CH624970A5 - Process for the preparation of glass-transparent polyamide - Google Patents
Process for the preparation of glass-transparent polyamide Download PDFInfo
- Publication number
- CH624970A5 CH624970A5 CH1228775A CH1228775A CH624970A5 CH 624970 A5 CH624970 A5 CH 624970A5 CH 1228775 A CH1228775 A CH 1228775A CH 1228775 A CH1228775 A CH 1228775A CH 624970 A5 CH624970 A5 CH 624970A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acid
- component
- polyamide
- melt
- transparent
- Prior art date
Links
- 239000004952 Polyamide Substances 0.000 title description 24
- 229920002647 polyamide Polymers 0.000 title description 24
- 238000000034 method Methods 0.000 title description 7
- 230000008569 process Effects 0.000 title description 5
- 238000002360 preparation method Methods 0.000 title description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- 239000000203 mixture Substances 0.000 description 22
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 20
- 238000009835 boiling Methods 0.000 description 15
- 150000004985 diamines Chemical class 0.000 description 15
- 239000000155 melt Substances 0.000 description 12
- -1 aliphatic diamine Chemical class 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 8
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- 238000006068 polycondensation reaction Methods 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 6
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 description 6
- 238000001746 injection moulding Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 6
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 6
- 239000007788 liquid Substances 0.000 description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 210000003298 dental enamel Anatomy 0.000 description 4
- 150000001991 dicarboxylic acids Chemical class 0.000 description 4
- 230000009477 glass transition Effects 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- QUBNFZFTFXTLKH-UHFFFAOYSA-N 2-aminododecanoic acid Chemical compound CCCCCCCCCCC(N)C(O)=O QUBNFZFTFXTLKH-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 229920006017 homo-polyamide Polymers 0.000 description 3
- 150000003951 lactams Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- IGSBHTZEJMPDSZ-UHFFFAOYSA-N 4-[(4-amino-3-methylcyclohexyl)methyl]-2-methylcyclohexan-1-amine Chemical compound C1CC(N)C(C)CC1CC1CC(C)C(N)CC1 IGSBHTZEJMPDSZ-UHFFFAOYSA-N 0.000 description 2
- DZIHTWJGPDVSGE-UHFFFAOYSA-N 4-[(4-aminocyclohexyl)methyl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1CC1CCC(N)CC1 DZIHTWJGPDVSGE-UHFFFAOYSA-N 0.000 description 2
- BDBZTOMUANOKRT-UHFFFAOYSA-N 4-[2-(4-aminocyclohexyl)propan-2-yl]cyclohexan-1-amine Chemical compound C1CC(N)CCC1C(C)(C)C1CCC(N)CC1 BDBZTOMUANOKRT-UHFFFAOYSA-N 0.000 description 2
- 229920000299 Nylon 12 Polymers 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- SHCFCJUJGBRSPO-UHFFFAOYSA-N 1-cyclohexylcyclohexan-1-amine Chemical group C1CCCCC1C1(N)CCCCC1 SHCFCJUJGBRSPO-UHFFFAOYSA-N 0.000 description 1
- QFGCFKJIPBRJGM-UHFFFAOYSA-N 12-[(2-methylpropan-2-yl)oxy]-12-oxododecanoic acid Chemical compound CC(C)(C)OC(=O)CCCCCCCCCCC(O)=O QFGCFKJIPBRJGM-UHFFFAOYSA-N 0.000 description 1
- HASUJDLTAYUWCO-UHFFFAOYSA-N 2-aminoundecanoic acid Chemical compound CCCCCCCCCC(N)C(O)=O HASUJDLTAYUWCO-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000005275 alloying Methods 0.000 description 1
- FXWXBAZWPVUWNE-UHFFFAOYSA-N amino dodecanoate Chemical compound CCCCCCCCCCCC(=O)ON FXWXBAZWPVUWNE-UHFFFAOYSA-N 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- MGIAHHJRDZCTHG-UHFFFAOYSA-N benzene-1,3-dicarboxylic acid;terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1.OC(=O)C1=CC=CC(C(O)=O)=C1 MGIAHHJRDZCTHG-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- YQLZOAVZWJBZSY-UHFFFAOYSA-N decane-1,10-diamine Chemical compound NCCCCCCCCCCN YQLZOAVZWJBZSY-UHFFFAOYSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- JMLPVHXESHXUSV-UHFFFAOYSA-N dodecane-1,1-diamine Chemical compound CCCCCCCCCCCC(N)N JMLPVHXESHXUSV-UHFFFAOYSA-N 0.000 description 1
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940100630 metacresol Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000012764 mineral filler Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- SXJVFQLYZSNZBT-UHFFFAOYSA-N nonane-1,9-diamine Chemical compound NCCCCCCCCCN SXJVFQLYZSNZBT-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/265—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids from at least two different diamines or at least two different dicarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/36—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino acids, polyamines and polycarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Polyamides (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1228775A CH624970A5 (en) | 1975-09-22 | 1975-09-22 | Process for the preparation of glass-transparent polyamide |
| IT5135976A IT1066199B (it) | 1975-09-22 | 1976-09-20 | Procedimento per la produzione di poliammide trasparente |
| DE19762642244 DE2642244C2 (de) | 1975-09-22 | 1976-09-20 | Verfahren zur Herstellung von glasklar durchsichtigen Copolyamiden und deren Verwendung zur Herstellung von Formkörpern |
| FR7628354A FR2324672A1 (fr) | 1975-09-22 | 1976-09-21 | Procede de preparation d'un polyamide transparent a l'aspect du verre |
| PL19255176A PL102928B1 (pl) | 1975-09-22 | 1976-09-21 | Sposob wytwarzania szkliscie przezroczystego poliamidu |
| GB3922076A GB1548431A (en) | 1975-09-22 | 1976-09-22 | Polyamides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1228775A CH624970A5 (en) | 1975-09-22 | 1975-09-22 | Process for the preparation of glass-transparent polyamide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH624970A5 true CH624970A5 (en) | 1981-08-31 |
Family
ID=4381599
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1228775A CH624970A5 (en) | 1975-09-22 | 1975-09-22 | Process for the preparation of glass-transparent polyamide |
Country Status (6)
| Country | Link |
|---|---|
| CH (1) | CH624970A5 (enrdf_load_stackoverflow) |
| DE (1) | DE2642244C2 (enrdf_load_stackoverflow) |
| FR (1) | FR2324672A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1548431A (enrdf_load_stackoverflow) |
| IT (1) | IT1066199B (enrdf_load_stackoverflow) |
| PL (1) | PL102928B1 (enrdf_load_stackoverflow) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2635085A1 (de) * | 1976-08-04 | 1978-02-09 | Bayer Ag | Polyamide |
| DE2726262A1 (de) * | 1977-06-10 | 1978-12-21 | Bayer Ag | Copolyamide |
| US4255559A (en) | 1978-10-18 | 1981-03-10 | Ciba-Geigy Corporation | Transparent copolyamide from 1,10-disubstituted-1,10 diamine |
| US4258176A (en) * | 1978-10-18 | 1981-03-24 | Ciba-Geigy Corporation | Transparent copolyamide from 1,10-disubstituted C11 diamine |
| US4277621A (en) | 1978-10-18 | 1981-07-07 | Ciba-Geigy Corporation | Substituted 11-amino-undeca-4,8-dienal and 11-amino-undecanal derivatives and processes for their preparation |
| DE2962152D1 (en) * | 1978-10-18 | 1982-03-25 | Ciba Geigy Ag | Substituted 1,11-diamino undecanes, processes for their preparation and their use |
| US4258177A (en) * | 1978-10-18 | 1981-03-24 | Ciba-Geigy Corporation | Transparent copolyamide from 1,10-disubstituted C10 diamine |
| US4264762A (en) * | 1978-10-24 | 1981-04-28 | Basf Aktiengesellschaft | Glass-clear nylons from 3,3'-dimethyl PACM |
| DE2936759C2 (de) * | 1979-09-12 | 1987-03-26 | Hüls AG, 4370 Marl | Transparente Copolyamide |
| DE2949064C2 (de) | 1979-12-06 | 1985-10-31 | Chemische Werke Hüls AG, 4370 Marl | Verwendung von Copolyetheresteramiden als Schmelzkleber zum Heißsiegeln von Textilien |
| DE3168062D1 (en) * | 1980-12-12 | 1985-02-14 | Dynamit Nobel Ag | Transparent polyamide resistant to boiling water and sterilization |
| CH667462A5 (de) * | 1985-01-07 | 1988-10-14 | Inventa Ag | Transparente copolyamide, verfahren zu deren herstellung und deren verwendung zur herstellung von formkoerpern. |
| GB8710748D0 (en) | 1987-05-07 | 1987-06-10 | Rennie Sa | Metal coating powders |
| FR2622197B1 (fr) * | 1987-10-21 | 1990-03-09 | Atochem | Polyamides transparents, leur procede de fabrication |
| FR2706474B1 (fr) * | 1993-06-11 | 1995-08-25 | Atochem Elf Sa | Compositions polyamides transparentes sans déformation à chaud. |
| CA2162429A1 (en) * | 1995-02-01 | 1996-08-02 | Hans Dalla Torre | Colorless, transparent copolyamides, their preparation, and molded articles made from these copolyamides, their blends or alloys |
| CH689422A5 (de) | 1995-02-01 | 1999-04-15 | Inventa Ag | Transparente Copolyamide, ihre Herstellung sowie Formkoerper aus den transparenten Copolyamiden. |
| DE10009756B4 (de) | 2000-03-01 | 2004-03-25 | Ems-Chemie Ag | Farblose, hochtransparente Polyamid-Blends mit verbesserter Spannungsrissbeständigkeit |
| DE10308226A1 (de) | 2003-02-25 | 2004-09-23 | Degussa Ag | Transparente Formmasse für optische Anwendungen |
| DE102006045269A1 (de) | 2005-11-09 | 2007-05-31 | Ems-Chemie Ag | Metallisch beschichtete Lichtreflektierbauteile auf der Basis von thermoplastischen Formmassen |
| US8044171B2 (en) | 2006-01-31 | 2011-10-25 | Ems-Chemie Ag | Polyamide molding compound and its use for producing transparent, hot-steam-sterilizable molded parts and extrudates |
| DE102006057957B4 (de) * | 2006-12-08 | 2017-03-23 | Ems-Chemie Ag | Transparenter Formkörper aus einer Polyamidformmasse sowie dessen Verwendung |
| US8268956B2 (en) | 2006-12-08 | 2012-09-18 | Ems-Chemie Ag | Transparent mold made of a polyamide molding material |
| EP2060607B2 (de) | 2007-11-16 | 2019-11-27 | Ems-Patent Ag | Gefüllte Polyamidformmassen |
| DE102007062063A1 (de) | 2007-12-21 | 2009-06-25 | Ems-Patent Ag | Transparente Polyamidformmasse |
| DE102008002599A1 (de) | 2008-06-24 | 2009-12-31 | Evonik Degussa Gmbh | Bauteil mit Deckschicht aus einer PA613-Formmasse |
| DE102008046682A1 (de) | 2008-09-10 | 2010-03-11 | Basf Se | Amorphe Polyamide |
| DE102009035974A1 (de) | 2009-08-04 | 2011-02-17 | Basf Se | Amorphe Polyamide |
| EP2365033B1 (de) | 2010-03-12 | 2013-07-10 | Ems-Patent Ag | Schlagzähmodifizierte Polyamidformmasse sowie hieraus gebildeter Behälter |
| EP2412757B1 (de) | 2010-07-30 | 2013-11-13 | Ems-Patent Ag | Polyamidformmasse zur Herstellung von Formkörpern mit einer Weichgriffoberfläche sowie entsprechende Formkörper |
| DE102010051726A1 (de) | 2010-11-19 | 2012-05-24 | Basf Se | Amorphe Polyamide mit bicyclischen aliphatischen Diaminen |
| DE102010051708A1 (de) | 2010-11-19 | 2012-05-24 | Basf Se | Amorphe Polyamide mit dialkylsubstituierten Diaminen |
| EP2535365B1 (de) | 2011-06-17 | 2013-09-25 | Ems-Patent Ag | Teilaromatische Formmassen und deren Verwendungen |
| EP2666803B1 (de) | 2012-05-23 | 2018-09-05 | Ems-Patent Ag | Kratzfeste, transparente und zähe Copolyamidformmassen, hieraus hergestellte Formkörper und deren Verwendung |
| EP2716716B1 (de) | 2012-10-02 | 2018-04-18 | Ems-Patent Ag | Polyamid-Formmassen und deren Verwendung bei der Herstellung von Formkörpern |
| EP2746339B1 (de) | 2012-12-18 | 2014-11-12 | Ems-Patent Ag | Polyamid-Formmasse und hieraus hergestellte Formkörper |
| EP2778190B1 (de) | 2013-03-15 | 2015-07-15 | Ems-Patent Ag | Polyamidformmasse sowie hieraus hergestellter Formkörper |
| EP2881438A1 (de) | 2013-12-05 | 2015-06-10 | LANXESS Deutschland GmbH | Polyamidzusammensetzungen |
| EP4008743B1 (de) | 2020-12-04 | 2024-09-04 | Ems-Chemie Ag | Wasserdampf-resistente transparente polyamide |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2512606A (en) * | 1945-09-12 | 1950-06-27 | Du Pont | Polyamides and method for obtaining same |
| US2516585A (en) * | 1948-12-21 | 1950-07-25 | Du Pont | Synthetic linear polyamides containing intralinear cyclic groups and process for obtaining same |
| US2696482A (en) * | 1951-07-19 | 1954-12-07 | Du Pont | Transparent synthetic linear polyamide and process for producing same |
| IL24111A (en) * | 1964-08-24 | 1969-02-27 | Du Pont | Linear polyamides |
| DE1595354C3 (de) * | 1966-10-18 | 1978-12-07 | Basf Ag | Verfahren zur Herstellung von Polyamiden |
| BE792063A (fr) * | 1971-12-02 | 1973-05-29 | Bayer Ag | Copolyamides transparentes |
| US3840501A (en) * | 1972-07-05 | 1974-10-08 | Phillips Petroleum Co | Copolyamides of 2,2-bis(4-aminocyclohexyl)propanes and a mixture of alkane dicarboxylic acids |
| US3842045A (en) * | 1972-07-05 | 1974-10-15 | Phillips Petroleum Co | Amorphous polyamides from bis(4-aminocyclohexyl)methane and a mixture of straight chain dicarboxylic acids |
| DE2405985A1 (de) * | 1974-02-08 | 1975-08-21 | Hoechst Ag | Flammwidrige polyamidformmassen |
-
1975
- 1975-09-22 CH CH1228775A patent/CH624970A5/de not_active IP Right Cessation
-
1976
- 1976-09-20 IT IT5135976A patent/IT1066199B/it active
- 1976-09-20 DE DE19762642244 patent/DE2642244C2/de not_active Expired
- 1976-09-21 PL PL19255176A patent/PL102928B1/pl unknown
- 1976-09-21 FR FR7628354A patent/FR2324672A1/fr active Granted
- 1976-09-22 GB GB3922076A patent/GB1548431A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1548431A (en) | 1979-07-18 |
| FR2324672A1 (fr) | 1977-04-15 |
| DE2642244A1 (de) | 1977-03-31 |
| PL102928B1 (pl) | 1979-05-31 |
| IT1066199B (it) | 1985-03-04 |
| DE2642244C2 (de) | 1983-07-07 |
| FR2324672B1 (enrdf_load_stackoverflow) | 1978-05-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH624970A5 (en) | Process for the preparation of glass-transparent polyamide | |
| DE3600015C2 (enrdf_load_stackoverflow) | ||
| DE3717928C2 (enrdf_load_stackoverflow) | ||
| EP0693515B1 (de) | Verfahren zur Herstellung von Vorkondensaten teilkristalliner oder amorpher, thermoplastischer teilaromatischer (Co)Polyamide | |
| DE69817361T2 (de) | Thermoplastisches copolyamid, formmasse aus diesem | |
| DE4023968C2 (de) | Amorphes Copolyamid, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE69107840T2 (de) | Halbkristalline halbaromatische copolyamide. | |
| DE69225946T3 (de) | Transparente Polyamid-Mischungen mit hoher Beständigkeit gegenüber chemischen Mitteln | |
| DE10057455C2 (de) | Polyamid-Formmassen mit verbesserten Eigenschaften | |
| DE69915741T2 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE69209036T2 (de) | Verfahren zur Herstellung von Copolyamiden | |
| EP1120443B1 (de) | Leichtfliessende transparente Polyamid-Formmasse | |
| DE2936759C2 (de) | Transparente Copolyamide | |
| EP2708569A1 (de) | Transparente Polyamidimide | |
| DE69500807T2 (de) | Polyamide mit verbesserte färbung und verarbeitung und verfahren zu ihrer herstellung | |
| DE1595354C3 (de) | Verfahren zur Herstellung von Polyamiden | |
| EP0012931B1 (de) | Copolyamide auf der Basis eines Gemisches cycloaliphatischer Amine und daraus erhaltene Formkörper | |
| DE2256217B2 (de) | Mischungen thermoplastischer Polyamide | |
| EP0469436A1 (de) | Copolyamide, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE3934926A1 (de) | Gegenueber alkoholen und kochendem wasser bestaendige formmassen | |
| DE3686250T2 (de) | Copolyamide und verfahren zu deren herstellung. | |
| DE69225307T2 (de) | Transparente amorphe Zusammensetzungen mit erhöhtem Gehalt an chemischen Stoffen | |
| DE2263929A1 (de) | Transparente polyamide | |
| EP0000492B1 (de) | Transparente Polyamide und deren Verwendung zur Herstellung von Formkörpern | |
| EP0001039B1 (de) | Transparente Polyamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |