CH619971A5 - - Google Patents
Download PDFInfo
- Publication number
- CH619971A5 CH619971A5 CH516175A CH516175A CH619971A5 CH 619971 A5 CH619971 A5 CH 619971A5 CH 516175 A CH516175 A CH 516175A CH 516175 A CH516175 A CH 516175A CH 619971 A5 CH619971 A5 CH 619971A5
- Authority
- CH
- Switzerland
- Prior art keywords
- methacrylamide
- bis
- hydroxypropyl
- acrylamide
- methacrylate
- Prior art date
Links
- -1 N-substituted acrylamides Chemical class 0.000 claims description 39
- 238000006116 polymerization reaction Methods 0.000 claims description 24
- 229920001577 copolymer Polymers 0.000 claims description 22
- OKPYIWASQZGASP-UHFFFAOYSA-N n-(2-hydroxypropyl)-2-methylprop-2-enamide Chemical compound CC(O)CNC(=O)C(C)=C OKPYIWASQZGASP-UHFFFAOYSA-N 0.000 claims description 20
- 239000000178 monomer Substances 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 10
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 claims description 8
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 claims description 6
- 239000000725 suspension Substances 0.000 claims description 6
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 5
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 5
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- HCLJOFJIQIJXHS-UHFFFAOYSA-N 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOCCOCCOC(=O)C=C HCLJOFJIQIJXHS-UHFFFAOYSA-N 0.000 claims description 4
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 4
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 claims description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 3
- SJIXRGNQPBQWMK-UHFFFAOYSA-N 2-(diethylamino)ethyl 2-methylprop-2-enoate Chemical compound CCN(CC)CCOC(=O)C(C)=C SJIXRGNQPBQWMK-UHFFFAOYSA-N 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 3
- LTHJXDSHSVNJKG-UHFFFAOYSA-N 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOCCOC(=O)C(C)=C LTHJXDSHSVNJKG-UHFFFAOYSA-N 0.000 claims description 3
- 239000005725 8-Hydroxyquinoline Substances 0.000 claims description 3
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims description 3
- 229960003540 oxyquinoline Drugs 0.000 claims description 3
- FYBFGAFWCBMEDG-UHFFFAOYSA-N 1-[3,5-di(prop-2-enoyl)-1,3,5-triazinan-1-yl]prop-2-en-1-one Chemical compound C=CC(=O)N1CN(C(=O)C=C)CN(C(=O)C=C)C1 FYBFGAFWCBMEDG-UHFFFAOYSA-N 0.000 claims description 2
- WWGQHTJIFOQAOC-UHFFFAOYSA-N 2,3,5-trichlorophenol Chemical compound OC1=CC(Cl)=CC(Cl)=C1Cl WWGQHTJIFOQAOC-UHFFFAOYSA-N 0.000 claims description 2
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 claims description 2
- JHWGFJBTMHEZME-UHFFFAOYSA-N 4-prop-2-enoyloxybutyl prop-2-enoate Chemical compound C=CC(=O)OCCCCOC(=O)C=C JHWGFJBTMHEZME-UHFFFAOYSA-N 0.000 claims description 2
- SAPGBCWOQLHKKZ-UHFFFAOYSA-N 6-(2-methylprop-2-enoyloxy)hexyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCCCCOC(=O)C(C)=C SAPGBCWOQLHKKZ-UHFFFAOYSA-N 0.000 claims description 2
- 239000011837 N,N-methylenebisacrylamide Substances 0.000 claims description 2
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 claims description 2
- DAKWPKUUDNSNPN-UHFFFAOYSA-N Trimethylolpropane triacrylate Chemical compound C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C DAKWPKUUDNSNPN-UHFFFAOYSA-N 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 claims description 2
- YQCFXPARMSSRRK-UHFFFAOYSA-N n-[6-(prop-2-enoylamino)hexyl]prop-2-enamide Chemical compound C=CC(=O)NCCCCCCNC(=O)C=C YQCFXPARMSSRRK-UHFFFAOYSA-N 0.000 claims description 2
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 claims description 2
- 238000010526 radical polymerization reaction Methods 0.000 claims description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims 5
- 125000001424 substituent group Chemical group 0.000 claims 3
- CARZNHSZGXCIJM-UHFFFAOYSA-N 1-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OC(C)OC(=O)C(C)=C CARZNHSZGXCIJM-UHFFFAOYSA-N 0.000 claims 1
- SBAPKYXYDFVHKP-UHFFFAOYSA-N 2,7-dimethylocta-2,6-dienedioic acid Chemical compound OC(=O)C(C)=CCCC=C(C)C(O)=O SBAPKYXYDFVHKP-UHFFFAOYSA-N 0.000 claims 1
- PIYJQTKZHLLZQE-UHFFFAOYSA-N 2-methyl-n-[2-(2-methylprop-2-enoylamino)ethyl]prop-2-enamide Chemical compound CC(=C)C(=O)NCCNC(=O)C(C)=C PIYJQTKZHLLZQE-UHFFFAOYSA-N 0.000 claims 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims 1
- SWHLOXLFJPTYTL-UHFFFAOYSA-N [2-methyl-3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCC(C)(COC(=O)C(C)=C)COC(=O)C(C)=C SWHLOXLFJPTYTL-UHFFFAOYSA-N 0.000 claims 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims 1
- 230000003993 interaction Effects 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 29
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 239000011521 glass Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 239000013543 active substance Substances 0.000 description 8
- RGBXDEHYFWDBKD-UHFFFAOYSA-N propan-2-yl propan-2-yloxy carbonate Chemical compound CC(C)OOC(=O)OC(C)C RGBXDEHYFWDBKD-UHFFFAOYSA-N 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000012528 membrane Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000000926 separation method Methods 0.000 description 6
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 5
- JTYHSQYLBPKGNA-UHFFFAOYSA-N 2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]acetic acid Chemical compound CC(=C)C(=O)NCC(=O)NCC(O)=O JTYHSQYLBPKGNA-UHFFFAOYSA-N 0.000 description 4
- 150000003926 acrylamides Chemical class 0.000 description 4
- 238000011049 filling Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 229940044192 2-hydroxyethyl methacrylate Drugs 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000005662 Paraffin oil Substances 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 3
- SWPMNMYLORDLJE-UHFFFAOYSA-N n-ethylprop-2-enamide Chemical compound CCNC(=O)C=C SWPMNMYLORDLJE-UHFFFAOYSA-N 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 239000012798 spherical particle Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 238000001042 affinity chromatography Methods 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 229940088623 biologically active substance Drugs 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical class CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 2
- QRWZCJXEAOZAAW-UHFFFAOYSA-N n,n,2-trimethylprop-2-enamide Chemical compound CN(C)C(=O)C(C)=C QRWZCJXEAOZAAW-UHFFFAOYSA-N 0.000 description 2
- OVHHHVAVHBHXAK-UHFFFAOYSA-N n,n-diethylprop-2-enamide Chemical compound CCN(CC)C(=O)C=C OVHHHVAVHBHXAK-UHFFFAOYSA-N 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- QQDCHXCQETWULU-UHFFFAOYSA-N (2-acetamido-2-phenoxyethyl) prop-2-enoate Chemical compound C=CC(=O)OCC(NC(=O)C)OC1=CC=CC=C1 QQDCHXCQETWULU-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- YWOYCXNNAGNDKT-UHFFFAOYSA-N 1-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OC(C)OC(=O)C=C YWOYCXNNAGNDKT-UHFFFAOYSA-N 0.000 description 1
- BOURDYMMTZXVRY-UHFFFAOYSA-N 2-(2-methylprop-2-enoylamino)acetic acid Chemical compound CC(=C)C(=O)NCC(O)=O BOURDYMMTZXVRY-UHFFFAOYSA-N 0.000 description 1
- JEJIWKKGUFJLAF-UHFFFAOYSA-N 2-(hydroxymethyl)-2-methylpropane-1,3-diol;2-methylprop-2-enoic acid Chemical compound CC(=C)C(O)=O.CC(=C)C(O)=O.CC(=C)C(O)=O.OCC(C)(CO)CO JEJIWKKGUFJLAF-UHFFFAOYSA-N 0.000 description 1
- MZGMQAMKOBOIDR-UHFFFAOYSA-N 2-[2-(2-hydroxyethoxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCO MZGMQAMKOBOIDR-UHFFFAOYSA-N 0.000 description 1
- HWSSEYVMGDIFMH-UHFFFAOYSA-N 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C HWSSEYVMGDIFMH-UHFFFAOYSA-N 0.000 description 1
- TWYMPBNGGPJTCF-UHFFFAOYSA-N 2-[[2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]acetyl]amino]acetic acid Chemical compound CC(=C)C(=O)NCC(=O)NCC(=O)NCC(O)=O TWYMPBNGGPJTCF-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- CCIDRBFZPRURMU-UHFFFAOYSA-N 2-methyl-n-propylprop-2-enamide Chemical compound CCCNC(=O)C(C)=C CCIDRBFZPRURMU-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- MWEDICIPWMSWFM-UHFFFAOYSA-N N-(2-acetamidophenyl)-2-methylprop-2-enamide Chemical compound C(C(=C)C)(=O)NC1=C(C=CC=C1)NC(C)=O MWEDICIPWMSWFM-UHFFFAOYSA-N 0.000 description 1
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 description 1
- 108010039491 Ricin Proteins 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940124277 aminobutyric acid Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000011449 brick Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 229960004138 cyclobarbital Drugs 0.000 description 1
- 239000012933 diacyl peroxide Substances 0.000 description 1
- KZNICNPSHKQLFF-UHFFFAOYSA-N dihydromaleimide Natural products O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 125000005397 methacrylic acid ester group Chemical group 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- YLOWTPHXXDJBAH-UHFFFAOYSA-N methyl 2-methylprop-2-enoate Chemical compound COC(=O)C(C)=C.COC(=O)C(C)=C YLOWTPHXXDJBAH-UHFFFAOYSA-N 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- XPHFGUOTCCLEAA-UHFFFAOYSA-N n-(4-acetamidophenyl)-2-methylprop-2-enamide Chemical compound CC(=O)NC1=CC=C(NC(=O)C(C)=C)C=C1 XPHFGUOTCCLEAA-UHFFFAOYSA-N 0.000 description 1
- YRVUCYWJQFRCOB-UHFFFAOYSA-N n-butylprop-2-enamide Chemical compound CCCCNC(=O)C=C YRVUCYWJQFRCOB-UHFFFAOYSA-N 0.000 description 1
- ZIWDVJPPVMGJGR-UHFFFAOYSA-N n-ethyl-2-methylprop-2-enamide Chemical compound CCNC(=O)C(C)=C ZIWDVJPPVMGJGR-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- UWHCKJMYHZGTIT-UHFFFAOYSA-N tetraethylene glycol Chemical compound OCCOCCOCCOCCO UWHCKJMYHZGTIT-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F220/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride ester, amide, imide or nitrile thereof
- C08F220/02—Monocarboxylic acids having less than ten carbon atoms; Derivatives thereof
- C08F220/52—Amides or imides
- C08F220/54—Amides, e.g. N,N-dimethylacrylamide or N-isopropylacrylamide
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS2879A CS173846B1 (enExample) | 1974-04-23 | 1974-04-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH619971A5 true CH619971A5 (enExample) | 1980-10-31 |
Family
ID=5367182
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH516175A CH619971A5 (enExample) | 1974-04-23 | 1975-04-23 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4062831A (enExample) |
| JP (1) | JPS50146696A (enExample) |
| CA (1) | CA1041695A (enExample) |
| CH (1) | CH619971A5 (enExample) |
| CS (1) | CS173846B1 (enExample) |
| DE (1) | DE2517511A1 (enExample) |
| FR (1) | FR2268818B1 (enExample) |
| GB (1) | GB1467771A (enExample) |
| IT (1) | IT1037561B (enExample) |
| NL (1) | NL7504823A (enExample) |
| SE (1) | SE411352B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4275183A (en) * | 1979-07-27 | 1981-06-23 | Peter Kuzma | Hydrophilic polymers and contact lenses therefrom |
| US4454301A (en) * | 1982-06-07 | 1984-06-12 | American Cyanamid Company | Crosslinking coating compositions |
| CH665565A5 (de) * | 1983-10-22 | 1988-05-31 | Mitsui Toatsu Chemicals | Verfahren zur steuerung der konzentration einer eine makromolekulare verbindung enthaltenden waessrigen loesung oder emulsion. |
| US4539200A (en) * | 1983-11-04 | 1985-09-03 | The Kendall Company | Treatment of skin lesions |
| GR851478B (enExample) * | 1984-06-21 | 1985-11-25 | Procter & Gamble | |
| US4871824A (en) * | 1987-03-13 | 1989-10-03 | Minnesota Mining And Manufacturing Company | Variably crosslinked polymeric supports |
| US4945006A (en) * | 1989-01-17 | 1990-07-31 | Minnesota Mining And Manufacturing Company | Low odor adhesive compositions and bonding method employing same |
| DE69118826T2 (de) * | 1990-11-27 | 1996-11-14 | Fuji Photo Film Co Ltd | Propenamidderivate, deren Polymere, Copolymere und deren Verwendung |
| GB9200247D0 (en) * | 1992-01-07 | 1992-02-26 | Erba Carlo Spa | Pharmaceutical compositions containing polymer derivative-bound anthracycline glycosides and a method for their preparation |
| GB9213077D0 (en) * | 1992-06-19 | 1992-08-05 | Erba Carlo Spa | Polymerbound taxol derivatives |
| JP3014262B2 (ja) * | 1994-01-11 | 2000-02-28 | 三菱レイヨン株式会社 | 生体触媒固定化用担体および固定化生体触媒 |
| FR2762394B1 (fr) * | 1997-04-16 | 1999-05-28 | Bio Merieux | Compose ligand de coordination et utilisation pour fixer un materiel biologique |
| US5965118A (en) * | 1997-04-18 | 1999-10-12 | Access Pharmaceuticals, Inc. | Polymer-platinum compounds |
| AU7124598A (en) * | 1997-04-18 | 1998-11-13 | Access Pharmaceuticals, Inc. | Polymer-platinum compounds |
| US6464850B1 (en) * | 1998-07-31 | 2002-10-15 | Biowhittaker Molecular Applications, Inc. | Method for producing hydrophilic monomers and uses thereof |
| ATE301679T1 (de) * | 1999-01-29 | 2005-08-15 | Amersham Biosciences Kk | Temperatursensitives polymer und verfahren zu seiner herstellung |
| ZA200001591B (en) * | 1999-04-28 | 2000-10-25 | Rohm & Haas | Polymer compositions. |
| CA2445985A1 (en) * | 2001-05-04 | 2002-11-14 | University Of Utah Research Foundation | Hyaluronic acid containing bioconjugates: targeted delivery of anti-cancer drugs to cancer cells |
| FR2824562A1 (fr) * | 2001-05-14 | 2002-11-15 | Bio Merieux | Latex de poly(n-isopropylacrylamide) comportant en surface des fonctions nitrile |
| CA2483696A1 (en) * | 2002-05-06 | 2003-11-20 | University Of Utah Research Foundation | Preblocking with non-ha gags increases effectiveness of ha conjugated anticancer agents |
| WO2007143209A2 (en) * | 2006-06-02 | 2007-12-13 | University Of Virginia Patent Foundation | Luminescent diketonate polymers |
| KR101705077B1 (ko) * | 2008-10-07 | 2017-02-09 | 렉산 파마슈티컬스, 인코포레이티드 | Hpma-도세탁셀 또는 젬시타빈 컨쥬게이트 및 이의 용도 |
| CN102686243B (zh) | 2009-10-13 | 2015-02-18 | 瑞沙恩医药公司 | 用于抗癌剂递送的聚合物系统 |
| JP5944836B2 (ja) | 2010-03-08 | 2016-07-05 | ユニバーシティ・オブ・ユタ・リサーチ・ファウンデイション | 高分子薬物送達結合体ならびにその製造および使用方法 |
| CN103189135B (zh) | 2010-10-29 | 2015-01-14 | Lg化学株式会社 | 挥发性有机化合物的吸附剂以及使用该吸附剂的吸附方法 |
| KR102384693B1 (ko) | 2013-03-12 | 2022-04-07 | 유니버시티 오브 유타 리서치 파운데이션 | 세포사멸 유도용 조성물 및 방법 |
-
1974
- 1974-04-23 CS CS2879A patent/CS173846B1/cs unknown
-
1975
- 1975-04-16 SE SE7504411A patent/SE411352B/xx unknown
- 1975-04-17 US US05/568,777 patent/US4062831A/en not_active Expired - Lifetime
- 1975-04-17 GB GB1583375A patent/GB1467771A/en not_active Expired
- 1975-04-21 IT IT22595/75A patent/IT1037561B/it active
- 1975-04-21 DE DE19752517511 patent/DE2517511A1/de not_active Withdrawn
- 1975-04-22 FR FR7512448A patent/FR2268818B1/fr not_active Expired
- 1975-04-23 NL NL7504823A patent/NL7504823A/xx not_active Application Discontinuation
- 1975-04-23 CA CA225,251A patent/CA1041695A/en not_active Expired
- 1975-04-23 CH CH516175A patent/CH619971A5/de not_active IP Right Cessation
- 1975-04-23 JP JP50048710A patent/JPS50146696A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CA1041695A (en) | 1978-10-31 |
| JPS50146696A (enExample) | 1975-11-25 |
| FR2268818B1 (enExample) | 1979-03-23 |
| DE2517511A1 (de) | 1975-11-13 |
| CS173846B1 (enExample) | 1977-03-31 |
| SE7504411L (sv) | 1975-10-24 |
| SE411352B (sv) | 1979-12-17 |
| IT1037561B (it) | 1979-11-20 |
| FR2268818A1 (enExample) | 1975-11-21 |
| GB1467771A (en) | 1977-03-23 |
| NL7504823A (nl) | 1975-10-27 |
| AU8041275A (en) | 1976-10-28 |
| US4062831A (en) | 1977-12-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH619971A5 (enExample) | ||
| DE69219223T2 (de) | Verfahren zur Herstellung von hoch wasserabsorbierende Polymeren | |
| DE69018546T2 (de) | Verfahren zur Herstellung von stark absorbierenden Polymeren. | |
| DE69027803T2 (de) | Polymerträger | |
| DE2501831C2 (de) | Verfahren zur Herstellung von einheitlich geformten, porösen, runden Polyacrylatperlen | |
| DE69827926T2 (de) | Ein verfahren zur herstellung von polymeren mikrogelen | |
| DE1103027B (de) | Verfahren zur Herstellung praktisch wasserfreier Massen, die in waessrigen Medien glatte Schleime bilden koennen | |
| DE2722751C2 (de) | Perlpolymerisat mit einem Teilchendurchmesser von 5 bis 1000 μm und innerem Hohlraum | |
| DE60015514T2 (de) | Aminogruppen enthaltende festphasenmatrix, verwendung und herstellung davon | |
| DE2655292A1 (de) | Teilchenfoermiges gel aus einem dextranderivat | |
| DE102004011497B4 (de) | Dentalwerkstoffe mit verbesserter Verträglichkeit | |
| DE69317609T2 (de) | Verfahren zur Herstellung von Polymerpartikeln von unregelmässiger Form | |
| CH621561A5 (en) | Process for producing a bromocyan-activated, hydrophilic, polymeric carrier for biologically active compounds in dried form | |
| DE3727044A1 (de) | Massen fuer kontaktlinsen und biokompatible koerper | |
| DE69410763T2 (de) | Microsphäre und Verfahren zu deren Herstellung | |
| DE68927772T2 (de) | Wasserabsorbierendes Polymer und Verfahren zu seiner Herstellung | |
| DE69613929T2 (de) | Verfahren zur Herstellung einer wässrigen Lösung aus Phosphorylcholin-Gruppen enthaltenden Polymeren, sowie wässrige Lösung aus Phosphorylcholin-Gruppen enthaltenden Polymeren | |
| EP2164881B1 (de) | Verwendung eines quellbaren polymers zum abdichten | |
| DE69624817T2 (de) | Carboxylgruppen enthaltende polymerzusammensetzung | |
| EP0100423A1 (de) | Vernetzer für wasserquellbare Polymere | |
| DE2416353A1 (de) | Hydrophiles copolymer von n,n-(c tief 1c tief 2-alkyl)-acrylamid | |
| DE9013137U1 (de) | Hochvernetztes, perlförmiges, aktivierbares, hydrophiles Trägermaterial | |
| WO2009143953A1 (de) | Ce(iv) initiierte pfropfpolymerisation auf nicht hydroxylgruppenhaltigen polymeren | |
| EP0421264B1 (de) | Hydrophile, quellbare Polymerisate | |
| EP0192183A2 (de) | Schwach vernetzte, in Wasser schnell quellende, teilchenförmige, feste Polymerisate oder Mischpolymerisate, Verfahren zu ihrer Herstellung und ihre Verwendung in Hygieneartikeln |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |