CA2903081A1 - Histone demethylase inhibitors - Google Patents
Histone demethylase inhibitors Download PDFInfo
- Publication number
- CA2903081A1 CA2903081A1 CA2903081A CA2903081A CA2903081A1 CA 2903081 A1 CA2903081 A1 CA 2903081A1 CA 2903081 A CA2903081 A CA 2903081A CA 2903081 A CA2903081 A CA 2903081A CA 2903081 A1 CA2903081 A1 CA 2903081A1
- Authority
- CA
- Canada
- Prior art keywords
- imidazol
- pyridine
- carboxylic acid
- compound
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 108010074870 Histone Demethylases Proteins 0.000 title claims abstract description 19
- 102000008157 Histone Demethylases Human genes 0.000 title claims abstract description 19
- 239000003112 inhibitor Substances 0.000 title description 7
- 150000001875 compounds Chemical class 0.000 claims abstract description 459
- 238000000034 method Methods 0.000 claims abstract description 274
- 239000000203 mixture Substances 0.000 claims abstract description 45
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 19
- 201000011510 cancer Diseases 0.000 claims abstract description 11
- 239000008194 pharmaceutical composition Chemical class 0.000 claims abstract description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 159
- 125000000217 alkyl group Chemical group 0.000 claims description 145
- 229910052739 hydrogen Inorganic materials 0.000 claims description 140
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 140
- 239000001257 hydrogen Substances 0.000 claims description 139
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 91
- 125000001072 heteroaryl group Chemical group 0.000 claims description 67
- 125000000623 heterocyclic group Chemical group 0.000 claims description 65
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 62
- 125000003118 aryl group Chemical group 0.000 claims description 59
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 58
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 58
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 58
- 125000004452 carbocyclyl group Chemical group 0.000 claims description 54
- 125000005884 carbocyclylalkyl group Chemical group 0.000 claims description 53
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 48
- 150000003839 salts Chemical class 0.000 claims description 44
- 229910052736 halogen Inorganic materials 0.000 claims description 30
- 150000002367 halogens Chemical group 0.000 claims description 30
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 23
- 125000000304 alkynyl group Chemical group 0.000 claims description 17
- 230000002401 inhibitory effect Effects 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims 3
- -1 imidazole-pyridine derivative compounds Chemical class 0.000 abstract description 177
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 14
- 238000011282 treatment Methods 0.000 abstract description 13
- 201000010099 disease Diseases 0.000 abstract description 11
- 230000005764 inhibitory process Effects 0.000 abstract description 10
- 206010006187 Breast cancer Diseases 0.000 abstract description 7
- 208000026310 Breast neoplasm Diseases 0.000 abstract description 7
- 206010005003 Bladder cancer Diseases 0.000 abstract description 6
- 206010058467 Lung neoplasm malignant Diseases 0.000 abstract description 5
- 208000000236 Prostatic Neoplasms Diseases 0.000 abstract description 5
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 abstract description 5
- 201000005202 lung cancer Diseases 0.000 abstract description 5
- 208000020816 lung neoplasm Diseases 0.000 abstract description 5
- 201000005112 urinary bladder cancer Diseases 0.000 abstract description 5
- 206010060862 Prostate cancer Diseases 0.000 abstract description 4
- 201000001441 melanoma Diseases 0.000 abstract description 4
- 230000001613 neoplastic effect Effects 0.000 abstract description 3
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 483
- 238000002360 preparation method Methods 0.000 description 321
- GPHQHTOMRSGBNZ-UHFFFAOYSA-N pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC=C1 GPHQHTOMRSGBNZ-UHFFFAOYSA-N 0.000 description 171
- 125000002140 imidazol-4-yl group Chemical group [H]N1C([H])=NC([*])=C1[H] 0.000 description 147
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 114
- 238000005160 1H NMR spectroscopy Methods 0.000 description 108
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 58
- 239000000126 substance Substances 0.000 description 58
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 57
- 125000002947 alkylene group Chemical group 0.000 description 56
- REQFDBXEACLQPU-UHFFFAOYSA-N 2-(1h-imidazol-5-yl)pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC(C=2N=CNC=2)=C1 REQFDBXEACLQPU-UHFFFAOYSA-N 0.000 description 53
- 239000000243 solution Substances 0.000 description 47
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 45
- 238000003786 synthesis reaction Methods 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 44
- 230000015572 biosynthetic process Effects 0.000 description 42
- TWBYWOBDOCUKOW-UHFFFAOYSA-M isonicotinate Chemical compound [O-]C(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-M 0.000 description 41
- 125000004432 carbon atom Chemical group C* 0.000 description 32
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 31
- 150000003254 radicals Chemical class 0.000 description 29
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 28
- 239000007787 solid Substances 0.000 description 28
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 28
- 108010033040 Histones Proteins 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 27
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 27
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 23
- 125000001207 fluorophenyl group Chemical group 0.000 description 22
- 239000011541 reaction mixture Substances 0.000 description 22
- 229910052757 nitrogen Inorganic materials 0.000 description 21
- 108090000623 proteins and genes Proteins 0.000 description 21
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 20
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 20
- 239000002253 acid Substances 0.000 description 19
- 238000003556 assay Methods 0.000 description 19
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 18
- 102100040584 Lysine-specific demethylase 2B Human genes 0.000 description 18
- 230000007062 hydrolysis Effects 0.000 description 18
- 238000006460 hydrolysis reaction Methods 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- 101000613625 Homo sapiens Lysine-specific demethylase 4A Proteins 0.000 description 17
- 102100040863 Lysine-specific demethylase 4A Human genes 0.000 description 17
- 210000004027 cell Anatomy 0.000 description 16
- 125000001424 substituent group Chemical group 0.000 description 16
- 102000006947 Histones Human genes 0.000 description 15
- 101001088893 Homo sapiens Lysine-specific demethylase 4C Proteins 0.000 description 15
- 101000615488 Homo sapiens Methyl-CpG-binding domain protein 2 Proteins 0.000 description 15
- 102100033230 Lysine-specific demethylase 4C Human genes 0.000 description 15
- 102100021299 Methyl-CpG-binding domain protein 2 Human genes 0.000 description 15
- 238000001514 detection method Methods 0.000 description 15
- 238000010438 heat treatment Methods 0.000 description 15
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 15
- 235000018102 proteins Nutrition 0.000 description 15
- 102000004169 proteins and genes Human genes 0.000 description 15
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 14
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 14
- 101710105679 Lysine-specific demethylase 2B Proteins 0.000 description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 14
- UZFKIHMFDWGBKC-UHFFFAOYSA-N pyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC=C1.NC(=O)C1=CC=NC=C1 UZFKIHMFDWGBKC-UHFFFAOYSA-N 0.000 description 14
- 102100040598 Lysine-specific demethylase 2A Human genes 0.000 description 13
- 125000003709 fluoroalkyl group Chemical group 0.000 description 13
- 239000000651 prodrug Substances 0.000 description 13
- 229940002612 prodrug Drugs 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 12
- 238000003818 flash chromatography Methods 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 11
- 102000036354 FBXLs Human genes 0.000 description 11
- 108091007025 FBXLs Proteins 0.000 description 11
- 102100033247 Lysine-specific demethylase 5B Human genes 0.000 description 11
- 125000004450 alkenylene group Chemical group 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 11
- 238000007069 methylation reaction Methods 0.000 description 11
- 108090000765 processed proteins & peptides Proteins 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 10
- 101001088892 Homo sapiens Lysine-specific demethylase 5A Proteins 0.000 description 10
- 101001088883 Homo sapiens Lysine-specific demethylase 5B Proteins 0.000 description 10
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 10
- 101710105678 Lysine-specific demethylase 2A Proteins 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- HWXBTNAVRSUOJR-UHFFFAOYSA-N alpha-hydroxyglutaric acid Natural products OC(=O)C(O)CCC(O)=O HWXBTNAVRSUOJR-UHFFFAOYSA-N 0.000 description 10
- 229940009533 alpha-ketoglutaric acid Drugs 0.000 description 10
- 229960002685 biotin Drugs 0.000 description 10
- 239000011616 biotin Substances 0.000 description 10
- 239000000872 buffer Substances 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 10
- 125000004122 cyclic group Chemical group 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 125000005843 halogen group Chemical group 0.000 description 10
- 235000018977 lysine Nutrition 0.000 description 10
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 10
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 10
- 238000002877 time resolved fluorescence resonance energy transfer Methods 0.000 description 10
- NZHDJNMKYDTLEC-UHFFFAOYSA-N 2-(1h-imidazol-5-yl)pyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC(C=2N=CNC=2)=C1 NZHDJNMKYDTLEC-UHFFFAOYSA-N 0.000 description 9
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 9
- 239000004472 Lysine Substances 0.000 description 9
- 102100033246 Lysine-specific demethylase 5A Human genes 0.000 description 9
- 125000003342 alkenyl group Chemical group 0.000 description 9
- 230000011987 methylation Effects 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 8
- 101100477411 Dictyostelium discoideum set1 gene Proteins 0.000 description 8
- 239000007995 HEPES buffer Substances 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 8
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 230000008901 benefit Effects 0.000 description 8
- SFNALCNOMXIBKG-UHFFFAOYSA-N ethylene glycol monododecyl ether Chemical compound CCCCCCCCCCCCOCCO SFNALCNOMXIBKG-UHFFFAOYSA-N 0.000 description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 244000201986 Cassia tora Species 0.000 description 7
- 238000003016 alphascreen Methods 0.000 description 7
- 125000004093 cyano group Chemical group *C#N 0.000 description 7
- MCARARBFNSEOCZ-UHFFFAOYSA-N methyl 2-(1h-imidazol-5-yl)pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(C=2N=CNC=2)=C1 MCARARBFNSEOCZ-UHFFFAOYSA-N 0.000 description 7
- NCAIGTHBQTXTLR-UHFFFAOYSA-N phentermine hydrochloride Chemical compound [Cl-].CC(C)([NH3+])CC1=CC=CC=C1 NCAIGTHBQTXTLR-UHFFFAOYSA-N 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 6
- LQWXEEDCMLEVHU-UHFFFAOYSA-N 2-(2h-tetrazol-5-yl)pyridine Chemical compound N1=CC=CC=C1C1=NNN=N1 LQWXEEDCMLEVHU-UHFFFAOYSA-N 0.000 description 6
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 6
- 102100035861 Cytosolic 5'-nucleotidase 1A Human genes 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 101000802744 Homo sapiens Cytosolic 5'-nucleotidase 1A Proteins 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 6
- 125000000068 chlorophenyl group Chemical group 0.000 description 6
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 6
- 125000000524 functional group Chemical group 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 125000003107 substituted aryl group Chemical group 0.000 description 6
- CMJQIHGBUKZEHP-UHFFFAOYSA-N (4-chloro-3-fluorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C(F)=C1 CMJQIHGBUKZEHP-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- VUAXHMVRKOTJKP-UHFFFAOYSA-M 2,2-dimethylbutanoate Chemical compound CCC(C)(C)C([O-])=O VUAXHMVRKOTJKP-UHFFFAOYSA-M 0.000 description 5
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- PZBFGYYEXUXCOF-UHFFFAOYSA-N TCEP Chemical compound OC(=O)CCP(CCC(O)=O)CCC(O)=O PZBFGYYEXUXCOF-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000012131 assay buffer Substances 0.000 description 5
- 239000011324 bead Substances 0.000 description 5
- 229910000024 caesium carbonate Inorganic materials 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 125000000753 cycloalkyl group Chemical group 0.000 description 5
- 230000017858 demethylation Effects 0.000 description 5
- 238000010520 demethylation reaction Methods 0.000 description 5
- 125000004188 dichlorophenyl group Chemical group 0.000 description 5
- IMBKASBLAKCLEM-UHFFFAOYSA-L ferrous ammonium sulfate (anhydrous) Chemical compound [NH4+].[NH4+].[Fe+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O IMBKASBLAKCLEM-UHFFFAOYSA-L 0.000 description 5
- 230000014509 gene expression Effects 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 150000002430 hydrocarbons Chemical group 0.000 description 5
- 125000001841 imino group Chemical group [H]N=* 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 238000011534 incubation Methods 0.000 description 5
- BMTXJJVXXUHJQZ-UHFFFAOYSA-N methyl 2-[1-(2-methylsulfonyloxyethyl)imidazol-4-yl]pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(C=2N=CN(CCOS(C)(=O)=O)C=2)=C1 BMTXJJVXXUHJQZ-UHFFFAOYSA-N 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Substances [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 5
- 235000019187 sodium-L-ascorbate Nutrition 0.000 description 5
- 239000011755 sodium-L-ascorbate Substances 0.000 description 5
- 241000701447 unidentified baculovirus Species 0.000 description 5
- 229910052727 yttrium Inorganic materials 0.000 description 5
- 125000004484 1-methylpiperidin-4-yl group Chemical group CN1CCC(CC1)* 0.000 description 4
- QRXBTPFMCTXCRD-UHFFFAOYSA-N 2-chloropyridine-4-carbonitrile Chemical compound ClC1=CC(C#N)=CC=N1 QRXBTPFMCTXCRD-UHFFFAOYSA-N 0.000 description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 208000005623 Carcinogenesis Diseases 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 108010077544 Chromatin Proteins 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 101000614013 Homo sapiens Lysine-specific demethylase 2B Proteins 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 230000033228 biological regulation Effects 0.000 description 4
- 230000036952 cancer formation Effects 0.000 description 4
- 231100000504 carcinogenesis Toxicity 0.000 description 4
- 230000001413 cellular effect Effects 0.000 description 4
- 210000003483 chromatin Anatomy 0.000 description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 4
- 230000004069 differentiation Effects 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 4
- 230000005284 excitation Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 4
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 125000004043 oxo group Chemical group O=* 0.000 description 4
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 4
- 235000011181 potassium carbonates Nutrition 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 238000007127 saponification reaction Methods 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- 125000000464 thioxo group Chemical group S=* 0.000 description 4
- 125000003652 trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 4
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 4
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 4
- 125000004486 1-methylpiperidin-3-yl group Chemical group CN1CC(CCC1)* 0.000 description 3
- ZVPDNRVYHLRXLX-UHFFFAOYSA-N 1-ter-butyl-3-p-tolyl-1h-pyrazolo[3,4-d]pyrimidin-4-ylamine Chemical compound C1=CC(C)=CC=C1C1=NN(C(C)(C)C)C2=NC=NC(N)=C12 ZVPDNRVYHLRXLX-UHFFFAOYSA-N 0.000 description 3
- 125000003070 2-(2-chlorophenyl)ethyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- ZJSZJNLCAOPVEJ-UHFFFAOYSA-N 2-[1-[(3-fluorophenyl)methyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CC=3C=C(F)C=CC=3)C=2)=C1 ZJSZJNLCAOPVEJ-UHFFFAOYSA-N 0.000 description 3
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 3
- LBUNNMJLXWQQBY-UHFFFAOYSA-N 4-fluorophenylboronic acid Chemical compound OB(O)C1=CC=C(F)C=C1 LBUNNMJLXWQQBY-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- 108020004414 DNA Proteins 0.000 description 3
- 230000004568 DNA-binding Effects 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007821 HATU Substances 0.000 description 3
- 101000613958 Homo sapiens Lysine-specific demethylase 2A Proteins 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 102000016624 JmjC domains Human genes 0.000 description 3
- 108050006228 JmjC domains Proteins 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- 108091006629 SLC13A2 Proteins 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 238000006619 Stille reaction Methods 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 3
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 3
- ZUSWDTWYONAOPH-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]hydrazine;hydrochloride Chemical group [Cl-].[NH3+]NC1=CC=CC=C1C(F)(F)F ZUSWDTWYONAOPH-UHFFFAOYSA-N 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- 125000004419 alkynylene group Chemical group 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 238000000423 cell based assay Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 125000006317 cyclopropyl amino group Chemical group 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- 238000005805 hydroxylation reaction Methods 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Chemical group 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical group C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- AECBVDLERUETKG-UHFFFAOYSA-N 1-(2-bromoethyl)-2-chlorobenzene Chemical compound ClC1=CC=CC=C1CCBr AECBVDLERUETKG-UHFFFAOYSA-N 0.000 description 2
- FSNGFFWICFYWQC-UHFFFAOYSA-N 1-(2-chloroethyl)pyrrolidine;hydron;chloride Chemical compound Cl.ClCCN1CCCC1 FSNGFFWICFYWQC-UHFFFAOYSA-N 0.000 description 2
- GEJIQZUSCIVUBN-UHFFFAOYSA-N 1-bromo-n,n-dimethylmethanamine;hydrobromide Chemical compound Br.CN(C)CBr GEJIQZUSCIVUBN-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical group C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- RMESDQNXOXOUEP-UHFFFAOYSA-N 2-(1-tritylimidazol-4-yl)pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC(C=2N=CN(C=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 RMESDQNXOXOUEP-UHFFFAOYSA-N 0.000 description 2
- VRUOQMXNECFHIE-UHFFFAOYSA-N 2-(5-bromo-1h-imidazol-4-yl)pyridine-4-carbonitrile Chemical compound N1C=NC(C=2N=CC=C(C=2)C#N)=C1Br VRUOQMXNECFHIE-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- NBKPXVZLKABEHX-UHFFFAOYSA-N 2-[1-(1-phenylpropan-2-yl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound C1=NC(C=2N=CC=C(C=2)C(O)=O)=CN1C(C)CC1=CC=CC=C1 NBKPXVZLKABEHX-UHFFFAOYSA-N 0.000 description 2
- OOXCAHWFMAEWNG-UHFFFAOYSA-N 2-[1-(2,2,2-trifluoroethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound FC(F)(F)CN1C=NC(C=2N=CC=C(C=2)C#N)=C1 OOXCAHWFMAEWNG-UHFFFAOYSA-N 0.000 description 2
- YLRCPDHINGGCLK-UHFFFAOYSA-N 2-[1-(2,2,2-trifluoroethyl)imidazol-4-yl]pyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC(C=2N=CN(CC(F)(F)F)C=2)=C1 YLRCPDHINGGCLK-UHFFFAOYSA-N 0.000 description 2
- YEIUTPICFPHMSZ-UHFFFAOYSA-N 2-[1-(2,3-dihydro-1h-inden-2-yl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(C=2)C2CC3=CC=CC=C3C2)=C1 YEIUTPICFPHMSZ-UHFFFAOYSA-N 0.000 description 2
- JJIYEQBZHWJIEX-UHFFFAOYSA-N 2-[1-(2-cyclohexylethyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CCC3CCCCC3)C=2)=C1 JJIYEQBZHWJIEX-UHFFFAOYSA-N 0.000 description 2
- PMGMVBUDUMOFTJ-UHFFFAOYSA-N 2-[1-(2-pyrrolidin-1-ylpropyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound C1CCCN1C(C)CN(C=1)C=NC=1C1=CC(C#N)=CC=N1 PMGMVBUDUMOFTJ-UHFFFAOYSA-N 0.000 description 2
- AXQRVZDNIHSEAN-UHFFFAOYSA-N 2-[1-(2-pyrrolidin-1-ylpropyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound C1CCCN1C(C)CN(C=1)C=NC=1C1=CC(C(O)=O)=CC=N1 AXQRVZDNIHSEAN-UHFFFAOYSA-N 0.000 description 2
- QUFQGCNSUGFPRL-UHFFFAOYSA-N 2-[1-(cyclohexylmethyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CC3CCCCC3)C=2)=C1 QUFQGCNSUGFPRL-UHFFFAOYSA-N 0.000 description 2
- GIHNMIREHCXXLT-UHFFFAOYSA-N 2-[1-(naphthalen-1-ylmethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC(C=2N=CN(CC=3C4=CC=CC=C4C=CC=3)C=2)=C1 GIHNMIREHCXXLT-UHFFFAOYSA-N 0.000 description 2
- GVIXCCOKQVMPAT-UHFFFAOYSA-N 2-[1-(oxolan-2-ylmethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC(C=2N=CN(CC3OCCC3)C=2)=C1 GVIXCCOKQVMPAT-UHFFFAOYSA-N 0.000 description 2
- KTVYOZMZDOAGAD-UHFFFAOYSA-N 2-[1-(oxolan-2-ylmethyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CC3OCCC3)C=2)=C1 KTVYOZMZDOAGAD-UHFFFAOYSA-N 0.000 description 2
- UTPBRCSMWYKMEF-UHFFFAOYSA-N 2-[1-(pyridin-2-ylmethyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CC=3N=CC=CC=3)C=2)=C1 UTPBRCSMWYKMEF-UHFFFAOYSA-N 0.000 description 2
- JFCPDRJTGNEZRS-UHFFFAOYSA-N 2-[1-(pyrrolidin-2-ylmethyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CC3NCCC3)C=2)=C1 JFCPDRJTGNEZRS-UHFFFAOYSA-N 0.000 description 2
- VCHJPYNNEGWXGJ-UHFFFAOYSA-N 2-[1-[(2-chlorophenyl)methyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound ClC1=CC=CC=C1CN1C=C(C=2N=CC=C(C=2)C#N)N=C1 VCHJPYNNEGWXGJ-UHFFFAOYSA-N 0.000 description 2
- DTPABGHPXSLKIZ-UHFFFAOYSA-N 2-[1-[(2-chlorophenyl)methyl]imidazol-4-yl]pyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC(C=2N=CN(CC=3C(=CC=CC=3)Cl)C=2)=C1 DTPABGHPXSLKIZ-UHFFFAOYSA-N 0.000 description 2
- CGBVLABAVLQTCP-UHFFFAOYSA-N 2-[1-[2-[2-(dimethylamino)ethoxy]ethyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound CN(C)CCOCCN1C=NC(C=2N=CC=C(C=2)C(O)=O)=C1 CGBVLABAVLQTCP-UHFFFAOYSA-N 0.000 description 2
- LVOMRBCPQKQDKC-UHFFFAOYSA-N 2-[5-bromo-1-(2,2,2-trifluoroethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound FC(F)(F)CN1C=NC(C=2N=CC=C(C=2)C#N)=C1Br LVOMRBCPQKQDKC-UHFFFAOYSA-N 0.000 description 2
- BRNBLQCNAVEFOM-UHFFFAOYSA-N 2-[5-bromo-1-(2-methoxyethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound COCCN1C=NC(C=2N=CC=C(C=2)C#N)=C1Br BRNBLQCNAVEFOM-UHFFFAOYSA-N 0.000 description 2
- QGUDVVFDWJVNEP-UHFFFAOYSA-N 2-[5-bromo-1-[(2-chlorophenyl)methyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound ClC1=CC=CC=C1CN1C(Br)=C(C=2N=CC=C(C=2)C#N)N=C1 QGUDVVFDWJVNEP-UHFFFAOYSA-N 0.000 description 2
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 2
- FFNVQNRYTPFDDP-UHFFFAOYSA-N 2-cyanopyridine Chemical compound N#CC1=CC=CC=N1 FFNVQNRYTPFDDP-UHFFFAOYSA-N 0.000 description 2
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 2
- FHZALEJIENDROK-UHFFFAOYSA-N 5-bromo-1h-imidazole Chemical compound BrC1=CN=CN1 FHZALEJIENDROK-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 108010066805 F-Box Proteins Proteins 0.000 description 2
- 102000018700 F-Box Proteins Human genes 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 108010034791 Heterochromatin Proteins 0.000 description 2
- 101710160287 Heterochromatin protein 1 Proteins 0.000 description 2
- 101001050886 Homo sapiens Lysine-specific histone demethylase 1A Proteins 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 102000058057 JmjC domain-containing Human genes 0.000 description 2
- 108700001203 JmjC domain-containing Proteins 0.000 description 2
- 102100024985 Lysine-specific histone demethylase 1A Human genes 0.000 description 2
- 241001024304 Mino Species 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical group C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 2
- 108010090804 Streptavidin Proteins 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- VXIFCATYYMRAES-UHFFFAOYSA-N [2-(cyclopropylmethoxy)-4-fluorophenyl]boronic acid Chemical compound OB(O)C1=CC=C(F)C=C1OCC1CC1 VXIFCATYYMRAES-UHFFFAOYSA-N 0.000 description 2
- BNAHHRKONJFSJY-UHFFFAOYSA-N [2-(cyclopropylmethoxy)-6-fluorophenyl]boronic acid Chemical compound OB(O)C1=C(F)C=CC=C1OCC1CC1 BNAHHRKONJFSJY-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 229940024606 amino acid Drugs 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 235000009697 arginine Nutrition 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 230000024245 cell differentiation Effects 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 2
- 210000001671 embryonic stem cell Anatomy 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 230000008029 eradication Effects 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 230000001890 gluconeogenic effect Effects 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 210000004458 heterochromatin Anatomy 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 230000033444 hydroxylation Effects 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 125000002632 imidazolidinyl group Chemical group 0.000 description 2
- 125000002636 imidazolinyl group Chemical group 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000003119 immunoblot Methods 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical group C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 101150076630 jhdm-1 gene Proteins 0.000 description 2
- 125000003588 lysine group Chemical class [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- CNMFHDIDIMZHKY-UHFFFAOYSA-N methyl 2,2-dimethylpropanoate Chemical compound COC(=O)C(C)(C)C CNMFHDIDIMZHKY-UHFFFAOYSA-N 0.000 description 2
- FFDYCLXEOFJLQL-UHFFFAOYSA-N methyl 2-(5-bromo-1-methylimidazol-4-yl)pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(C2=C(N(C)C=N2)Br)=C1 FFDYCLXEOFJLQL-UHFFFAOYSA-N 0.000 description 2
- XUEANJSDPMKHGO-UHFFFAOYSA-N methyl 2-[1-(2-hydroxyethyl)imidazol-4-yl]pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(C=2N=CN(CCO)C=2)=C1 XUEANJSDPMKHGO-UHFFFAOYSA-N 0.000 description 2
- KKOUHTMLFUAAGG-UHFFFAOYSA-N methyl 2-chloropyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(Cl)=C1 KKOUHTMLFUAAGG-UHFFFAOYSA-N 0.000 description 2
- FLXVRBSKKVMMQQ-UHFFFAOYSA-N methyl 2-formylpyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(C=O)=C1 FLXVRBSKKVMMQQ-UHFFFAOYSA-N 0.000 description 2
- OLXYLDUSSBULGU-UHFFFAOYSA-N methyl pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC=C1 OLXYLDUSSBULGU-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 125000004344 phenylpropyl group Chemical group 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 230000001323 posttranslational effect Effects 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 229910000160 potassium phosphate Inorganic materials 0.000 description 2
- 235000011009 potassium phosphates Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000019639 protein methylation Effects 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 230000009758 senescence Effects 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 229910052717 sulfur Chemical group 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- YAPQBXQYLJRXSA-UHFFFAOYSA-N theobromine Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2C YAPQBXQYLJRXSA-UHFFFAOYSA-N 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000013518 transcription Methods 0.000 description 2
- 230000035897 transcription Effects 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- REDSKZBUUUQMSK-UHFFFAOYSA-N tributyltin Chemical compound CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC REDSKZBUUUQMSK-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- YBIVAKBKIJCQGS-UHFFFAOYSA-N (2,2-difluorocyclobutyl)methanamine;hydron;chloride Chemical compound Cl.NCC1CCC1(F)F YBIVAKBKIJCQGS-UHFFFAOYSA-N 0.000 description 1
- QNEGDGPAXKYZHZ-UHFFFAOYSA-N (2,4-dichlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1Cl QNEGDGPAXKYZHZ-UHFFFAOYSA-N 0.000 description 1
- PLWSVNYQYXGJJG-UHFFFAOYSA-N (2-butoxy-4-fluorophenyl)boronic acid Chemical compound CCCCOC1=CC(F)=CC=C1B(O)O PLWSVNYQYXGJJG-UHFFFAOYSA-N 0.000 description 1
- KDDNKZCVYQDGKE-UHFFFAOYSA-N (2-chlorophenyl)methanamine Chemical compound NCC1=CC=CC=C1Cl KDDNKZCVYQDGKE-UHFFFAOYSA-N 0.000 description 1
- JPYXQNWIQIBLJT-UHFFFAOYSA-N (2-ethylphenyl)methanamine Chemical compound CCC1=CC=CC=C1CN JPYXQNWIQIBLJT-UHFFFAOYSA-N 0.000 description 1
- PXJACNDVRNAFHD-UHFFFAOYSA-N (2-methoxyphenyl)methanamine Chemical compound COC1=CC=CC=C1CN PXJACNDVRNAFHD-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- JKIGHOARKAIPJI-UHFFFAOYSA-N (3,4-dichlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C(Cl)=C1 JKIGHOARKAIPJI-UHFFFAOYSA-N 0.000 description 1
- SDEAGACSNFSZCU-UHFFFAOYSA-N (3-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(Cl)=C1 SDEAGACSNFSZCU-UHFFFAOYSA-N 0.000 description 1
- KNXQDJCZSVHEIW-UHFFFAOYSA-N (3-fluorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(F)=C1 KNXQDJCZSVHEIW-UHFFFAOYSA-N 0.000 description 1
- BVFGFBGCIAWVMF-UHFFFAOYSA-N (3-hydroxy-4-methylphenyl)boronic acid Chemical compound CC1=CC=C(B(O)O)C=C1O BVFGFBGCIAWVMF-UHFFFAOYSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- HNJQCPHETXMWSG-UHFFFAOYSA-N (4,4-difluorocyclohexyl)methanamine;hydrochloride Chemical compound Cl.NCC1CCC(F)(F)CC1 HNJQCPHETXMWSG-UHFFFAOYSA-N 0.000 description 1
- NIWJJDHZRLYASL-UHFFFAOYSA-N (4-chloro-2-ethoxyphenyl)boronic acid Chemical compound CCOC1=CC(Cl)=CC=C1B(O)O NIWJJDHZRLYASL-UHFFFAOYSA-N 0.000 description 1
- SRXXSLUUAWHGBZ-UHFFFAOYSA-N (4-chloro-2-methylphenyl)boronic acid Chemical compound CC1=CC(Cl)=CC=C1B(O)O SRXXSLUUAWHGBZ-UHFFFAOYSA-N 0.000 description 1
- DZNNRXURZJLARZ-UHFFFAOYSA-N (4-chloro-3-methoxyphenyl)boronic acid Chemical compound COC1=CC(B(O)O)=CC=C1Cl DZNNRXURZJLARZ-UHFFFAOYSA-N 0.000 description 1
- ZTFFXVLPGHNNKQ-UHFFFAOYSA-N (4-chloro-3-phenylmethoxyphenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C(OCC=2C=CC=CC=2)=C1 ZTFFXVLPGHNNKQ-UHFFFAOYSA-N 0.000 description 1
- CAYQIZIAYYNFCS-UHFFFAOYSA-N (4-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1 CAYQIZIAYYNFCS-UHFFFAOYSA-N 0.000 description 1
- YNLGFXOBRXSMJZ-UHFFFAOYSA-N (4-cyclopropylphenyl)boronic acid Chemical compound C1=CC(B(O)O)=CC=C1C1CC1 YNLGFXOBRXSMJZ-UHFFFAOYSA-N 0.000 description 1
- WRQNDLDUNQMTCL-UHFFFAOYSA-N (4-ethoxyphenyl)boronic acid Chemical compound CCOC1=CC=C(B(O)O)C=C1 WRQNDLDUNQMTCL-UHFFFAOYSA-N 0.000 description 1
- RZCPLOMUUCFPQA-UHFFFAOYSA-N (4-ethylphenyl)boronic acid Chemical compound CCC1=CC=C(B(O)O)C=C1 RZCPLOMUUCFPQA-UHFFFAOYSA-N 0.000 description 1
- RRRYTONNYRBSRP-UHFFFAOYSA-N (4-ethynylphenyl)boronic acid Chemical group OB(O)C1=CC=C(C#C)C=C1 RRRYTONNYRBSRP-UHFFFAOYSA-N 0.000 description 1
- GNCXNRGBOBWFSO-UHFFFAOYSA-N (4-fluoro-3-hydroxyphenyl)boronic acid Chemical compound OB(O)C1=CC=C(F)C(O)=C1 GNCXNRGBOBWFSO-UHFFFAOYSA-N 0.000 description 1
- QDKHJFAOVBXUDN-UHFFFAOYSA-N (4-fluoro-3-phenylmethoxyphenyl)boronic acid Chemical compound OB(O)C1=CC=C(F)C(OCC=2C=CC=CC=2)=C1 QDKHJFAOVBXUDN-UHFFFAOYSA-N 0.000 description 1
- IDCGAEJGZLYEAZ-UHFFFAOYSA-N (4-fluoronaphthalen-1-yl)boronic acid Chemical compound C1=CC=C2C(B(O)O)=CC=C(F)C2=C1 IDCGAEJGZLYEAZ-UHFFFAOYSA-N 0.000 description 1
- IIFVWLUQBAIPMJ-UHFFFAOYSA-N (4-fluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1 IIFVWLUQBAIPMJ-UHFFFAOYSA-N 0.000 description 1
- VOAAEKKFGLPLLU-UHFFFAOYSA-N (4-methoxyphenyl)boronic acid Chemical compound COC1=CC=C(B(O)O)C=C1 VOAAEKKFGLPLLU-UHFFFAOYSA-N 0.000 description 1
- BIWQNIMLAISTBV-UHFFFAOYSA-N (4-methylphenyl)boronic acid Chemical compound CC1=CC=C(B(O)O)C=C1 BIWQNIMLAISTBV-UHFFFAOYSA-N 0.000 description 1
- XTVMZKCCFLOJBL-UHFFFAOYSA-N (4-pyrazol-1-ylphenyl)boronic acid Chemical compound C1=CC(B(O)O)=CC=C1N1N=CC=C1 XTVMZKCCFLOJBL-UHFFFAOYSA-N 0.000 description 1
- HNEBXPPPIFWGHH-UHFFFAOYSA-N (4-pyrrolidin-1-ylphenyl)boronic acid Chemical compound C1=CC(B(O)O)=CC=C1N1CCCC1 HNEBXPPPIFWGHH-UHFFFAOYSA-N 0.000 description 1
- MNJYZNVROSZZQC-UHFFFAOYSA-N (4-tert-butylphenyl)boronic acid Chemical compound CC(C)(C)C1=CC=C(B(O)O)C=C1 MNJYZNVROSZZQC-UHFFFAOYSA-N 0.000 description 1
- 125000006732 (C1-C15) alkyl group Chemical group 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- 125000006313 (C5-C8) alkyl group Chemical group 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 101150084750 1 gene Proteins 0.000 description 1
- 125000005988 1,1-dioxo-thiomorpholinyl group Chemical group 0.000 description 1
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 1
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 description 1
- FSOVYXOQVGSMHN-UHFFFAOYSA-N 1-(1-bromo-2-methylpropan-2-yl)-2-chlorobenzene Chemical compound BrCC(C)(C)C1=CC=CC=C1Cl FSOVYXOQVGSMHN-UHFFFAOYSA-N 0.000 description 1
- RBCAJUWPIJXRML-UHFFFAOYSA-N 1-(1-chloropropan-2-yl)pyrrolidine;hydrochloride Chemical compound Cl.ClCC(C)N1CCCC1 RBCAJUWPIJXRML-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- QECZMYGJNDGESU-UHFFFAOYSA-N 1-(2-bromoethyl)-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1CCBr QECZMYGJNDGESU-UHFFFAOYSA-N 0.000 description 1
- FQGDFWIQBCQXPS-UHFFFAOYSA-N 1-(2-bromoethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CCBr FQGDFWIQBCQXPS-UHFFFAOYSA-N 0.000 description 1
- UIIJKBSUGZNVQN-UHFFFAOYSA-N 1-(2-bromoethyl)-2-methoxybenzene Chemical compound COC1=CC=CC=C1CCBr UIIJKBSUGZNVQN-UHFFFAOYSA-N 0.000 description 1
- PZXWZXNXBNIAHO-UHFFFAOYSA-N 1-(2-bromoethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CCBr PZXWZXNXBNIAHO-UHFFFAOYSA-N 0.000 description 1
- LKPWGXCMVLJRIK-UHFFFAOYSA-N 1-(2-bromoethyl)-3-chlorobenzene Chemical compound ClC1=CC=CC(CCBr)=C1 LKPWGXCMVLJRIK-UHFFFAOYSA-N 0.000 description 1
- FLRUNCJXOVYWDH-UHFFFAOYSA-N 1-(2-bromoethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCBr)C=C1 FLRUNCJXOVYWDH-UHFFFAOYSA-N 0.000 description 1
- OXHPTABOQVHKLN-UHFFFAOYSA-N 1-(2-bromoethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCBr)C=C1 OXHPTABOQVHKLN-UHFFFAOYSA-N 0.000 description 1
- GPHCPUFIWQJZOI-UHFFFAOYSA-N 1-(2-bromoethyl)naphthalene Chemical compound C1=CC=C2C(CCBr)=CC=CC2=C1 GPHCPUFIWQJZOI-UHFFFAOYSA-N 0.000 description 1
- CWLYHDWHNFLUEI-UHFFFAOYSA-N 1-(2-chloroethyl)pyrrolidin-2-one Chemical compound ClCCN1CCCC1=O CWLYHDWHNFLUEI-UHFFFAOYSA-N 0.000 description 1
- ZXWCKKSSCIFVBT-UHFFFAOYSA-N 1-(3-fluorophenyl)-n-methylmethanamine Chemical compound CNCC1=CC=CC(F)=C1 ZXWCKKSSCIFVBT-UHFFFAOYSA-N 0.000 description 1
- SZJIQLSCDIEJFC-UHFFFAOYSA-N 1-(4-fluorophenyl)-n-methylmethanamine Chemical compound CNCC1=CC=C(F)C=C1 SZJIQLSCDIEJFC-UHFFFAOYSA-N 0.000 description 1
- KALOJGOUZQSEGH-UHFFFAOYSA-N 1-(bromomethyl)-1,2,3,4-tetrahydronaphthalene Chemical compound C1=CC=C2C(CBr)CCCC2=C1 KALOJGOUZQSEGH-UHFFFAOYSA-N 0.000 description 1
- PVIGUZZDWGININ-UHFFFAOYSA-N 1-(bromomethyl)-2,3-dichlorobenzene Chemical compound ClC1=CC=CC(CBr)=C1Cl PVIGUZZDWGININ-UHFFFAOYSA-N 0.000 description 1
- IMRPPXKOKBZGQO-UHFFFAOYSA-N 1-(bromomethyl)-2-(2-methylpropoxy)benzene Chemical compound CC(C)COC1=CC=CC=C1CBr IMRPPXKOKBZGQO-UHFFFAOYSA-N 0.000 description 1
- TUNSVUOTVLWNQT-UHFFFAOYSA-N 1-(bromomethyl)-2-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=CC=C1CBr TUNSVUOTVLWNQT-UHFFFAOYSA-N 0.000 description 1
- ZPHUUSQDKIEPDN-UHFFFAOYSA-N 1-(bromomethyl)-2-chloro-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CBr)=C1Cl ZPHUUSQDKIEPDN-UHFFFAOYSA-N 0.000 description 1
- FFWQLZFIMNTUCZ-UHFFFAOYSA-N 1-(bromomethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CBr FFWQLZFIMNTUCZ-UHFFFAOYSA-N 0.000 description 1
- MYYYZNVAUZVXBO-UHFFFAOYSA-N 1-(bromomethyl)-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(CBr)=C1 MYYYZNVAUZVXBO-UHFFFAOYSA-N 0.000 description 1
- SCBZBMXPJYMXRC-UHFFFAOYSA-N 1-(bromomethyl)-3-fluorobenzene Chemical compound FC1=CC=CC(CBr)=C1 SCBZBMXPJYMXRC-UHFFFAOYSA-N 0.000 description 1
- RTFPTPXBTIUISM-UHFFFAOYSA-N 1-(bromomethyl)-3-phenylbenzene Chemical compound BrCC1=CC=CC(C=2C=CC=CC=2)=C1 RTFPTPXBTIUISM-UHFFFAOYSA-N 0.000 description 1
- NVNPLEPBDPJYRZ-UHFFFAOYSA-N 1-(bromomethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CBr)C=C1 NVNPLEPBDPJYRZ-UHFFFAOYSA-N 0.000 description 1
- RZJGKPNCYQZFGR-UHFFFAOYSA-N 1-(bromomethyl)naphthalene Chemical compound C1=CC=C2C(CBr)=CC=CC2=C1 RZJGKPNCYQZFGR-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical group CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- QLXHLJVEFKKBNC-UHFFFAOYSA-N 1-[1-(benzotriazol-1-yl)ethyl]benzotriazole Chemical compound N1=NC2=CC=CC=C2N1C(C)N1C2=CC=CC=C2N=N1 QLXHLJVEFKKBNC-UHFFFAOYSA-N 0.000 description 1
- SQVGBIQSEYQZQV-UHFFFAOYSA-N 1-[benzotriazol-1-yl(phenyl)methyl]benzotriazole Chemical compound C1=CC=CC=C1C(N1C2=CC=CC=C2N=N1)N1C2=CC=CC=C2N=N1 SQVGBIQSEYQZQV-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- CEVMYGZHEJSOHZ-UHFFFAOYSA-N 1-bromo-3-methoxypropane Chemical compound COCCCBr CEVMYGZHEJSOHZ-UHFFFAOYSA-N 0.000 description 1
- LJOJKFHNKMTEFS-UHFFFAOYSA-N 1-bromo-4-[1-(trifluoromethyl)cyclopropyl]benzene Chemical compound C=1C=C(Br)C=CC=1C1(C(F)(F)F)CC1 LJOJKFHNKMTEFS-UHFFFAOYSA-N 0.000 description 1
- CQFDENIIPSNVQG-UHFFFAOYSA-N 1-bromo-4-fluoro-2,3-dihydro-1h-indene Chemical compound FC1=CC=CC2=C1CCC2Br CQFDENIIPSNVQG-UHFFFAOYSA-N 0.000 description 1
- FXUWRVDNJUZFRM-UHFFFAOYSA-N 1-bromo-6-fluoro-2,3-dihydro-1h-indene Chemical compound FC1=CC=C2CCC(Br)C2=C1 FXUWRVDNJUZFRM-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- XJSUFXFSUACKAT-UHFFFAOYSA-N 1-bromopropylbenzene Chemical compound CCC(Br)C1=CC=CC=C1 XJSUFXFSUACKAT-UHFFFAOYSA-N 0.000 description 1
- BFPMCZWKUSUMKE-UHFFFAOYSA-N 1-cyclopropyl-n-methylmethanamine Chemical compound CNCC1CC1 BFPMCZWKUSUMKE-UHFFFAOYSA-N 0.000 description 1
- 125000005987 1-oxo-thiomorpholinyl group Chemical group 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 1
- NKWCGTOZTHZDHB-UHFFFAOYSA-N 1h-imidazol-1-ium-4-carboxylate Chemical compound OC(=O)C1=CNC=N1 NKWCGTOZTHZDHB-UHFFFAOYSA-N 0.000 description 1
- SBPIDKODQVLBGV-UHFFFAOYSA-N 1h-imidazole;pyridine Chemical class C1=CNC=N1.C1=CC=NC=C1 SBPIDKODQVLBGV-UHFFFAOYSA-N 0.000 description 1
- ZVMHOIWRCCZGPZ-UHFFFAOYSA-N 1h-indol-6-ylboronic acid Chemical compound OB(O)C1=CC=C2C=CNC2=C1 ZVMHOIWRCCZGPZ-UHFFFAOYSA-N 0.000 description 1
- IGKCQDUYZULGBM-UHFFFAOYSA-N 2,2,2-trifluoroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCC(F)(F)F)C=C1 IGKCQDUYZULGBM-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- ZBONBGOYILUGCL-UHFFFAOYSA-N 2,2-dimethylpropanoate Chemical compound CC(C)([CH2+])C([O-])=O ZBONBGOYILUGCL-UHFFFAOYSA-N 0.000 description 1
- XVJQMFRHWPSTDY-UHFFFAOYSA-N 2,3-dihydro-1h-isoindole-4-carbonitrile;hydrochloride Chemical compound Cl.N#CC1=CC=CC2=C1CNC2 XVJQMFRHWPSTDY-UHFFFAOYSA-N 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical class OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- YMTUVGRFKLITAS-UHFFFAOYSA-N 2-(1-benzylimidazol-4-yl)pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CC=3C=CC=CC=3)C=2)=C1 YMTUVGRFKLITAS-UHFFFAOYSA-N 0.000 description 1
- AHHQCRZKQHDXIY-UHFFFAOYSA-N 2-(1h-imidazol-5-yl)pyridine Chemical group N1C=NC=C1C1=CC=CC=N1 AHHQCRZKQHDXIY-UHFFFAOYSA-N 0.000 description 1
- UCZKIFBRVWUSTF-UHFFFAOYSA-N 2-(2-chloroethyl)pyridine;hydron;chloride Chemical compound Cl.ClCCC1=CC=CC=N1 UCZKIFBRVWUSTF-UHFFFAOYSA-N 0.000 description 1
- YOIPUKJRNNBGNK-UHFFFAOYSA-N 2-(2-ethoxyphenyl)ethyl methanesulfonate Chemical compound CCOC1=CC=CC=C1CCOS(C)(=O)=O YOIPUKJRNNBGNK-UHFFFAOYSA-N 0.000 description 1
- VOHILFSOWRNVJJ-UHFFFAOYSA-N 2-(bromomethyl)oxolane Chemical compound BrCC1CCCO1 VOHILFSOWRNVJJ-UHFFFAOYSA-N 0.000 description 1
- UTYOOBRKCYPDAK-UHFFFAOYSA-N 2-(chloromethyl)-4-methylmorpholine Chemical compound CN1CCOC(CCl)C1 UTYOOBRKCYPDAK-UHFFFAOYSA-N 0.000 description 1
- XHNIEVIJHDHWDQ-UHFFFAOYSA-N 2-[1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CC3C4=CC=CC=C4CCC3)C=2)=C1 XHNIEVIJHDHWDQ-UHFFFAOYSA-N 0.000 description 1
- NMESCDKGNVRKHG-UHFFFAOYSA-N 2-[1-(2-methoxyethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound COCCN1C=NC(C=2N=CC=C(C=2)C#N)=C1 NMESCDKGNVRKHG-UHFFFAOYSA-N 0.000 description 1
- VJLABPNSGBCXOH-UHFFFAOYSA-N 2-[1-(2-methyl-1-phenylpropyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound C1=NC(C=2N=CC=C(C=2)C(O)=O)=CN1C(C(C)C)C1=CC=CC=C1 VJLABPNSGBCXOH-UHFFFAOYSA-N 0.000 description 1
- VTBZXRRFAQZNQE-UHFFFAOYSA-N 2-[1-(4-fluoro-2,3-dihydro-1h-inden-1-yl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(C=2)C2C3=C(C(=CC=C3)F)CC2)=C1 VTBZXRRFAQZNQE-UHFFFAOYSA-N 0.000 description 1
- IHQFUQDEYXBGQR-UHFFFAOYSA-N 2-[1-(6-fluoro-2,3-dihydro-1h-inden-1-yl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(C=2)C2C3=CC(F)=CC=C3CC2)=C1 IHQFUQDEYXBGQR-UHFFFAOYSA-N 0.000 description 1
- QTVSUVDGPCFJJH-UHFFFAOYSA-N 2-[1-(cyclopropylmethyl)-5-(4-fluorophenyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound C1=CC(F)=CC=C1C1=C(C=2N=CC=C(C=2)C#N)N=CN1CC1CC1 QTVSUVDGPCFJJH-UHFFFAOYSA-N 0.000 description 1
- CRVQLJOEUPYQFD-UHFFFAOYSA-N 2-[1-(cyclopropylmethyl)-5-(4-fluorophenyl)imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C2=C(N(CC3CC3)C=N2)C=2C=CC(F)=CC=2)=C1 CRVQLJOEUPYQFD-UHFFFAOYSA-N 0.000 description 1
- RFHHWXHSUUNHKQ-UHFFFAOYSA-N 2-[1-(cyclopropylmethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC(C=2N=CN(CC3CC3)C=2)=C1 RFHHWXHSUUNHKQ-UHFFFAOYSA-N 0.000 description 1
- IMUVMMAMNCHLOO-UHFFFAOYSA-N 2-[1-(cyclopropylmethyl)imidazol-4-yl]pyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC(C=2N=CN(CC3CC3)C=2)=C1 IMUVMMAMNCHLOO-UHFFFAOYSA-N 0.000 description 1
- RYOGJXXWSKMNIH-UHFFFAOYSA-N 2-[1-(pyridin-2-ylmethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC(C=2N=CN(CC=3N=CC=CC=3)C=2)=C1 RYOGJXXWSKMNIH-UHFFFAOYSA-N 0.000 description 1
- ZMPAHCRCERHOOM-UHFFFAOYSA-N 2-[1-[(1-methylpiperidin-3-yl)methyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound C1N(C)CCCC1CN1C=C(C=2N=CC=C(C=2)C#N)N=C1 ZMPAHCRCERHOOM-UHFFFAOYSA-N 0.000 description 1
- JCGCVOGOLOCZAY-UHFFFAOYSA-N 2-[1-[(2,3-dichlorophenyl)methyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound ClC1=CC=CC(CN2C=C(N=C2)C=2N=CC=C(C=2)C#N)=C1Cl JCGCVOGOLOCZAY-UHFFFAOYSA-N 0.000 description 1
- KJLMDBQYMBVZGL-UHFFFAOYSA-N 2-[1-[(2,6-dichlorophenyl)methyl]imidazol-4-yl]-4-(2h-tetrazol-5-yl)pyridine Chemical compound ClC1=CC=CC(Cl)=C1CN1C=C(C=2N=CC=C(C=2)C2=NNN=N2)N=C1 KJLMDBQYMBVZGL-UHFFFAOYSA-N 0.000 description 1
- KAMGHXAJRYYASU-UHFFFAOYSA-N 2-[1-[(2,6-dichlorophenyl)methyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound ClC1=CC=CC(Cl)=C1CN1C=C(C=2N=CC=C(C=2)C#N)N=C1 KAMGHXAJRYYASU-UHFFFAOYSA-N 0.000 description 1
- MYTTVMBMNLTMHQ-UHFFFAOYSA-N 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound ClC1=CC=CC(CN2C=C(N=C2)C=2N=CC=C(C=2)C#N)=C1 MYTTVMBMNLTMHQ-UHFFFAOYSA-N 0.000 description 1
- WZCFPBNGPRIVMR-UHFFFAOYSA-N 2-[1-[(3-chlorophenyl)methyl]imidazol-4-yl]pyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC(C=2N=CN(CC=3C=C(Cl)C=CC=3)C=2)=C1 WZCFPBNGPRIVMR-UHFFFAOYSA-N 0.000 description 1
- OBKCDRMFXSQUSL-UHFFFAOYSA-N 2-[1-[(4-chlorophenyl)methyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound C1=CC(Cl)=CC=C1CN1C=C(C=2N=CC=C(C=2)C#N)N=C1 OBKCDRMFXSQUSL-UHFFFAOYSA-N 0.000 description 1
- NHIWIMQRCCRMRZ-UHFFFAOYSA-N 2-[1-[(4-chlorophenyl)methyl]imidazol-4-yl]pyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC(C=2N=CN(CC=3C=CC(Cl)=CC=3)C=2)=C1 NHIWIMQRCCRMRZ-UHFFFAOYSA-N 0.000 description 1
- SZGDHNLSGOGPJL-UHFFFAOYSA-N 2-[1-[(4-methylmorpholin-2-yl)methyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound C1N(C)CCOC1CN1C=C(C=2N=CC=C(C=2)C#N)N=C1 SZGDHNLSGOGPJL-UHFFFAOYSA-N 0.000 description 1
- XVIKJBZPEYLLFN-UHFFFAOYSA-N 2-[1-[(4-methylmorpholin-2-yl)methyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound C1N(C)CCOC1CN1C=C(C=2N=CC=C(C=2)C(O)=O)N=C1 XVIKJBZPEYLLFN-UHFFFAOYSA-N 0.000 description 1
- VWLPRJAIFVIYRG-UHFFFAOYSA-N 2-[1-[1-(2-chlorophenyl)ethyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound C1=NC(C=2N=CC=C(C=2)C#N)=CN1C(C)C1=CC=CC=C1Cl VWLPRJAIFVIYRG-UHFFFAOYSA-N 0.000 description 1
- UWXPQJZRJBBIFX-UHFFFAOYSA-N 2-[1-[2-(2-chlorophenyl)ethyl]-5-(4-fluorophenyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound C1=CC(F)=CC=C1C1=C(C=2N=CC=C(C=2)C#N)N=CN1CCC1=CC=CC=C1Cl UWXPQJZRJBBIFX-UHFFFAOYSA-N 0.000 description 1
- BGZOMHLKUBGXRT-UHFFFAOYSA-N 2-[1-[2-(2-chlorophenyl)ethyl]imidazol-4-yl]pyridine-4-carbonitrile Chemical compound ClC1=CC=CC=C1CCN1C=C(C=2N=CC=C(C=2)C#N)N=C1 BGZOMHLKUBGXRT-UHFFFAOYSA-N 0.000 description 1
- LYECZDRRRZNARD-UHFFFAOYSA-N 2-[1-[2-(4-chloro-n-methylanilino)ethyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound C=1C=C(Cl)C=CC=1N(C)CCN(C=1)C=NC=1C1=CC(C(O)=O)=CC=N1 LYECZDRRRZNARD-UHFFFAOYSA-N 0.000 description 1
- HNQJHFKEFOZLKD-UHFFFAOYSA-N 2-[1-[2-(6-chloro-3,4-dihydro-2h-quinolin-1-yl)ethyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CCN3C4=CC=C(Cl)C=C4CCC3)C=2)=C1 HNQJHFKEFOZLKD-UHFFFAOYSA-N 0.000 description 1
- HFKOFUFQGTVMPB-UHFFFAOYSA-N 2-[1-[2-(6-fluoro-3,4-dihydro-2h-quinolin-1-yl)ethyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CCN3C4=CC=C(F)C=C4CCC3)C=2)=C1 HFKOFUFQGTVMPB-UHFFFAOYSA-N 0.000 description 1
- JESVJQKIAGLWLN-UHFFFAOYSA-N 2-[1-[2-(dimethylamino)ethyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound CN(C)CCN1C=NC(C=2N=CC=C(C=2)C(O)=O)=C1 JESVJQKIAGLWLN-UHFFFAOYSA-N 0.000 description 1
- QVDRDNVABMUEIS-UHFFFAOYSA-N 2-[1-[2-[(3,3-difluorocyclobutyl)methylamino]ethyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CCNCC3CC(F)(F)C3)C=2)=C1 QVDRDNVABMUEIS-UHFFFAOYSA-N 0.000 description 1
- MBHMCPDRAOESBT-UHFFFAOYSA-N 2-[1-[2-[cyclopropylmethyl(methyl)amino]ethyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound C1CC1CN(C)CCN(C=1)C=NC=1C1=CC(C(O)=O)=CC=N1 MBHMCPDRAOESBT-UHFFFAOYSA-N 0.000 description 1
- JQYLYLCPLZVGGQ-UHFFFAOYSA-N 2-[1-[[3-(trifluoromethyl)phenyl]methyl]imidazol-4-yl]pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(C=2N=CN(CC=3C=C(C=CC=3)C(F)(F)F)C=2)=C1 JQYLYLCPLZVGGQ-UHFFFAOYSA-N 0.000 description 1
- TVDPVJZHYPPVSB-UHFFFAOYSA-N 2-[2-(cyclopropylmethoxy)-4,5-difluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC(F)=C(F)C=C1OCC1CC1 TVDPVJZHYPPVSB-UHFFFAOYSA-N 0.000 description 1
- ADRJDECMGIZIRR-UHFFFAOYSA-N 2-[5-bromo-1-(cyclopropylmethyl)imidazol-4-yl]pyridine-4-carbonitrile Chemical compound BrC1=C(C=2N=CC=C(C=2)C#N)N=CN1CC1CC1 ADRJDECMGIZIRR-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- AXHRGVJWDJDYPO-UHFFFAOYSA-N 2-bromo-1h-imidazole Chemical compound BrC1=NC=CN1 AXHRGVJWDJDYPO-UHFFFAOYSA-N 0.000 description 1
- APYDCTAPNKFTRB-UHFFFAOYSA-N 2-bromo-2,3-dihydro-1h-indene Chemical compound C1=CC=C2CC(Br)CC2=C1 APYDCTAPNKFTRB-UHFFFAOYSA-N 0.000 description 1
- 125000006016 2-bromoethoxy group Chemical group 0.000 description 1
- JRQAAYVLPPGEHT-UHFFFAOYSA-N 2-bromoethylcyclohexane Chemical compound BrCCC1CCCCC1 JRQAAYVLPPGEHT-UHFFFAOYSA-N 0.000 description 1
- NVYOCAOZCSNIHR-UHFFFAOYSA-N 2-bromopropylbenzene Chemical compound CC(Br)CC1=CC=CC=C1 NVYOCAOZCSNIHR-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- SIUTWYZMSNPSIO-UHFFFAOYSA-N 2-chloroethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCCl SIUTWYZMSNPSIO-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000006088 2-oxoazepinyl group Chemical group 0.000 description 1
- 125000004638 2-oxopiperazinyl group Chemical group O=C1N(CCNC1)* 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- GTKIGDZXPDCIKR-UHFFFAOYSA-N 2-phenylbenzamide Chemical compound NC(=O)C1=CC=CC=C1C1=CC=CC=C1 GTKIGDZXPDCIKR-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- FFOIFAAVWJZLFE-UHFFFAOYSA-N 3-(chloromethyl)-1-methylpiperidine Chemical compound CN1CCCC(CCl)C1 FFOIFAAVWJZLFE-UHFFFAOYSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- IDBJSERXBDUKCD-UHFFFAOYSA-N 3-bromo-n,n-dimethylpropan-1-amine;hydron;bromide Chemical compound Br.CN(C)CCCBr IDBJSERXBDUKCD-UHFFFAOYSA-N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- KBGYVEMTQPFYBN-UHFFFAOYSA-N 4-(2-chloroethyl)-1h-pyrazole Chemical compound ClCCC=1C=NNC=1 KBGYVEMTQPFYBN-UHFFFAOYSA-N 0.000 description 1
- NBJHDLKSWUDGJG-UHFFFAOYSA-N 4-(2-chloroethyl)morpholin-4-ium;chloride Chemical compound Cl.ClCCN1CCOCC1 NBJHDLKSWUDGJG-UHFFFAOYSA-N 0.000 description 1
- LPWSSZKXKQCTCS-UHFFFAOYSA-N 4-(bromomethyl)-1-methylpiperidine;hydrobromide Chemical compound Br.CN1CCC(CBr)CC1 LPWSSZKXKQCTCS-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical class C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 1
- BHGGKDRWZHDWRI-UHFFFAOYSA-N 4-chloro-2,3-dihydro-1h-isoindole;hydrochloride Chemical compound Cl.ClC1=CC=CC2=C1CNC2 BHGGKDRWZHDWRI-UHFFFAOYSA-N 0.000 description 1
- AHFINSWGYAZBOZ-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)benzaldehyde Chemical group FC(F)(F)C1=CC(Cl)=CC=C1C=O AHFINSWGYAZBOZ-UHFFFAOYSA-N 0.000 description 1
- XCEYKKJMLOFDSS-UHFFFAOYSA-N 4-chloro-n-methylaniline Chemical compound CNC1=CC=C(Cl)C=C1 XCEYKKJMLOFDSS-UHFFFAOYSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- ZYUVGYBAPZYKSA-UHFFFAOYSA-N 5-(3-hydroxybutan-2-yl)-4-methylbenzene-1,3-diol Chemical compound CC(O)C(C)C1=CC(O)=CC(O)=C1C ZYUVGYBAPZYKSA-UHFFFAOYSA-N 0.000 description 1
- MLGLDTHUKQAQEC-UHFFFAOYSA-N 5-(trifluoromethyl)-2,3-dihydro-1h-isoindole Chemical compound FC(F)(F)C1=CC=C2CNCC2=C1 MLGLDTHUKQAQEC-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- SPDKLINCVDBABZ-UHFFFAOYSA-N 5-chloro-2,3-dihydro-1h-isoindole;hydrochloride Chemical compound Cl.ClC1=CC=C2CNCC2=C1 SPDKLINCVDBABZ-UHFFFAOYSA-N 0.000 description 1
- NXQRMQIYCWFDGP-UHFFFAOYSA-N 5-fluoro-2,3-dihydro-1h-indole Chemical compound FC1=CC=C2NCCC2=C1 NXQRMQIYCWFDGP-UHFFFAOYSA-N 0.000 description 1
- UYIALDLZAMTNLK-UHFFFAOYSA-N 5-fluoro-2,3-dihydro-1h-isoindole Chemical compound FC1=CC=C2CNCC2=C1 UYIALDLZAMTNLK-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- PASUADIMFGAUDB-UHFFFAOYSA-N 6-chloro-1,2,3,4-tetrahydroquinoline Chemical compound N1CCCC2=CC(Cl)=CC=C21 PASUADIMFGAUDB-UHFFFAOYSA-N 0.000 description 1
- NECDDBBJVCNJNS-UHFFFAOYSA-N 6-fluoro-1,2,3,4-tetrahydroquinoline Chemical compound N1CCCC2=CC(F)=CC=C21 NECDDBBJVCNJNS-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 1
- 201000004384 Alopecia Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 108700020463 BRCA1 Proteins 0.000 description 1
- 102000036365 BRCA1 Human genes 0.000 description 1
- 101150072950 BRCA1 gene Proteins 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- ZNSMNVMLTJELDZ-UHFFFAOYSA-N Bis(2-chloroethyl)ether Chemical compound ClCCOCCCl ZNSMNVMLTJELDZ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 101100446326 Caenorhabditis elegans fbxl-1 gene Proteins 0.000 description 1
- 101100366000 Caenorhabditis elegans snr-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 102000014914 Carrier Proteins Human genes 0.000 description 1
- 102100035888 Caveolin-1 Human genes 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- 108091029523 CpG island Proteins 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 102100024673 Dual specificity protein phosphatase 3 Human genes 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 108700028146 Genetic Enhancer Elements Proteins 0.000 description 1
- 208000031448 Genomic Instability Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 102100031181 Glyceraldehyde-3-phosphate dehydrogenase Human genes 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 102100039869 Histone H2B type F-S Human genes 0.000 description 1
- 108010036115 Histone Methyltransferases Proteins 0.000 description 1
- 102000011787 Histone Methyltransferases Human genes 0.000 description 1
- 102100035864 Histone lysine demethylase PHF8 Human genes 0.000 description 1
- 101000715467 Homo sapiens Caveolin-1 Proteins 0.000 description 1
- 101000908482 Homo sapiens Dual specificity protein phosphatase 3 Proteins 0.000 description 1
- 101001035372 Homo sapiens Histone H2B type F-S Proteins 0.000 description 1
- 101001000378 Homo sapiens Histone lysine demethylase PHF8 Proteins 0.000 description 1
- 101000613629 Homo sapiens Lysine-specific demethylase 4B Proteins 0.000 description 1
- 101001088895 Homo sapiens Lysine-specific demethylase 4D Proteins 0.000 description 1
- 101001088900 Homo sapiens Lysine-specific demethylase 4E Proteins 0.000 description 1
- 101001088887 Homo sapiens Lysine-specific demethylase 5C Proteins 0.000 description 1
- 101001088879 Homo sapiens Lysine-specific demethylase 5D Proteins 0.000 description 1
- 101000692954 Homo sapiens Lysine-specific demethylase PHF2 Proteins 0.000 description 1
- 101001056567 Homo sapiens Protein Jumonji Proteins 0.000 description 1
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- 101150086476 KDM5B gene Proteins 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- 125000002435 L-phenylalanyl group Chemical group O=C([*])[C@](N([H])[H])([H])C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 102100040860 Lysine-specific demethylase 4B Human genes 0.000 description 1
- 102100033231 Lysine-specific demethylase 4D Human genes 0.000 description 1
- 102100033232 Lysine-specific demethylase 4E Human genes 0.000 description 1
- 102100033249 Lysine-specific demethylase 5C Human genes 0.000 description 1
- 102100033143 Lysine-specific demethylase 5D Human genes 0.000 description 1
- 102100026395 Lysine-specific demethylase PHF2 Human genes 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 206010073150 Multiple endocrine neoplasia Type 1 Diseases 0.000 description 1
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 108020005497 Nuclear hormone receptor Proteins 0.000 description 1
- 102000007399 Nuclear hormone receptor Human genes 0.000 description 1
- 108010047956 Nucleosomes Proteins 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- 108091002531 OF-1 protein Proteins 0.000 description 1
- 102100027069 Odontogenic ameloblast-associated protein Human genes 0.000 description 1
- 101710091533 Odontogenic ameloblast-associated protein Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 108010011536 PTEN Phosphohydrolase Proteins 0.000 description 1
- 102000014160 PTEN Phosphohydrolase Human genes 0.000 description 1
- 244000025272 Persea americana Species 0.000 description 1
- 235000008673 Persea americana Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100025733 Protein Jumonji Human genes 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 description 1
- 201000000582 Retinoblastoma Diseases 0.000 description 1
- 108700025701 Retinoblastoma Genes Proteins 0.000 description 1
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 description 1
- 101000650578 Salmonella phage P22 Regulatory protein C3 Proteins 0.000 description 1
- 206010041067 Small cell lung cancer Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 101001040920 Triticum aestivum Alpha-amylase inhibitor 0.28 Proteins 0.000 description 1
- 108700025716 Tumor Suppressor Genes Proteins 0.000 description 1
- 102000044209 Tumor Suppressor Genes Human genes 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- ZSKQIFWUTUZAGF-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=CC=C1C(F)(F)F ZSKQIFWUTUZAGF-UHFFFAOYSA-N 0.000 description 1
- CHQAQRIPXQLTME-UHFFFAOYSA-N [2-bromoethoxy(diphenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(OCCBr)C1=CC=CC=C1 CHQAQRIPXQLTME-UHFFFAOYSA-N 0.000 description 1
- HGTDLKXUWVKLQX-UHFFFAOYSA-N [3-(hydroxymethyl)phenyl]boronic acid Chemical compound OCC1=CC=CC(B(O)O)=C1 HGTDLKXUWVKLQX-UHFFFAOYSA-N 0.000 description 1
- FYFFPNFUVMBPRZ-UHFFFAOYSA-N [3-(methylcarbamoyl)phenyl]boronic acid Chemical compound CNC(=O)C1=CC=CC(B(O)O)=C1 FYFFPNFUVMBPRZ-UHFFFAOYSA-N 0.000 description 1
- AYJVDOMUBHORKK-UHFFFAOYSA-N [4-(cyclopropylmethoxy)phenyl]boronic acid Chemical compound C1=CC(B(O)O)=CC=C1OCC1CC1 AYJVDOMUBHORKK-UHFFFAOYSA-N 0.000 description 1
- HUOFUOCSQCYFPW-UHFFFAOYSA-N [4-(trifluoromethoxy)phenyl]boronic acid Chemical compound OB(O)C1=CC=C(OC(F)(F)F)C=C1 HUOFUOCSQCYFPW-UHFFFAOYSA-N 0.000 description 1
- ALMFIOZYDASRRC-UHFFFAOYSA-N [4-(trifluoromethyl)phenyl]boronic acid Chemical compound OB(O)C1=CC=C(C(F)(F)F)C=C1 ALMFIOZYDASRRC-UHFFFAOYSA-N 0.000 description 1
- RSZPBFYCGLSBAF-UHFFFAOYSA-N [4-[1-(hydroxymethyl)cyclopropyl]phenyl]boronic acid Chemical compound C=1C=C(B(O)O)C=CC=1C1(CO)CC1 RSZPBFYCGLSBAF-UHFFFAOYSA-N 0.000 description 1
- YAPBOBGBYQQYHX-UHFFFAOYSA-N [4-chloro-2-(trifluoromethyl)phenyl]boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1C(F)(F)F YAPBOBGBYQQYHX-UHFFFAOYSA-N 0.000 description 1
- XHKNQBNGLMOTDB-UHFFFAOYSA-N [4-chloro-3-(trifluoromethyl)phenyl]boronic acid Chemical compound OB(O)C1=CC=C(Cl)C(C(F)(F)F)=C1 XHKNQBNGLMOTDB-UHFFFAOYSA-N 0.000 description 1
- UMXXWOWPLFZKQJ-UHFFFAOYSA-N [4-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]boronic acid Chemical compound OB(O)C1=CC=C(F)C(OCC(F)(F)F)=C1 UMXXWOWPLFZKQJ-UHFFFAOYSA-N 0.000 description 1
- KHFWXFSYCGFPGR-UHFFFAOYSA-N [4-fluoro-3-(phenylcarbamoyl)phenyl]boronic acid Chemical compound OB(O)C1=CC=C(F)C(C(=O)NC=2C=CC=CC=2)=C1 KHFWXFSYCGFPGR-UHFFFAOYSA-N 0.000 description 1
- HTJVSOKFRYKNCQ-UHFFFAOYSA-N [5-[2-[1-[(2-chlorophenyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyridin-4-yl]tetrazol-2-yl]methyl acetate Chemical compound CC(=O)OCN1N=NC(C=2C=C(N=CC=2)C2=C(N(CC=3C(=CC=CC=3)Cl)C=N2)C=2C=CC(F)=CC=2)=N1 HTJVSOKFRYKNCQ-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 230000011759 adipose tissue development Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003121 arginine Drugs 0.000 description 1
- 150000001484 arginines Chemical class 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005870 benzindolyl group Chemical group 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000005875 benzo[b][1,4]dioxepinyl group Chemical group 0.000 description 1
- 125000005876 benzo[b][1,4]oxazinyl group Chemical group 0.000 description 1
- 125000005873 benzo[d]thiazolyl group Chemical group 0.000 description 1
- 125000000928 benzodioxinyl group Chemical group O1C(=COC2=C1C=CC=C2)* 0.000 description 1
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000005878 benzonaphthofuranyl group Chemical group 0.000 description 1
- 125000005872 benzooxazolyl group Chemical group 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 108091008324 binding proteins Proteins 0.000 description 1
- 238000010256 biochemical assay Methods 0.000 description 1
- 238000012925 biological evaluation Methods 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 201000001531 bladder carcinoma Diseases 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- NHYXMAKLBXBVEO-UHFFFAOYSA-N bromomethyl acetate Chemical compound CC(=O)OCBr NHYXMAKLBXBVEO-UHFFFAOYSA-N 0.000 description 1
- UUWSLBWDFJMSFP-UHFFFAOYSA-N bromomethylcyclohexane Chemical compound BrCC1CCCCC1 UUWSLBWDFJMSFP-UHFFFAOYSA-N 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- ILAJWURWJKXJPW-UHFFFAOYSA-N butanedioic acid;octanedioic acid Chemical class OC(=O)CCC(O)=O.OC(=O)CCCCCCC(O)=O ILAJWURWJKXJPW-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- PBAYDYUZOSNJGU-UHFFFAOYSA-N chelidonic acid Natural products OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- SMJYMSAPPGLBAR-UHFFFAOYSA-N chloromethyl acetate Chemical compound CC(=O)OCCl SMJYMSAPPGLBAR-UHFFFAOYSA-N 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 125000005507 decahydroisoquinolyl group Chemical group 0.000 description 1
- 125000004855 decalinyl group Chemical group C1(CCCC2CCCCC12)* 0.000 description 1
- NHADDZMCASKINP-HTRCEHHLSA-N decarboxydihydrocitrinin Natural products C1=C(O)C(C)=C2[C@H](C)[C@@H](C)OCC2=C1O NHADDZMCASKINP-HTRCEHHLSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000000326 densiometry Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 125000005509 dibenzothiophenyl group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000007907 direct compression Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000019975 dosage compensation by inactivation of X chromosome Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 230000003828 downregulation Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 230000005014 ectopic expression Effects 0.000 description 1
- 238000007824 enzymatic assay Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 230000001973 epigenetic effect Effects 0.000 description 1
- 229960005309 estradiol Drugs 0.000 description 1
- 229930182833 estradiol Natural products 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical group C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000003844 furanonyl group Chemical group 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000030279 gene silencing Effects 0.000 description 1
- 238000012226 gene silencing method Methods 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 230000014101 glucose homeostasis Effects 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 108020004445 glyceraldehyde-3-phosphate dehydrogenase Proteins 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 208000024963 hair loss Diseases 0.000 description 1
- 230000003676 hair loss Effects 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000000232 haloalkynyl group Chemical group 0.000 description 1
- 230000003862 health status Effects 0.000 description 1
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 229960002885 histidine Drugs 0.000 description 1
- 235000014304 histidine Nutrition 0.000 description 1
- 102000033785 histone binding proteins Human genes 0.000 description 1
- 108091009732 histone binding proteins Proteins 0.000 description 1
- XGIHQYAWBCFNPY-AZOCGYLKSA-N hydrabamine Chemical compound C([C@@H]12)CC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC[C@@]1(C)CNCCNC[C@@]1(C)[C@@H]2CCC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC1 XGIHQYAWBCFNPY-AZOCGYLKSA-N 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000003018 immunoassay Methods 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000003114 inden-1-yl group Chemical group [H]C1=C([H])C([H])(*)C2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 206010073095 invasive ductal breast carcinoma Diseases 0.000 description 1
- 201000010985 invasive ductal carcinoma Diseases 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- GWVMLCQWXVFZCN-UHFFFAOYSA-N isoindoline Chemical compound C1=CC=C2CNCC2=C1 GWVMLCQWXVFZCN-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000003903 lactic acid esters Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229940031703 low substituted hydroxypropyl cellulose Drugs 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 108010082117 matrigel Proteins 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000001800 methanetriyl group Chemical group C(*)(*)* 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- XGXIJKTWKKJERF-UHFFFAOYSA-N methyl 2-(1-tritylimidazol-4-yl)pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(C=2N=CN(C=2)C(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 XGXIJKTWKKJERF-UHFFFAOYSA-N 0.000 description 1
- PBBNEARCAGHGCQ-UHFFFAOYSA-N methyl 2-(hydroxymethyl)pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(CO)=C1 PBBNEARCAGHGCQ-UHFFFAOYSA-N 0.000 description 1
- WIGJIJYNPCKRAK-UHFFFAOYSA-N methyl 2-[1-[(3-phenylphenyl)methyl]imidazol-4-yl]pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(C=2N=CN(CC=3C=C(C=CC=3)C=3C=CC=CC=3)C=2)=C1 WIGJIJYNPCKRAK-UHFFFAOYSA-N 0.000 description 1
- CAFWWZWJFFJXTF-UHFFFAOYSA-N methyl 4-nitrosobenzoate Chemical compound COC(=O)C1=CC=C(N=O)C=C1 CAFWWZWJFFJXTF-UHFFFAOYSA-N 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical class COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000011278 mitosis Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000005322 morpholin-1-yl group Chemical group 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical compound C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- NOUUUQMKVOUUNR-UHFFFAOYSA-N n,n'-diphenylethane-1,2-diamine Chemical compound C=1C=CC=CC=1NCCNC1=CC=CC=C1 NOUUUQMKVOUUNR-UHFFFAOYSA-N 0.000 description 1
- ARVDJBARMJFVNT-UHFFFAOYSA-N n-[(3,4-dichlorophenyl)methyl]cyclopropanamine Chemical compound C1=C(Cl)C(Cl)=CC=C1CNC1CC1 ARVDJBARMJFVNT-UHFFFAOYSA-N 0.000 description 1
- RVXJABFVIDLTSI-UHFFFAOYSA-N n-[(4-chlorophenyl)methyl]cyclopropanamine Chemical compound C1=CC(Cl)=CC=C1CNC1CC1 RVXJABFVIDLTSI-UHFFFAOYSA-N 0.000 description 1
- YKNFXOCMGURJMK-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]cyclopropanamine Chemical compound C1=CC(F)=CC=C1CNC1CC1 YKNFXOCMGURJMK-UHFFFAOYSA-N 0.000 description 1
- CURFQQZYGVCIGJ-UHFFFAOYSA-N n-[(4-fluorophenyl)methyl]ethanamine Chemical compound CCNCC1=CC=C(F)C=C1 CURFQQZYGVCIGJ-UHFFFAOYSA-N 0.000 description 1
- BIAGWQYHUNVQCD-UHFFFAOYSA-N n-cyanopyridine-4-carboxamide Chemical compound N#CNC(=O)C1=CC=NC=C1 BIAGWQYHUNVQCD-UHFFFAOYSA-N 0.000 description 1
- WCTNVGNEUDTSOZ-UHFFFAOYSA-N n-methyl-1-(3-methylphenyl)methanamine Chemical compound CNCC1=CC=CC(C)=C1 WCTNVGNEUDTSOZ-UHFFFAOYSA-N 0.000 description 1
- YDFFIGRIWDSNOZ-UHFFFAOYSA-N n-methyl-1-(4-methylphenyl)methanamine Chemical compound CNCC1=CC=C(C)C=C1 YDFFIGRIWDSNOZ-UHFFFAOYSA-N 0.000 description 1
- YMSMEZAYZIYFGA-UHFFFAOYSA-N n-methyl-1-[4-(trifluoromethyl)phenyl]methanamine Chemical compound CNCC1=CC=C(C(F)(F)F)C=C1 YMSMEZAYZIYFGA-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 230000017095 negative regulation of cell growth Effects 0.000 description 1
- 230000035407 negative regulation of cell proliferation Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 108020004017 nuclear receptors Proteins 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Chemical group C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- 125000005060 octahydroindolyl group Chemical group N1(CCC2CCCCC12)* 0.000 description 1
- 125000005061 octahydroisoindolyl group Chemical group C1(NCC2CCCCC12)* 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical class CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 230000006548 oncogenic transformation Effects 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 229940096978 oral tablet Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000003901 oxalic acid esters Chemical class 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 238000005895 oxidative decarboxylation reaction Methods 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- CAMRHYBKQTWSCM-UHFFFAOYSA-N oxocyanamide Chemical compound O=NC#N CAMRHYBKQTWSCM-UHFFFAOYSA-N 0.000 description 1
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 description 1
- 201000008129 pancreatic ductal adenocarcinoma Diseases 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 150000004841 phenylimidazoles Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229960005141 piperazine Drugs 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 230000029279 positive regulation of transcription, DNA-dependent Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 235000004252 protein component Nutrition 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 150000003212 purines Chemical class 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 108700022487 rRNA Genes Proteins 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000022532 regulation of transcription, DNA-dependent Effects 0.000 description 1
- 230000000754 repressing effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 108020004418 ribosomal RNA Proteins 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical class OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 230000001568 sexual effect Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 210000000130 stem cell Anatomy 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003899 tartaric acid esters Chemical class 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- QJTKPXFJOXKUEY-UHFFFAOYSA-N tert-butyl 3-bromopyrrolidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(Br)C1 QJTKPXFJOXKUEY-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 229960004559 theobromine Drugs 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000005985 thienyl[1,3]dithianyl group Chemical group 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- WCEWCRAPSCLFOV-UHFFFAOYSA-N tributyl-(1-methylimidazol-4-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CN(C)C=N1 WCEWCRAPSCLFOV-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 125000005455 trithianyl group Chemical group 0.000 description 1
- 208000010570 urinary bladder carcinoma Diseases 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/4439—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. omeprazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/444—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a six-membered ring with nitrogen as a ring heteroatom, e.g. amrinone
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/445—Non condensed piperidines, e.g. piperocaine
- A61K31/4523—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems
- A61K31/4545—Non condensed piperidines, e.g. piperocaine containing further heterocyclic ring systems containing a six-membered ring with nitrogen as a ring hetero atom, e.g. pipamperone, anabasine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/4709—Non-condensed quinolines and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/535—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one oxygen as the ring hetero atoms, e.g. 1,2-oxazines
- A61K31/5375—1,4-Oxazines, e.g. morpholine
- A61K31/5377—1,4-Oxazines, e.g. morpholine not condensed and containing further heterocyclic rings, e.g. timolol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Enzymes And Modification Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201361783563P | 2013-03-14 | 2013-03-14 | |
| US61/783,563 | 2013-03-14 | ||
| PCT/US2014/026710 WO2014151945A1 (en) | 2013-03-14 | 2014-03-13 | Histone demethylase inhibitors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2903081A1 true CA2903081A1 (en) | 2014-09-25 |
Family
ID=51529949
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2903081A Abandoned CA2903081A1 (en) | 2013-03-14 | 2014-03-13 | Histone demethylase inhibitors |
Country Status (7)
| Country | Link |
|---|---|
| US (5) | US9133166B2 (OSRAM) |
| EP (1) | EP2969007B1 (OSRAM) |
| JP (1) | JP6276378B2 (OSRAM) |
| AU (1) | AU2014236711A1 (OSRAM) |
| CA (1) | CA2903081A1 (OSRAM) |
| ES (1) | ES2731773T3 (OSRAM) |
| WO (1) | WO2014151945A1 (OSRAM) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9133166B2 (en) * | 2013-03-14 | 2015-09-15 | Quanticel Pharmaceuticals, Inc. | Histone demethylase inhibitors |
| ES2905280T3 (es) | 2014-07-03 | 2022-04-07 | Celgene Quanticel Res Inc | Inhibidores de la desmetilasa 1 específica de lisina |
| US9896436B2 (en) | 2014-09-16 | 2018-02-20 | Celgene Quanticel Research, Inc. | Histone demethylase inhibitors |
| EA201790502A1 (ru) * | 2014-09-16 | 2017-10-31 | Селджен Квонтисел Рисёрч, Инк. | Ингибиторы гистоновых диметилаз |
| JP2016089002A (ja) * | 2014-10-31 | 2016-05-23 | 出光興産株式会社 | ベンゾフラノチオフェン骨格を有するモノマー及びポリマー、及びそのポリマーを用いた有機薄膜太陽電池材料 |
| EP3242875B1 (en) * | 2015-01-09 | 2022-02-23 | Genentech, Inc. | 4,5-dihydroimidazole derivatives and their use as histone demethylase (kdm2b) inhibitors |
| EP3313420B1 (en) | 2015-06-25 | 2024-03-13 | The Children's Medical Center Corporation | Methods and compositions relating to hematopoietic stem cell expansion, enrichment, and maintenance |
| US20190055212A1 (en) * | 2016-02-16 | 2019-02-21 | Stephen Gwaltney | Histone demethylase inhibitors |
| WO2017161001A1 (en) | 2016-03-15 | 2017-09-21 | Children's Medical Center Corporation | Methods and compositions relating to hematopoietic stem cell expansion |
| JP6970680B2 (ja) * | 2016-03-15 | 2021-11-24 | セルジーン クオンティセル リサーチ,インク. | ヒストンデメチラーゼ阻害剤 |
| US10150754B2 (en) | 2016-04-19 | 2018-12-11 | Celgene Quanticel Research, Inc. | Histone demethylase inhibitors |
| EP3246330A1 (en) | 2016-05-18 | 2017-11-22 | Istituto Europeo di Oncologia S.r.l. | Imidazoles as histone demethylase inhibitors |
| BR102017010009A2 (pt) | 2016-05-27 | 2017-12-12 | Gilead Sciences, Inc. | Compounds for the treatment of hepatitis b virus infection |
| WO2017205078A1 (en) | 2016-05-27 | 2017-11-30 | Gilead Sciences, Inc. | Methods for treating hepatitis b virus infections using ns5a, ns5b or ns3 inhibitors |
| JOP20190024A1 (ar) | 2016-08-26 | 2019-02-19 | Gilead Sciences Inc | مركبات بيروليزين بها استبدال واستخداماتها |
| ES2906581T3 (es) | 2016-09-02 | 2022-04-19 | Gilead Sciences Inc | Compuestos moduladores de los receptores tipo Toll |
| US10640499B2 (en) | 2016-09-02 | 2020-05-05 | Gilead Sciences, Inc. | Toll like receptor modulator compounds |
| BR112019007450A2 (pt) | 2016-10-14 | 2020-07-07 | Precision Biosciences, Inc. | meganucleases modificadas específicas para sequências de reconhecimento no genoma do vírus da hepatite b |
| CN106543092B (zh) * | 2016-10-14 | 2019-05-17 | 华东师范大学 | 1,5-二芳香基-1,2,4-三氮唑类化合物及其制药用途 |
| TWI714820B (zh) | 2017-01-31 | 2021-01-01 | 美商基利科學股份有限公司 | 替諾福韋艾拉酚胺(tenofovir alafenamide)之晶型 |
| JOP20180008A1 (ar) | 2017-02-02 | 2019-01-30 | Gilead Sciences Inc | مركبات لعلاج إصابة بعدوى فيروس الالتهاب الكبدي b |
| JOP20180040A1 (ar) | 2017-04-20 | 2019-01-30 | Gilead Sciences Inc | مثبطات pd-1/pd-l1 |
| EP3728282B1 (en) | 2017-12-20 | 2023-11-22 | Institute of Organic Chemistry and Biochemistry ASCR, V.V.I. | 2'3' cyclic dinucleotides with phosphonate bond activating the sting adaptor protein |
| CN111566120B (zh) | 2017-12-20 | 2023-09-29 | 捷克共和国有机化学与生物化学研究所 | 活化sting转接蛋白的具有膦酸酯键的3’3’环状二核苷酸 |
| CN111712494A (zh) | 2018-02-13 | 2020-09-25 | 吉利德科学公司 | Pd-1/pd-l1抑制剂 |
| CA3091142C (en) | 2018-02-26 | 2023-04-11 | Gilead Sciences, Inc. | Substituted pyrrolizine compounds and uses thereof |
| WO2019195181A1 (en) | 2018-04-05 | 2019-10-10 | Gilead Sciences, Inc. | Antibodies and fragments thereof that bind hepatitis b virus protein x |
| TWI818007B (zh) | 2018-04-06 | 2023-10-11 | 捷克科學院有機化學與生物化學研究所 | 2'3'-環二核苷酸 |
| TW202005654A (zh) | 2018-04-06 | 2020-02-01 | 捷克科學院有機化學與生物化學研究所 | 2,2,─環二核苷酸 |
| TWI833744B (zh) | 2018-04-06 | 2024-03-01 | 捷克科學院有機化學與生物化學研究所 | 3'3'-環二核苷酸 |
| US11142750B2 (en) | 2018-04-12 | 2021-10-12 | Precision Biosciences, Inc. | Optimized engineered meganucleases having specificity for a recognition sequence in the Hepatitis B virus genome |
| EP4600247A3 (en) | 2018-04-19 | 2025-11-19 | Gilead Sciences, Inc. | Pd-1/pd-l1 inhibitors |
| WO2019211799A1 (en) | 2018-05-03 | 2019-11-07 | Institute Of Organic Chemistry And Biochemistry Ascr, V.V.I. | 2'3'-cyclic dinucleotide analogue comprising a cyclopentanyl modified nucleotide |
| WO2019236766A1 (en) | 2018-06-06 | 2019-12-12 | Ideaya Biosciences, Inc. | Methods of culturing and/or expanding stem cells and/or lineage committed progenitor cells using lactam compounds |
| KR20230159715A (ko) | 2018-07-13 | 2023-11-21 | 길리애드 사이언시즈, 인코포레이티드 | Pd-1/pd-l1 억제제 |
| WO2020028097A1 (en) | 2018-08-01 | 2020-02-06 | Gilead Sciences, Inc. | Solid forms of (r)-11-(methoxymethyl)-12-(3-methoxypropoxy)-3,3-dimethyl-8-0x0-2,3,8,13b-tetrahydro-1h-pyrido[2,1-a]pyrrolo[1,2-c] phthalazine-7-c arboxylic acid |
| AU2019366355B2 (en) | 2018-10-24 | 2022-10-13 | Gilead Sciences, Inc. | PD-1/PD-L1 inhibitors |
| CN113227089B (zh) | 2018-10-31 | 2024-07-05 | 吉利德科学公司 | 作为hpk1抑制剂的取代的6-氮杂苯并咪唑化合物 |
| CN117105933A (zh) | 2018-10-31 | 2023-11-24 | 吉利德科学公司 | 具有hpk1抑制活性的取代的6-氮杂苯并咪唑化合物 |
| EP3934757B1 (en) | 2019-03-07 | 2023-02-22 | Institute of Organic Chemistry and Biochemistry ASCR, V.V.I. | 2'3'-cyclic dinucleotides and prodrugs thereof |
| US20220143061A1 (en) | 2019-03-07 | 2022-05-12 | Institute Of Organic Chemistry And Biochemistry Ascr, V.V.I. | 3'3'-cyclic dinucleotides and prodrugs thereof |
| EP3935065A1 (en) | 2019-03-07 | 2022-01-12 | Institute of Organic Chemistry and Biochemistry ASCR, V.V.I. | 3'3'-cyclic dinucleotide analogue comprising a cyclopentanyl modified nucleotide as sting modulator |
| TWI751517B (zh) | 2019-04-17 | 2022-01-01 | 美商基利科學股份有限公司 | 類鐸受體調節劑之固體形式 |
| TWI751516B (zh) | 2019-04-17 | 2022-01-01 | 美商基利科學股份有限公司 | 類鐸受體調節劑之固體形式 |
| EP3972695A1 (en) | 2019-05-23 | 2022-03-30 | Gilead Sciences, Inc. | Substituted exo-methylene-oxindoles which are hpk1/map4k1 inhibitors |
| JP7237311B2 (ja) * | 2019-06-06 | 2023-03-13 | 京都府公立大学法人 | 化合物、医薬組成物、kdm5c阻害剤及び抗うつ剤 |
| JP7295283B2 (ja) | 2019-06-25 | 2023-06-20 | ギリアード サイエンシーズ, インコーポレイテッド | Flt3l-fc融合タンパク質及び使用方法 |
| WO2021011891A1 (en) | 2019-07-18 | 2021-01-21 | Gilead Sciences, Inc. | Long-acting formulations of tenofovir alafenamide |
| EP4017476A1 (en) | 2019-08-19 | 2022-06-29 | Gilead Sciences, Inc. | Pharmaceutical formulations of tenofovir alafenamide |
| HRP20241379T1 (hr) | 2019-09-30 | 2024-12-20 | Gilead Sciences, Inc. | Cjepiva za hbv i postupci za liječenje hbv |
| ES3022990T3 (en) | 2019-12-06 | 2025-05-29 | Prec Biosciences Inc | Optimized engineered meganucleases having specificity for a recognition sequence in the hepatitis b virus genome |
| TWI845826B (zh) | 2020-03-20 | 2024-06-21 | 美商基利科學股份有限公司 | 4'-c-經取代-2-鹵基-2'-去氧腺苷核苷之前藥及其製造與使用方法 |
| MX2023001507A (es) | 2020-08-07 | 2023-03-06 | Gilead Sciences Inc | Profarmacos de analogos de nucleotidos de fosfonamida y su uso farmaceutico. |
| TWI815194B (zh) | 2020-10-22 | 2023-09-11 | 美商基利科學股份有限公司 | 介白素2-Fc融合蛋白及使用方法 |
| TW202348237A (zh) | 2021-05-13 | 2023-12-16 | 美商基利科學股份有限公司 | TLR8調節化合物及抗HBV siRNA療法之組合 |
| CN117480155A (zh) | 2021-06-23 | 2024-01-30 | 吉利德科学公司 | 二酰基甘油激酶调节化合物 |
| CN117377671A (zh) | 2021-06-23 | 2024-01-09 | 吉利德科学公司 | 二酰基甘油激酶调节化合物 |
| JP7686091B2 (ja) | 2021-06-23 | 2025-05-30 | ギリアード サイエンシーズ, インコーポレイテッド | ジアシルグリセロールキナーゼ調節化合物 |
| EP4359415A1 (en) | 2021-06-23 | 2024-05-01 | Gilead Sciences, Inc. | Diacylglyercol kinase modulating compounds |
| CA3267079A1 (en) | 2022-09-09 | 2024-03-14 | Innovo Therapeutics, Inc. | CK1α AND DOUBLE CK1α/GSPT1 DEGRADATION COMPOUNDS |
| WO2025240242A1 (en) | 2024-05-13 | 2025-11-20 | Gilead Sciences, Inc. | Combination therapies with ribavirin |
| WO2025240246A1 (en) | 2024-05-13 | 2025-11-20 | Gilead Sciences, Inc. | Combination therapies with ribavirin |
| US20250345390A1 (en) | 2024-05-13 | 2025-11-13 | Gilead Sciences, Inc. | Combination therapies |
| US20250345389A1 (en) | 2024-05-13 | 2025-11-13 | Gilead Sciences, Inc. | Combination therapies |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000038683A1 (en) | 1998-12-23 | 2000-07-06 | Du Pont Pharmaceuticals Company | THROMBIN OR FACTOR Xa INHIBITORS |
| NZ525474A (en) | 2000-10-26 | 2005-10-28 | Tularik Inc | Antiinflammation agents |
| US20040127733A1 (en) | 2002-10-31 | 2004-07-01 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | New beta-agonists, processes for preparing them and their use as pharmaceutical compositions |
| DE102004021779A1 (de) | 2004-04-30 | 2005-11-24 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Neue Beta-Agonisten, Verfahren zu deren Herstellung und deren Verwendung als Arzneimittel |
| US20090221589A1 (en) | 2005-12-19 | 2009-09-03 | Thomas Trieselmann | Use of aminoalcohol derivatives for the treatment of overactive bladder |
| TWI386405B (zh) * | 2006-09-05 | 2013-02-21 | 咪唑衍生物 | |
| CA2684950A1 (en) * | 2007-04-20 | 2008-10-30 | Deciphera Pharmaceuticals, Llc | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
| GB0818907D0 (en) * | 2008-10-15 | 2008-11-19 | Isis Innovation | Histone lysine demethylase inhibitors |
| EP2451790A4 (en) * | 2009-07-07 | 2012-12-26 | Anthem Biosciences Private Ltd | INHIBITORS OF HISTONE DEACETYLASE |
| MX2012005429A (es) | 2009-11-10 | 2012-06-19 | Pfizer | Inhibidores de n1-pirazoloespirocetona acetil-coa carboxilasa. |
| JP5725475B2 (ja) * | 2010-01-21 | 2015-05-27 | 公立大学法人名古屋市立大学 | ヒドロキサム酸誘導体及びそれを用いたhdac8阻害剤 |
| GB201112607D0 (en) * | 2011-07-22 | 2011-09-07 | Glaxo Group Ltd | Novel compounds |
| CN102775368B (zh) * | 2011-05-10 | 2016-08-17 | 上海驺虞医药科技有限公司 | 一类噻唑类化合物及其制备方法和用途 |
| US9133166B2 (en) * | 2013-03-14 | 2015-09-15 | Quanticel Pharmaceuticals, Inc. | Histone demethylase inhibitors |
| EA201790502A1 (ru) | 2014-09-16 | 2017-10-31 | Селджен Квонтисел Рисёрч, Инк. | Ингибиторы гистоновых диметилаз |
-
2014
- 2014-03-13 US US14/210,006 patent/US9133166B2/en active Active
- 2014-03-13 ES ES14767499T patent/ES2731773T3/es active Active
- 2014-03-13 WO PCT/US2014/026710 patent/WO2014151945A1/en not_active Ceased
- 2014-03-13 JP JP2016502219A patent/JP6276378B2/ja not_active Expired - Fee Related
- 2014-03-13 US US14/774,338 patent/US9527829B2/en active Active
- 2014-03-13 CA CA2903081A patent/CA2903081A1/en not_active Abandoned
- 2014-03-13 AU AU2014236711A patent/AU2014236711A1/en not_active Abandoned
- 2014-03-13 EP EP14767499.8A patent/EP2969007B1/en active Active
-
2015
- 2015-09-11 US US14/852,079 patent/US9701657B2/en active Active
-
2016
- 2016-11-17 US US15/354,044 patent/US9963441B2/en active Active
-
2017
- 2017-06-07 US US15/616,319 patent/US10273222B2/en active Active
Also Published As
| Publication number | Publication date |
|---|---|
| EP2969007A1 (en) | 2016-01-20 |
| US20170066739A1 (en) | 2017-03-09 |
| US9963441B2 (en) | 2018-05-08 |
| US20160113914A1 (en) | 2016-04-28 |
| US20160122314A1 (en) | 2016-05-05 |
| US9527829B2 (en) | 2016-12-27 |
| US9701657B2 (en) | 2017-07-11 |
| WO2014151945A1 (en) | 2014-09-25 |
| US20140275084A1 (en) | 2014-09-18 |
| US20170334879A1 (en) | 2017-11-23 |
| EP2969007A4 (en) | 2016-07-27 |
| AU2014236711A1 (en) | 2015-09-17 |
| JP6276378B2 (ja) | 2018-02-07 |
| ES2731773T3 (es) | 2019-11-19 |
| EP2969007B1 (en) | 2019-05-08 |
| US9133166B2 (en) | 2015-09-15 |
| US10273222B2 (en) | 2019-04-30 |
| JP2016514159A (ja) | 2016-05-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2903081A1 (en) | Histone demethylase inhibitors | |
| JP6768857B2 (ja) | リジン特異的なデメチラーゼ−1の阻害剤 | |
| AU2015253040B2 (en) | Inhibitors of lysine specific demethylase-1 | |
| CA2894399A1 (en) | Histone demethylase inhibitors | |
| EP3193881B1 (en) | Histone demethylase inhibitors | |
| AU2015284197A1 (en) | Inhibitors of lysine specific demethylase-1 | |
| EP3436445B1 (en) | Histone demethylase inhibitors | |
| HK1231860A1 (en) | Inhibitors of lysine specific demethylase-1 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Dead |
Effective date: 20200313 |