CH648277A5 - Dihydroperoxide, verfahren zur autoxydation von isopropylphenylestern zu hydroperoxyisopropylestern sowie deren verwendung. - Google Patents
Dihydroperoxide, verfahren zur autoxydation von isopropylphenylestern zu hydroperoxyisopropylestern sowie deren verwendung. Download PDFInfo
- Publication number
- CH648277A5 CH648277A5 CH7935/78A CH793578A CH648277A5 CH 648277 A5 CH648277 A5 CH 648277A5 CH 7935/78 A CH7935/78 A CH 7935/78A CH 793578 A CH793578 A CH 793578A CH 648277 A5 CH648277 A5 CH 648277A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- isopropylphenyl
- group
- conversion
- temperature
- Prior art date
Links
- -1 ISOPROPYLPHENYL Chemical class 0.000 title claims description 78
- 238000000034 method Methods 0.000 title claims description 48
- 238000006701 autoxidation reaction Methods 0.000 claims description 40
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 35
- 150000001875 compounds Chemical class 0.000 claims description 35
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 32
- 239000001301 oxygen Substances 0.000 claims description 31
- 229910052760 oxygen Inorganic materials 0.000 claims description 31
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 15
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 14
- 239000003054 catalyst Substances 0.000 claims description 13
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000004185 ester group Chemical group 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 claims description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-M hydroperoxide group Chemical group [O-]O MHAJPDPJQMAIIY-UHFFFAOYSA-M 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 5
- SGFXBRIXZGHPBH-UHFFFAOYSA-N (4-propan-2-ylphenyl) acetate Chemical compound CC(C)C1=CC=C(OC(C)=O)C=C1 SGFXBRIXZGHPBH-UHFFFAOYSA-N 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- FAMYXRBOUQOMGA-UHFFFAOYSA-N bis(4-propan-2-ylphenyl) carbonate Chemical compound C1=CC(C(C)C)=CC=C1OC(=O)OC1=CC=C(C(C)C)C=C1 FAMYXRBOUQOMGA-UHFFFAOYSA-N 0.000 claims description 4
- 239000003849 aromatic solvent Substances 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000001867 hydroperoxy group Chemical group [*]OO[H] 0.000 claims description 3
- 238000007171 acid catalysis Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- MVPPADPHJFYWMZ-IDEBNGHGSA-N chlorobenzene Chemical group Cl[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 MVPPADPHJFYWMZ-IDEBNGHGSA-N 0.000 claims 1
- 125000002081 peroxide group Chemical group 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 95
- 239000000243 solution Substances 0.000 description 59
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 34
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 26
- 239000000047 product Substances 0.000 description 25
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 17
- 238000005481 NMR spectroscopy Methods 0.000 description 17
- 150000002989 phenols Chemical class 0.000 description 17
- 230000006698 induction Effects 0.000 description 16
- 230000008707 rearrangement Effects 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 238000004128 high performance liquid chromatography Methods 0.000 description 15
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 14
- 238000004458 analytical method Methods 0.000 description 14
- 229910052739 hydrogen Inorganic materials 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 230000007062 hydrolysis Effects 0.000 description 11
- 238000006460 hydrolysis reaction Methods 0.000 description 11
- 230000003647 oxidation Effects 0.000 description 11
- 238000007254 oxidation reaction Methods 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 10
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 9
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 229910052799 carbon Inorganic materials 0.000 description 8
- 238000010183 spectrum analysis Methods 0.000 description 8
- RERBQXVRXYCGLT-UHFFFAOYSA-N 2-(4-propan-2-ylphenyl)acetic acid Chemical compound CC(C)C1=CC=C(CC(O)=O)C=C1 RERBQXVRXYCGLT-UHFFFAOYSA-N 0.000 description 7
- 150000001721 carbon Chemical group 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- IHNFUCHSZGPRKA-UHFFFAOYSA-N (4-hydroperoxy-2-propan-2-ylphenyl) acetate Chemical compound CC(C)C1=CC(OO)=CC=C1OC(C)=O IHNFUCHSZGPRKA-UHFFFAOYSA-N 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 5
- PQVJKRXRURQQBU-UHFFFAOYSA-N 2-(4-hydroperoxyphenyl)-3-methylbutanoic acid Chemical compound CC(C)C(C1=CC=C(C=C1)OO)C(=O)O PQVJKRXRURQQBU-UHFFFAOYSA-N 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 150000002432 hydroperoxides Chemical class 0.000 description 5
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 5
- 238000002798 spectrophotometry method Methods 0.000 description 5
- PQIGLWOWGHCVDE-UHFFFAOYSA-N (4-hydroxy-2-propan-2-ylphenyl) acetate Chemical compound CC(C)C1=CC(O)=CC=C1OC(C)=O PQIGLWOWGHCVDE-UHFFFAOYSA-N 0.000 description 4
- GDBITPXOESTAML-UHFFFAOYSA-N 2-(4-hydroxyphenyl)-3-methylbutyric acid Chemical compound CC(C)C(C(O)=O)C1=CC=C(O)C=C1 GDBITPXOESTAML-UHFFFAOYSA-N 0.000 description 4
- YQUQWHNMBPIWGK-UHFFFAOYSA-N 4-isopropylphenol Chemical compound CC(C)C1=CC=C(O)C=C1 YQUQWHNMBPIWGK-UHFFFAOYSA-N 0.000 description 4
- 229930185605 Bisphenol Natural products 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- JBVRDDQHPHGNTM-UHFFFAOYSA-N bis[3,5-di(propan-2-yl)phenyl] carbonate Chemical compound CC(C)C1=CC(C(C)C)=CC(OC(=O)OC=2C=C(C=C(C=2)C(C)C)C(C)C)=C1 JBVRDDQHPHGNTM-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 230000014759 maintenance of location Effects 0.000 description 4
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 4
- JFAXJRJMFOACBO-UHFFFAOYSA-N (4-hydroxyphenyl) benzoate Chemical compound C1=CC(O)=CC=C1OC(=O)C1=CC=CC=C1 JFAXJRJMFOACBO-UHFFFAOYSA-N 0.000 description 3
- KPVUCQCHICRYHH-UHFFFAOYSA-N (4-propan-2-ylphenyl) benzoate Chemical compound C1=CC(C(C)C)=CC=C1OC(=O)C1=CC=CC=C1 KPVUCQCHICRYHH-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- CRBJBYGJVIBWIY-UHFFFAOYSA-N 2-isopropylphenol Chemical class CC(C)C1=CC=CC=C1O CRBJBYGJVIBWIY-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- ZKZNDCLNOPMFPC-UHFFFAOYSA-N CC(C)C1=CC=CC(OC(=O)C=2C=CC(=CC=2)C(=O)OC=2C=C(C=CC=2)C(C)C)=C1 Chemical compound CC(C)C1=CC=CC(OC(=O)C=2C=CC(=CC=2)C(=O)OC=2C=C(C=CC=2)C(C)C)=C1 ZKZNDCLNOPMFPC-UHFFFAOYSA-N 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical class [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- VXDLSUFPNAPWHI-UHFFFAOYSA-N [3,5-di(propan-2-yl)phenyl] benzoate Chemical compound CC(C)C1=CC(C(C)C)=CC(OC(=O)C=2C=CC=CC=2)=C1 VXDLSUFPNAPWHI-UHFFFAOYSA-N 0.000 description 3
- 229940069428 antacid Drugs 0.000 description 3
- 239000003159 antacid agent Substances 0.000 description 3
- 230000001458 anti-acid effect Effects 0.000 description 3
- LKOOOAHAGDENDU-UHFFFAOYSA-N bis(4-hydroperoxy-2-propan-2-ylphenyl) carbonate Chemical compound CC(C)C1=CC(OO)=CC=C1OC(=O)OC1=CC=C(OO)C=C1C(C)C LKOOOAHAGDENDU-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- VLJSLTNSFSOYQR-UHFFFAOYSA-N 3-propan-2-ylphenol Chemical compound CC(C)C1=CC=CC(O)=C1 VLJSLTNSFSOYQR-UHFFFAOYSA-N 0.000 description 2
- RKCBNCOFPKXLIQ-UHFFFAOYSA-N 5-propan-2-ylbenzene-1,3-diol Chemical compound CC(C)C1=CC(O)=CC(O)=C1 RKCBNCOFPKXLIQ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KUZOZPMFIMCATF-UHFFFAOYSA-N C1(=CC=CC=C1)O.C1(O)=CC(O)=CC(O)=C1 Chemical compound C1(=CC=CC=C1)O.C1(O)=CC(O)=CC(O)=C1 KUZOZPMFIMCATF-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- SSMBXPJYHMZLOJ-UHFFFAOYSA-N Isopropyl phenylacetate Chemical compound CC(C)OC(=O)CC1=CC=CC=C1 SSMBXPJYHMZLOJ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000010945 base-catalyzed hydrolysis reactiony Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- SDVFZXYYHLMOLW-UHFFFAOYSA-N bis(2-propan-2-ylphenyl) carbonate Chemical class CC(C)C1=CC=CC=C1OC(=O)OC1=CC=CC=C1C(C)C SDVFZXYYHLMOLW-UHFFFAOYSA-N 0.000 description 2
- SLBBUAMCOKCBNJ-UHFFFAOYSA-N bis(3-propan-2-ylphenyl) carbonate Chemical compound CC(C)C1=CC=CC(OC(=O)OC=2C=C(C=CC=2)C(C)C)=C1 SLBBUAMCOKCBNJ-UHFFFAOYSA-N 0.000 description 2
- LJSUSQRVKPWPCV-UHFFFAOYSA-N bis(4-hydroxyphenyl) carbonate Chemical compound C1=CC(O)=CC=C1OC(=O)OC1=CC=C(O)C=C1 LJSUSQRVKPWPCV-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000010354 integration Effects 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 150000002978 peroxides Chemical group 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229940049953 phenylacetate Drugs 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- PQDJYEQOELDLCP-UHFFFAOYSA-N trimethylsilane Chemical compound C[SiH](C)C PQDJYEQOELDLCP-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- BFOSIFSSXHTYFS-UHFFFAOYSA-N (2,3-dihydroxyphenyl) benzoate Chemical compound OC1=CC=CC(OC(=O)C=2C=CC=CC=2)=C1O BFOSIFSSXHTYFS-UHFFFAOYSA-N 0.000 description 1
- OTHYPAMNTUGKDK-UHFFFAOYSA-N (3-acetylphenyl) acetate Chemical compound CC(=O)OC1=CC=CC(C(C)=O)=C1 OTHYPAMNTUGKDK-UHFFFAOYSA-N 0.000 description 1
- FZYWCPJQIBXOOC-UHFFFAOYSA-N (3-propan-2-ylphenyl) acetate Chemical compound CC(C)C1=CC=CC(OC(C)=O)=C1 FZYWCPJQIBXOOC-UHFFFAOYSA-N 0.000 description 1
- AKOGNYJNGMLDOA-UHFFFAOYSA-N (4-acetyloxyphenyl) acetate Chemical compound CC(=O)OC1=CC=C(OC(C)=O)C=C1 AKOGNYJNGMLDOA-UHFFFAOYSA-N 0.000 description 1
- SVEQEYXSQNOBJX-UHFFFAOYSA-N (4-hydroxyphenyl) hydrogen carbonate Chemical compound OC(=O)OC1=CC=C(O)C=C1 SVEQEYXSQNOBJX-UHFFFAOYSA-N 0.000 description 1
- UJNVTDGCOKFBKM-UHFFFAOYSA-N 1,1-bis(tert-butylperoxy)hexane Chemical compound CCCCCC(OOC(C)(C)C)OOC(C)(C)C UJNVTDGCOKFBKM-UHFFFAOYSA-N 0.000 description 1
- XSZYESUNPWGWFQ-UHFFFAOYSA-N 1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane Chemical compound CC1CCC(C(C)(C)OO)CC1 XSZYESUNPWGWFQ-UHFFFAOYSA-N 0.000 description 1
- VMHNWKFYYPLKFF-UHFFFAOYSA-N 2,13-dioxabicyclo[12.2.2]octadeca-1(16),14,17-triene-3,12-dione Chemical compound O1C(=O)CCCCCCCCC(=O)OC2=CC=C1C=C2 VMHNWKFYYPLKFF-UHFFFAOYSA-N 0.000 description 1
- YLQQAQZFLYZGDN-UHFFFAOYSA-N 2,3-dimethyl-2-phenylbutanoic acid Chemical compound CC(C)C(C)(C(O)=O)C1=CC=CC=C1 YLQQAQZFLYZGDN-UHFFFAOYSA-N 0.000 description 1
- LAYUFNWXGNEQPA-UHFFFAOYSA-N 2,9-dioxabicyclo[8.2.2]tetradeca-1(12),10,13-triene-3,8-dione Chemical compound O1C(=O)CCCCC(=O)OC2=CC=C1C=C2 LAYUFNWXGNEQPA-UHFFFAOYSA-N 0.000 description 1
- QVFVRYPUIDISKU-UHFFFAOYSA-N 2,9-dioxabicyclo[8.3.1]tetradeca-1(14),10,12-triene-3,8-dione Chemical compound O1C(=O)CCCCC(=O)OC2=CC=CC1=C2 QVFVRYPUIDISKU-UHFFFAOYSA-N 0.000 description 1
- GSQFSOBXWFMRSP-UHFFFAOYSA-N 2-(3,5-dihydroxyphenyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC(O)=CC(O)=C1 GSQFSOBXWFMRSP-UHFFFAOYSA-N 0.000 description 1
- XQZBEAUFPDEWTL-UHFFFAOYSA-N 2-(3-hydroperoxyphenyl)-3-methylbutanoic acid Chemical compound CC(C)C(C1=CC(=CC=C1)OO)C(=O)O XQZBEAUFPDEWTL-UHFFFAOYSA-N 0.000 description 1
- DPPCUFWVXOOGCS-UHFFFAOYSA-N 2-(3-hydroxyphenyl)-3-methylbutanoic acid Chemical compound CC(C)C(C(O)=O)C1=CC=CC(O)=C1 DPPCUFWVXOOGCS-UHFFFAOYSA-N 0.000 description 1
- MPYWPTKSAZAESN-UHFFFAOYSA-N 2-(4-propan-2-ylphenoxy)carbonylbenzoic acid Chemical compound CC(C)C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2C(=O)O MPYWPTKSAZAESN-UHFFFAOYSA-N 0.000 description 1
- ZGNFRWMMJAYEOA-UHFFFAOYSA-N 2-ethyl-3-methyl-2-phenylbutanoic acid Chemical compound CCC(C(C)C)(C(O)=O)C1=CC=CC=C1 ZGNFRWMMJAYEOA-UHFFFAOYSA-N 0.000 description 1
- MIRQGKQPLPBZQM-UHFFFAOYSA-N 2-hydroperoxy-2,4,4-trimethylpentane Chemical compound CC(C)(C)CC(C)(C)OO MIRQGKQPLPBZQM-UHFFFAOYSA-N 0.000 description 1
- CBNOHYYCHDRBEB-UHFFFAOYSA-N 2-hydroperoxypropan-2-yl 2-phenylbenzoate Chemical compound C1(=CC=CC=C1)C1=C(C(=O)OC(C)(C)OO)C=CC=C1 CBNOHYYCHDRBEB-UHFFFAOYSA-N 0.000 description 1
- ZEOPQBXNPWFPLQ-UHFFFAOYSA-N 2-phenyl-2-propan-2-ylpentanoic acid Chemical compound CCCC(C1=CC=CC=C1)(C(C)C)C(=O)O ZEOPQBXNPWFPLQ-UHFFFAOYSA-N 0.000 description 1
- PFSUXRDZGRNSKI-UHFFFAOYSA-N 2-phenyl-3-propan-2-ylbenzoic acid Chemical compound C(C)(C)C=1C(=C(C(=O)O)C=CC=1)C1=CC=CC=C1 PFSUXRDZGRNSKI-UHFFFAOYSA-N 0.000 description 1
- OPNWOLOSBNFEBU-UHFFFAOYSA-N 2-phenyl-3-propan-2-ylnaphthalene-1-carboxylic acid Chemical compound CC(C)C1=CC2=CC=CC=C2C(=C1C3=CC=CC=C3)C(=O)O OPNWOLOSBNFEBU-UHFFFAOYSA-N 0.000 description 1
- YYOQJBLGFMMRLJ-UHFFFAOYSA-N 3,5-di(propan-2-yl)phenol Chemical compound CC(C)C1=CC(O)=CC(C(C)C)=C1 YYOQJBLGFMMRLJ-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- SMIOEQSLJNNKQF-UHFFFAOYSA-N 4-acetoxy acetophenone Chemical compound CC(=O)OC1=CC=C(C(C)=O)C=C1 SMIOEQSLJNNKQF-UHFFFAOYSA-N 0.000 description 1
- VJTSPAJCYGNWKD-UHFFFAOYSA-N 4-methyl-3-phenyl-2-propan-2-ylbenzoic acid Chemical compound CC1=C(C(=C(C=C1)C(=O)O)C(C)C)C2=CC=CC=C2 VJTSPAJCYGNWKD-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- QUGCGRKJBDNHBP-UHFFFAOYSA-N C1=C2C(=O)OC(C(=O)CC)=CC2=CC2=C1OCO2 Chemical compound C1=C2C(=O)OC(C(=O)CC)=CC2=CC2=C1OCO2 QUGCGRKJBDNHBP-UHFFFAOYSA-N 0.000 description 1
- JLAHHXJDBOLAPH-UHFFFAOYSA-N C=1C=C(C=2C=CC=CC=2)C(C(C)C)(OO)C(C(C)C)C=1OC(=O)C1=CC=C(C(O)=O)C=C1 Chemical compound C=1C=C(C=2C=CC=CC=2)C(C(C)C)(OO)C(C(C)C)C=1OC(=O)C1=CC=C(C(O)=O)C=C1 JLAHHXJDBOLAPH-UHFFFAOYSA-N 0.000 description 1
- WPTFDADSKJZGMB-UHFFFAOYSA-N CC(C)C1=C(C(=C(C=C1)C(=O)O)C2=CC(=CC=C2)C(C)C)O Chemical compound CC(C)C1=C(C(=C(C=C1)C(=O)O)C2=CC(=CC=C2)C(C)C)O WPTFDADSKJZGMB-UHFFFAOYSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- UKVWXPZHFORVKA-UHFFFAOYSA-N O1P(=O)OC2=CC=C1C=C2 Chemical compound O1P(=O)OC2=CC=C1C=C2 UKVWXPZHFORVKA-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- QRKYYYIDJYBFED-UHFFFAOYSA-N [3,5-di(propan-2-yl)phenyl] 4-methylbenzoate Chemical compound C1(=CC=C(C=C1)C(=O)OC1=CC(=CC(=C1)C(C)C)C(C)C)C QRKYYYIDJYBFED-UHFFFAOYSA-N 0.000 description 1
- IANMANYZPNUMKN-UHFFFAOYSA-N [3,5-di(propan-2-yl)phenyl] acetate Chemical compound CC(C)C1=CC(OC(C)=O)=CC(C(C)C)=C1 IANMANYZPNUMKN-UHFFFAOYSA-N 0.000 description 1
- DKHPPDKRRVUSRK-UHFFFAOYSA-N [3-hydroperoxy-2,5-di(propan-2-yl)phenyl] benzoate Chemical compound CC(C)C1=CC(OO)=C(C(C)C)C(OC(=O)C=2C=CC=CC=2)=C1 DKHPPDKRRVUSRK-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- LYZZIYQKZYMGRU-UHFFFAOYSA-N bis(2-hydroxyphenyl) carbonate Chemical class OC1=CC=CC=C1OC(=O)OC1=CC=CC=C1O LYZZIYQKZYMGRU-UHFFFAOYSA-N 0.000 description 1
- PYFIWXJMWSWYRU-UHFFFAOYSA-N bis(3,5-dihydroperoxy-2-propan-2-ylphenyl) carbonate Chemical compound CC(C)C1=C(OO)C=C(OO)C=C1OC(=O)OC1=CC(OO)=CC(OO)=C1C(C)C PYFIWXJMWSWYRU-UHFFFAOYSA-N 0.000 description 1
- JDXVGQKSLUEMDC-UHFFFAOYSA-N bis(3-hydroperoxy-2-propan-2-ylphenyl) carbonate Chemical class CC(C)C1=C(OO)C=CC=C1OC(=O)OC1=CC=CC(OO)=C1C(C)C JDXVGQKSLUEMDC-UHFFFAOYSA-N 0.000 description 1
- WOKRXWCROXJRHO-UHFFFAOYSA-N bis(4-propan-2-ylphenyl) benzene-1,3-dicarboxylate Chemical compound C1=CC(C(C)C)=CC=C1OC(=O)C1=CC=CC(C(=O)OC=2C=CC(=CC=2)C(C)C)=C1 WOKRXWCROXJRHO-UHFFFAOYSA-N 0.000 description 1
- AAXAFFZZWNSHRA-UHFFFAOYSA-N bis(4-propan-2-ylphenyl) benzene-1,4-dicarboxylate Chemical compound C1=CC(C(C)C)=CC=C1OC(=O)C1=CC=C(C(=O)OC=2C=CC(=CC=2)C(C)C)C=C1 AAXAFFZZWNSHRA-UHFFFAOYSA-N 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000004651 carbonic acid esters Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- YQHLDYVWEZKEOX-UHFFFAOYSA-N cumene hydroperoxide Chemical compound OOC(C)(C)C1=CC=CC=C1 YQHLDYVWEZKEOX-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MMBMIVSDYYPRHH-UHFFFAOYSA-N hydrogen peroxide Chemical compound OO.OO MMBMIVSDYYPRHH-UHFFFAOYSA-N 0.000 description 1
- 150000004680 hydrogen peroxides Chemical class 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- XNTUJOTWIMFEQS-UHFFFAOYSA-N octadecanoyl octadecaneperoxoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCCCCCCCC XNTUJOTWIMFEQS-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/02—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides
- C07C409/04—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides the carbon atom being acyclic
- C07C409/08—Compounds containing six-membered aromatic rings
- C07C409/12—Compounds containing six-membered aromatic rings with two alpha,alpha-dialkylmethyl hydroperoxy groups bound to carbon atoms of the same six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/02—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides
- C07C409/04—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides the carbon atom being acyclic
- C07C409/08—Compounds containing six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81823377A | 1977-07-22 | 1977-07-22 | |
| US05/879,788 US4164510A (en) | 1977-07-22 | 1978-02-21 | Process for the autoxidation of an isopropylphenyl ester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH648277A5 true CH648277A5 (de) | 1985-03-15 |
Family
ID=27124246
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH7935/78A CH648277A5 (de) | 1977-07-22 | 1978-07-21 | Dihydroperoxide, verfahren zur autoxydation von isopropylphenylestern zu hydroperoxyisopropylestern sowie deren verwendung. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4164510A (enExample) |
| JP (1) | JPS5424841A (enExample) |
| CH (1) | CH648277A5 (enExample) |
| DE (1) | DE2827004A1 (enExample) |
| FR (1) | FR2398729A1 (enExample) |
| GB (1) | GB2001629B (enExample) |
| NL (1) | NL7807749A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4339614A (en) * | 1980-03-14 | 1982-07-13 | Pcuk Produits Chimiques Ugine Kuhlmann | Superacid catalyzed preparation of resorcinol from meta-isopropylphenol |
| US4695658A (en) * | 1984-03-12 | 1987-09-22 | Fmc Corporation | Aryl carboxylate process |
| CN104761435B (zh) * | 2015-04-20 | 2016-04-06 | 荣成青木高新材料股份有限公司 | 3,5-二甲基苯酚的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2773906A (en) * | 1953-05-06 | 1956-12-11 | Monsanto Chemicals | alpha, alpha-dialkyl-ar-phenylbenzyl hydroperoxides |
| BE535707A (enExample) * | 1954-02-17 | |||
| US2862973A (en) * | 1956-04-27 | 1958-12-02 | Shell Dev | Di-tertiary-alkyl peroxide production |
| US3028410A (en) * | 1958-06-26 | 1962-04-03 | Hooker Chemical Corp | Synthesis of polyhydroxy aromatic compounds |
| US3402205A (en) * | 1961-09-13 | 1968-09-17 | Hercules Inc | Polyperoxides |
| NL6908858A (enExample) * | 1969-06-10 | 1970-12-14 | ||
| US3634328A (en) * | 1970-04-21 | 1972-01-11 | Sun Oil Co | Catalyst for oxidation of secondary and tertiary alkyl aromatic hydrocarbons |
-
1978
- 1978-02-21 US US05/879,788 patent/US4164510A/en not_active Expired - Lifetime
- 1978-06-20 DE DE19782827004 patent/DE2827004A1/de active Granted
- 1978-07-05 GB GB787828863A patent/GB2001629B/en not_active Expired
- 1978-07-19 NL NL7807749A patent/NL7807749A/xx not_active Application Discontinuation
- 1978-07-21 CH CH7935/78A patent/CH648277A5/de not_active IP Right Cessation
- 1978-07-21 FR FR7821792A patent/FR2398729A1/fr active Granted
- 1978-07-21 JP JP8849578A patent/JPS5424841A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2827004A1 (de) | 1979-02-08 |
| GB2001629A (en) | 1979-02-07 |
| JPS5424841A (en) | 1979-02-24 |
| DE2827004C2 (enExample) | 1989-10-19 |
| FR2398729B3 (enExample) | 1981-03-27 |
| JPS6317059B2 (enExample) | 1988-04-12 |
| NL7807749A (nl) | 1979-01-24 |
| GB2001629B (en) | 1982-02-24 |
| FR2398729A1 (fr) | 1979-02-23 |
| US4164510A (en) | 1979-08-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2412517C3 (de) | Verfahren zur Herstellung von Alkoholen | |
| DE4219459A1 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethylpiperidin-N-oxyl und seinen in 4-Stellung substituierten Derivaten | |
| CH642344A5 (de) | Verfahren zur herstellung von p-n-alkylbenzoesaeure. | |
| CH632506A5 (de) | Verfahren zur herstellung eines optischen isomers eines 1-hydroxy-3-substituierten-6,6-dimethyl-6,6a,7,8,10,10a-hexahydro-9h-dibenzo(b,d)pyran-9-ons. | |
| DE1768717B1 (de) | Verfahren zur Herstellung von 4,4'-Dihydroxy-3,5,3',5'-tetraalkyldiphenylen | |
| DE2056555A1 (enExample) | ||
| DE1618151A1 (de) | Aromatische N,N-disubstituierte Thioncarbamate und Thiolcarbamate sowie Verfahren zur Umwandlung dieser Thioncarbamate in die Thiolcarbamate | |
| DE2149159A1 (de) | Verfahren zur Herstellung von Trimethylhydrochinon | |
| CH648277A5 (de) | Dihydroperoxide, verfahren zur autoxydation von isopropylphenylestern zu hydroperoxyisopropylestern sowie deren verwendung. | |
| DE2324473A1 (de) | Verfahren zur herstellung von 2,2-dimethyl-3-(2'-methyl)-1'-propenyl-1,3-transcyclopropan-1-carbonsaeurealkylestern und der freien saeure | |
| DE2161526A1 (de) | Verfahren zur Herstellung von PoIybromphenylderivatmethacrylsäuree stern | |
| DE1205976B (de) | Verfahren zur Herstellung von 3-Phenolkerne enthaltenden Antioxydationsmitteln | |
| DE2809496A1 (de) | Verfahren zur herstellung von 2-methyl-3-phenyl-4,5,6-trimethoxyphenol | |
| DE1645041A1 (de) | Neue Polyalkyl-Alkohole | |
| DE2150146C3 (de) | Verfahren zur Herstellung von Flavon-7-oxyessigsäureäthylester | |
| DE2461605B2 (de) | S-Acetyl-U.e-trimethyltricyclo [53AO27J-dodeca-5-en, Verfahren zu seiner Herstellung und seine Verwendung als Riechstoff | |
| DE2132315C3 (de) | Verfahren zur Herstellung der 1 beta, 11 alpha-Dimethyl-1,2,3,4,10 alpha, 11hexahydro-9 beta-hydroxyfluoren-1 alpha, 9alpha-dicarbonsäure aus Abietinsäure | |
| EP0320451A2 (de) | Verfahren zur Herstellung von alkylsubstituierten Phenolen oder Naphtholen | |
| EP0288428B1 (de) | Verfahren zur Herstellung von 2,6-Dihydroxynaphthalin | |
| DE2461593C3 (de) | 1,2,6-Trimethyltricyclo [53,2,O2'7! -dodeca-5-on, Verfahren zu seiner Herstellung und seine Verwendung als Riechstoff | |
| DE2547223C3 (de) | Verfahren zur Herstellung von 2,6,6-Trimethyl-cyclohex-2-en-1 -on | |
| DE1001259C2 (de) | Verfahren zur Herstellung von Derivaten des Nortricyclens | |
| DE2426863A1 (de) | Verfahren zur spaltung von cycloaliphatischen hdroperoxiden | |
| DE2530901A1 (de) | Verfahren zur herstellung von beta-isopropylnaphthalinhydroperoxid | |
| EP0591799B1 (de) | Oxidation von Hydroxybenzaldehyden zur Herstellung von Dihydroxybenzol Verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUE | Assignment |
Owner name: THE DOW CHEMICAL COMPANY |
|
| PL | Patent ceased | ||
| PL | Patent ceased |