Kanebo Ltd | 新規キノリンカルボン酸誘導体および該化合物を有効成分とする抗菌剤 |
| US4473568A (en) * | 1983-03-01 | 1984-09-25 | Warner Lambert Company | Antibacterial thiazolidine or thiomorpholine substituted quinolines |
| DE3308908A1 (de) * | 1983-03-12 | 1984-09-13 | Bayer Ag, 5090 Leverkusen | Bakterizide mittel |
| DE3318145A1 (de) * | 1983-05-18 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-difluor-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US4526975A (en) * | 1983-07-08 | 1985-07-02 | Ethyl Corporation | 2-Amino-4-(4-pyridinyl)benzoic acids |
| AU553415B2 (en) * | 1983-09-19 | 1986-07-17 | Abbott Japan Co., Ltd. | 6-fluoro-1-4-dihydro-4-oxo-7-substituted piperazinyl- quinoline-3-carboxylic acids |
| CA1285279C (en) * | 1984-02-17 | 1991-06-25 | Joseph P. Sanchez | 7-amine derivatives of 1-cyclopropyl-6,8-difluoro-1,4- dihydro-4-oxo-3-quinolinecarboxylic acids and 1-cyclopropyl-1,4-dihydro-6-fluoro-4-oxo-1,8-naphthyridine- 3-carboxylic acidsas antibacterial agents |
| DE3409922A1 (de) * | 1984-03-17 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | 1,7-diamino-1,4-dihydro-4-oxo-3-(aza)chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie ihre verwendung bei der bekaempfung bakterieller erkrankungen |
| DE3420798A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 7-(3-aryl-l-piperazinyl)- sowie 7-(3-cyclohexyl-l-piperazinyl)-3-chinoloncarbonsaeuren |
| DE3420743A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-dihalogen-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US5468861A (en) * | 1984-06-04 | 1995-11-21 | Bayer Aktiengesellschaft | 8-chloro-1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid and alkyl esters thereof |
| DE3420770A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-(3-oxo-1-piperazinyl)-3-chinoloncarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| US4604401A (en) * | 1984-07-20 | 1986-08-05 | Warner-Lambert Company | Antibacterial agents III |
| EP0181521A1 (en) * | 1984-10-19 | 1986-05-21 | Otsuka Pharmaceutical Co., Ltd. | Antimicrobial 1-substituted Phenyl-4-oxoquinoline-3-carboxylic acid compounds |
| US4636506A (en) * | 1984-12-06 | 1987-01-13 | Pfizer, Inc. | 7-heterocyclic-1,4-dihydroquinolones |
| US4623650A (en) | 1984-12-06 | 1986-11-18 | Pfizer Inc. | Antibiotic derivatives of 7-phenyl-1,4-dihydro-4-oxo-3-quinolinecarboxylic acids |
| US4797490A (en) * | 1984-12-06 | 1989-01-10 | Pfizer Inc. | Process for the preparation of 3-(2'-fluorophenyl)pyridine |
| FR2574404B1 (fr) * | 1984-12-12 | 1987-04-24 | Provesan Sa | Derives 1-substitues de l'acide 6-fluoro-7-(pyrrol-1-yl)-1,4-dihydro-4-oxoquinoleine-3-carboxylique, leur preparation et leur application en tant que medicaments |
| US4617308A (en) * | 1985-01-25 | 1986-10-14 | Warner-Lambert Company | 7-substituted amino-1-aryl-6,8-difluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acids and derivatives thereof as antibacterial agents |
| US4755513A (en) * | 1985-01-30 | 1988-07-05 | Otsuka Pharmaceutical Company, Limited | Antimicrobial 1-substituted phenyl-4-oxoquinoline-3-carboxylic acid compounds |
| US4578473A (en) * | 1985-04-15 | 1986-03-25 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| US4657913A (en) * | 1985-04-18 | 1987-04-14 | Warner-Lambert Company | Trifluoro- quinoline -3- carboxylic acids and their use as anti-bacterial agents |
| US4684648A (en) * | 1985-05-10 | 1987-08-04 | Otsuka Pharmaceutical Company Limited | Antimicrobial 1-substituted phenyl-4-oxoquinoline-3-carboxylic acid compounds and compositions thereof |
| GB8512143D0 (en) * | 1985-05-14 | 1985-06-19 | Beecham Group Plc | Method of treatment |
| DE3517535A1 (de) * | 1985-05-15 | 1986-11-20 | Bayer Ag, 5090 Leverkusen | 1-aryl-4-chinolon-3-carbonsaeuren |
| DE3522406A1 (de) * | 1985-06-22 | 1987-01-02 | Bayer Ag | Verfahren zur herstellung von 1,8-verbrueckten 4-chinolon-3-carbonsaeuren |
| IT1201437B (it) * | 1985-07-22 | 1989-02-02 | Uason Srl | Derivato dell'acido chinolin-3-carbossilico,procedimento per la sua preparazione e composizioni farmaceutiche che lo contengono |
| US4692454A (en) * | 1986-02-03 | 1987-09-08 | Warner-Lambert Company | Opthalmic use of quinolone antibiotics |
| DE3705621C2 (de) * | 1986-02-25 | 1997-01-09 | Otsuka Pharma Co Ltd | Heterocyclisch substituierte Chinoloncarbonsäurederivate |
| ZA874696B (en) * | 1986-07-03 | 1988-01-04 | F. Hoffmann-La Roche & Co. Aktiengesellschaft | Acyl derivatives |
| FR2655545B1 (fr) * | 1989-12-11 | 1994-06-10 | Rhone Poulenc Sante | Nouvelle application therapeutique des derives des fluoroquinolones. |
| FR2675144B1 (fr) * | 1991-04-10 | 1995-06-16 | Bouchara Sa | Nouvelles quinolones difluorees - leur procede de preparation et les compositions pharmaceutiques en renfermant. |
| DE10108750A1 (de) * | 2001-02-23 | 2002-09-05 | Bayer Ag | Verbessertes Verfahren zur Herstellung von Fluorchinoloncarbonsäuren |
| SI1666477T1 (sl) * | 2003-09-10 | 2013-10-30 | Kyorin Pharmaceutical Co., Ltd. | Derivati 7-(4-substituiran 3-ciklopropilaminometil-1-pirolidinil) kinolonkarboksilne kisline |
| US8222407B2 (en) * | 2007-05-24 | 2012-07-17 | Kyorin Pharmaceutical Co., Ltd. | Mutilin derivative having heterocyclic aromatic ring carboxylic acid structure in substituent at 14-position |
| FR2916446B1 (fr) | 2007-05-24 | 2009-08-21 | Biocodex Sa | Nouveau procede de synthese de fluoroquinolones |
| CN104876909A (zh) * | 2015-04-24 | 2015-09-02 | 河南大学 | 一种氨甲基三唑取代的多氟喹诺酮羧酸类衍生物及其制备方法和应用 |
| CN109232528A (zh) * | 2018-09-11 | 2019-01-18 | 河南精康制药有限公司 | 一种司帕沙星缩合母液的高效回收利用方法 |
| CN114890945B (zh) * | 2022-04-06 | 2023-09-05 | 大连万福制药有限公司 | 一种合成那氟沙星中间体的方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA947301A (en) * | 1970-01-28 | 1974-05-14 | Sumitomo Chemical Company | Process for the preparation of compound having antibacterial action |
| US4017622A (en) * | 1972-12-18 | 1977-04-12 | Dainippon Pharmaceutical Co., Ltd. | Piperazine derivatives |
| JPS53141286A (en) * | 1977-05-16 | 1978-12-08 | Kyorin Seiyaku Kk | Novel substituted quinolinecarboxylic acid |
| SE444566B (sv) * | 1977-09-20 | 1986-04-21 | Bellon Labor Sa Roger | 7-dialkylamin-6-halogen-4-oxo-1,4-dihydrokinolin-3-karboxylsyra, forfarande for framstellning derav och farmaceutiskt preparat derav |
| JPS5845426B2 (ja) * | 1978-09-29 | 1983-10-08 | 杏林製薬株式会社 | 置換キノリンカルボン酸誘導体 |
| JPS5630964A (en) * | 1979-08-22 | 1981-03-28 | Kyorin Pharmaceut Co Ltd | Novel substituted quinolinecarboxylic acid and its preparation |
| JPS56128764A (en) * | 1980-03-14 | 1981-10-08 | Kyorin Pharmaceut Co Ltd | Quinolinecarboxylic acid derivative and its preparation |
-
1981
- 1981-02-12 SE SE8100978A patent/SE440354B/sv not_active IP Right Cessation
- 1981-02-17 CA CA000371026A patent/CA1159831A/en not_active Expired
- 1981-02-18 CH CH1071/81A patent/CH650501A5/de not_active IP Right Cessation
- 1981-02-18 DE DE19813106013 patent/DE3106013A1/de active Granted
- 1981-02-19 FR FR8103307A patent/FR2499990B1/fr not_active Expired
- 1981-02-20 US US06/236,168 patent/US4398029A/en not_active Expired - Lifetime
- 1981-06-09 FR FR8111319A patent/FR2507183B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2507183B1 (fr) | 1986-03-07 |
| FR2507183A1 (fr) | 1982-12-10 |
| DE3106013C2 (enExample) | 1987-12-10 |
| SE440354B (sv) | 1985-07-29 |
| US4398029A (en) | 1983-08-09 |
| CA1159831A (en) | 1984-01-03 |
| DE3106013A1 (de) | 1982-09-09 |
| SE8100978L (sv) | 1982-08-13 |
| US4398029B1 (enExample) | 1990-06-05 |
| FR2499990A1 (fr) | 1982-08-20 |
| FR2499990B1 (fr) | 1986-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH650501A5 (de) | Chinolin-carbonsaeurederivate. | |
| DE2804097C3 (de) | l-Ethyl-6-fluor-1,4-dihydro-7-(lpiperazinyl)-4-oxochinolin-3-carbonsäure, ihre Hydrate und Salze mit Säuren | |
| DE3789878T2 (de) | 8-Alkoxychinolinkarbonsäure und Salze davon, die sich durch selektive Toxizität auszeichnen, und Verfahren zu ihrer Herstellung. | |
| DE2939786C2 (de) | Chinolincarbonsäure- und Naphthyridincarbonsäurederivate und ihre Verwendung | |
| AT395150B (de) | Verfahren zur herstellung von neuen benzoheterozyklischen verbindungen | |
| EP0198192B1 (de) | 7-Amino-1-(subst.cyclopropyl)-1,4-dihydro-4-oxo-3-chinolincarbonsäuren, Verfahren zu ihrer Herstellung sowie diese enthaltende antibakterielle Mittel | |
| DE3031767A1 (de) | Chinolincarbonsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung | |
| AT390258B (de) | Verfahren zur herstellung von neuen 1,4-dihydro-4-oxonaphthydridin-derivaten und deren salzen | |
| EP0113093B1 (de) | 1-Cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-(alkyl-1-piperazinyl)-3-chinolincarbonsäuren, Verfahren zu ihrer Herstellung sowie diese enthaltende antibakterielle Mittel | |
| EP0126355A1 (de) | 7-Amino-1-cyclopropyl-6,8-difluor-1,4-dihydro-4-oxo-3-chinolincarbonsäuren, Verfahren zu ihrer Herstellung sowie diese enthaltende antibakterielle Mittel | |
| DE3433924A1 (de) | 6-fluoro-1,4-dihydro-4-oxo-7-substituierte piperazinyl-chinolin-3-carbonsaeure-derivate und verfahren zu ihrer herstellung | |
| EP0205029A2 (de) | Antibakteriell wirksame Chinoloncarbonsäureester | |
| EP0187376B1 (de) | 6,7-Disubstituierte 1-Cyclopropyl-1,4-dihydro-4-oxo-1,8-naphthyridin-3-carbonsäuren | |
| EP0216345B1 (de) | Chinolinderivate | |
| CH646697A5 (de) | Verfahren zur herstellung von 7-piperazinyl-chinolin-carbonsaeure-derivaten. | |
| DD280530A5 (de) | Verfahren zur herstellung von l-tertiaer-alkyl-substituierten naphthyridin- und chinolin-carbonsaeuren und -carbonsaeurederivaten | |
| EP0201829A1 (de) | 1-Aryl-4-chinolon-3-carbonsäuren | |
| DE2914258C2 (enExample) | ||
| DE3542002A1 (de) | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7- (1-piperazinyl)-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel | |
| EP0191390B1 (de) | 1-Cyclopropyl-1,4-dihydro-4-oxo-7-[4-(2-oxo-1,3-dioxol-4-yl-methyl)-1-piperazinyl]-3-chinolincarbonsäuren, Verfahren zu ihrer Herstellung sowie diese enthaltende antibakterielle Mittel | |
| DD262428A1 (de) | Verfahren zur herstellung neuer 4-pyridonderivate und deren physiologisch vertraeglicher salze und ester | |
| DE69020199T2 (de) | Durch Azetidine substituierte Derivate von Pyridon-Carboxylsäure, ihre Herstellung und Verwendung als Arzneimittel. | |
| EP0401623A1 (de) | Verfahren zur Herstellung von 7-(3-Amino- sowie 3-Aminomethyl-1-pyrrolidinyl)-3-chinolon-carbonsäuren sowie -naphthyridoncarbonsäuren | |
| GB2093018A (en) | 6,8-Difluoro-quinoline carboxylic acid derivatives | |
| DD283385A5 (de) | Verfahren zur herstellung von derivaten der 7-(1-azetidinyl)-1,4-dihydro-4-oxoquinolein-3-carboxylsaeure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SPCF | Supplementary protection certificate filed |
Free format text: IKS 51743/920629, 960123 |
|
| SPCG | Supplementary protection certificate granted |
Free format text: IKS 51743/920629, 960123, EXPIRES:20060217 |
|
| PL | Patent ceased | ||
| SPCL | Supplementary protection certificate deletion |
Spc suppl protection certif: C650501/01 |