CH502413A - Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen - Google Patents
Verfahren zur Herstellung von wasserlöslichen AzofarbstoffenInfo
- Publication number
- CH502413A CH502413A CH312767A CH312767A CH502413A CH 502413 A CH502413 A CH 502413A CH 312767 A CH312767 A CH 312767A CH 312767 A CH312767 A CH 312767A CH 502413 A CH502413 A CH 502413A
- Authority
- CH
- Switzerland
- Prior art keywords
- alkyl
- formula
- compound
- water
- hydroxyalkyl
- Prior art date
Links
- 150000003242 quaternary ammonium salts Chemical class 0.000 title description 3
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- 125000004966 cyanoalkyl group Chemical group 0.000 claims abstract description 6
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 3
- 150000002367 halogens Chemical class 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000000987 azo dye Substances 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 4
- 239000006172 buffering agent Substances 0.000 claims description 3
- 150000004982 aromatic amines Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 239000000395 magnesium oxide Substances 0.000 claims description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 238000005956 quaternization reaction Methods 0.000 claims 1
- 239000000975 dye Substances 0.000 abstract description 12
- 229920002239 polyacrylonitrile Polymers 0.000 abstract description 7
- 230000008878 coupling Effects 0.000 abstract description 6
- 238000010168 coupling process Methods 0.000 abstract description 6
- 238000005859 coupling reaction Methods 0.000 abstract description 6
- 238000000859 sublimation Methods 0.000 abstract description 5
- 230000008022 sublimation Effects 0.000 abstract description 5
- 238000004043 dyeing Methods 0.000 abstract description 4
- 150000001412 amines Chemical class 0.000 abstract 2
- 229910006069 SO3H Inorganic materials 0.000 abstract 1
- 229940100198 alkylating agent Drugs 0.000 abstract 1
- 239000002168 alkylating agent Substances 0.000 abstract 1
- 239000003086 colorant Substances 0.000 abstract 1
- 239000012458 free base Substances 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 11
- 239000000835 fiber Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 150000008049 diazo compounds Chemical class 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 2
- 230000001035 methylating effect Effects 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- JHRMJWGBGBDNJE-UHFFFAOYSA-N 1,3-benzothiazole-2,4-diamine Chemical compound C1=CC=C2SC(N)=NC2=C1N JHRMJWGBGBDNJE-UHFFFAOYSA-N 0.000 description 1
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical group C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical group C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- LHRIICYSGQGXSX-UHFFFAOYSA-N 2-chloro-4,6-dinitroaniline Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1[N+]([O-])=O LHRIICYSGQGXSX-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- CZXGXYBOQYQXQD-UHFFFAOYSA-N methyl benzenesulfonate Chemical compound COS(=O)(=O)C1=CC=CC=C1 CZXGXYBOQYQXQD-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- -1 phenylsulfonyl anion Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/02—Azo dyes containing onium groups containing ammonium groups not directly attached to an azo group
- C09B44/04—Azo dyes containing onium groups containing ammonium groups not directly attached to an azo group from coupling components containing amino as the only directing group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL113296A PL56821B1 (oth) | 1966-03-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH502413A true CH502413A (de) | 1971-01-31 |
Family
ID=19949434
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH312767A CH502413A (de) | 1966-03-03 | 1967-03-03 | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE694938A (oth) |
| CH (1) | CH502413A (oth) |
| DE (1) | DE1644279A1 (oth) |
| GB (1) | GB1133683A (oth) |
| NL (1) | NL6703423A (oth) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4072672A (en) * | 1972-07-31 | 1978-02-07 | Sandoz Ltd. | Cationic dyes containing an aryloxy group linked through a bridging radical to a quaternized nitrogen atom |
| DD113239A5 (oth) * | 1973-02-26 | 1975-05-20 | ||
| EP0514336B1 (de) * | 1991-05-17 | 1996-12-11 | Ciba-Geigy Ag | Verfahren zur Herstellung hochkonzentrierter wässriger Lösungen von kationischen Azofarbstoffen |
-
1967
- 1967-03-02 NL NL6703423A patent/NL6703423A/xx unknown
- 1967-03-02 DE DE19671644279 patent/DE1644279A1/de active Pending
- 1967-03-02 BE BE694938D patent/BE694938A/xx unknown
- 1967-03-03 GB GB1008867A patent/GB1133683A/en not_active Expired
- 1967-03-03 CH CH312767A patent/CH502413A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE1644279A1 (de) | 1971-07-15 |
| GB1133683A (en) | 1968-11-13 |
| BE694938A (oth) | 1967-08-14 |
| NL6703423A (oth) | 1967-09-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1769423A1 (de) | Neue Disazoverbindungen,Verfahren zu deren Herstellung und Anwendung | |
| DE2043192C3 (de) | Basische Farbstoffe, deren Herstellung und Verwendung | |
| DE1297259B (de) | Verfahren zur Herstellung von Farbstoffen | |
| DE2531445C3 (de) | Sulfogruppenfreie wasserlösliche Azofarbstoffe und deren Verwendung zum Färben und/oder Bedrucken von synthetischen Textilfasern | |
| US2576037A (en) | Sulfonyl fluorides of amino azo dyestuffs | |
| DE943901C (de) | Verfahren zur Herstellung neuer Carbonsaeureamidderivate von Azofarbstoffen | |
| DE2022624C3 (de) | Basischer Disazofarbstoff, Verfahren zu dessen Herstellung und dessen Verwendung | |
| DE2006131B2 (de) | Mono- und Disazofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben und Bedrucken von Acryl-, Nylon- oder Polypropylenfasern, sowie von estergruppenhaltigen Fasern | |
| CH502413A (de) | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen | |
| DE1544458A1 (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| DE2842186A1 (de) | Azofarbstoffe | |
| DE2804599C2 (de) | Azofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| CH324391A (de) | Verfahren zur Herstellung neuer kobalthaltiger Azofarbstoffe | |
| DE2544568C3 (de) | Sulfonsäuregruppenfreie Azofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung als Pigmente in Lacken, Druckfarben oder Kunststoffen | |
| EP0005449A1 (de) | Wasserlösliche Monoazofarbstoffe, ihre Herstellung, konzentrierte wässrige Lösungen, welche die Monoazofarbstoffe enthalten, die Herstellung der Lösungen,die Verwendung der Farbstoffe und konzentrierten Lösungen und damit gefärbte und bedruckte Materialien | |
| DE1619424A1 (de) | Verwendung von Azofarbstoffen zum Faerben von hydrophoben Faeden und Fasern | |
| DE1644093A1 (de) | Verfahren zur Herstellung von wasserloeslichen basischen Azofarbstoffen | |
| AT206549B (de) | Verfahren zur Herstellung neuer basischer Farbstoffe | |
| DE2051023A1 (en) | Mono and dis-azo dyes - of the benzimidazole series contg sulphonic acid gps | |
| DE1544410C (de) | Verfahren zur Herstellung basischer Farbstoffe | |
| DE1644287C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE1769430B2 (de) | Wasserloesliche azopyrimidinfarbstoffsalze und deren verwendung | |
| DE1644122B2 (de) | Sulfonsaeure- und carbonsaeuregruppenfreie wasserunloesliche monoazofarbstoffe und verfahren zu ihrer herstellung | |
| DE1644122C3 (de) | Sulfonsäure- und carbonsäuregruppenfreie wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| AT162618B (de) | Verfahren zur Herstellung neuer Tetrakisazofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |