CH533108A - Verfahren zur Herstellung substituierter Azabicycloalkane - Google Patents
Verfahren zur Herstellung substituierter AzabicycloalkaneInfo
- Publication number
- CH533108A CH533108A CH1519072A CH1519072A CH533108A CH 533108 A CH533108 A CH 533108A CH 1519072 A CH1519072 A CH 1519072A CH 1519072 A CH1519072 A CH 1519072A CH 533108 A CH533108 A CH 533108A
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- decahydroquinoline
- carbonyl
- azabicycloalkanes
- compound
- Prior art date
Links
- 230000008635 plant growth Effects 0.000 title claims description 3
- 230000002363 herbicidal effect Effects 0.000 title description 3
- 230000001105 regulatory effect Effects 0.000 title 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 3
- 239000004009 herbicide Substances 0.000 claims abstract description 3
- -1 alkali metal salt Chemical class 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 239000002253 acid Substances 0.000 abstract description 7
- 239000011230 binding agent Substances 0.000 abstract description 6
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 239000005648 plant growth regulator Substances 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000000203 mixture Substances 0.000 description 8
- JJWKPURADFRFRB-UHFFFAOYSA-N carbonyl sulfide Chemical compound O=C=S JJWKPURADFRFRB-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 241000209094 Oryza Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- POTIYWUALSJREP-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline Chemical class N1CCCC2CCCCC21 POTIYWUALSJREP-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 241001148683 Zostera marina Species 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- POTIYWUALSJREP-DTWKUNHWSA-N (4as,8ar)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline Chemical compound N1CCC[C@@H]2CCCC[C@H]21 POTIYWUALSJREP-DTWKUNHWSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- POTIYWUALSJREP-RKDXNWHRSA-N (4ar,8ar)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline Chemical compound N1CCC[C@H]2CCCC[C@H]21 POTIYWUALSJREP-RKDXNWHRSA-N 0.000 description 1
- IWVVNECNSFETIY-WDEREUQCSA-N 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-chloropropane-1-thione Chemical compound ClCCC(=S)N1CCC[C@@H]2CCCC[C@@H]12 IWVVNECNSFETIY-WDEREUQCSA-N 0.000 description 1
- IWVVNECNSFETIY-QWRGUYRKSA-N 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-chloropropane-1-thione Chemical compound ClCCC(=S)N1CCC[C@@H]2CCCC[C@H]12 IWVVNECNSFETIY-QWRGUYRKSA-N 0.000 description 1
- GRSVWKDBAXRCPN-STQMWFEESA-N 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]pent-3-ene-1-thione Chemical compound C(C=CC)C(=S)N1CCC[C@@H]2CCCC[C@H]12 GRSVWKDBAXRCPN-STQMWFEESA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- OJNBQKPUNCKBHL-UHFFFAOYSA-N 3-chloro-1-(8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)propane-1-thione Chemical compound ClCCC(=S)N1CCCC2CCCC(C12)C OJNBQKPUNCKBHL-UHFFFAOYSA-N 0.000 description 1
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 230000005078 fruit development Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/08—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms with acylated ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1519072A CH533108A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung substituierter Azabicycloalkane |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1519072A CH533108A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung substituierter Azabicycloalkane |
| CH55371A CH535011A (de) | 1971-01-14 | 1971-01-14 | Selektive herbizide Mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH533108A true CH533108A (de) | 1973-01-31 |
Family
ID=4189652
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1519072A CH533108A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung substituierter Azabicycloalkane |
| CH603672A CH533107A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung substituierter Azabicycloalkane |
| CH1519172A CH533109A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung von substituierten Azabicycloalkanen |
| CH55371A CH535011A (de) | 1971-01-14 | 1971-01-14 | Selektive herbizide Mittel |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH603672A CH533107A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung substituierter Azabicycloalkane |
| CH1519172A CH533109A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung von substituierten Azabicycloalkanen |
| CH55371A CH535011A (de) | 1971-01-14 | 1971-01-14 | Selektive herbizide Mittel |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3776912A (Direct) |
| AT (1) | AT315567B (Direct) |
| BE (1) | BE777997A (Direct) |
| CA (1) | CA994781A (Direct) |
| CH (4) | CH533108A (Direct) |
| CS (1) | CS176181B2 (Direct) |
| DD (1) | DD100859A5 (Direct) |
| DE (1) | DE2201584A1 (Direct) |
| EG (1) | EG11289A (Direct) |
| ES (1) | ES398822A1 (Direct) |
| FR (1) | FR2121834B1 (Direct) |
| GB (1) | GB1345672A (Direct) |
| HU (1) | HU163471B (Direct) |
| IL (1) | IL38497A (Direct) |
| IT (1) | IT946560B (Direct) |
| NL (1) | NL7200533A (Direct) |
| OA (1) | OA04064A (Direct) |
| PH (1) | PH9356A (Direct) |
| RO (1) | RO61543A (Direct) |
| SU (1) | SU555828A3 (Direct) |
| ZA (1) | ZA72227B (Direct) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4002461A (en) * | 1969-07-16 | 1977-01-11 | Ciba-Geigy Corporation | Substituted 2-azabicycloalkanes as selective herbicides |
| CH535537A (de) * | 1971-01-14 | 1973-04-15 | Ciba Geigy Ag | Pflanzenbeeinflussendes und fungizides Mittel |
| US4292237A (en) * | 1977-11-14 | 1981-09-29 | The B. F. Goodrich Company | Polymeric ultraviolet light stabilizers containing hindered alkyl amines |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3344134A (en) * | 1964-04-29 | 1967-09-26 | Monsanto Co | Azabicyclononanecarbothiolates |
| CH510380A (de) * | 1969-04-29 | 1971-07-31 | Ciba Geigy Ag | Verwendung von Dithiocarbamaten zur Beeinflussung der Pflanzenentwicklung |
| FI49164C (fi) * | 1969-07-16 | 1975-04-10 | Agripat Sa | Herbisideissä käytettäviä substituoituja 2-atsabisykloalkaaneja. |
-
1971
- 1971-01-11 OA OA54460A patent/OA04064A/xx unknown
- 1971-01-14 CH CH1519072A patent/CH533108A/de not_active IP Right Cessation
- 1971-01-14 CH CH603672A patent/CH533107A/de not_active IP Right Cessation
- 1971-01-14 CH CH1519172A patent/CH533109A/de not_active IP Right Cessation
- 1971-01-14 CH CH55371A patent/CH535011A/de not_active IP Right Cessation
- 1971-12-30 DD DD160048A patent/DD100859A5/xx unknown
-
1972
- 1972-01-03 IL IL38497A patent/IL38497A/xx unknown
- 1972-01-05 CA CA131,708A patent/CA994781A/en not_active Expired
- 1972-01-10 US US00216778A patent/US3776912A/en not_active Expired - Lifetime
- 1972-01-12 EG EG17/72A patent/EG11289A/xx active
- 1972-01-13 AT AT26572A patent/AT315567B/de not_active IP Right Cessation
- 1972-01-13 NL NL7200533A patent/NL7200533A/xx unknown
- 1972-01-13 GB GB170372A patent/GB1345672A/en not_active Expired
- 1972-01-13 PH PH13194*UA patent/PH9356A/en unknown
- 1972-01-13 DE DE19722201584 patent/DE2201584A1/de active Pending
- 1972-01-13 RO RO7200069385A patent/RO61543A/ro unknown
- 1972-01-13 BE BE777997A patent/BE777997A/xx unknown
- 1972-01-13 ZA ZA720227A patent/ZA72227B/xx unknown
- 1972-01-13 IT IT19346/72A patent/IT946560B/it active
- 1972-01-13 FR FR7201134A patent/FR2121834B1/fr not_active Expired
- 1972-01-13 CS CS227A patent/CS176181B2/cs unknown
- 1972-01-13 ES ES398822A patent/ES398822A1/es not_active Expired
- 1972-01-13 HU HUAI205A patent/HU163471B/hu unknown
- 1972-01-14 SU SU1737351A patent/SU555828A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| CH533107A (de) | 1973-01-31 |
| DD100859A5 (Direct) | 1973-10-12 |
| DE2201584A1 (de) | 1972-07-27 |
| AT315567B (de) | 1974-05-27 |
| FR2121834A1 (Direct) | 1972-08-25 |
| FR2121834B1 (Direct) | 1978-03-03 |
| EG11289A (en) | 1977-01-31 |
| BE777997A (fr) | 1972-07-13 |
| OA04064A (fr) | 1979-10-30 |
| ZA72227B (en) | 1972-09-27 |
| NL7200533A (Direct) | 1972-07-18 |
| ES398822A1 (es) | 1975-06-16 |
| PH9356A (en) | 1975-10-06 |
| IL38497A0 (en) | 1972-03-28 |
| SU555828A3 (ru) | 1977-04-25 |
| RO61543A (Direct) | 1977-04-15 |
| GB1345672A (en) | 1974-01-30 |
| HU163471B (Direct) | 1973-09-27 |
| CA994781A (en) | 1976-08-10 |
| IT946560B (it) | 1973-05-21 |
| CH535011A (de) | 1973-03-31 |
| CH533109A (de) | 1973-01-31 |
| IL38497A (en) | 1975-02-10 |
| CS176181B2 (Direct) | 1977-06-30 |
| US3776912A (en) | 1973-12-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2406475A1 (de) | 2,4-dimethyltrifluormethansulfonanilide | |
| DE2129109A1 (de) | Phenylpyridazine, ihre herstellung und verwendung als herbizide | |
| DE2815340C2 (Direct) | ||
| CH533108A (de) | Verfahren zur Herstellung substituierter Azabicycloalkane | |
| DE2145456A1 (de) | 2-imidazolylcarbonyl-benzoesaeuren, deren ester und salze, verfahren zu ihrer herstellung und ihre verwendung als pflanzenwachstumsregulatoren | |
| DE2545569C3 (de) | 13-Dithiacyclopenten-2-ylidenmalonsäuredialkylester, Verfahren zu deren Herstellung und diese enthaltende fungizide Mittel | |
| DE2156447A1 (de) | Neue Amidothionophosphonsäureester, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2137538C3 (de) | oxyamin und seine Salze sowie ein Verfahren zu seiner Herstellung und dieses enthaltende Arzneimittel | |
| DE1542760B2 (de) | Schaedlingsbekaepfungsmittel | |
| EP0080106B1 (de) | Verfahren zur Herstellung von N-substituierten N-Isocyanatocarbonyl-carbamaten | |
| DE1953422A1 (de) | Fungicide Zubereitung fuer Landwirtschaft und Gartenbau | |
| CH533106A (de) | Verfahren zur Herstellung von substituierten Azabicycloalkanen | |
| EP0066771B1 (de) | 1-Iod-1-propin-3-ole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Pflanzenschutzmittel | |
| DE2035145B2 (de) | Decahydrochinoline und octahydroindole | |
| DE1913839A1 (de) | O-Chlor- bzw. O-Bromalkyl-S-benzyl-S'-alkyl-dithiolphosphorsaeureester sowie Verfahren zu ihrer Herstellung | |
| DD151447A1 (de) | Verfahren zur herstellung von amidinen und deren salzen | |
| EP0035768A2 (de) | Oximester, Verfahren und Mittel zu deren Herstellung, ihre Verwendung, sowie diese Oximester enthaltende Mittel | |
| DE2320371A1 (de) | Thiophosphonsaeureester | |
| DE2204738C3 (de) | Substituierte Octahydropyrindene, Verfahren zu deren Herstellung und deren Verwendung | |
| CH513170A (de) | Verfahren zur Herstellung von substituierten Decahydrochinolinen | |
| EP0138183A2 (de) | Diaryläther und deren Verwendung als Unkrautbekämpfungsmittel | |
| DE2529648A1 (de) | Carbamidsaeureester der gallussaeure, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| CH550170A (de) | Verfahren zur herstellung von substituierten 2-abzabicycloalkanen. | |
| EP0113030A1 (de) | Cycloalkenylderivate, ihre Herstellung und Verwendung | |
| DE1925423C (de) | 2,2-Dimethyl-omega-aryloxy alkansäuren und deren Derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |