CH647899A5 - Strombegrenzungseinrichtung. - Google Patents
Strombegrenzungseinrichtung. Download PDFInfo
- Publication number
- CH647899A5 CH647899A5 CH6680/79A CH668079A CH647899A5 CH 647899 A5 CH647899 A5 CH 647899A5 CH 6680/79 A CH6680/79 A CH 6680/79A CH 668079 A CH668079 A CH 668079A CH 647899 A5 CH647899 A5 CH 647899A5
- Authority
- CH
- Switzerland
- Prior art keywords
- heat sink
- current limiter
- current
- additional heat
- limiter
- Prior art date
Links
- 238000001816 cooling Methods 0.000 claims description 21
- 239000000126 substance Substances 0.000 claims description 9
- 239000000843 powder Substances 0.000 claims description 4
- 239000004519 grease Substances 0.000 claims description 3
- 230000002093 peripheral effect Effects 0.000 claims 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 238000006073 displacement reaction Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- LTPBRCUWZOMYOC-UHFFFAOYSA-N beryllium oxide Inorganic materials O=[Be] LTPBRCUWZOMYOC-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- FRWYFWZENXDZMU-UHFFFAOYSA-N 2-iodoquinoline Chemical compound C1=CC=CC2=NC(I)=CC=C21 FRWYFWZENXDZMU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000012777 electrically insulating material Substances 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H87/00—Protective devices in which a current flowing through a liquid or solid is interrupted by the evaporation of the liquid or by the melting and evaporation of the solid when the current becomes excessive, the circuit continuity being reestablished on cooling
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H85/00—Protective devices in which the current flows through a part of fusible material and this current is interrupted by displacement of the fusible material when this current becomes excessive
- H01H85/02—Details
- H01H85/47—Means for cooling
Landscapes
- Emergency Protection Circuit Devices (AREA)
- Thermistors And Varistors (AREA)
- Fuses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1978098500U JPS6210925Y2 (enExample) | 1978-07-18 | 1978-07-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH647899A5 true CH647899A5 (de) | 1985-02-15 |
Family
ID=14221351
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH6680/79A CH647899A5 (de) | 1978-07-18 | 1979-07-18 | Strombegrenzungseinrichtung. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4216456A (enExample) |
| JP (1) | JPS6210925Y2 (enExample) |
| BR (1) | BR7807581A (enExample) |
| CH (1) | CH647899A5 (enExample) |
| DE (1) | DE2928710C2 (enExample) |
| FR (1) | FR2431763A1 (enExample) |
| GB (1) | GB2026247B (enExample) |
| IT (1) | IT1122584B (enExample) |
| NL (1) | NL174892C (enExample) |
| SE (1) | SE7906147L (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5775951U (enExample) * | 1980-10-29 | 1982-05-11 | ||
| JPS57156162A (en) * | 1981-03-19 | 1982-09-27 | Hasegawa Tekko Kk | Curved surface grinder for woodworking service |
| DE3415288A1 (de) * | 1984-04-24 | 1985-02-07 | Peter 8918 Dießen Beger | Dauer-sicherungsanordnung fuer den niederspannungsbereich, mit reversibler, definierter trennung |
| JPS60227334A (ja) * | 1984-04-24 | 1985-11-12 | 東京電力株式会社 | 自己復旧形限流素子 |
| JPS6017940U (ja) * | 1984-05-31 | 1985-02-06 | 長谷川鉄工株式会社 | 木工用曲面研磨機 |
| DD282778A5 (de) * | 1989-04-26 | 1990-09-19 | Karl Marx Stadt Tech Hochschul | Stromgesteuerte abschaltvorrichtung |
| JP2000164111A (ja) * | 1998-03-16 | 2000-06-16 | Yazaki Corp | 自動車用大電流ヒュ―ズ |
| DE19859095A1 (de) * | 1998-12-21 | 2000-07-27 | Moeller Gmbh | Selbsterholende Strombegrenzungseinrichtung mit Flüssigmetall |
| US6710696B2 (en) * | 2002-04-08 | 2004-03-23 | Eaton Corporation | Fuse housing for network protector |
| DE102016220058A1 (de) * | 2016-10-14 | 2018-04-19 | Continental Automotive Gmbh | Schaltungsanordnung mit einer Schmelzsicherung, Kraftfahrzeug und Verfahren zum Herstellen der Schaltungsanordnung |
| FI20205844A1 (fi) * | 2020-08-31 | 2022-03-01 | Epec Oy | Sähkölaite ja menetelmä sähkölaitteen jäähdyttämiseksi |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH447394A (de) * | 1966-11-23 | 1967-11-30 | Jaeger Edwin | Kühlkörper für zylinderförmige, elektrotechnische Elemente |
| US3699489A (en) * | 1970-03-28 | 1972-10-17 | Tokyo Shibaura Electric Co | Current limiting device |
| DE2348309A1 (de) * | 1973-09-26 | 1975-04-10 | Licentia Gmbh | Hochbelastbare diode mit einem halbleiterkoerper |
| US3991396A (en) * | 1975-05-07 | 1976-11-09 | General Electric Company | Electric circuit protector comprising parallel-connected liquid-metal current-limiting devices |
-
1978
- 1978-07-18 JP JP1978098500U patent/JPS6210925Y2/ja not_active Expired
- 1978-10-18 US US05/952,395 patent/US4216456A/en not_active Expired - Lifetime
- 1978-11-20 BR BR7807581A patent/BR7807581A/pt unknown
-
1979
- 1979-07-13 FR FR7918206A patent/FR2431763A1/fr active Granted
- 1979-07-16 DE DE2928710A patent/DE2928710C2/de not_active Expired
- 1979-07-16 SE SE7906147A patent/SE7906147L/ not_active Application Discontinuation
- 1979-07-17 NL NLAANVRAGE7905546,A patent/NL174892C/xx not_active IP Right Cessation
- 1979-07-17 IT IT7924393A patent/IT1122584B/it active
- 1979-07-18 CH CH6680/79A patent/CH647899A5/de not_active IP Right Cessation
- 1979-07-18 GB GB7925050A patent/GB2026247B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6210925Y2 (enExample) | 1987-03-14 |
| NL7905546A (nl) | 1980-01-22 |
| DE2928710C2 (de) | 1983-11-10 |
| NL174892C (nl) | 1984-08-16 |
| JPS5515955U (enExample) | 1980-01-31 |
| SE7906147L (sv) | 1980-01-19 |
| IT1122584B (it) | 1986-04-23 |
| GB2026247A (en) | 1980-01-30 |
| FR2431763A1 (fr) | 1980-02-15 |
| GB2026247B (en) | 1982-12-22 |
| IT7924393A0 (it) | 1979-07-17 |
| FR2431763B1 (enExample) | 1983-05-27 |
| DE2928710A1 (de) | 1980-02-07 |
| BR7807581A (pt) | 1980-05-20 |
| US4216456A (en) | 1980-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2527681C3 (de) | Elektrische Kontaktanordnung | |
| DE2204589A1 (de) | Kuehlanordnung fuer flache halbleiterbauelemente | |
| CH626758A5 (enExample) | ||
| DE112009004685B4 (de) | Leiter einer elektrischen Hochspannungsvorrichtung | |
| CH647899A5 (de) | Strombegrenzungseinrichtung. | |
| DE3830166A1 (de) | Zuendkerze fuer eine brennkraftmaschine | |
| DE3201367A1 (de) | Elektrischer widerstandsheizkoerper mit kaltleiter-elementen | |
| DE112013007667T5 (de) | Leistungshalbleitervorrichtung | |
| CH397905A (de) | Rohrförmiger Schweisselektrodenhalter mit austauschbaren Führungs- und Kontaktbacken | |
| DE1514477B2 (de) | Halbleiteranordnung mit einer Anzahl von Halbleiterbauelementen | |
| DE3144901A1 (de) | Elektrisch isolierte verbindung zwischen zwei gleichachsig angeordneten, stabfoermigen elementen aus metall | |
| DE1439909B2 (de) | Gehaeuse fuer ein halbleiterbauelement | |
| DE1991022U (de) | Stromkreisunterbrecher | |
| DE2233792A1 (de) | Elektrischer schalter | |
| WO2017129498A1 (de) | Klemmkörper für eine elektrische anschlussvorrichtung | |
| DE2415893A1 (de) | Kuehlvorrichtung | |
| DE1098103B (de) | Verfahren zum Einbau eines elektrischen Halbleiterelementes in ein Gehaeuse | |
| DE1912041A1 (de) | Halbleitervorrichtung | |
| DE69031883T2 (de) | Kühlvorrichtung mit elektrisch isoliertem Wärmerohr für Halbleiter | |
| DE68922881T2 (de) | Thermischer Schutz mit variablem Widerstand sowie Verfahren zu dessen Herstellung. | |
| DE1907364A1 (de) | Fluessigkeitswiderstand zur Steuerung elektrischer Stroeme | |
| DE1540597C3 (de) | Hochspannungsdurchführung | |
| DE2211513A1 (de) | Halbleiterelement mit radiator | |
| DD201072A1 (de) | Einstueckiger schmelzleiter fuer elektrische sicherungen | |
| AT203599B (de) | Verfahren zum vakuumdichten Verschließen einer Hülle einer halbleitenden Vorrichtung und nach diesem Verfahren hergestellte vakuumdichte Hülle für eine solche Vorrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |