CH635066A5 - Verfahren zur herstellung cyclischer aminosaeuren. - Google Patents
Verfahren zur herstellung cyclischer aminosaeuren. Download PDFInfo
- Publication number
- CH635066A5 CH635066A5 CH343777A CH343777A CH635066A5 CH 635066 A5 CH635066 A5 CH 635066A5 CH 343777 A CH343777 A CH 343777A CH 343777 A CH343777 A CH 343777A CH 635066 A5 CH635066 A5 CH 635066A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acid
- formula
- compounds
- amino acids
- imide
- Prior art date
Links
- 150000001413 amino acids Chemical class 0.000 title description 8
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 description 34
- -1 cyclic amino acids Chemical class 0.000 description 25
- 238000000034 method Methods 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 238000006644 Lossen rearrangement reaction Methods 0.000 description 11
- 239000002253 acid Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 150000003949 imides Chemical class 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 229940086542 triethylamine Drugs 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000005840 aryl radicals Chemical class 0.000 description 4
- 229940077388 benzenesulfonate Drugs 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000006188 syrup Substances 0.000 description 4
- 235000020357 syrup Nutrition 0.000 description 4
- KMBMIFAMYKVGMQ-UHFFFAOYSA-N 2-[1-[2-(hydroxyamino)-2-oxoethyl]cyclohexyl]acetic acid Chemical compound ON=C(O)CC1(CC(O)=O)CCCCC1 KMBMIFAMYKVGMQ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000002015 acyclic group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 3
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 2
- CQAHQVNBEBOLQB-UHFFFAOYSA-N 2-[1-(aminomethyl)cycloheptyl]acetic acid;hydrochloride Chemical compound Cl.OC(=O)CC1(CN)CCCCCC1 CQAHQVNBEBOLQB-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 230000006179 O-acylation Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000003951 lactams Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- SAYBRQDMVZLOPM-UHFFFAOYSA-N 2-[(4-chlorophenyl)methylsulfanyl]acetic acid Chemical compound OC(=O)CSCC1=CC=C(Cl)C=C1 SAYBRQDMVZLOPM-UHFFFAOYSA-N 0.000 description 1
- MXNASYICBPHSLF-UHFFFAOYSA-N 2-[1-(aminomethyl)cycloheptyl]acetic acid Chemical compound OC(=O)CC1(CN)CCCCCC1 MXNASYICBPHSLF-UHFFFAOYSA-N 0.000 description 1
- BBZPPPNVZUVGSW-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclohexyl]acetic acid;benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1.OC(=O)CC1(CN)CCCCC1 BBZPPPNVZUVGSW-UHFFFAOYSA-N 0.000 description 1
- XBUDZAQEMFGLEU-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclohexyl]acetic acid;hydron;chloride Chemical compound Cl.OC(=O)CC1(CN)CCCCC1 XBUDZAQEMFGLEU-UHFFFAOYSA-N 0.000 description 1
- ZREIWWCKNBMKBH-UHFFFAOYSA-N 2-[1-(aminomethyl)cyclopentyl]acetic acid;benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1.OC(=O)CC1(CN)CCCC1 ZREIWWCKNBMKBH-UHFFFAOYSA-N 0.000 description 1
- XFLACBVNBXGJKW-UHFFFAOYSA-N 2-[1-(carboxymethyl)cycloheptyl]acetic acid Chemical compound OC(=O)CC1(CC(O)=O)CCCCCC1 XFLACBVNBXGJKW-UHFFFAOYSA-N 0.000 description 1
- USFHSOVRNQGFKG-UHFFFAOYSA-N 2-[1-[2-(benzenesulfonyloxyamino)-2-oxoethyl]cycloheptyl]acetic acid Chemical compound C=1C=CC=CC=1S(=O)(=O)ONC(=O)CC1(CC(=O)O)CCCCCC1 USFHSOVRNQGFKG-UHFFFAOYSA-N 0.000 description 1
- MOOLOLYTJOYTAN-UHFFFAOYSA-N 2-[1-[2-(hydroxyamino)-2-oxoethyl]cyclopentyl]acetic acid Chemical compound ON=C(O)CC1(CC(O)=O)CCCC1 MOOLOLYTJOYTAN-UHFFFAOYSA-N 0.000 description 1
- XNDSIASQMRYFSW-UHFFFAOYSA-N 3-oxaspiro[5.5]undecane-2,4-dione Chemical compound C1C(=O)OC(=O)CC11CCCCC1 XNDSIASQMRYFSW-UHFFFAOYSA-N 0.000 description 1
- CGSIJCLRVFEHNY-UHFFFAOYSA-N 3-oxaspiro[5.6]dodecane-2,4-dione Chemical compound C1C(=O)OC(=O)CC21CCCCCC2 CGSIJCLRVFEHNY-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- GFWLMILMVMCJDI-UHFFFAOYSA-N 8-oxaspiro[4.5]decane-7,9-dione Chemical compound C1C(=O)OC(=O)CC11CCCC1 GFWLMILMVMCJDI-UHFFFAOYSA-N 0.000 description 1
- HWTDMFJYBAURQR-UHFFFAOYSA-N 80-82-0 Chemical compound OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O HWTDMFJYBAURQR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101100412921 Drosophila melanogaster Rich gene Proteins 0.000 description 1
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapentin Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- LJOODBDWMQKMFB-UHFFFAOYSA-N cyclohexyl-acetic acid Natural products OC(=O)CC1CCCCC1 LJOODBDWMQKMFB-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical class C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical class OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/20—Spiro-condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/54—Spiro-condensed
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pyrrole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762611690 DE2611690A1 (de) | 1976-03-19 | 1976-03-19 | Cyclische sulfonyloxyimide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH635066A5 true CH635066A5 (de) | 1983-03-15 |
Family
ID=5972938
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH343777A CH635066A5 (de) | 1976-03-19 | 1977-03-18 | Verfahren zur herstellung cyclischer aminosaeuren. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4152326A (OSRAM) |
| JP (1) | JPS52113977A (OSRAM) |
| AU (1) | AU513892B2 (OSRAM) |
| BE (1) | BE852591A (OSRAM) |
| CH (1) | CH635066A5 (OSRAM) |
| DE (1) | DE2611690A1 (OSRAM) |
| DK (2) | DK156826C (OSRAM) |
| ES (1) | ES457050A1 (OSRAM) |
| FR (1) | FR2344540A1 (OSRAM) |
| GB (1) | GB1575709A (OSRAM) |
| IE (1) | IE44641B1 (OSRAM) |
| LU (1) | LU76974A1 (OSRAM) |
| NL (1) | NL186634C (OSRAM) |
| SE (2) | SE442013B (OSRAM) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| YU162789A (en) * | 1988-09-01 | 1990-12-31 | Lonza Ag | 2-aza-4-(alcoxycarbonyl) spiro/4,5/decan-3-ones |
| MY106864A (en) * | 1989-08-25 | 1995-08-30 | Warner Lambert Co | Improved process for cyclic amino acid anticonvulsant compounds. |
| US5132451A (en) * | 1989-08-25 | 1992-07-21 | Warner-Lambert Company | Process for cyclic amino acid anticonvulsant compounds |
| DE3928183A1 (de) * | 1989-08-25 | 1991-02-28 | Goedecke Ag | Lactamfreie cyclische aminosaeuren |
| US5319135A (en) * | 1989-08-25 | 1994-06-07 | Warner-Lambert Company | Process for cyclic amino acid anticonvulsant compounds |
| DE3928182A1 (de) | 1989-08-25 | 1991-02-28 | Goedecke Ag | Verfahren zur herstellung von gabapentin |
| US5136091A (en) * | 1989-11-16 | 1992-08-04 | Lonza Ltd. | Process for the production of 1-(aminomethyl) cyclohexane acetic acid |
| FI905584A7 (fi) * | 1989-11-16 | 1991-05-17 | Lonza Ag | Menetelmä 1-(aminometyyli)sykloheksaanietikkahapon valmistamiseksi |
| US5149870A (en) * | 1989-11-16 | 1992-09-22 | Lonza Ltd. | Process for the production of 1-(aminomethyl)cyclohexane acetic acid |
| CZ293759B6 (cs) * | 1996-03-14 | 2004-07-14 | Warner-Lambert Company | Substituovaná cyklická aminokyselina, její použití a farmaceutický prostředek na její bázi |
| WO1999018063A2 (en) | 1997-10-07 | 1999-04-15 | Warner-Lambert Company | Process for preparing a cyclic amino acid anticonvulsant compound |
| KR100589066B1 (ko) | 1997-10-27 | 2006-06-13 | 워너-램버트 캄파니 엘엘씨 | 약제로서 유용한 시클릭 아미노산 및 그의 유도체 |
| GB2362646A (en) * | 2000-05-26 | 2001-11-28 | Warner Lambert Co | Cyclic amino acid derivatives useful as pharmaceutical agents |
| EP1289364B1 (en) | 2000-06-16 | 2003-12-10 | Teva Pharmaceutical Industries Ltd. | Stable gabapentin containing more than 2o ppm of chlorine ion |
| AU2001266992B8 (en) * | 2000-06-16 | 2005-12-01 | Teva Pharmaceutical Industries Ltd. | Stable gabapentin having pH within a controlled range |
| US6818787B2 (en) * | 2001-06-11 | 2004-11-16 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US7186855B2 (en) | 2001-06-11 | 2007-03-06 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| US8048917B2 (en) | 2005-04-06 | 2011-11-01 | Xenoport, Inc. | Prodrugs of GABA analogs, compositions and uses thereof |
| CN1264607C (zh) * | 2001-09-28 | 2006-07-19 | 大赛璐化学工业株式会社 | 含有n-取代的环酰亚胺化合物的催化剂和使用该催化剂生产有机化合物的方法 |
| US20070184104A1 (en) * | 2001-10-25 | 2007-08-09 | Depomed, Inc. | Gastric retentive gabapentin dosage forms and methods for using same |
| US20060159743A1 (en) * | 2001-10-25 | 2006-07-20 | Depomed, Inc. | Methods of treating non-nociceptive pain states with gastric retentive gabapentin |
| US7612112B2 (en) | 2001-10-25 | 2009-11-03 | Depomed, Inc. | Methods of treatment using a gastric retained gabapentin dosage |
| TWI312285B (en) * | 2001-10-25 | 2009-07-21 | Depomed Inc | Methods of treatment using a gastric retained gabapentin dosage |
| ITMI20012750A1 (it) | 2001-12-21 | 2003-06-21 | Procos Spa | Processo per la produzione dell'acido 1-(amminometil)-cicloesil-acetico in forma pura |
| ITMI20022071A1 (it) * | 2002-10-01 | 2004-04-02 | Erregierre Spa | Processo di sintesi dell'acido 1-(aminometil)cicloesanacetico cloridato. |
| ATE418535T1 (de) | 2002-11-18 | 2009-01-15 | Nicholas Piramal India Ltd | Verbessertes verfahren zur herstellung von gabapentin |
| ITMI20030825A1 (it) * | 2003-04-18 | 2004-10-19 | Farchemia Srl | Procedimento per la preparazione di gabapentin esente da |
| US20050187295A1 (en) * | 2004-02-19 | 2005-08-25 | Surendra Kalyan | Processes for the preparation of gabapentin |
| US20090176882A1 (en) * | 2008-12-09 | 2009-07-09 | Depomed, Inc. | Gastric retentive gabapentin dosage forms and methods for using same |
| US8431739B2 (en) | 2010-06-14 | 2013-04-30 | Divi's Laboratories, Ltd. | Process for the preparation of gabapentin |
| RU2678991C1 (ru) * | 2017-12-21 | 2019-02-05 | Закрытое акционерное общество "Институт новых углеродных материалов и технологий" (ЗАО "ИНУМиТ") | Латентный катализатор ускорения отверждения смесей фенолформальдегидных и эпоксидных смол и способ его изготовления |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3256277A (en) * | 1966-06-14 | Azaspiro alkanes | ||
| US3256276A (en) * | 1961-02-17 | 1966-06-14 | Geschickter Fund Med Res | Substituted spiroimides |
| US3238217A (en) * | 1961-09-07 | 1966-03-01 | Geschickter Fund Med Res | Azaspiranes |
| US3432499A (en) * | 1965-04-02 | 1969-03-11 | Geschickter Fund Med Res | Trifluoromethylazaspiranes and azaspirane diones |
| DE2460891C2 (de) * | 1974-12-21 | 1982-09-23 | Gödecke AG, 1000 Berlin | 1-Aminomethyl-1-cycloalkanessigsäuren und deren Ester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel |
-
1976
- 1976-03-19 DE DE19762611690 patent/DE2611690A1/de active Granted
-
1977
- 1977-03-07 US US05/775,336 patent/US4152326A/en not_active Expired - Lifetime
- 1977-03-09 IE IE520/77A patent/IE44641B1/en not_active IP Right Cessation
- 1977-03-16 GB GB11097/77A patent/GB1575709A/en not_active Expired
- 1977-03-17 BE BE6045936A patent/BE852591A/xx not_active IP Right Cessation
- 1977-03-17 SE SE7703018A patent/SE442013B/xx not_active IP Right Cessation
- 1977-03-17 FR FR7707961A patent/FR2344540A1/fr active Granted
- 1977-03-18 CH CH343777A patent/CH635066A5/de not_active IP Right Cessation
- 1977-03-18 DK DK120077A patent/DK156826C/da not_active IP Right Cessation
- 1977-03-18 AU AU23414/77A patent/AU513892B2/en not_active Expired
- 1977-03-18 JP JP2934577A patent/JPS52113977A/ja active Pending
- 1977-03-18 LU LU76974A patent/LU76974A1/xx unknown
- 1977-03-18 NL NLAANVRAGE7703014,A patent/NL186634C/xx not_active IP Right Cessation
- 1977-03-21 ES ES457050A patent/ES457050A1/es not_active Expired
-
1982
- 1982-09-24 SE SE8205469A patent/SE454273B/sv not_active IP Right Cessation
-
1988
- 1988-04-20 DK DK214688A patent/DK159680C/da active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2344540B1 (OSRAM) | 1981-02-27 |
| SE442013B (sv) | 1985-11-25 |
| AU513892B2 (en) | 1981-01-15 |
| DK214688D0 (da) | 1988-04-20 |
| IE44641B1 (en) | 1982-02-10 |
| DK159680C (da) | 1991-04-22 |
| SE7703018L (sv) | 1977-09-20 |
| SE8205469D0 (sv) | 1982-09-24 |
| US4152326A (en) | 1979-05-01 |
| SE454273B (sv) | 1988-04-18 |
| DK156826C (da) | 1990-03-12 |
| LU76974A1 (OSRAM) | 1977-07-22 |
| BE852591A (fr) | 1977-09-19 |
| JPS52113977A (en) | 1977-09-24 |
| AU2341477A (en) | 1978-09-21 |
| SE8205469L (sv) | 1982-09-24 |
| DE2611690C2 (OSRAM) | 1992-01-16 |
| NL7703014A (nl) | 1977-09-21 |
| DE2611690A1 (de) | 1977-09-22 |
| DK214688A (da) | 1988-04-20 |
| NL186634C (nl) | 1991-01-16 |
| ES457050A1 (es) | 1978-08-16 |
| IE44641L (en) | 1977-09-19 |
| DK159680B (da) | 1990-11-19 |
| DK156826B (da) | 1989-10-09 |
| FR2344540A1 (fr) | 1977-10-14 |
| DK120077A (da) | 1977-09-20 |
| GB1575709A (en) | 1980-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2611690C2 (OSRAM) | ||
| EP0414275A2 (de) | Verfahren zur Herstellung von cyclischen Aminosäurederivaten sowie Zwischenprodukte | |
| DE69909165T2 (de) | Verfahren zur Herstellung von N-Glycyltyrosin | |
| DE2541342A1 (de) | Neue phenoxyalkylcarbonsaeuren und verfahren zur herstellung derselben | |
| DE2537681A1 (de) | Verfahren zur herstellung der isomeren 1,4-dibrom-epoxy-cyclohexene | |
| DE3642105A1 (de) | Substituierte aminomethyl-5,6,7,8-tetrahydronaphtyl-oxyessigsaeuren, neue zwischenprodukte, verfahren zu ihrer herstellung sowie ihre verwendung in arzneimitteln | |
| EP0025140B1 (de) | Verfahren zur Herstellung bekannter und neuer 6-Amino-6-desoxy-2,3-0-isopropyliden-alpha-L-sorbofuranose-Derivate sowie neue Zwischenprodukte des Verfahrens | |
| CH619955A5 (OSRAM) | ||
| DE887816C (de) | Verfahren zur Herstellung von 1-Nitrophenyl-2-amino-propan-1, 3-diolderivaten | |
| DE2427420C2 (de) | Verfahren zum 11a-Dehalogenieren eines 11a-Halogen-6-methylentetracyclins | |
| EP0088252B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| CH644122A5 (de) | 14-oxo-15-halogen-e-homoeburnanderivate, verfahren zu deren herstellung und deren verwendung. | |
| DE2436897C2 (de) | Verfahren zur Herstellung von Trisaminopyridinen | |
| DE2214488C3 (de) | Verfahren zur Herstellung 1-substituierter 4-AminopyiTolin-3-one(2) | |
| US2891987A (en) | alpha-amino-beta-aminoxypropionic acid and derivatives thereof | |
| DE3323510A1 (de) | 2-ketosulfonamide und verfahren zu deren herstellung | |
| EP0087656B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| EP0087654B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| DE1121052B (de) | Verfahren zur Herstellung von 4, 5-substituierten 2-Amino-oxazolen | |
| DE2362687A1 (de) | Verfahren zur razematspaltung von d,l-penicillamin | |
| EP0087657B1 (de) | Verfahren zur Herstellung von 1-(4-Chlorbenzoyl)-5-methoxy-2-methyl-3-indolacetoxyessigsäure | |
| DE68904546T2 (de) | Aminoacetonitril-derivate. | |
| DE69819315T2 (de) | Verfahren zur herstellung von piperidincarbonsäureamiden | |
| DE930565C (de) | Verfahren zur Herstellung von 1-Phenyl-2-amino-1, 3-propandiolen oder von im Phenylrest substituierten 1-Phenyl-2-amino-1, 3-propandiolen | |
| DE19713506A1 (de) | Verfahren zur Herstellung von 2,6-Dichlor-5-fluornicotinonitril und die chemische Verbindung 3-Cyano-2-hydroxy-5-fluorpyrid-6-on-mononatriumsalz sowie dessen Tautomere |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |