CH616934A5 - Process for the preparation of chromone derivatives - Google Patents
Process for the preparation of chromone derivatives Download PDFInfo
- Publication number
- CH616934A5 CH616934A5 CH1731074A CH1731074A CH616934A5 CH 616934 A5 CH616934 A5 CH 616934A5 CH 1731074 A CH1731074 A CH 1731074A CH 1731074 A CH1731074 A CH 1731074A CH 616934 A5 CH616934 A5 CH 616934A5
- Authority
- CH
- Switzerland
- Prior art keywords
- carboxylic acid
- radical
- group
- hydrogen
- chromon
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 46
- 238000002360 preparation method Methods 0.000 title claims description 16
- 230000008569 process Effects 0.000 title claims description 12
- 150000004777 chromones Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 92
- -1 N-pyrrolidinyl Chemical group 0.000 claims description 84
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 34
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 32
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 27
- 229910052757 nitrogen Inorganic materials 0.000 claims description 23
- 125000004432 carbon atom Chemical group C* 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 14
- 150000002148 esters Chemical class 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 159000000000 sodium salts Chemical class 0.000 claims description 10
- 238000011282 treatment Methods 0.000 claims description 9
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 7
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 150000001350 alkyl halides Chemical class 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 150000001204 N-oxides Chemical class 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 150000003222 pyridines Chemical class 0.000 claims description 4
- 239000003377 acid catalyst Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- DZCBKUAAGVVLOX-UHFFFAOYSA-N 1-morpholin-4-ylethanol Chemical compound CC(O)N1CCOCC1 DZCBKUAAGVVLOX-UHFFFAOYSA-N 0.000 claims description 2
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 239000002841 Lewis acid Substances 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 claims description 2
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical group C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 claims description 2
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical group C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 claims description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 2
- 150000007517 lewis acids Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 238000007363 ring formation reaction Methods 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 claims description 2
- 150000002440 hydroxy compounds Chemical class 0.000 claims 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 85
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 49
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 33
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 27
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 238000010992 reflux Methods 0.000 description 23
- 229920002554 vinyl polymer Polymers 0.000 description 23
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 22
- 238000001816 cooling Methods 0.000 description 21
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 17
- 239000002244 precipitate Substances 0.000 description 15
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 14
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 13
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 150000003254 radicals Chemical class 0.000 description 12
- 150000002431 hydrogen Chemical group 0.000 description 11
- 238000007865 diluting Methods 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 9
- YLQMFQKRHQCFBI-UHFFFAOYSA-N 4-oxo-2-(2-propan-2-yloxyphenyl)chromene-6-carboxylic acid Chemical compound CC(C)OC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 YLQMFQKRHQCFBI-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 235000019253 formic acid Nutrition 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- OTAFHZMPRISVEM-UHFFFAOYSA-N chromone Chemical compound C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 8
- 239000013543 active substance Substances 0.000 description 7
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 7
- FPYAQSSSRQZXMS-UHFFFAOYSA-N methyl 3-acetyl-4-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(O)C(C(C)=O)=C1 FPYAQSSSRQZXMS-UHFFFAOYSA-N 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 125000001331 3-methylbutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 5
- ABOMOLAFCBXXGB-UHFFFAOYSA-N 2-[2-(2-hydroxypropoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CC(O)COC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 ABOMOLAFCBXXGB-UHFFFAOYSA-N 0.000 description 5
- LUBUQDZAKIYUNX-UHFFFAOYSA-N 2-[2-(2-methylpropoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CC(C)COC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 LUBUQDZAKIYUNX-UHFFFAOYSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 230000003266 anti-allergic effect Effects 0.000 description 5
- 238000010790 dilution Methods 0.000 description 5
- 239000012895 dilution Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 239000000825 pharmaceutical preparation Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- YLDKKSCUVZPZEY-UHFFFAOYSA-N 2-(2-butan-2-yloxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound CCC(C)OC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 YLDKKSCUVZPZEY-UHFFFAOYSA-N 0.000 description 4
- ZWQMQNRKCRVLHW-UHFFFAOYSA-N 4-oxo-2-phenylchromene-6-carboxylic acid Chemical compound C=1C(=O)C2=CC(C(=O)O)=CC=C2OC=1C1=CC=CC=C1 ZWQMQNRKCRVLHW-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- SLONTNWWEGEUDU-UHFFFAOYSA-N 2-[2-(2-hydroxy-2-methylbutoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CCC(C)(O)COC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 SLONTNWWEGEUDU-UHFFFAOYSA-N 0.000 description 3
- MUXIVVKGFQMCHP-UHFFFAOYSA-N 2-[2-(2-hydroxy-2-methylpropoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CC(C)(O)COC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 MUXIVVKGFQMCHP-UHFFFAOYSA-N 0.000 description 3
- OKQOGQFCHRQDKW-UHFFFAOYSA-N 2-[2-(2-hydroxy-3-methylbutoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CC(C)C(O)COC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 OKQOGQFCHRQDKW-UHFFFAOYSA-N 0.000 description 3
- BHMHAZWBOPIELQ-UHFFFAOYSA-N 2-[2-(3-hydroxypropoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound OCCCOC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 BHMHAZWBOPIELQ-UHFFFAOYSA-N 0.000 description 3
- JPQLYHXMTDKJDF-UHFFFAOYSA-N 4-oxo-2-(2-propan-2-yloxyphenyl)chromene-6-carbonyl chloride Chemical compound CC(C)OC1=CC=CC=C1C1=CC(=O)C2=CC(C(Cl)=O)=CC=C2O1 JPQLYHXMTDKJDF-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- LEQKWPMUVFBBAL-UHFFFAOYSA-N methyl 4-acetyl-3-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(C(C)=O)C(O)=C1 LEQKWPMUVFBBAL-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000003380 propellant Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- MMYKTRPLXXWLBC-UHFFFAOYSA-N 1-bromo-2-ethoxyethane Chemical compound CCOCCBr MMYKTRPLXXWLBC-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- FNOGVKQMXXVLIH-UHFFFAOYSA-N 2-(2-butoxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound CCCCOC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 FNOGVKQMXXVLIH-UHFFFAOYSA-N 0.000 description 2
- FPZWZCWUIYYYBU-UHFFFAOYSA-N 2-(2-ethoxyethoxy)ethyl acetate Chemical group CCOCCOCCOC(C)=O FPZWZCWUIYYYBU-UHFFFAOYSA-N 0.000 description 2
- VJTLVZSINHPNBX-UHFFFAOYSA-N 2-(2-ethoxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound CCOC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 VJTLVZSINHPNBX-UHFFFAOYSA-N 0.000 description 2
- KOVWYFNCPUAGTI-UHFFFAOYSA-N 2-(2-methoxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound COC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 KOVWYFNCPUAGTI-UHFFFAOYSA-N 0.000 description 2
- WWZSEFGEROSCNG-UHFFFAOYSA-N 2-(3-fluorophenyl)-4-oxochromene-6-carboxylic acid Chemical compound C(=O)(O)C=1C=C2C(C=C(OC2=CC=1)C1=CC(=CC=C1)F)=O WWZSEFGEROSCNG-UHFFFAOYSA-N 0.000 description 2
- GKWXNIZHVQLKQY-UHFFFAOYSA-N 2-[2-(2-ethoxyethoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CCOCCOC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 GKWXNIZHVQLKQY-UHFFFAOYSA-N 0.000 description 2
- QFWHGFWLTJVPHG-UHFFFAOYSA-N 2-[2-(dimethylamino)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CN(C)C1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 QFWHGFWLTJVPHG-UHFFFAOYSA-N 0.000 description 2
- QKVNNCNPDOJZJZ-UHFFFAOYSA-N 2-[4-(2-ethoxyethoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound C1=CC(OCCOCC)=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 QKVNNCNPDOJZJZ-UHFFFAOYSA-N 0.000 description 2
- GUKBJOXDNWXHPC-UHFFFAOYSA-N 2-[4-(2-hydroxyethoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound C1=CC(OCCO)=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 GUKBJOXDNWXHPC-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- FPBXWXGOFQSROI-UHFFFAOYSA-N 3-acetyl-4-hydroxybenzoic acid Chemical compound CC(=O)C1=CC(C(O)=O)=CC=C1O FPBXWXGOFQSROI-UHFFFAOYSA-N 0.000 description 2
- 125000001137 3-hydroxypropoxy group Chemical group [H]OC([H])([H])C([H])([H])C([H])([H])O* 0.000 description 2
- MYMPPTLOVDOFKL-UHFFFAOYSA-N 4-oxo-2-(2-phenylmethoxyphenyl)chromene-6-carboxylic acid Chemical compound C(=O)(O)C=1C=C2C(C=C(OC2=CC=1)C1=C(C=CC=C1)OCC1=CC=CC=C1)=O MYMPPTLOVDOFKL-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 206010042220 Stress ulcer Diseases 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 208000000718 duodenal ulcer Diseases 0.000 description 2
- ZGEGDOHAFHDXAU-UHFFFAOYSA-N ethyl 3-acetyl-4-hydroxybenzoate Chemical compound CCOC(=O)C1=CC=C(O)C(C(C)=O)=C1 ZGEGDOHAFHDXAU-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229940071870 hydroiodic acid Drugs 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- NTSMIVYANJBXBU-UHFFFAOYSA-N methyl 2-(2-hydroxyphenyl)-4-oxochromene-6-carboxylate Chemical compound C=1C(=O)C2=CC(C(=O)OC)=CC=C2OC=1C1=CC=CC=C1O NTSMIVYANJBXBU-UHFFFAOYSA-N 0.000 description 2
- RDAALIJZJHPRRP-UHFFFAOYSA-N methyl 2-propan-2-yloxybenzoate Chemical compound COC(=O)C1=CC=CC=C1OC(C)C RDAALIJZJHPRRP-UHFFFAOYSA-N 0.000 description 2
- YNBADRVTZLEFNH-UHFFFAOYSA-N methyl nicotinate Chemical compound COC(=O)C1=CC=CN=C1 YNBADRVTZLEFNH-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- FTWJPSKBCIVZJO-UHFFFAOYSA-N (2-acetyl-4-methoxycarbonylphenyl) 5-methyl-2-propan-2-yloxybenzoate Chemical compound CC(=O)C1=CC(C(=O)OC)=CC=C1OC(=O)C1=CC(C)=CC=C1OC(C)C FTWJPSKBCIVZJO-UHFFFAOYSA-N 0.000 description 1
- DZKRDHLYQRTDBU-UPHRSURJSA-N (z)-but-2-enediperoxoic acid Chemical compound OOC(=O)\C=C/C(=O)OO DZKRDHLYQRTDBU-UPHRSURJSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 description 1
- MVXXQYNUNXJABR-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 3-acetyl-4-hydroxybenzoate Chemical compound C(C)(=O)C=1C=C(C(=O)OCOC(C(C)(C)C)=O)C=CC=1O MVXXQYNUNXJABR-UHFFFAOYSA-N 0.000 description 1
- APFDQNNTSSPHGQ-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 4-oxo-2-pyrazin-2-ylchromene-6-carboxylate Chemical compound C(C(C)(C)C)(=O)OCOC(=O)C=1C=C2C(C=C(OC2=CC=1)C1=NC=CN=C1)=O APFDQNNTSSPHGQ-UHFFFAOYSA-N 0.000 description 1
- DRHABPMHZRIRAH-UHFFFAOYSA-N 2,4,4,6,6-pentamethylhept-2-ene Chemical compound CC(C)=CC(C)(C)CC(C)(C)C DRHABPMHZRIRAH-UHFFFAOYSA-N 0.000 description 1
- HAMWAIICFOPULY-UHFFFAOYSA-N 2-(2,6-dimethoxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound COC1=CC=CC(OC)=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 HAMWAIICFOPULY-UHFFFAOYSA-N 0.000 description 1
- MALPGDSEBULKPW-UHFFFAOYSA-N 2-(2-aminophenyl)-4-oxochromene-6-carboxylic acid Chemical compound NC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 MALPGDSEBULKPW-UHFFFAOYSA-N 0.000 description 1
- CCCXWWHGGRBMBF-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)-4-oxochromene-6-carboxylic acid Chemical compound COC1=CC=C(C)C=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 CCCXWWHGGRBMBF-UHFFFAOYSA-N 0.000 description 1
- DUFHTTLAAGQEKR-UHFFFAOYSA-N 2-(2-nitrophenyl)-4-oxochromene-6-carboxylic acid Chemical compound C=1C(=O)C2=CC(C(=O)O)=CC=C2OC=1C1=CC=CC=C1[N+]([O-])=O DUFHTTLAAGQEKR-UHFFFAOYSA-N 0.000 description 1
- NOOOBMKCHNUIGM-UHFFFAOYSA-N 2-(2-propan-2-yloxyphenyl)-6-(2h-tetrazol-5-yl)chromen-4-one Chemical compound CC(C)OC1=CC=CC=C1C1=CC(=O)C2=CC(C=3NN=NN=3)=CC=C2O1 NOOOBMKCHNUIGM-UHFFFAOYSA-N 0.000 description 1
- ZHOGIERKNLHQAU-UHFFFAOYSA-N 2-(3-methoxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound COC1=CC=CC(C=2OC3=CC=C(C=C3C(=O)C=2)C(O)=O)=C1 ZHOGIERKNLHQAU-UHFFFAOYSA-N 0.000 description 1
- HLBUIVARRPNNSN-UHFFFAOYSA-N 2-(3-methyl-2-propan-2-yloxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound CC(C)OC1=C(C)C=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 HLBUIVARRPNNSN-UHFFFAOYSA-N 0.000 description 1
- XZJLRTHIVFYYMZ-UHFFFAOYSA-N 2-(4-fluorophenyl)-4-oxochromene-6-carboxylic acid Chemical compound C=1C(=O)C2=CC(C(=O)O)=CC=C2OC=1C1=CC=C(F)C=C1 XZJLRTHIVFYYMZ-UHFFFAOYSA-N 0.000 description 1
- CXZTWQVDMUXTTB-UHFFFAOYSA-N 2-(4-methoxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound C1=CC(OC)=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 CXZTWQVDMUXTTB-UHFFFAOYSA-N 0.000 description 1
- LLEQVOQPQJJXRU-UHFFFAOYSA-N 2-(4-methyl-2-propan-2-yloxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound CC(C)OC1=CC(C)=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 LLEQVOQPQJJXRU-UHFFFAOYSA-N 0.000 description 1
- UFLZLPNPZUTXTQ-UHFFFAOYSA-N 2-(5-ethyl-2-propan-2-yloxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound CCC1=CC=C(OC(C)C)C(C=2OC3=CC=C(C=C3C(=O)C=2)C(O)=O)=C1 UFLZLPNPZUTXTQ-UHFFFAOYSA-N 0.000 description 1
- YLTVMVPQDVIYER-UHFFFAOYSA-N 2-(5-methyl-2-propan-2-yloxyphenyl)-4-oxochromene-6-carboxylic acid Chemical compound CC(C)OC1=CC=C(C)C=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 YLTVMVPQDVIYER-UHFFFAOYSA-N 0.000 description 1
- KKFDCBRMNNSAAW-UHFFFAOYSA-N 2-(morpholin-4-yl)ethanol Chemical compound OCCN1CCOCC1 KKFDCBRMNNSAAW-UHFFFAOYSA-N 0.000 description 1
- SVLCHSFCKRQQBJ-UHFFFAOYSA-N 2-[2-(2,3-dihydroxypropoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound OCC(O)COC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 SVLCHSFCKRQQBJ-UHFFFAOYSA-N 0.000 description 1
- XABQUCHHYPGVCS-UHFFFAOYSA-N 2-[2-(2-hydroxyethoxy)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound OCCOC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 XABQUCHHYPGVCS-UHFFFAOYSA-N 0.000 description 1
- UQTNKAVXIKLHPE-UHFFFAOYSA-N 2-[2-(2-hydroxypropoxy)phenyl]-4-oxo-8-propylchromene-6-carboxylic acid Chemical compound CCCC1=CC(C(O)=O)=CC(C(C=2)=O)=C1OC=2C1=CC=CC=C1OCC(C)O UQTNKAVXIKLHPE-UHFFFAOYSA-N 0.000 description 1
- CXYKQZNNKXYHGY-UHFFFAOYSA-N 2-[2-(methylamino)phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CNC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 CXYKQZNNKXYHGY-UHFFFAOYSA-N 0.000 description 1
- IRGNJNXUZAIIQD-UHFFFAOYSA-N 2-[2-[ethyl(methyl)amino]phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CCN(C)C1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 IRGNJNXUZAIIQD-UHFFFAOYSA-N 0.000 description 1
- VLGTXARHJKHTRX-UHFFFAOYSA-N 2-[2-[methyl(propan-2-yl)amino]phenyl]-4-oxochromene-6-carboxylic acid Chemical compound CC(C)N(C)C1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 VLGTXARHJKHTRX-UHFFFAOYSA-N 0.000 description 1
- DAUAQNGYDSHRET-UHFFFAOYSA-N 3,4-dimethoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1OC DAUAQNGYDSHRET-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- KNSPZJBQWIGKBI-UHFFFAOYSA-N 4-hydroxy-3-(3-oxo-3-pyrazin-2-ylpropanoyl)benzoic acid Chemical compound OC1=C(C(=O)CC(=O)C2=NC=CN=C2)C=C(C=C1)C(=O)O KNSPZJBQWIGKBI-UHFFFAOYSA-N 0.000 description 1
- GWYYYAYTJFQAIE-UHFFFAOYSA-N 4-oxo-2-(2-propan-2-yloxy-5-propylphenyl)chromene-6-carboxylic acid Chemical compound CCCC1=CC=C(OC(C)C)C(C=2OC3=CC=C(C=C3C(=O)C=2)C(O)=O)=C1 GWYYYAYTJFQAIE-UHFFFAOYSA-N 0.000 description 1
- JGTGAYHYIMGPEN-UHFFFAOYSA-N 4-oxo-2-(2-propan-2-yloxyphenyl)-8-propylchromene-6-carboxylic acid Chemical compound CCCC1=CC(C(O)=O)=CC(C(C=2)=O)=C1OC=2C1=CC=CC=C1OC(C)C JGTGAYHYIMGPEN-UHFFFAOYSA-N 0.000 description 1
- CACYIXYLZLKFJO-UHFFFAOYSA-N 4-oxo-2-(2-propan-2-yloxyphenyl)chromene-7-carboxylic acid Chemical compound CC(C)OC1=CC=CC=C1C1=CC(=O)C2=CC=C(C(O)=O)C=C2O1 CACYIXYLZLKFJO-UHFFFAOYSA-N 0.000 description 1
- RWBCSOJJSOOSPA-UHFFFAOYSA-N 4-oxo-2-(2-propoxyphenyl)chromene-6-carboxylic acid Chemical compound CCCOC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 RWBCSOJJSOOSPA-UHFFFAOYSA-N 0.000 description 1
- VLTPRNORGYFZAV-UHFFFAOYSA-N 4-oxo-2-(4-propan-2-ylphenyl)chromene-6-carboxylic acid Chemical compound C1=CC(C(C)C)=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 VLTPRNORGYFZAV-UHFFFAOYSA-N 0.000 description 1
- IJRWYPMSOQRREY-UHFFFAOYSA-N 4-oxo-2-[2-(propan-2-ylamino)phenyl]chromene-6-carboxylic acid Chemical compound CC(C)NC1=CC=CC=C1C1=CC(=O)C2=CC(C(O)=O)=CC=C2O1 IJRWYPMSOQRREY-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- UMOLEKILJGKUHA-UHFFFAOYSA-N 5-methyl-2-propan-2-yloxybenzoyl chloride Chemical compound CC(C)OC1=CC=C(C)C=C1C(Cl)=O UMOLEKILJGKUHA-UHFFFAOYSA-N 0.000 description 1
- 125000004938 5-pyridyl group Chemical group N1=CC=CC(=C1)* 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BMICFYWMFBEGHQ-UHFFFAOYSA-N CC(=O)C1=C(C=CC(=C1)C(=O)OC)OC(=O)C=CC2=CC=C(C=C2)OC(=O)C3=CC=CC=C3 Chemical compound CC(=O)C1=C(C=CC(=C1)C(=O)OC)OC(=O)C=CC2=CC=C(C=C2)OC(=O)C3=CC=CC=C3 BMICFYWMFBEGHQ-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 238000005618 Fries rearrangement reaction Methods 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 208000004756 Respiratory Insufficiency Diseases 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 244000274883 Urtica dioica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000004479 aerosol dispenser Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000000026 anti-ulcerogenic effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- BWHOZHOGCMHOBV-UHFFFAOYSA-N benzylideneacetone Chemical class CC(=O)C=CC1=CC=CC=C1 BWHOZHOGCMHOBV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229920002055 compound 48/80 Polymers 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 229960000265 cromoglicic acid Drugs 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical class CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940074928 isopropyl myristate Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- LLWHVIBMCLUXGY-UHFFFAOYSA-N methyl 2-(2-methoxy-5-methylphenyl)-4-oxochromene-6-carboxylate Chemical compound C=1C(=O)C2=CC(C(=O)OC)=CC=C2OC=1C1=CC(C)=CC=C1OC LLWHVIBMCLUXGY-UHFFFAOYSA-N 0.000 description 1
- LNDBOJKIDVIRQA-UHFFFAOYSA-N methyl 2-(4-hydroxyphenyl)-4-oxochromene-6-carboxylate Chemical compound C(=O)(OC)C=1C=C2C(C=C(OC2=CC=1)C1=CC=C(C=C1)O)=O LNDBOJKIDVIRQA-UHFFFAOYSA-N 0.000 description 1
- BRXCFXNWZAGTKZ-UHFFFAOYSA-N methyl 2-(5-methyl-2-propan-2-yloxyphenyl)-4-oxochromene-6-carboxylate Chemical compound C=1C(=O)C2=CC(C(=O)OC)=CC=C2OC=1C1=CC(C)=CC=C1OC(C)C BRXCFXNWZAGTKZ-UHFFFAOYSA-N 0.000 description 1
- KGZYMRFJKMHAKX-UHFFFAOYSA-N methyl 2-[2-(2-benzoyloxypropoxy)phenyl]-4-oxochromene-6-carboxylate Chemical compound C=1C(=O)C2=CC(C(=O)OC)=CC=C2OC=1C1=CC=CC=C1OCC(C)OC(=O)C1=CC=CC=C1 KGZYMRFJKMHAKX-UHFFFAOYSA-N 0.000 description 1
- MTGWPWPIDLQCPQ-UHFFFAOYSA-N methyl 2-[2-(2-ethoxyethoxy)phenyl]-4-oxochromene-6-carboxylate Chemical compound CCOCCOC1=CC=CC=C1C1=CC(=O)C2=CC(C(=O)OC)=CC=C2O1 MTGWPWPIDLQCPQ-UHFFFAOYSA-N 0.000 description 1
- HRIFAUHCKFFZKB-UHFFFAOYSA-N methyl 2-methoxy-5-methylbenzoate Chemical compound COC(=O)C1=CC(C)=CC=C1OC HRIFAUHCKFFZKB-UHFFFAOYSA-N 0.000 description 1
- KADJYMYAIVZJHM-UHFFFAOYSA-N methyl 3-acetyl-4-(3-phenylprop-2-enoyloxy)benzoate Chemical compound CC(=O)C1=CC(C(=O)OC)=CC=C1OC(=O)C=CC1=CC=CC=C1 KADJYMYAIVZJHM-UHFFFAOYSA-N 0.000 description 1
- JDGVFXOHSDRXGK-UHFFFAOYSA-N methyl 3-acetyl-4-hydroxy-5-propylbenzoate Chemical compound CCCC1=CC(C(=O)OC)=CC(C(C)=O)=C1O JDGVFXOHSDRXGK-UHFFFAOYSA-N 0.000 description 1
- LTZXGXWGJXCHDR-UHFFFAOYSA-N methyl 4-hydroxy-3-(3-oxo-3-pyridin-3-ylpropanoyl)benzoate Chemical compound COC(=O)C1=CC=C(O)C(C(=O)CC(=O)C=2C=NC=CC=2)=C1 LTZXGXWGJXCHDR-UHFFFAOYSA-N 0.000 description 1
- IBJSHJADLVBFDA-UHFFFAOYSA-N methyl 4-hydroxy-3-(3-oxo-5-phenylpent-4-enoyl)benzoate Chemical compound COC(=O)C1=CC=C(O)C(C(=O)CC(=O)C=CC=2C=CC=CC=2)=C1 IBJSHJADLVBFDA-UHFFFAOYSA-N 0.000 description 1
- KBPQVFKIEINSJX-UHFFFAOYSA-N methyl 4-hydroxy-3-[3-(2-methoxy-5-methylphenyl)-3-oxopropanoyl]benzoate Chemical compound COC(=O)C1=CC=C(O)C(C(=O)CC(=O)C=2C(=CC=C(C)C=2)OC)=C1 KBPQVFKIEINSJX-UHFFFAOYSA-N 0.000 description 1
- MDIBGPICHUESMF-UHFFFAOYSA-N methyl 4-hydroxy-3-[3-oxo-3-(2-propan-2-yloxyphenyl)propanoyl]benzoate Chemical compound COC(=O)C1=CC=C(O)C(C(=O)CC(=O)C=2C(=CC=CC=2)OC(C)C)=C1 MDIBGPICHUESMF-UHFFFAOYSA-N 0.000 description 1
- BWMZRJNKUBWRFP-UHFFFAOYSA-N methyl 4-oxo-2-(2-propan-2-yloxyphenyl)chromene-6-carboxylate Chemical compound C=1C(=O)C2=CC(C(=O)OC)=CC=C2OC=1C1=CC=CC=C1OC(C)C BWMZRJNKUBWRFP-UHFFFAOYSA-N 0.000 description 1
- ZLOCBCDZSURPDU-UHFFFAOYSA-N methyl 4-oxo-2-(2-propan-2-yloxyphenyl)chromene-7-carboxylate Chemical compound C=1C(C(=O)OC)=CC=C(C(C=2)=O)C=1OC=2C1=CC=CC=C1OC(C)C ZLOCBCDZSURPDU-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960001238 methylnicotinate Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229940068965 polysorbates Drugs 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 201000004193 respiratory failure Diseases 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 229940071117 starch glycolate Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/26—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3
- C07D311/28—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only
- C07D311/30—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only not hydrogenated in the hetero ring, e.g. flavones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrane Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT3208973 | 1973-12-27 | ||
| IT2477774A IT1045480B (it) | 1974-07-04 | 1974-07-04 | Acidi 2 vinil cromon carbossilici sostituiti |
| IT2524474 | 1974-07-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH616934A5 true CH616934A5 (en) | 1980-04-30 |
Family
ID=27273401
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1731074A CH616934A5 (en) | 1973-12-27 | 1974-12-24 | Process for the preparation of chromone derivatives |
| CH388578A CH616935A5 (en) | 1973-12-27 | 1978-03-13 | Process for the preparation of chromone derivatives |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH388578A CH616935A5 (en) | 1973-12-27 | 1978-03-13 | Process for the preparation of chromone derivatives |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5634595B2 (enExample) |
| AT (1) | AT345830B (enExample) |
| CA (1) | CA1061353A (enExample) |
| CH (2) | CH616934A5 (enExample) |
| CS (1) | CS202543B2 (enExample) |
| DE (1) | DE2461670A1 (enExample) |
| DK (1) | DK680474A (enExample) |
| FI (1) | FI67080C (enExample) |
| FR (1) | FR2255894B1 (enExample) |
| GB (1) | GB1479518A (enExample) |
| HU (1) | HU171874B (enExample) |
| IL (1) | IL46423A (enExample) |
| NL (1) | NL7416873A (enExample) |
| NO (1) | NO144110C (enExample) |
| SE (1) | SE417427B (enExample) |
| SU (1) | SU611590A3 (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4160028A (en) * | 1977-08-02 | 1979-07-03 | Carlo Erba S.P.A. | Substituted 2-cyclopropyl-chromones and pharmaceutical compositions and use thereof |
| IT1134205B (it) * | 1980-11-11 | 1986-08-13 | Bonomelli Spa | Processo per la produzione di derivati flavonici ad attivita' medicinale |
| FR2516922A1 (fr) * | 1981-11-25 | 1983-05-27 | Lipha | Acides (oxo-4-4h-(1)-benzopyran-8-yl) alcanoiques, sels et derives, preparation et medicament les contenant |
| US4525356A (en) * | 1982-11-02 | 1985-06-25 | Hokuriku Pharmaceutical Co., Ltd. | N-substituted flavone-8-carboxamides |
| IL108841A0 (en) * | 1993-03-10 | 1994-06-24 | Pfizer Res & Dev | Benzopyrans |
| JP3957795B2 (ja) * | 1996-10-04 | 2007-08-15 | 興和株式会社 | フラボン誘導体及びこれを含有する医薬 |
| IN2014MN02331A (enExample) * | 2012-04-27 | 2015-08-14 | Basf Se | |
| WO2014184073A1 (en) * | 2013-05-15 | 2014-11-20 | Basf Se | Substituted n-(tetrazol-5-yl)- and n-(triazol-5-yl)arylcarboxamide compounds and their use as herbicides |
-
1974
- 1974-12-17 GB GB54453/74A patent/GB1479518A/en not_active Expired
- 1974-12-23 SE SE7416231A patent/SE417427B/xx unknown
- 1974-12-23 DK DK680474A patent/DK680474A/da not_active Application Discontinuation
- 1974-12-23 HU HU74EA00000142A patent/HU171874B/hu unknown
- 1974-12-24 CH CH1731074A patent/CH616934A5/de not_active IP Right Cessation
- 1974-12-24 NL NL7416873A patent/NL7416873A/xx not_active Application Discontinuation
- 1974-12-27 CA CA216,961A patent/CA1061353A/en not_active Expired
- 1974-12-27 AT AT1034174A patent/AT345830B/de not_active IP Right Cessation
- 1974-12-27 JP JP753008A patent/JPS5634595B2/ja not_active Expired
- 1974-12-27 FR FR7443125A patent/FR2255894B1/fr not_active Expired
- 1974-12-27 SU SU742098258A patent/SU611590A3/ru active
- 1974-12-27 FI FI3742/74A patent/FI67080C/fi active
- 1974-12-27 NO NO744714A patent/NO144110C/no unknown
- 1974-12-27 CS CS749033A patent/CS202543B2/cs unknown
- 1974-12-27 DE DE19742461670 patent/DE2461670A1/de not_active Withdrawn
-
1975
- 1975-01-10 IL IL46423A patent/IL46423A/xx unknown
-
1978
- 1978-03-13 CH CH388578A patent/CH616935A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI67080B (fi) | 1984-09-28 |
| IL46423A (en) | 1979-03-12 |
| SE7416231L (enExample) | 1975-06-30 |
| FI67080C (fi) | 1985-01-10 |
| NO744714L (enExample) | 1975-07-21 |
| DE2461670A1 (de) | 1975-07-10 |
| IL46423A0 (en) | 1975-05-22 |
| SE417427B (sv) | 1981-03-16 |
| AT345830B (de) | 1978-10-10 |
| NL7416873A (nl) | 1975-07-01 |
| SU611590A3 (ru) | 1978-06-15 |
| ATA1034174A (de) | 1978-02-15 |
| CH616935A5 (en) | 1980-04-30 |
| NO144110B (no) | 1981-03-16 |
| NO144110C (no) | 1981-06-24 |
| CA1061353A (en) | 1979-08-28 |
| DK680474A (enExample) | 1975-08-25 |
| FR2255894A1 (enExample) | 1975-07-25 |
| GB1479518A (en) | 1977-07-13 |
| JPS5634595B2 (enExample) | 1981-08-11 |
| CS202543B2 (en) | 1981-01-30 |
| JPS50129568A (enExample) | 1975-10-13 |
| FI374274A7 (enExample) | 1975-06-28 |
| HU171874B (hu) | 1978-04-28 |
| FR2255894B1 (enExample) | 1978-07-21 |
| AU7687874A (en) | 1976-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2614406C2 (enExample) | ||
| DE60302336T2 (de) | Neue pyridin- und quinolin-derivate | |
| CH650782A5 (de) | Carbostyrilverbindungen, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. | |
| JPS6391391A (ja) | 2−または3−アリール置換イミダゾ[1,2−a]ビリジン | |
| DE69713255T2 (de) | Pharmazeutische Pyridin-Derivate, ihre Herstellungsverfahren und Zwischenprodukte dafür | |
| EP0127763B1 (de) | Tricyclische Ether, Verfahren zu ihrer Herstellung, ihre Anwendung und sie enthaltende Arzneimittel | |
| EP0340718A1 (de) | Chromanderivate | |
| CH655110A5 (de) | Carbostyrilderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. | |
| DE2557342A1 (de) | Basisch substituierte indolderivate und verfahren zu ihrer herstellung | |
| DE2654215A1 (de) | 3,4-dihydrochinazolinderivate, verfahren zu ihrer herstellung und sie enthaltendes pharmazeutisches mittel | |
| EP0410208B1 (de) | Chromanderivate | |
| EP0406656B1 (de) | Chromanderivate | |
| DE3918041A1 (de) | Chromanderivate | |
| EP0368160A1 (de) | Tetralinderivate | |
| DE3835011A1 (de) | Chromanderivate | |
| DE1770163A1 (de) | Neue Glyzerinester,Verfahren zu ihrer Herstellung und diese Ester enthaltende pharmazeutische Zusammensetzungen | |
| DD280965A5 (de) | Verfahren zur herstellung von antiarrhythmisch wirkenden mitteln | |
| DE68924308T2 (de) | Pyridazinon-Derivate. | |
| CH616935A5 (en) | Process for the preparation of chromone derivatives | |
| EP0489327A1 (de) | Chromanderivate | |
| CH647777A5 (de) | Substituierte pyrido-(1,2-a)-pyrimidine. | |
| DE2737407A1 (de) | Verfahren zur herstellung neuer benzopyranderivate | |
| DE3014813A1 (de) | 2-hydroxy-5-(1-hydroxy-2-piperazinylethyl)benzoesaeure-derivate | |
| DD151751A5 (de) | Verfahren zur herstellung von schwefelhaltigen isochinolinderivaten | |
| DE2832358C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |